`;\n\n currentDocument.body.appendChild(parent);\n\n const isDifferent = parent.children[0].getBoundingClientRect().top !== top;\n\n currentDocument.body.removeChild(parent);\n\n return isDifferent;\n});\n\nconst canUseDOM = () => Boolean(\n // from fbjs\n typeof window !== 'undefined' &&\n window.document &&\n window.document.createElement\n);\n\nconst utils = {\n eitherRect,\n scaleRect,\n removeStackingOffset,\n hasRelativeStackingContext,\n canUseDOM\n};\n\nexport default utils;","import wnd from './window';\nimport getDocument from './document';\nimport scrollbarWidth from './scrollbar-width';\n\nexport default function windowViewport(element) {\n const win = wnd(element);\n const document = getDocument(element);\n const result = {\n height: win.innerHeight,\n width: win.innerWidth\n };\n\n if (document.scrollHeight - document.clientHeight > 0) {\n result.width -= scrollbarWidth();\n }\n\n return result;\n}\n","import ownerDocument from './owner-document';\n\nconst getWindow = (element) => ownerDocument(element).defaultView;\n\nexport default getWindow;\n","import parents from './parents';\nimport siblingContainer from './sibling-container';\n\nexport default function zIndex(anchor, container) {\n if (!anchor || !container) { return null; }\n\n const sibling = siblingContainer(anchor, container);\n\n if (!sibling) { return null; }\n\n const result = [ anchor ].concat(parents(anchor, sibling)).reduce(\n (index, p) => {\n const zIndexStyle = p.style.zIndex || window.getComputedStyle(p).zIndex;\n const current = parseInt(zIndexStyle, 10);\n return current > index ? current : index;\n },\n 0\n );\n\n return result ? (result + 1) : null;\n}","const caretTrIcon = {\n name: 'caret-tr',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretBrIcon = {\n name: 'caret-br',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretBlIcon = {\n name: 'caret-bl',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretTlIcon = {\n name: 'caret-tl',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltUpIcon = {\n name: 'caret-alt-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltRightIcon = {\n name: 'caret-alt-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltDownIcon = {\n name: 'caret-alt-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltLeftIcon = {\n name: 'caret-alt-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltToTopIcon = {\n name: 'caret-alt-to-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltToRightIcon = {\n name: 'caret-alt-to-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltToBottomIcon = {\n name: 'caret-alt-to-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltToLeftIcon = {\n name: 'caret-alt-to-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretDoubleAltUpIcon = {\n name: 'caret-double-alt-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretDoubleAltRightIcon = {\n name: 'caret-double-alt-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretDoubleAltDownIcon = {\n name: 'caret-double-alt-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretDoubleAltLeftIcon = {\n name: 'caret-double-alt-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst caretAltExpandIcon = {\n name: 'caret-alt-expand',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowsNoChangeIcon = {\n name: 'arrows-no-change',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowOverflowDownIcon = {\n name: 'arrow-overflow-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronUpIcon = {\n name: 'chevron-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronRightIcon = {\n name: 'chevron-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronDownIcon = {\n name: 'chevron-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronLeftIcon = {\n name: 'chevron-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowUpIcon = {\n name: 'arrow-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowRightIcon = {\n name: 'arrow-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowDownIcon = {\n name: 'arrow-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowLeftIcon = {\n name: 'arrow-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst levelDownIcon = {\n name: 'level-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst levelUpIcon = {\n name: 'level-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst levelToTopIcon = {\n name: 'level-to-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst colResizeIcon = {\n name: 'col-resize',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowsAxesIcon = {\n name: 'arrows-axes',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowsSwapIcon = {\n name: 'arrows-swap',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dragAndDropIcon = {\n name: 'drag-and-drop',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst categorizeIcon = {\n name: 'categorize',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gridIcon = {\n name: 'grid',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gridLayoutIcon = {\n name: 'grid-layout',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst groupIcon = {\n name: 'group',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst ungroupIcon = {\n name: 'ungroup',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst handleDragIcon = {\n name: 'handle-drag',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst layoutIcon = {\n name: 'layout',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst layout1By4Icon = {\n name: 'layout-1-by-4',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst layout2By2Icon = {\n name: 'layout-2-by-2',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst layoutSideBySideIcon = {\n name: 'layout-side-by-side',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst layoutStackedIcon = {\n name: 'layout-stacked',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst columnsIcon = {\n name: 'columns',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rowsIcon = {\n name: 'rows',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst reorderIcon = {\n name: 'reorder',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst menuIcon = {\n name: 'menu',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst moreVerticalIcon = {\n name: 'more-vertical',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst moreHorizontalIcon = {\n name: 'more-horizontal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst overlapIcon = {\n name: 'overlap',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst homeIcon = {\n name: 'home',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowsLeftRightIcon = {\n name: 'arrows-left-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowsTopBottomIcon = {\n name: 'arrows-top-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderRadiusBottomLeftIcon = {\n name: 'border-radius-bottom-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderRadiusBottomRightIcon = {\n name: 'border-radius-bottom-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderRadiusTopLeftIcon = {\n name: 'border-radius-top-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderRadiusTopRightIcon = {\n name: 'border-radius-top-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderRadiusIcon = {\n name: 'border-radius',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderStyleBottomIcon = {\n name: 'border-style-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderStyleLeftIcon = {\n name: 'border-style-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderStyleRightIcon = {\n name: 'border-style-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderStyleTopIcon = {\n name: 'border-style-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderStyleIcon = {\n name: 'border-style',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst boxSizingIcon = {\n name: 'box-sizing',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronDoubleDownIcon = {\n name: 'chevron-double-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronDoubleLeftIcon = {\n name: 'chevron-double-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronDoubleRightIcon = {\n name: 'chevron-double-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chevronDoubleUpIcon = {\n name: 'chevron-double-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataOdsIcon = {\n name: 'data-ods',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst nonRecurrenceIcon = {\n name: 'non-recurrence',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst displayBlockIcon = {\n name: 'display-block',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst displayFlexIcon = {\n name: 'display-flex',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst displayInlineFlexIcon = {\n name: 'display-inline-flex',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dropletSliderIcon = {\n name: 'droplet-slider',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileReportIcon = {\n name: 'file-report',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gapColumnIcon = {\n name: 'gap-column',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gapRowIcon = {\n name: 'gap-row',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst handleResizeAltIcon = {\n name: 'handle-resize-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst handleResizeIcon = {\n name: 'handle-resize',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imagesIcon = {\n name: 'images',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst letterSpaceIcon = {\n name: 'letter-space',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst lineHeightIcon = {\n name: 'line-height',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listLatinBigIcon = {\n name: 'list-latin-big',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listLatinSmallIcon = {\n name: 'list-latin-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listRomanBigIcon = {\n name: 'list-roman-big',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listRomanSmallIcon = {\n name: 'list-roman-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listUnorderedOutlineIcon = {\n name: 'list-unordered-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listUnorderedSquareIcon = {\n name: 'list-unordered-square',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst maxHeightIcon = {\n name: 'max-height',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst maxWidthIcon = {\n name: 'max-width',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst minHeightIcon = {\n name: 'min-height',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst minWidthIcon = {\n name: 'min-width',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst outlineOffsetIcon = {\n name: 'outline-offset',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst outlineWidthIcon = {\n name: 'outline-width',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paddingBottomIcon = {\n name: 'padding-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paddingLeftIcon = {\n name: 'padding-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paddingRightIcon = {\n name: 'padding-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paddingTopIcon = {\n name: 'padding-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paddingIcon = {\n name: 'padding',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst positionBottomIcon = {\n name: 'position-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst positionLeftIcon = {\n name: 'position-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst positionRightIcon = {\n name: 'position-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst positionTopIcon = {\n name: 'position-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst regularExpressionIcon = {\n name: 'regular-expression',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst replaceAllIcon = {\n name: 'replace-all',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst replaceSingleIcon = {\n name: 'replace-single',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst reportElementIcon = {\n name: 'report-element',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rightDoubleQuotesIcon = {\n name: 'right-double-quotes',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst wholeWordIcon = {\n name: 'whole-word',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataSdsIcon = {\n name: 'data-sds',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst downloadLightIcon = {\n name: 'download-light',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst eyeSlashIcon = {\n name: 'eye-slash',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst displayInlineBlockIcon = {\n name: 'display-inline-block',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paperPlaneIcon = {\n name: 'paper-plane',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gaugeLinearIcon = {\n name: 'gauge-linear',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gaugeRadialIcon = {\n name: 'gauge-radial',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst envelopeBoxIcon = {\n name: 'envelope-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst envelopeLinkIcon = {\n name: 'envelope-link',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst envelopeIcon = {\n name: 'envelope',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst undoIcon = {\n name: 'undo',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst redoIcon = {\n name: 'redo',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowRotateCcwIcon = {\n name: 'arrow-rotate-ccw',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowRotateCwIcon = {\n name: 'arrow-rotate-cw',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowsNoRepeatIcon = {\n name: 'arrows-no-repeat',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowRotateCcwSmallIcon = {\n name: 'arrow-rotate-ccw-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowRotateCwSmallIcon = {\n name: 'arrow-rotate-cw-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clockIcon = {\n name: 'clock',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst calendarIcon = {\n name: 'calendar',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst saveIcon = {\n name: 'save',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst printIcon = {\n name: 'print',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pencilIcon = {\n name: 'pencil',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst trashIcon = {\n name: 'trash',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paperclipIcon = {\n name: 'paperclip',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paperclipAltIcon = {\n name: 'paperclip-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst linkIcon = {\n name: 'link',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst unlinkIcon = {\n name: 'unlink',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst linkVerticalIcon = {\n name: 'link-vertical',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst unlinkVerticalIcon = {\n name: 'unlink-vertical',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst lockIcon = {\n name: 'lock',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst unlockIcon = {\n name: 'unlock',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cancelIcon = {\n name: 'cancel',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cancelOutlineIcon = {\n name: 'cancel-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cancelCircleIcon = {\n name: 'cancel-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst checkIcon = {\n name: 'check',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst checkOutlineIcon = {\n name: 'check-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst checkCircleIcon = {\n name: 'check-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst xIcon = {\n name: 'x',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst xOutlineIcon = {\n name: 'x-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst xCircleIcon = {\n name: 'x-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst plusIcon = {\n name: 'plus',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst plusOutlineIcon = {\n name: 'plus-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst plusCircleIcon = {\n name: 'plus-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst minusIcon = {\n name: 'minus',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst minusOutlineIcon = {\n name: 'minus-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst minusCircleIcon = {\n name: 'minus-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sortAscIcon = {\n name: 'sort-asc',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sortDescIcon = {\n name: 'sort-desc',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sortClearIcon = {\n name: 'sort-clear',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sortAscSmallIcon = {\n name: 'sort-asc-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sortDescSmallIcon = {\n name: 'sort-desc-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filterIcon = {\n name: 'filter',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filterClearIcon = {\n name: 'filter-clear',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filterSmallIcon = {\n name: 'filter-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filterSortAscSmallIcon = {\n name: 'filter-sort-asc-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filterSortDescSmallIcon = {\n name: 'filter-sort-desc-small',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filterAddExpressionIcon = {\n name: 'filter-add-expression',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filterAddGroupIcon = {\n name: 'filter-add-group',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst loginIcon = {\n name: 'login',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst logoutIcon = {\n name: 'logout',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst downloadIcon = {\n name: 'download',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst uploadIcon = {\n name: 'upload',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst hyperlinkOpenIcon = {\n name: 'hyperlink-open',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst hyperlinkOpenSmIcon = {\n name: 'hyperlink-open-sm',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst launchIcon = {\n name: 'launch',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst windowIcon = {\n name: 'window',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst windowRestoreIcon = {\n name: 'window-restore',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst windowMinimizeIcon = {\n name: 'window-minimize',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gearIcon = {\n name: 'gear',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst gearsIcon = {\n name: 'gears',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst wrenchIcon = {\n name: 'wrench',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst eyeIcon = {\n name: 'eye',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst searchIcon = {\n name: 'search',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst zoomInIcon = {\n name: 'zoom-in',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst zoomOutIcon = {\n name: 'zoom-out',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst arrowsMoveIcon = {\n name: 'arrows-move',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst calculatorIcon = {\n name: 'calculator',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cartIcon = {\n name: 'cart',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst connectorIcon = {\n name: 'connector',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst plusSmIcon = {\n name: 'plus-sm',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst minusSmIcon = {\n name: 'minus-sm',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst kpiStatusDenyIcon = {\n name: 'kpi-status-deny',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst kpiStatusHoldIcon = {\n name: 'kpi-status-hold',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst kpiStatusOpenIcon = {\n name: 'kpi-status-open',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst equalIcon = {\n name: 'equal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst notEqualIcon = {\n name: 'not-equal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst lessOrEqualIcon = {\n name: 'less-or-equal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst greaterOrEqualIcon = {\n name: 'greater-or-equal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst divideIcon = {\n name: 'divide',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst accessibilityIcon = {\n name: 'accessibility',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst barcodeOutlineIcon = {\n name: 'barcode-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst barcodeIcon = {\n name: 'barcode',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst barcodeScannerIcon = {\n name: 'barcode-scanner',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst qrCodeOutlineIcon = {\n name: 'qr-code-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst qrCodeIcon = {\n name: 'qr-code',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst qrCodeScannerIcon = {\n name: 'qr-code-scanner',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst barcodeQrCodeScannerIcon = {\n name: 'barcode-qr-code-scanner',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst signatureIcon = {\n name: 'signature',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst handIcon = {\n name: 'hand',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pointerIcon = {\n name: 'pointer',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stickIcon = {\n name: 'stick',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst unstickIcon = {\n name: 'unstick',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst setColumnPositionIcon = {\n name: 'set-column-position',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clockArrowRotateIcon = {\n name: 'clock-arrow-rotate',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst playIcon = {\n name: 'play',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pauseIcon = {\n name: 'pause',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stopIcon = {\n name: 'stop',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rewindIcon = {\n name: 'rewind',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst forwardIcon = {\n name: 'forward',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst volumeDownIcon = {\n name: 'volume-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst volumeUpIcon = {\n name: 'volume-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst volumeMuteIcon = {\n name: 'volume-mute',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst hdIcon = {\n name: 'hd',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst closedCaptionsIcon = {\n name: 'closed-captions',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst playlistIcon = {\n name: 'playlist',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst musicNotesIcon = {\n name: 'music-notes',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst playSmIcon = {\n name: 'play-sm',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pauseSmIcon = {\n name: 'pause-sm',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stopSmIcon = {\n name: 'stop-sm',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst heartOutlineIcon = {\n name: 'heart-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst heartIcon = {\n name: 'heart',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst starOutlineIcon = {\n name: 'star-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst starIcon = {\n name: 'star',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst checkboxIcon = {\n name: 'checkbox',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst checkboxCheckedIcon = {\n name: 'checkbox-checked',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst checkboxIndeterminateIcon = {\n name: 'checkbox-indeterminate',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst checkboxNullIcon = {\n name: 'checkbox-null',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst circleIcon = {\n name: 'circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst radiobuttonIcon = {\n name: 'radiobutton',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst radiobuttonCheckedIcon = {\n name: 'radiobutton-checked',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bellIcon = {\n name: 'bell',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst infoCircleIcon = {\n name: 'info-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst questionCircleIcon = {\n name: 'question-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst exclamationCircleIcon = {\n name: 'exclamation-circle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cameraIcon = {\n name: 'camera',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imageIcon = {\n name: 'image',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imageExportIcon = {\n name: 'image-export',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst zoomActualSizeIcon = {\n name: 'zoom-actual-size',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst zoomBestFitIcon = {\n name: 'zoom-best-fit',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imageResizeIcon = {\n name: 'image-resize',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cropIcon = {\n name: 'crop',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst mirrorIcon = {\n name: 'mirror',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst flipHorizontalIcon = {\n name: 'flip-horizontal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst flipVerticalIcon = {\n name: 'flip-vertical',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rotateIcon = {\n name: 'rotate',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rotateRightIcon = {\n name: 'rotate-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rotateLeftIcon = {\n name: 'rotate-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst brushIcon = {\n name: 'brush',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paletteIcon = {\n name: 'palette',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dropletIcon = {\n name: 'droplet',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst shapeLineIcon = {\n name: 'shape-line',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst brightnessContrastIcon = {\n name: 'brightness-contrast',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst slidersIcon = {\n name: 'sliders',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst invertColorsIcon = {\n name: 'invert-colors',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst transparencyIcon = {\n name: 'transparency',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst grayscaleIcon = {\n name: 'grayscale',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst blurIcon = {\n name: 'blur',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sharpenIcon = {\n name: 'sharpen',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst shapesIcon = {\n name: 'shapes',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst roundCornersIcon = {\n name: 'round-corners',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bringToFrontIcon = {\n name: 'bring-to-front',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bringToBackIcon = {\n name: 'bring-to-back',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bringForwardIcon = {\n name: 'bring-forward',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bringBackwardIcon = {\n name: 'bring-backward',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfStartIcon = {\n name: 'align-self-start',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfCenterIcon = {\n name: 'align-self-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfEndIcon = {\n name: 'align-self-end',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfStartAltIcon = {\n name: 'align-self-start-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfCenterAltIcon = {\n name: 'align-self-center-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfEndAltIcon = {\n name: 'align-self-end-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst thumbnailsUpIcon = {\n name: 'thumbnails-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst thumbnailsRightIcon = {\n name: 'thumbnails-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst thumbnailsDownIcon = {\n name: 'thumbnails-down',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst thumbnailsLeftIcon = {\n name: 'thumbnails-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fullscreenIcon = {\n name: 'fullscreen',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fullscreenExitIcon = {\n name: 'fullscreen-exit',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dropletSlashIcon = {\n name: 'droplet-slash',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst photosIcon = {\n name: 'photos',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignToGridIcon = {\n name: 'align-to-grid',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sizeToGridIcon = {\n name: 'size-to-grid',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst makeSameSizeIcon = {\n name: 'make-same-size',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst makeSameWidthIcon = {\n name: 'make-same-width',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst makeSameHeightIcon = {\n name: 'make-same-height',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst makeHorizontalSpacingEqualIcon = {\n name: 'make-horizontal-spacing-equal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst increaseHorizontalSpacingIcon = {\n name: 'increase-horizontal-spacing',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst decreaseHorizontalSpacingIcon = {\n name: 'decrease-horizontal-spacing',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst removeHorizontalSpacingIcon = {\n name: 'remove-horizontal-spacing',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst makeVerticalSpacingEqualIcon = {\n name: 'make-vertical-spacing-equal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst increaseVerticalSpacingIcon = {\n name: 'increase-vertical-spacing',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst decreaseVerticalSpacingIcon = {\n name: 'decrease-vertical-spacing',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst removeVerticalSpacingIcon = {\n name: 'remove-vertical-spacing',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst eyedropperIcon = {\n name: 'eyedropper',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst snapGridIcon = {\n name: 'snap-grid',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst snapToGridlinesIcon = {\n name: 'snap-to-gridlines',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst snapToSnaplinesIcon = {\n name: 'snap-to-snaplines',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dimensionsIcon = {\n name: 'dimensions',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfStretchIcon = {\n name: 'align-self-stretch',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignSelfStretchAltIcon = {\n name: 'align-self-stretch-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsStartIcon = {\n name: 'align-items-start',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsCenterIcon = {\n name: 'align-items-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsEndIcon = {\n name: 'align-items-end',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsStretchIcon = {\n name: 'align-items-stretch',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsBaselineIcon = {\n name: 'align-items-baseline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsStartAltIcon = {\n name: 'align-items-start-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsCenterAltIcon = {\n name: 'align-items-center-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsEndAltIcon = {\n name: 'align-items-end-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsStretchAltIcon = {\n name: 'align-items-stretch-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignItemsBaselineAltIcon = {\n name: 'align-items-baseline-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentStartIcon = {\n name: 'justify-content-start',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentCenterIcon = {\n name: 'justify-content-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentEndIcon = {\n name: 'justify-content-end',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentBetweenIcon = {\n name: 'justify-content-between',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentAroundIcon = {\n name: 'justify-content-around',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentStartAltIcon = {\n name: 'justify-content-start-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentCenterAltIcon = {\n name: 'justify-content-center-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentEndAltIcon = {\n name: 'justify-content-end-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentBetweenAltIcon = {\n name: 'justify-content-between-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst justifyContentAroundAltIcon = {\n name: 'justify-content-around-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileWrenchIcon = {\n name: 'file-wrench',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst boldIcon = {\n name: 'bold',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst italicIcon = {\n name: 'italic',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst underlineIcon = {\n name: 'underline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fontFamilyIcon = {\n name: 'font-family',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst foregroundColorIcon = {\n name: 'foreground-color',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst convertLowercaseIcon = {\n name: 'convert-lowercase',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst convertUppercaseIcon = {\n name: 'convert-uppercase',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst strikethroughIcon = {\n name: 'strikethrough',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst subscriptIcon = {\n name: 'subscript',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst supscriptIcon = {\n name: 'supscript',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst divIcon = {\n name: 'div',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst allIcon = {\n name: 'all',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst h1Icon = {\n name: 'h1',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst h2Icon = {\n name: 'h2',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst h3Icon = {\n name: 'h3',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst h4Icon = {\n name: 'h4',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst h5Icon = {\n name: 'h5',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst h6Icon = {\n name: 'h6',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listOrderedIcon = {\n name: 'list-ordered',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listUnorderedIcon = {\n name: 'list-unordered',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst indentIcon = {\n name: 'indent',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst outdentIcon = {\n name: 'outdent',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst insertTopIcon = {\n name: 'insert-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst insertMiddleIcon = {\n name: 'insert-middle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst insertBottomIcon = {\n name: 'insert-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignTopIcon = {\n name: 'align-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignMiddleIcon = {\n name: 'align-middle',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignBottomIcon = {\n name: 'align-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignLeftIcon = {\n name: 'align-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignCenterIcon = {\n name: 'align-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignRightIcon = {\n name: 'align-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignJustifyIcon = {\n name: 'align-justify',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst alignRemoveIcon = {\n name: 'align-remove',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst textWrapIcon = {\n name: 'text-wrap',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst horizontalRuleIcon = {\n name: 'horizontal-rule',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignTopLeftIcon = {\n name: 'table-align-top-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignTopCenterIcon = {\n name: 'table-align-top-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignTopRightIcon = {\n name: 'table-align-top-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignMiddleLeftIcon = {\n name: 'table-align-middle-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignMiddleCenterIcon = {\n name: 'table-align-middle-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignMiddleRightIcon = {\n name: 'table-align-middle-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignBottomLeftIcon = {\n name: 'table-align-bottom-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignBottomCenterIcon = {\n name: 'table-align-bottom-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignBottomRightIcon = {\n name: 'table-align-bottom-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAlignRemoveIcon = {\n name: 'table-align-remove',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bordersAllIcon = {\n name: 'borders-all',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bordersOutsideIcon = {\n name: 'borders-outside',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bordersInsideIcon = {\n name: 'borders-inside',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bordersInsideHorizontalIcon = {\n name: 'borders-inside-horizontal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bordersInsideVerticalIcon = {\n name: 'borders-inside-vertical',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderTopIcon = {\n name: 'border-top',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderBottomIcon = {\n name: 'border-bottom',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderLeftIcon = {\n name: 'border-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst borderRightIcon = {\n name: 'border-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bordersNoneIcon = {\n name: 'borders-none',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bordersShowHideIcon = {\n name: 'borders-show-hide',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst formIcon = {\n name: 'form',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst formElementIcon = {\n name: 'form-element',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst codeSnippetIcon = {\n name: 'code-snippet',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst selectAllIcon = {\n name: 'select-all',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst buttonIcon = {\n name: 'button',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst selectBoxIcon = {\n name: 'select-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst calendarDateIcon = {\n name: 'calendar-date',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst groupBoxIcon = {\n name: 'group-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst textareaIcon = {\n name: 'textarea',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst textboxIcon = {\n name: 'textbox',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst textboxHiddenIcon = {\n name: 'textbox-hidden',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst passwordIcon = {\n name: 'password',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paragraphAddIcon = {\n name: 'paragraph-add',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst editToolsIcon = {\n name: 'edit-tools',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst templateManagerIcon = {\n name: 'template-manager',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst changeManuallyIcon = {\n name: 'change-manually',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst trackChangesIcon = {\n name: 'track-changes',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst trackChangesEnableIcon = {\n name: 'track-changes-enable',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst trackChangesAcceptIcon = {\n name: 'track-changes-accept',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst trackChangesAcceptAllIcon = {\n name: 'track-changes-accept-all',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst trackChangesRejectIcon = {\n name: 'track-changes-reject',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst trackChangesRejectAllIcon = {\n name: 'track-changes-reject-all',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst documentManagerIcon = {\n name: 'document-manager',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst customIconIcon = {\n name: 'custom-icon',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bookIcon = {\n name: 'book',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imageAddIcon = {\n name: 'image-add',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imageEditIcon = {\n name: 'image-edit',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imageMapEditorIcon = {\n name: 'image-map-editor',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst commentIcon = {\n name: 'comment',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst commentRemoveIcon = {\n name: 'comment-remove',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst commentsRemoveIcon = {\n name: 'comments-remove',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst silverlightIcon = {\n name: 'silverlight',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst mediaManagerIcon = {\n name: 'media-manager',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst videoExternalIcon = {\n name: 'video-external',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst flashManagerIcon = {\n name: 'flash-manager',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst binocularsIcon = {\n name: 'binoculars',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst copyIcon = {\n name: 'copy',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cutIcon = {\n name: 'cut',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clipboardIcon = {\n name: 'clipboard',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clipboardCodeIcon = {\n name: 'clipboard-code',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clipboardWordIcon = {\n name: 'clipboard-word',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clipboardWordAltIcon = {\n name: 'clipboard-word-alt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clipboardHtmlIcon = {\n name: 'clipboard-html',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clipboardMarkdownIcon = {\n name: 'clipboard-markdown',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clipboardTextIcon = {\n name: 'clipboard-text',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst applyFormatIcon = {\n name: 'apply-format',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst clearCssIcon = {\n name: 'clear-css',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst copyFormatIcon = {\n name: 'copy-format',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stripAllFormattingIcon = {\n name: 'strip-all-formatting',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stripCssFormatIcon = {\n name: 'strip-css-format',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stripFontElementsIcon = {\n name: 'strip-font-elements',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stripSpanElementsIcon = {\n name: 'strip-span-elements',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stripWordFormattingIcon = {\n name: 'strip-word-formatting',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst formatCodeBlockIcon = {\n name: 'format-code-block',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst buildingBlocksIcon = {\n name: 'building-blocks',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst puzzlePieceIcon = {\n name: 'puzzle-piece',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst linkAddIcon = {\n name: 'link-add',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst globeLinkIcon = {\n name: 'globe-link',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst globeUnlinkIcon = {\n name: 'globe-unlink',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst envelopLinkIcon = {\n name: 'envelop-link',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst anchorIcon = {\n name: 'anchor',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableAddIcon = {\n name: 'table-add',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableIcon = {\n name: 'table',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tablePropertiesIcon = {\n name: 'table-properties',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableCellIcon = {\n name: 'table-cell',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableCellPropertiesIcon = {\n name: 'table-cell-properties',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableColumnInsertLeftIcon = {\n name: 'table-column-insert-left',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableColumnInsertRightIcon = {\n name: 'table-column-insert-right',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableRowInsertAboveIcon = {\n name: 'table-row-insert-above',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableRowInsertBelowIcon = {\n name: 'table-row-insert-below',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableColumnDeleteIcon = {\n name: 'table-column-delete',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableRowDeleteIcon = {\n name: 'table-row-delete',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableCellDeleteIcon = {\n name: 'table-cell-delete',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableDeleteIcon = {\n name: 'table-delete',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cellsMergeIcon = {\n name: 'cells-merge',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cellsMergeHorizontallyIcon = {\n name: 'cells-merge-horizontally',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cellsMergeVerticallyIcon = {\n name: 'cells-merge-vertically',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cellSplitHorizontallyIcon = {\n name: 'cell-split-horizontally',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cellSplitVerticallyIcon = {\n name: 'cell-split-vertically',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableUnmergeIcon = {\n name: 'table-unmerge',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst paneFreezeIcon = {\n name: 'pane-freeze',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rowFreezeIcon = {\n name: 'row-freeze',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst columnFreezeIcon = {\n name: 'column-freeze',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst toolbarFloatIcon = {\n name: 'toolbar-float',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst spellCheckerIcon = {\n name: 'spell-checker',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst validationXhtmlIcon = {\n name: 'validation-xhtml',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst validationDataIcon = {\n name: 'validation-data',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst toggleFullScreenModeIcon = {\n name: 'toggle-full-screen-mode',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst formulaFxIcon = {\n name: 'formula-fx',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst sumIcon = {\n name: 'sum',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst symbolIcon = {\n name: 'symbol',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dollarIcon = {\n name: 'dollar',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst percentIcon = {\n name: 'percent',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst customFormatIcon = {\n name: 'custom-format',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst decimalIncreaseIcon = {\n name: 'decimal-increase',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst decimalDecreaseIcon = {\n name: 'decimal-decrease',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fontSizeIcon = {\n name: 'font-size',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst imageAbsolutePositionIcon = {\n name: 'image-absolute-position',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableWizardIcon = {\n name: 'table-wizard',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst crosstabIcon = {\n name: 'crosstab',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst crosstabWizardIcon = {\n name: 'crosstab-wizard',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableBodyIcon = {\n name: 'table-body',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableColumnGroupsIcon = {\n name: 'table-column-groups',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableCornerIcon = {\n name: 'table-corner',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tableRowGroupsIcon = {\n name: 'table-row-groups',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst globeOutlineIcon = {\n name: 'globe-outline',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst globeIcon = {\n name: 'globe',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst mapMarkerIcon = {\n name: 'map-marker',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst mapMarkerTargetIcon = {\n name: 'map-marker-target',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pinIcon = {\n name: 'pin',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst unpinIcon = {\n name: 'unpin',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst shareIcon = {\n name: 'share',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst userIcon = {\n name: 'user',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst inboxIcon = {\n name: 'inbox',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bloggerIcon = {\n name: 'blogger',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst bloggerBoxIcon = {\n name: 'blogger-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst deliciousIcon = {\n name: 'delicious',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst deliciousBoxIcon = {\n name: 'delicious-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst diggIcon = {\n name: 'digg',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst diggBoxIcon = {\n name: 'digg-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst envelopIcon = {\n name: 'envelop',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst envelopBoxIcon = {\n name: 'envelop-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst facebookIcon = {\n name: 'facebook',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst facebookBoxIcon = {\n name: 'facebook-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst googleIcon = {\n name: 'google',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst googleBoxIcon = {\n name: 'google-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst googlePlusIcon = {\n name: 'google-plus',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst googlePlusBoxIcon = {\n name: 'google-plus-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst linkedinIcon = {\n name: 'linkedin',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst linkedinBoxIcon = {\n name: 'linkedin-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst myspaceIcon = {\n name: 'myspace',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst myspaceBoxIcon = {\n name: 'myspace-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pinterestIcon = {\n name: 'pinterest',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pinterestBoxIcon = {\n name: 'pinterest-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst redditIcon = {\n name: 'reddit',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst redditBoxIcon = {\n name: 'reddit-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stumbleUponIcon = {\n name: 'stumble-upon',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst stumbleUponBoxIcon = {\n name: 'stumble-upon-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tellAFriendIcon = {\n name: 'tell-a-friend',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tellAFriendBoxIcon = {\n name: 'tell-a-friend-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tumblrIcon = {\n name: 'tumblr',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tumblrBoxIcon = {\n name: 'tumblr-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst twitterIcon = {\n name: 'twitter',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst twitterBoxIcon = {\n name: 'twitter-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst yammerIcon = {\n name: 'yammer',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst yammerBoxIcon = {\n name: 'yammer-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst behanceIcon = {\n name: 'behance',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst behanceBoxIcon = {\n name: 'behance-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dribbbleIcon = {\n name: 'dribbble',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dribbbleBoxIcon = {\n name: 'dribbble-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rssIcon = {\n name: 'rss',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst rssBoxIcon = {\n name: 'rss-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst vimeoIcon = {\n name: 'vimeo',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst vimeoBoxIcon = {\n name: 'vimeo-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst youtubeIcon = {\n name: 'youtube',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst youtubeBoxIcon = {\n name: 'youtube-box',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst folderIcon = {\n name: 'folder',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst folderOpenIcon = {\n name: 'folder-open',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst folderAddIcon = {\n name: 'folder-add',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst folderUpIcon = {\n name: 'folder-up',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst folderMoreIcon = {\n name: 'folder-more',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst aggregateFieldsIcon = {\n name: 'aggregate-fields',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileIcon = {\n name: 'file',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileAddIcon = {\n name: 'file-add',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileTxtIcon = {\n name: 'file-txt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileCsvIcon = {\n name: 'file-csv',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileExcelIcon = {\n name: 'file-excel',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileWordIcon = {\n name: 'file-word',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileMdbIcon = {\n name: 'file-mdb',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filePptIcon = {\n name: 'file-ppt',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filePdfIcon = {\n name: 'file-pdf',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filePsdIcon = {\n name: 'file-psd',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileFlashIcon = {\n name: 'file-flash',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileConfigIcon = {\n name: 'file-config',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileAscxIcon = {\n name: 'file-ascx',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileBacIcon = {\n name: 'file-bac',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileZipIcon = {\n name: 'file-zip',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filmIcon = {\n name: 'film',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst css3Icon = {\n name: 'css3',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst html5Icon = {\n name: 'html5',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst codeIcon = {\n name: 'code',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cssIcon = {\n name: 'css',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst jsIcon = {\n name: 'js',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst exeIcon = {\n name: 'exe',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst csprojIcon = {\n name: 'csproj',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst vbprojIcon = {\n name: 'vbproj',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst csIcon = {\n name: 'cs',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst vbIcon = {\n name: 'vb',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst slnIcon = {\n name: 'sln',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst cloudIcon = {\n name: 'cloud',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileHorizontalIcon = {\n name: 'file-horizontal',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst subreportIcon = {\n name: 'subreport',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataIcon = {\n name: 'data',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileHeaderIcon = {\n name: 'file-header',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileFooterIcon = {\n name: 'file-footer',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst groupHeaderSectionIcon = {\n name: 'group-header-section',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst groupFooterSectionIcon = {\n name: 'group-footer-section',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pageHeaderSectionIcon = {\n name: 'page-header-section',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst pageFooterSectionIcon = {\n name: 'page-footer-section',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst detailSectionIcon = {\n name: 'detail-section',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tocSectionIcon = {\n name: 'toc-section',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst groupSectionIcon = {\n name: 'group-section',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parametersIcon = {\n name: 'parameters',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataCsvIcon = {\n name: 'data-csv',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataJsonIcon = {\n name: 'data-json',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataSqlIcon = {\n name: 'data-sql',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataWebIcon = {\n name: 'data-web',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst groupCollectionIcon = {\n name: 'group-collection',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parameterBooleanIcon = {\n name: 'parameter-boolean',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parameterDateTimeIcon = {\n name: 'parameter-date-time',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parameterFloatIcon = {\n name: 'parameter-float',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parameterIntegerIcon = {\n name: 'parameter-integer',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parameterStringIcon = {\n name: 'parameter-string',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tocSectionLevelIcon = {\n name: 'toc-section-level',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst inheritedIcon = {\n name: 'inherited',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileVideoIcon = {\n name: 'file-video',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileAudioIcon = {\n name: 'file-audio',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileImageIcon = {\n name: 'file-image',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filePresentationIcon = {\n name: 'file-presentation',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileDataIcon = {\n name: 'file-data',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileDiscImageIcon = {\n name: 'file-disc-image',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileProgrammingIcon = {\n name: 'file-programming',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parametersByteArrayIcon = {\n name: 'parameters-byte-array',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst parametersUnknownIcon = {\n name: 'parameters-unknown',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileErrorIcon = {\n name: 'file-error',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst filesErrorIcon = {\n name: 'files-error',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst dataRestIcon = {\n name: 'data-rest',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst fileTypescriptIcon = {\n name: 'file-typescript',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tablePositionStartIcon = {\n name: 'table-position-start',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tablePositionCenterIcon = {\n name: 'table-position-center',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst tablePositionEndIcon = {\n name: 'table-position-end',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listRomanUpperIcon = {\n name: 'list-roman-upper',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst listRomanLowerIcon = {\n name: 'list-roman-lower',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst importIcon = {\n name: 'import',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst exportIcon = {\n name: 'export',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst graphIcon = {\n name: 'graph',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartColumnClusteredIcon = {\n name: 'chart-column-clustered',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartColumnStackedIcon = {\n name: 'chart-column-stacked',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartColumnStacked100Icon = {\n name: 'chart-column-stacked100',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartColumnRangeIcon = {\n name: 'chart-column-range',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartBarClusteredIcon = {\n name: 'chart-bar-clustered',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartBarStackedIcon = {\n name: 'chart-bar-stacked',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartBarStacked100Icon = {\n name: 'chart-bar-stacked100',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartBarRangeIcon = {\n name: 'chart-bar-range',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartAreaClusteredIcon = {\n name: 'chart-area-clustered',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartAreaStackedIcon = {\n name: 'chart-area-stacked',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartAreaStacked100Icon = {\n name: 'chart-area-stacked100',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartAreaRangeIcon = {\n name: 'chart-area-range',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartLineIcon = {\n name: 'chart-line',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartLineStackedIcon = {\n name: 'chart-line-stacked',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartLineStacked100Icon = {\n name: 'chart-line-stacked100',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartLineMarkersIcon = {\n name: 'chart-line-markers',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartLineStackedMarkersIcon = {\n name: 'chart-line-stacked-markers',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartLineStacked100MarkersIcon = {\n name: 'chart-line-stacked100-markers',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartPieIcon = {\n name: 'chart-pie',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartDoughnutIcon = {\n name: 'chart-doughnut',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartScatterIcon = {\n name: 'chart-scatter',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartScatterSmoothLinesMarkersIcon = {\n name: 'chart-scatter-smooth-lines-markers',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartScatterSmoothLinesIcon = {\n name: 'chart-scatter-smooth-lines',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartScatterStraightLinesMarkersIcon = {\n name: 'chart-scatter-straight-lines-markers',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartScatterStraightLinesIcon = {\n name: 'chart-scatter-straight-lines',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartBubbleIcon = {\n name: 'chart-bubble',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartCandlestickIcon = {\n name: 'chart-candlestick',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartOhlcIcon = {\n name: 'chart-ohlc',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartRadarIcon = {\n name: 'chart-radar',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartRadarMarkersIcon = {\n name: 'chart-radar-markers',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartRadarFilledIcon = {\n name: 'chart-radar-filled',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartRoseIcon = {\n name: 'chart-rose',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nconst chartChoroplethIcon = {\n name: 'chart-choropleth',\n content: '',\n viewBox: '0 0 512 512'\n};\n\nexport { accessibilityIcon, aggregateFieldsIcon, alignBottomIcon, alignCenterIcon, alignItemsBaselineAltIcon, alignItemsBaselineIcon, alignItemsCenterAltIcon, alignItemsCenterIcon, alignItemsEndAltIcon, alignItemsEndIcon, alignItemsStartAltIcon, alignItemsStartIcon, alignItemsStretchAltIcon, alignItemsStretchIcon, alignJustifyIcon, alignLeftIcon, alignMiddleIcon, alignRemoveIcon, alignRightIcon, alignSelfCenterAltIcon, alignSelfCenterIcon, alignSelfEndAltIcon, alignSelfEndIcon, alignSelfStartAltIcon, alignSelfStartIcon, alignSelfStretchAltIcon, alignSelfStretchIcon, alignToGridIcon, alignTopIcon, allIcon, anchorIcon, applyFormatIcon, arrowDownIcon, arrowLeftIcon, arrowOverflowDownIcon, arrowRightIcon, arrowRotateCcwIcon, arrowRotateCcwSmallIcon, arrowRotateCwIcon, arrowRotateCwSmallIcon, arrowUpIcon, arrowsAxesIcon, arrowsLeftRightIcon, arrowsMoveIcon, arrowsNoChangeIcon, arrowsNoRepeatIcon, arrowsSwapIcon, arrowsTopBottomIcon, barcodeIcon, barcodeOutlineIcon, barcodeQrCodeScannerIcon, barcodeScannerIcon, behanceBoxIcon, behanceIcon, bellIcon, binocularsIcon, bloggerBoxIcon, bloggerIcon, blurIcon, boldIcon, bookIcon, borderBottomIcon, borderLeftIcon, borderRadiusBottomLeftIcon, borderRadiusBottomRightIcon, borderRadiusIcon, borderRadiusTopLeftIcon, borderRadiusTopRightIcon, borderRightIcon, borderStyleBottomIcon, borderStyleIcon, borderStyleLeftIcon, borderStyleRightIcon, borderStyleTopIcon, borderTopIcon, bordersAllIcon, bordersInsideHorizontalIcon, bordersInsideIcon, bordersInsideVerticalIcon, bordersNoneIcon, bordersOutsideIcon, bordersShowHideIcon, boxSizingIcon, brightnessContrastIcon, bringBackwardIcon, bringForwardIcon, bringToBackIcon, bringToFrontIcon, brushIcon, buildingBlocksIcon, buttonIcon, calculatorIcon, calendarDateIcon, calendarIcon, cameraIcon, cancelCircleIcon, cancelIcon, cancelOutlineIcon, caretAltDownIcon, caretAltExpandIcon, caretAltLeftIcon, caretAltRightIcon, caretAltToBottomIcon, caretAltToLeftIcon, caretAltToRightIcon, caretAltToTopIcon, caretAltUpIcon, caretBlIcon, caretBrIcon, caretDoubleAltDownIcon, caretDoubleAltLeftIcon, caretDoubleAltRightIcon, caretDoubleAltUpIcon, caretTlIcon, caretTrIcon, cartIcon, categorizeIcon, cellSplitHorizontallyIcon, cellSplitVerticallyIcon, cellsMergeHorizontallyIcon, cellsMergeIcon, cellsMergeVerticallyIcon, changeManuallyIcon, chartAreaClusteredIcon, chartAreaRangeIcon, chartAreaStacked100Icon, chartAreaStackedIcon, chartBarClusteredIcon, chartBarRangeIcon, chartBarStacked100Icon, chartBarStackedIcon, chartBubbleIcon, chartCandlestickIcon, chartChoroplethIcon, chartColumnClusteredIcon, chartColumnRangeIcon, chartColumnStacked100Icon, chartColumnStackedIcon, chartDoughnutIcon, chartLineIcon, chartLineMarkersIcon, chartLineStacked100Icon, chartLineStacked100MarkersIcon, chartLineStackedIcon, chartLineStackedMarkersIcon, chartOhlcIcon, chartPieIcon, chartRadarFilledIcon, chartRadarIcon, chartRadarMarkersIcon, chartRoseIcon, chartScatterIcon, chartScatterSmoothLinesIcon, chartScatterSmoothLinesMarkersIcon, chartScatterStraightLinesIcon, chartScatterStraightLinesMarkersIcon, checkCircleIcon, checkIcon, checkOutlineIcon, checkboxCheckedIcon, checkboxIcon, checkboxIndeterminateIcon, checkboxNullIcon, chevronDoubleDownIcon, chevronDoubleLeftIcon, chevronDoubleRightIcon, chevronDoubleUpIcon, chevronDownIcon, chevronLeftIcon, chevronRightIcon, chevronUpIcon, circleIcon, clearCssIcon, clipboardCodeIcon, clipboardHtmlIcon, clipboardIcon, clipboardMarkdownIcon, clipboardTextIcon, clipboardWordAltIcon, clipboardWordIcon, clockArrowRotateIcon, clockIcon, closedCaptionsIcon, cloudIcon, codeIcon, codeSnippetIcon, colResizeIcon, columnFreezeIcon, columnsIcon, commentIcon, commentRemoveIcon, commentsRemoveIcon, connectorIcon, convertLowercaseIcon, convertUppercaseIcon, copyFormatIcon, copyIcon, cropIcon, crosstabIcon, crosstabWizardIcon, csIcon, csprojIcon, css3Icon, cssIcon, customFormatIcon, customIconIcon, cutIcon, dataCsvIcon, dataIcon, dataJsonIcon, dataOdsIcon, dataRestIcon, dataSdsIcon, dataSqlIcon, dataWebIcon, decimalDecreaseIcon, decimalIncreaseIcon, decreaseHorizontalSpacingIcon, decreaseVerticalSpacingIcon, deliciousBoxIcon, deliciousIcon, detailSectionIcon, diggBoxIcon, diggIcon, dimensionsIcon, displayBlockIcon, displayFlexIcon, displayInlineBlockIcon, displayInlineFlexIcon, divIcon, divideIcon, documentManagerIcon, dollarIcon, downloadIcon, downloadLightIcon, dragAndDropIcon, dribbbleBoxIcon, dribbbleIcon, dropletIcon, dropletSlashIcon, dropletSliderIcon, editToolsIcon, envelopBoxIcon, envelopIcon, envelopLinkIcon, envelopeBoxIcon, envelopeIcon, envelopeLinkIcon, equalIcon, exclamationCircleIcon, exeIcon, exportIcon, eyeIcon, eyeSlashIcon, eyedropperIcon, facebookBoxIcon, facebookIcon, fileAddIcon, fileAscxIcon, fileAudioIcon, fileBacIcon, fileConfigIcon, fileCsvIcon, fileDataIcon, fileDiscImageIcon, fileErrorIcon, fileExcelIcon, fileFlashIcon, fileFooterIcon, fileHeaderIcon, fileHorizontalIcon, fileIcon, fileImageIcon, fileMdbIcon, filePdfIcon, filePptIcon, filePresentationIcon, fileProgrammingIcon, filePsdIcon, fileReportIcon, fileTxtIcon, fileTypescriptIcon, fileVideoIcon, fileWordIcon, fileWrenchIcon, fileZipIcon, filesErrorIcon, filmIcon, filterAddExpressionIcon, filterAddGroupIcon, filterClearIcon, filterIcon, filterSmallIcon, filterSortAscSmallIcon, filterSortDescSmallIcon, flashManagerIcon, flipHorizontalIcon, flipVerticalIcon, folderAddIcon, folderIcon, folderMoreIcon, folderOpenIcon, folderUpIcon, fontFamilyIcon, fontSizeIcon, foregroundColorIcon, formElementIcon, formIcon, formatCodeBlockIcon, formulaFxIcon, forwardIcon, fullscreenExitIcon, fullscreenIcon, gapColumnIcon, gapRowIcon, gaugeLinearIcon, gaugeRadialIcon, gearIcon, gearsIcon, globeIcon, globeLinkIcon, globeOutlineIcon, globeUnlinkIcon, googleBoxIcon, googleIcon, googlePlusBoxIcon, googlePlusIcon, graphIcon, grayscaleIcon, greaterOrEqualIcon, gridIcon, gridLayoutIcon, groupBoxIcon, groupCollectionIcon, groupFooterSectionIcon, groupHeaderSectionIcon, groupIcon, groupSectionIcon, h1Icon, h2Icon, h3Icon, h4Icon, h5Icon, h6Icon, handIcon, handleDragIcon, handleResizeAltIcon, handleResizeIcon, hdIcon, heartIcon, heartOutlineIcon, homeIcon, horizontalRuleIcon, html5Icon, hyperlinkOpenIcon, hyperlinkOpenSmIcon, imageAbsolutePositionIcon, imageAddIcon, imageEditIcon, imageExportIcon, imageIcon, imageMapEditorIcon, imageResizeIcon, imagesIcon, importIcon, inboxIcon, increaseHorizontalSpacingIcon, increaseVerticalSpacingIcon, indentIcon, infoCircleIcon, inheritedIcon, insertBottomIcon, insertMiddleIcon, insertTopIcon, invertColorsIcon, italicIcon, jsIcon, justifyContentAroundAltIcon, justifyContentAroundIcon, justifyContentBetweenAltIcon, justifyContentBetweenIcon, justifyContentCenterAltIcon, justifyContentCenterIcon, justifyContentEndAltIcon, justifyContentEndIcon, justifyContentStartAltIcon, justifyContentStartIcon, kpiStatusDenyIcon, kpiStatusHoldIcon, kpiStatusOpenIcon, launchIcon, layout1By4Icon, layout2By2Icon, layoutIcon, layoutSideBySideIcon, layoutStackedIcon, lessOrEqualIcon, letterSpaceIcon, levelDownIcon, levelToTopIcon, levelUpIcon, lineHeightIcon, linkAddIcon, linkIcon, linkVerticalIcon, linkedinBoxIcon, linkedinIcon, listLatinBigIcon, listLatinSmallIcon, listOrderedIcon, listRomanBigIcon, listRomanLowerIcon, listRomanSmallIcon, listRomanUpperIcon, listUnorderedIcon, listUnorderedOutlineIcon, listUnorderedSquareIcon, lockIcon, loginIcon, logoutIcon, makeHorizontalSpacingEqualIcon, makeSameHeightIcon, makeSameSizeIcon, makeSameWidthIcon, makeVerticalSpacingEqualIcon, mapMarkerIcon, mapMarkerTargetIcon, maxHeightIcon, maxWidthIcon, mediaManagerIcon, menuIcon, minHeightIcon, minWidthIcon, minusCircleIcon, minusIcon, minusOutlineIcon, minusSmIcon, mirrorIcon, moreHorizontalIcon, moreVerticalIcon, musicNotesIcon, myspaceBoxIcon, myspaceIcon, nonRecurrenceIcon, notEqualIcon, outdentIcon, outlineOffsetIcon, outlineWidthIcon, overlapIcon, paddingBottomIcon, paddingIcon, paddingLeftIcon, paddingRightIcon, paddingTopIcon, pageFooterSectionIcon, pageHeaderSectionIcon, paletteIcon, paneFreezeIcon, paperPlaneIcon, paperclipAltIcon, paperclipIcon, paragraphAddIcon, parameterBooleanIcon, parameterDateTimeIcon, parameterFloatIcon, parameterIntegerIcon, parameterStringIcon, parametersByteArrayIcon, parametersIcon, parametersUnknownIcon, passwordIcon, pauseIcon, pauseSmIcon, pencilIcon, percentIcon, photosIcon, pinIcon, pinterestBoxIcon, pinterestIcon, playIcon, playSmIcon, playlistIcon, plusCircleIcon, plusIcon, plusOutlineIcon, plusSmIcon, pointerIcon, positionBottomIcon, positionLeftIcon, positionRightIcon, positionTopIcon, printIcon, puzzlePieceIcon, qrCodeIcon, qrCodeOutlineIcon, qrCodeScannerIcon, questionCircleIcon, radiobuttonCheckedIcon, radiobuttonIcon, redditBoxIcon, redditIcon, redoIcon, regularExpressionIcon, removeHorizontalSpacingIcon, removeVerticalSpacingIcon, reorderIcon, replaceAllIcon, replaceSingleIcon, reportElementIcon, rewindIcon, rightDoubleQuotesIcon, rotateIcon, rotateLeftIcon, rotateRightIcon, roundCornersIcon, rowFreezeIcon, rowsIcon, rssBoxIcon, rssIcon, saveIcon, searchIcon, selectAllIcon, selectBoxIcon, setColumnPositionIcon, shapeLineIcon, shapesIcon, shareIcon, sharpenIcon, signatureIcon, silverlightIcon, sizeToGridIcon, slidersIcon, slnIcon, snapGridIcon, snapToGridlinesIcon, snapToSnaplinesIcon, sortAscIcon, sortAscSmallIcon, sortClearIcon, sortDescIcon, sortDescSmallIcon, spellCheckerIcon, starIcon, starOutlineIcon, stickIcon, stopIcon, stopSmIcon, strikethroughIcon, stripAllFormattingIcon, stripCssFormatIcon, stripFontElementsIcon, stripSpanElementsIcon, stripWordFormattingIcon, stumbleUponBoxIcon, stumbleUponIcon, subreportIcon, subscriptIcon, sumIcon, supscriptIcon, symbolIcon, tableAddIcon, tableAlignBottomCenterIcon, tableAlignBottomLeftIcon, tableAlignBottomRightIcon, tableAlignMiddleCenterIcon, tableAlignMiddleLeftIcon, tableAlignMiddleRightIcon, tableAlignRemoveIcon, tableAlignTopCenterIcon, tableAlignTopLeftIcon, tableAlignTopRightIcon, tableBodyIcon, tableCellDeleteIcon, tableCellIcon, tableCellPropertiesIcon, tableColumnDeleteIcon, tableColumnGroupsIcon, tableColumnInsertLeftIcon, tableColumnInsertRightIcon, tableCornerIcon, tableDeleteIcon, tableIcon, tablePositionCenterIcon, tablePositionEndIcon, tablePositionStartIcon, tablePropertiesIcon, tableRowDeleteIcon, tableRowGroupsIcon, tableRowInsertAboveIcon, tableRowInsertBelowIcon, tableUnmergeIcon, tableWizardIcon, tellAFriendBoxIcon, tellAFriendIcon, templateManagerIcon, textWrapIcon, textareaIcon, textboxHiddenIcon, textboxIcon, thumbnailsDownIcon, thumbnailsLeftIcon, thumbnailsRightIcon, thumbnailsUpIcon, tocSectionIcon, tocSectionLevelIcon, toggleFullScreenModeIcon, toolbarFloatIcon, trackChangesAcceptAllIcon, trackChangesAcceptIcon, trackChangesEnableIcon, trackChangesIcon, trackChangesRejectAllIcon, trackChangesRejectIcon, transparencyIcon, trashIcon, tumblrBoxIcon, tumblrIcon, twitterBoxIcon, twitterIcon, underlineIcon, undoIcon, ungroupIcon, unlinkIcon, unlinkVerticalIcon, unlockIcon, unpinIcon, unstickIcon, uploadIcon, userIcon, validationDataIcon, validationXhtmlIcon, vbIcon, vbprojIcon, videoExternalIcon, vimeoBoxIcon, vimeoIcon, volumeDownIcon, volumeMuteIcon, volumeUpIcon, wholeWordIcon, windowIcon, windowMinimizeIcon, windowRestoreIcon, wrenchIcon, xCircleIcon, xIcon, xOutlineIcon, yammerBoxIcon, yammerIcon, youtubeBoxIcon, youtubeIcon, zoomActualSizeIcon, zoomBestFitIcon, zoomInIcon, zoomOutIcon };\n","//! moment.js locale configuration\n//! locale : Afrikaans [af]\n//! author : Werner Mollentze : https://github.com/wernerm\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var af = moment.defineLocale('af', {\n months: 'Januarie_Februarie_Maart_April_Mei_Junie_Julie_Augustus_September_Oktober_November_Desember'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mrt_Apr_Mei_Jun_Jul_Aug_Sep_Okt_Nov_Des'.split('_'),\n weekdays: 'Sondag_Maandag_Dinsdag_Woensdag_Donderdag_Vrydag_Saterdag'.split(\n '_'\n ),\n weekdaysShort: 'Son_Maa_Din_Woe_Don_Vry_Sat'.split('_'),\n weekdaysMin: 'So_Ma_Di_Wo_Do_Vr_Sa'.split('_'),\n meridiemParse: /vm|nm/i,\n isPM: function (input) {\n return /^nm$/i.test(input);\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours < 12) {\n return isLower ? 'vm' : 'VM';\n } else {\n return isLower ? 'nm' : 'NM';\n }\n },\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Vandag om] LT',\n nextDay: '[Môre om] LT',\n nextWeek: 'dddd [om] LT',\n lastDay: '[Gister om] LT',\n lastWeek: '[Laas] dddd [om] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'oor %s',\n past: '%s gelede',\n s: \"'n paar sekondes\",\n ss: '%d sekondes',\n m: \"'n minuut\",\n mm: '%d minute',\n h: \"'n uur\",\n hh: '%d ure',\n d: \"'n dag\",\n dd: '%d dae',\n M: \"'n maand\",\n MM: '%d maande',\n y: \"'n jaar\",\n yy: '%d jaar',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(ste|de)/,\n ordinal: function (number) {\n return (\n number +\n (number === 1 || number === 8 || number >= 20 ? 'ste' : 'de')\n ); // Thanks to Joris Röling : https://github.com/jjupiter\n },\n week: {\n dow: 1, // Maandag is die eerste dag van die week.\n doy: 4, // Die week wat die 4de Januarie bevat is die eerste week van die jaar.\n },\n });\n\n return af;\n\n})));\n","//! moment.js locale configuration\n//! locale : Arabic (Algeria) [ar-dz]\n//! author : Amine Roukh: https://github.com/Amine27\n//! author : Abdel Said: https://github.com/abdelsaid\n//! author : Ahmed Elkhatib\n//! author : forabi https://github.com/forabi\n//! author : Noureddine LOUAHEDJ : https://github.com/noureddinem\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var pluralForm = function (n) {\n return n === 0\n ? 0\n : n === 1\n ? 1\n : n === 2\n ? 2\n : n % 100 >= 3 && n % 100 <= 10\n ? 3\n : n % 100 >= 11\n ? 4\n : 5;\n },\n plurals = {\n s: [\n 'أقل من ثانية',\n 'ثانية واحدة',\n ['ثانيتان', 'ثانيتين'],\n '%d ثوان',\n '%d ثانية',\n '%d ثانية',\n ],\n m: [\n 'أقل من دقيقة',\n 'دقيقة واحدة',\n ['دقيقتان', 'دقيقتين'],\n '%d دقائق',\n '%d دقيقة',\n '%d دقيقة',\n ],\n h: [\n 'أقل من ساعة',\n 'ساعة واحدة',\n ['ساعتان', 'ساعتين'],\n '%d ساعات',\n '%d ساعة',\n '%d ساعة',\n ],\n d: [\n 'أقل من يوم',\n 'يوم واحد',\n ['يومان', 'يومين'],\n '%d أيام',\n '%d يومًا',\n '%d يوم',\n ],\n M: [\n 'أقل من شهر',\n 'شهر واحد',\n ['شهران', 'شهرين'],\n '%d أشهر',\n '%d شهرا',\n '%d شهر',\n ],\n y: [\n 'أقل من عام',\n 'عام واحد',\n ['عامان', 'عامين'],\n '%d أعوام',\n '%d عامًا',\n '%d عام',\n ],\n },\n pluralize = function (u) {\n return function (number, withoutSuffix, string, isFuture) {\n var f = pluralForm(number),\n str = plurals[u][pluralForm(number)];\n if (f === 2) {\n str = str[withoutSuffix ? 0 : 1];\n }\n return str.replace(/%d/i, number);\n };\n },\n months = [\n 'جانفي',\n 'فيفري',\n 'مارس',\n 'أفريل',\n 'ماي',\n 'جوان',\n 'جويلية',\n 'أوت',\n 'سبتمبر',\n 'أكتوبر',\n 'نوفمبر',\n 'ديسمبر',\n ];\n\n var arDz = moment.defineLocale('ar-dz', {\n months: months,\n monthsShort: months,\n weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),\n weekdaysShort: 'أحد_إثنين_ثلاثاء_أربعاء_خميس_جمعة_سبت'.split('_'),\n weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'D/\\u200FM/\\u200FYYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n meridiemParse: /ص|م/,\n isPM: function (input) {\n return 'م' === input;\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ص';\n } else {\n return 'م';\n }\n },\n calendar: {\n sameDay: '[اليوم عند الساعة] LT',\n nextDay: '[غدًا عند الساعة] LT',\n nextWeek: 'dddd [عند الساعة] LT',\n lastDay: '[أمس عند الساعة] LT',\n lastWeek: 'dddd [عند الساعة] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'بعد %s',\n past: 'منذ %s',\n s: pluralize('s'),\n ss: pluralize('s'),\n m: pluralize('m'),\n mm: pluralize('m'),\n h: pluralize('h'),\n hh: pluralize('h'),\n d: pluralize('d'),\n dd: pluralize('d'),\n M: pluralize('M'),\n MM: pluralize('M'),\n y: pluralize('y'),\n yy: pluralize('y'),\n },\n postformat: function (string) {\n return string.replace(/,/g, '،');\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return arDz;\n\n})));\n","//! moment.js locale configuration\n//! locale : Arabic (Kuwait) [ar-kw]\n//! author : Nusret Parlak: https://github.com/nusretparlak\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var arKw = moment.defineLocale('ar-kw', {\n months: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(\n '_'\n ),\n monthsShort: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(\n '_'\n ),\n weekdays: 'الأحد_الإتنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),\n weekdaysShort: 'احد_اتنين_ثلاثاء_اربعاء_خميس_جمعة_سبت'.split('_'),\n weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[اليوم على الساعة] LT',\n nextDay: '[غدا على الساعة] LT',\n nextWeek: 'dddd [على الساعة] LT',\n lastDay: '[أمس على الساعة] LT',\n lastWeek: 'dddd [على الساعة] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'في %s',\n past: 'منذ %s',\n s: 'ثوان',\n ss: '%d ثانية',\n m: 'دقيقة',\n mm: '%d دقائق',\n h: 'ساعة',\n hh: '%d ساعات',\n d: 'يوم',\n dd: '%d أيام',\n M: 'شهر',\n MM: '%d أشهر',\n y: 'سنة',\n yy: '%d سنوات',\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return arKw;\n\n})));\n","//! moment.js locale configuration\n//! locale : Arabic (Lybia) [ar-ly]\n//! author : Ali Hmer: https://github.com/kikoanis\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '1',\n 2: '2',\n 3: '3',\n 4: '4',\n 5: '5',\n 6: '6',\n 7: '7',\n 8: '8',\n 9: '9',\n 0: '0',\n },\n pluralForm = function (n) {\n return n === 0\n ? 0\n : n === 1\n ? 1\n : n === 2\n ? 2\n : n % 100 >= 3 && n % 100 <= 10\n ? 3\n : n % 100 >= 11\n ? 4\n : 5;\n },\n plurals = {\n s: [\n 'أقل من ثانية',\n 'ثانية واحدة',\n ['ثانيتان', 'ثانيتين'],\n '%d ثوان',\n '%d ثانية',\n '%d ثانية',\n ],\n m: [\n 'أقل من دقيقة',\n 'دقيقة واحدة',\n ['دقيقتان', 'دقيقتين'],\n '%d دقائق',\n '%d دقيقة',\n '%d دقيقة',\n ],\n h: [\n 'أقل من ساعة',\n 'ساعة واحدة',\n ['ساعتان', 'ساعتين'],\n '%d ساعات',\n '%d ساعة',\n '%d ساعة',\n ],\n d: [\n 'أقل من يوم',\n 'يوم واحد',\n ['يومان', 'يومين'],\n '%d أيام',\n '%d يومًا',\n '%d يوم',\n ],\n M: [\n 'أقل من شهر',\n 'شهر واحد',\n ['شهران', 'شهرين'],\n '%d أشهر',\n '%d شهرا',\n '%d شهر',\n ],\n y: [\n 'أقل من عام',\n 'عام واحد',\n ['عامان', 'عامين'],\n '%d أعوام',\n '%d عامًا',\n '%d عام',\n ],\n },\n pluralize = function (u) {\n return function (number, withoutSuffix, string, isFuture) {\n var f = pluralForm(number),\n str = plurals[u][pluralForm(number)];\n if (f === 2) {\n str = str[withoutSuffix ? 0 : 1];\n }\n return str.replace(/%d/i, number);\n };\n },\n months = [\n 'يناير',\n 'فبراير',\n 'مارس',\n 'أبريل',\n 'مايو',\n 'يونيو',\n 'يوليو',\n 'أغسطس',\n 'سبتمبر',\n 'أكتوبر',\n 'نوفمبر',\n 'ديسمبر',\n ];\n\n var arLy = moment.defineLocale('ar-ly', {\n months: months,\n monthsShort: months,\n weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),\n weekdaysShort: 'أحد_إثنين_ثلاثاء_أربعاء_خميس_جمعة_سبت'.split('_'),\n weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'D/\\u200FM/\\u200FYYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n meridiemParse: /ص|م/,\n isPM: function (input) {\n return 'م' === input;\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ص';\n } else {\n return 'م';\n }\n },\n calendar: {\n sameDay: '[اليوم عند الساعة] LT',\n nextDay: '[غدًا عند الساعة] LT',\n nextWeek: 'dddd [عند الساعة] LT',\n lastDay: '[أمس عند الساعة] LT',\n lastWeek: 'dddd [عند الساعة] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'بعد %s',\n past: 'منذ %s',\n s: pluralize('s'),\n ss: pluralize('s'),\n m: pluralize('m'),\n mm: pluralize('m'),\n h: pluralize('h'),\n hh: pluralize('h'),\n d: pluralize('d'),\n dd: pluralize('d'),\n M: pluralize('M'),\n MM: pluralize('M'),\n y: pluralize('y'),\n yy: pluralize('y'),\n },\n preparse: function (string) {\n return string.replace(/،/g, ',');\n },\n postformat: function (string) {\n return string\n .replace(/\\d/g, function (match) {\n return symbolMap[match];\n })\n .replace(/,/g, '،');\n },\n week: {\n dow: 6, // Saturday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return arLy;\n\n})));\n","//! moment.js locale configuration\n//! locale : Arabic (Morocco) [ar-ma]\n//! author : ElFadili Yassine : https://github.com/ElFadiliY\n//! author : Abdel Said : https://github.com/abdelsaid\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var arMa = moment.defineLocale('ar-ma', {\n months: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(\n '_'\n ),\n monthsShort: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(\n '_'\n ),\n weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),\n weekdaysShort: 'احد_اثنين_ثلاثاء_اربعاء_خميس_جمعة_سبت'.split('_'),\n weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[اليوم على الساعة] LT',\n nextDay: '[غدا على الساعة] LT',\n nextWeek: 'dddd [على الساعة] LT',\n lastDay: '[أمس على الساعة] LT',\n lastWeek: 'dddd [على الساعة] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'في %s',\n past: 'منذ %s',\n s: 'ثوان',\n ss: '%d ثانية',\n m: 'دقيقة',\n mm: '%d دقائق',\n h: 'ساعة',\n hh: '%d ساعات',\n d: 'يوم',\n dd: '%d أيام',\n M: 'شهر',\n MM: '%d أشهر',\n y: 'سنة',\n yy: '%d سنوات',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return arMa;\n\n})));\n","//! moment.js locale configuration\n//! locale : Arabic (Saudi Arabia) [ar-sa]\n//! author : Suhail Alkowaileet : https://github.com/xsoh\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '١',\n 2: '٢',\n 3: '٣',\n 4: '٤',\n 5: '٥',\n 6: '٦',\n 7: '٧',\n 8: '٨',\n 9: '٩',\n 0: '٠',\n },\n numberMap = {\n '١': '1',\n '٢': '2',\n '٣': '3',\n '٤': '4',\n '٥': '5',\n '٦': '6',\n '٧': '7',\n '٨': '8',\n '٩': '9',\n '٠': '0',\n };\n\n var arSa = moment.defineLocale('ar-sa', {\n months: 'يناير_فبراير_مارس_أبريل_مايو_يونيو_يوليو_أغسطس_سبتمبر_أكتوبر_نوفمبر_ديسمبر'.split(\n '_'\n ),\n monthsShort: 'يناير_فبراير_مارس_أبريل_مايو_يونيو_يوليو_أغسطس_سبتمبر_أكتوبر_نوفمبر_ديسمبر'.split(\n '_'\n ),\n weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),\n weekdaysShort: 'أحد_إثنين_ثلاثاء_أربعاء_خميس_جمعة_سبت'.split('_'),\n weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n meridiemParse: /ص|م/,\n isPM: function (input) {\n return 'م' === input;\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ص';\n } else {\n return 'م';\n }\n },\n calendar: {\n sameDay: '[اليوم على الساعة] LT',\n nextDay: '[غدا على الساعة] LT',\n nextWeek: 'dddd [على الساعة] LT',\n lastDay: '[أمس على الساعة] LT',\n lastWeek: 'dddd [على الساعة] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'في %s',\n past: 'منذ %s',\n s: 'ثوان',\n ss: '%d ثانية',\n m: 'دقيقة',\n mm: '%d دقائق',\n h: 'ساعة',\n hh: '%d ساعات',\n d: 'يوم',\n dd: '%d أيام',\n M: 'شهر',\n MM: '%d أشهر',\n y: 'سنة',\n yy: '%d سنوات',\n },\n preparse: function (string) {\n return string\n .replace(/[١٢٣٤٥٦٧٨٩٠]/g, function (match) {\n return numberMap[match];\n })\n .replace(/،/g, ',');\n },\n postformat: function (string) {\n return string\n .replace(/\\d/g, function (match) {\n return symbolMap[match];\n })\n .replace(/,/g, '،');\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return arSa;\n\n})));\n","//! moment.js locale configuration\n//! locale : Arabic (Tunisia) [ar-tn]\n//! author : Nader Toukabri : https://github.com/naderio\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var arTn = moment.defineLocale('ar-tn', {\n months: 'جانفي_فيفري_مارس_أفريل_ماي_جوان_جويلية_أوت_سبتمبر_أكتوبر_نوفمبر_ديسمبر'.split(\n '_'\n ),\n monthsShort: 'جانفي_فيفري_مارس_أفريل_ماي_جوان_جويلية_أوت_سبتمبر_أكتوبر_نوفمبر_ديسمبر'.split(\n '_'\n ),\n weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),\n weekdaysShort: 'أحد_إثنين_ثلاثاء_أربعاء_خميس_جمعة_سبت'.split('_'),\n weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[اليوم على الساعة] LT',\n nextDay: '[غدا على الساعة] LT',\n nextWeek: 'dddd [على الساعة] LT',\n lastDay: '[أمس على الساعة] LT',\n lastWeek: 'dddd [على الساعة] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'في %s',\n past: 'منذ %s',\n s: 'ثوان',\n ss: '%d ثانية',\n m: 'دقيقة',\n mm: '%d دقائق',\n h: 'ساعة',\n hh: '%d ساعات',\n d: 'يوم',\n dd: '%d أيام',\n M: 'شهر',\n MM: '%d أشهر',\n y: 'سنة',\n yy: '%d سنوات',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return arTn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Arabic [ar]\n//! author : Abdel Said: https://github.com/abdelsaid\n//! author : Ahmed Elkhatib\n//! author : forabi https://github.com/forabi\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '١',\n 2: '٢',\n 3: '٣',\n 4: '٤',\n 5: '٥',\n 6: '٦',\n 7: '٧',\n 8: '٨',\n 9: '٩',\n 0: '٠',\n },\n numberMap = {\n '١': '1',\n '٢': '2',\n '٣': '3',\n '٤': '4',\n '٥': '5',\n '٦': '6',\n '٧': '7',\n '٨': '8',\n '٩': '9',\n '٠': '0',\n },\n pluralForm = function (n) {\n return n === 0\n ? 0\n : n === 1\n ? 1\n : n === 2\n ? 2\n : n % 100 >= 3 && n % 100 <= 10\n ? 3\n : n % 100 >= 11\n ? 4\n : 5;\n },\n plurals = {\n s: [\n 'أقل من ثانية',\n 'ثانية واحدة',\n ['ثانيتان', 'ثانيتين'],\n '%d ثوان',\n '%d ثانية',\n '%d ثانية',\n ],\n m: [\n 'أقل من دقيقة',\n 'دقيقة واحدة',\n ['دقيقتان', 'دقيقتين'],\n '%d دقائق',\n '%d دقيقة',\n '%d دقيقة',\n ],\n h: [\n 'أقل من ساعة',\n 'ساعة واحدة',\n ['ساعتان', 'ساعتين'],\n '%d ساعات',\n '%d ساعة',\n '%d ساعة',\n ],\n d: [\n 'أقل من يوم',\n 'يوم واحد',\n ['يومان', 'يومين'],\n '%d أيام',\n '%d يومًا',\n '%d يوم',\n ],\n M: [\n 'أقل من شهر',\n 'شهر واحد',\n ['شهران', 'شهرين'],\n '%d أشهر',\n '%d شهرا',\n '%d شهر',\n ],\n y: [\n 'أقل من عام',\n 'عام واحد',\n ['عامان', 'عامين'],\n '%d أعوام',\n '%d عامًا',\n '%d عام',\n ],\n },\n pluralize = function (u) {\n return function (number, withoutSuffix, string, isFuture) {\n var f = pluralForm(number),\n str = plurals[u][pluralForm(number)];\n if (f === 2) {\n str = str[withoutSuffix ? 0 : 1];\n }\n return str.replace(/%d/i, number);\n };\n },\n months = [\n 'يناير',\n 'فبراير',\n 'مارس',\n 'أبريل',\n 'مايو',\n 'يونيو',\n 'يوليو',\n 'أغسطس',\n 'سبتمبر',\n 'أكتوبر',\n 'نوفمبر',\n 'ديسمبر',\n ];\n\n var ar = moment.defineLocale('ar', {\n months: months,\n monthsShort: months,\n weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),\n weekdaysShort: 'أحد_إثنين_ثلاثاء_أربعاء_خميس_جمعة_سبت'.split('_'),\n weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'D/\\u200FM/\\u200FYYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n meridiemParse: /ص|م/,\n isPM: function (input) {\n return 'م' === input;\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ص';\n } else {\n return 'م';\n }\n },\n calendar: {\n sameDay: '[اليوم عند الساعة] LT',\n nextDay: '[غدًا عند الساعة] LT',\n nextWeek: 'dddd [عند الساعة] LT',\n lastDay: '[أمس عند الساعة] LT',\n lastWeek: 'dddd [عند الساعة] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'بعد %s',\n past: 'منذ %s',\n s: pluralize('s'),\n ss: pluralize('s'),\n m: pluralize('m'),\n mm: pluralize('m'),\n h: pluralize('h'),\n hh: pluralize('h'),\n d: pluralize('d'),\n dd: pluralize('d'),\n M: pluralize('M'),\n MM: pluralize('M'),\n y: pluralize('y'),\n yy: pluralize('y'),\n },\n preparse: function (string) {\n return string\n .replace(/[١٢٣٤٥٦٧٨٩٠]/g, function (match) {\n return numberMap[match];\n })\n .replace(/،/g, ',');\n },\n postformat: function (string) {\n return string\n .replace(/\\d/g, function (match) {\n return symbolMap[match];\n })\n .replace(/,/g, '،');\n },\n week: {\n dow: 6, // Saturday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return ar;\n\n})));\n","//! moment.js locale configuration\n//! locale : Azerbaijani [az]\n//! author : topchiyev : https://github.com/topchiyev\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var suffixes = {\n 1: '-inci',\n 5: '-inci',\n 8: '-inci',\n 70: '-inci',\n 80: '-inci',\n 2: '-nci',\n 7: '-nci',\n 20: '-nci',\n 50: '-nci',\n 3: '-üncü',\n 4: '-üncü',\n 100: '-üncü',\n 6: '-ncı',\n 9: '-uncu',\n 10: '-uncu',\n 30: '-uncu',\n 60: '-ıncı',\n 90: '-ıncı',\n };\n\n var az = moment.defineLocale('az', {\n months: 'yanvar_fevral_mart_aprel_may_iyun_iyul_avqust_sentyabr_oktyabr_noyabr_dekabr'.split(\n '_'\n ),\n monthsShort: 'yan_fev_mar_apr_may_iyn_iyl_avq_sen_okt_noy_dek'.split('_'),\n weekdays: 'Bazar_Bazar ertəsi_Çərşənbə axşamı_Çərşənbə_Cümə axşamı_Cümə_Şənbə'.split(\n '_'\n ),\n weekdaysShort: 'Baz_BzE_ÇAx_Çər_CAx_Cüm_Şən'.split('_'),\n weekdaysMin: 'Bz_BE_ÇA_Çə_CA_Cü_Şə'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[bugün saat] LT',\n nextDay: '[sabah saat] LT',\n nextWeek: '[gələn həftə] dddd [saat] LT',\n lastDay: '[dünən] LT',\n lastWeek: '[keçən həftə] dddd [saat] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s sonra',\n past: '%s əvvəl',\n s: 'bir neçə saniyə',\n ss: '%d saniyə',\n m: 'bir dəqiqə',\n mm: '%d dəqiqə',\n h: 'bir saat',\n hh: '%d saat',\n d: 'bir gün',\n dd: '%d gün',\n M: 'bir ay',\n MM: '%d ay',\n y: 'bir il',\n yy: '%d il',\n },\n meridiemParse: /gecə|səhər|gündüz|axşam/,\n isPM: function (input) {\n return /^(gündüz|axşam)$/.test(input);\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'gecə';\n } else if (hour < 12) {\n return 'səhər';\n } else if (hour < 17) {\n return 'gündüz';\n } else {\n return 'axşam';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(ıncı|inci|nci|üncü|ncı|uncu)/,\n ordinal: function (number) {\n if (number === 0) {\n // special case for zero\n return number + '-ıncı';\n }\n var a = number % 10,\n b = (number % 100) - a,\n c = number >= 100 ? 100 : null;\n return number + (suffixes[a] || suffixes[b] || suffixes[c]);\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return az;\n\n})));\n","//! moment.js locale configuration\n//! locale : Belarusian [be]\n//! author : Dmitry Demidov : https://github.com/demidov91\n//! author: Praleska: http://praleska.pro/\n//! Author : Menelion Elensúle : https://github.com/Oire\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function plural(word, num) {\n var forms = word.split('_');\n return num % 10 === 1 && num % 100 !== 11\n ? forms[0]\n : num % 10 >= 2 && num % 10 <= 4 && (num % 100 < 10 || num % 100 >= 20)\n ? forms[1]\n : forms[2];\n }\n function relativeTimeWithPlural(number, withoutSuffix, key) {\n var format = {\n ss: withoutSuffix ? 'секунда_секунды_секунд' : 'секунду_секунды_секунд',\n mm: withoutSuffix ? 'хвіліна_хвіліны_хвілін' : 'хвіліну_хвіліны_хвілін',\n hh: withoutSuffix ? 'гадзіна_гадзіны_гадзін' : 'гадзіну_гадзіны_гадзін',\n dd: 'дзень_дні_дзён',\n MM: 'месяц_месяцы_месяцаў',\n yy: 'год_гады_гадоў',\n };\n if (key === 'm') {\n return withoutSuffix ? 'хвіліна' : 'хвіліну';\n } else if (key === 'h') {\n return withoutSuffix ? 'гадзіна' : 'гадзіну';\n } else {\n return number + ' ' + plural(format[key], +number);\n }\n }\n\n var be = moment.defineLocale('be', {\n months: {\n format: 'студзеня_лютага_сакавіка_красавіка_траўня_чэрвеня_ліпеня_жніўня_верасня_кастрычніка_лістапада_снежня'.split(\n '_'\n ),\n standalone: 'студзень_люты_сакавік_красавік_травень_чэрвень_ліпень_жнівень_верасень_кастрычнік_лістапад_снежань'.split(\n '_'\n ),\n },\n monthsShort: 'студ_лют_сак_крас_трав_чэрв_ліп_жнів_вер_каст_ліст_снеж'.split(\n '_'\n ),\n weekdays: {\n format: 'нядзелю_панядзелак_аўторак_сераду_чацвер_пятніцу_суботу'.split(\n '_'\n ),\n standalone: 'нядзеля_панядзелак_аўторак_серада_чацвер_пятніца_субота'.split(\n '_'\n ),\n isFormat: /\\[ ?[Ууў] ?(?:мінулую|наступную)? ?\\] ?dddd/,\n },\n weekdaysShort: 'нд_пн_ат_ср_чц_пт_сб'.split('_'),\n weekdaysMin: 'нд_пн_ат_ср_чц_пт_сб'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY г.',\n LLL: 'D MMMM YYYY г., HH:mm',\n LLLL: 'dddd, D MMMM YYYY г., HH:mm',\n },\n calendar: {\n sameDay: '[Сёння ў] LT',\n nextDay: '[Заўтра ў] LT',\n lastDay: '[Учора ў] LT',\n nextWeek: function () {\n return '[У] dddd [ў] LT';\n },\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n case 3:\n case 5:\n case 6:\n return '[У мінулую] dddd [ў] LT';\n case 1:\n case 2:\n case 4:\n return '[У мінулы] dddd [ў] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'праз %s',\n past: '%s таму',\n s: 'некалькі секунд',\n m: relativeTimeWithPlural,\n mm: relativeTimeWithPlural,\n h: relativeTimeWithPlural,\n hh: relativeTimeWithPlural,\n d: 'дзень',\n dd: relativeTimeWithPlural,\n M: 'месяц',\n MM: relativeTimeWithPlural,\n y: 'год',\n yy: relativeTimeWithPlural,\n },\n meridiemParse: /ночы|раніцы|дня|вечара/,\n isPM: function (input) {\n return /^(дня|вечара)$/.test(input);\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'ночы';\n } else if (hour < 12) {\n return 'раніцы';\n } else if (hour < 17) {\n return 'дня';\n } else {\n return 'вечара';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(і|ы|га)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'M':\n case 'd':\n case 'DDD':\n case 'w':\n case 'W':\n return (number % 10 === 2 || number % 10 === 3) &&\n number % 100 !== 12 &&\n number % 100 !== 13\n ? number + '-і'\n : number + '-ы';\n case 'D':\n return number + '-га';\n default:\n return number;\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return be;\n\n})));\n","//! moment.js locale configuration\n//! locale : Bulgarian [bg]\n//! author : Krasen Borisov : https://github.com/kraz\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var bg = moment.defineLocale('bg', {\n months: 'януари_февруари_март_април_май_юни_юли_август_септември_октомври_ноември_декември'.split(\n '_'\n ),\n monthsShort: 'яну_фев_мар_апр_май_юни_юли_авг_сеп_окт_ное_дек'.split('_'),\n weekdays: 'неделя_понеделник_вторник_сряда_четвъртък_петък_събота'.split(\n '_'\n ),\n weekdaysShort: 'нед_пон_вто_сря_чет_пет_съб'.split('_'),\n weekdaysMin: 'нд_пн_вт_ср_чт_пт_сб'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'D.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY H:mm',\n LLLL: 'dddd, D MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[Днес в] LT',\n nextDay: '[Утре в] LT',\n nextWeek: 'dddd [в] LT',\n lastDay: '[Вчера в] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n case 3:\n case 6:\n return '[Миналата] dddd [в] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[Миналия] dddd [в] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'след %s',\n past: 'преди %s',\n s: 'няколко секунди',\n ss: '%d секунди',\n m: 'минута',\n mm: '%d минути',\n h: 'час',\n hh: '%d часа',\n d: 'ден',\n dd: '%d дена',\n w: 'седмица',\n ww: '%d седмици',\n M: 'месец',\n MM: '%d месеца',\n y: 'година',\n yy: '%d години',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(ев|ен|ти|ви|ри|ми)/,\n ordinal: function (number) {\n var lastDigit = number % 10,\n last2Digits = number % 100;\n if (number === 0) {\n return number + '-ев';\n } else if (last2Digits === 0) {\n return number + '-ен';\n } else if (last2Digits > 10 && last2Digits < 20) {\n return number + '-ти';\n } else if (lastDigit === 1) {\n return number + '-ви';\n } else if (lastDigit === 2) {\n return number + '-ри';\n } else if (lastDigit === 7 || lastDigit === 8) {\n return number + '-ми';\n } else {\n return number + '-ти';\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return bg;\n\n})));\n","//! moment.js locale configuration\n//! locale : Bambara [bm]\n//! author : Estelle Comment : https://github.com/estellecomment\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var bm = moment.defineLocale('bm', {\n months: 'Zanwuyekalo_Fewuruyekalo_Marisikalo_Awirilikalo_Mɛkalo_Zuwɛnkalo_Zuluyekalo_Utikalo_Sɛtanburukalo_ɔkutɔburukalo_Nowanburukalo_Desanburukalo'.split(\n '_'\n ),\n monthsShort: 'Zan_Few_Mar_Awi_Mɛ_Zuw_Zul_Uti_Sɛt_ɔku_Now_Des'.split('_'),\n weekdays: 'Kari_Ntɛnɛn_Tarata_Araba_Alamisa_Juma_Sibiri'.split('_'),\n weekdaysShort: 'Kar_Ntɛ_Tar_Ara_Ala_Jum_Sib'.split('_'),\n weekdaysMin: 'Ka_Nt_Ta_Ar_Al_Ju_Si'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'MMMM [tile] D [san] YYYY',\n LLL: 'MMMM [tile] D [san] YYYY [lɛrɛ] HH:mm',\n LLLL: 'dddd MMMM [tile] D [san] YYYY [lɛrɛ] HH:mm',\n },\n calendar: {\n sameDay: '[Bi lɛrɛ] LT',\n nextDay: '[Sini lɛrɛ] LT',\n nextWeek: 'dddd [don lɛrɛ] LT',\n lastDay: '[Kunu lɛrɛ] LT',\n lastWeek: 'dddd [tɛmɛnen lɛrɛ] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s kɔnɔ',\n past: 'a bɛ %s bɔ',\n s: 'sanga dama dama',\n ss: 'sekondi %d',\n m: 'miniti kelen',\n mm: 'miniti %d',\n h: 'lɛrɛ kelen',\n hh: 'lɛrɛ %d',\n d: 'tile kelen',\n dd: 'tile %d',\n M: 'kalo kelen',\n MM: 'kalo %d',\n y: 'san kelen',\n yy: 'san %d',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return bm;\n\n})));\n","//! moment.js locale configuration\n//! locale : Bengali (Bangladesh) [bn-bd]\n//! author : Asraf Hossain Patoary : https://github.com/ashwoolford\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '১',\n 2: '২',\n 3: '৩',\n 4: '৪',\n 5: '৫',\n 6: '৬',\n 7: '৭',\n 8: '৮',\n 9: '৯',\n 0: '০',\n },\n numberMap = {\n '১': '1',\n '২': '2',\n '৩': '3',\n '৪': '4',\n '৫': '5',\n '৬': '6',\n '৭': '7',\n '৮': '8',\n '৯': '9',\n '০': '0',\n };\n\n var bnBd = moment.defineLocale('bn-bd', {\n months: 'জানুয়ারি_ফেব্রুয়ারি_মার্চ_এপ্রিল_মে_জুন_জুলাই_আগস্ট_সেপ্টেম্বর_অক্টোবর_নভেম্বর_ডিসেম্বর'.split(\n '_'\n ),\n monthsShort: 'জানু_ফেব্রু_মার্চ_এপ্রিল_মে_জুন_জুলাই_আগস্ট_সেপ্ট_অক্টো_নভে_ডিসে'.split(\n '_'\n ),\n weekdays: 'রবিবার_সোমবার_মঙ্গলবার_বুধবার_বৃহস্পতিবার_শুক্রবার_শনিবার'.split(\n '_'\n ),\n weekdaysShort: 'রবি_সোম_মঙ্গল_বুধ_বৃহস্পতি_শুক্র_শনি'.split('_'),\n weekdaysMin: 'রবি_সোম_মঙ্গল_বুধ_বৃহ_শুক্র_শনি'.split('_'),\n longDateFormat: {\n LT: 'A h:mm সময়',\n LTS: 'A h:mm:ss সময়',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm সময়',\n LLLL: 'dddd, D MMMM YYYY, A h:mm সময়',\n },\n calendar: {\n sameDay: '[আজ] LT',\n nextDay: '[আগামীকাল] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[গতকাল] LT',\n lastWeek: '[গত] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s পরে',\n past: '%s আগে',\n s: 'কয়েক সেকেন্ড',\n ss: '%d সেকেন্ড',\n m: 'এক মিনিট',\n mm: '%d মিনিট',\n h: 'এক ঘন্টা',\n hh: '%d ঘন্টা',\n d: 'এক দিন',\n dd: '%d দিন',\n M: 'এক মাস',\n MM: '%d মাস',\n y: 'এক বছর',\n yy: '%d বছর',\n },\n preparse: function (string) {\n return string.replace(/[১২৩৪৫৬৭৮৯০]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n\n meridiemParse: /রাত|ভোর|সকাল|দুপুর|বিকাল|সন্ধ্যা|রাত/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'রাত') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'ভোর') {\n return hour;\n } else if (meridiem === 'সকাল') {\n return hour;\n } else if (meridiem === 'দুপুর') {\n return hour >= 3 ? hour : hour + 12;\n } else if (meridiem === 'বিকাল') {\n return hour + 12;\n } else if (meridiem === 'সন্ধ্যা') {\n return hour + 12;\n }\n },\n\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'রাত';\n } else if (hour < 6) {\n return 'ভোর';\n } else if (hour < 12) {\n return 'সকাল';\n } else if (hour < 15) {\n return 'দুপুর';\n } else if (hour < 18) {\n return 'বিকাল';\n } else if (hour < 20) {\n return 'সন্ধ্যা';\n } else {\n return 'রাত';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return bnBd;\n\n})));\n","//! moment.js locale configuration\n//! locale : Bengali [bn]\n//! author : Kaushik Gandhi : https://github.com/kaushikgandhi\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '১',\n 2: '২',\n 3: '৩',\n 4: '৪',\n 5: '৫',\n 6: '৬',\n 7: '৭',\n 8: '৮',\n 9: '৯',\n 0: '০',\n },\n numberMap = {\n '১': '1',\n '২': '2',\n '৩': '3',\n '৪': '4',\n '৫': '5',\n '৬': '6',\n '৭': '7',\n '৮': '8',\n '৯': '9',\n '০': '0',\n };\n\n var bn = moment.defineLocale('bn', {\n months: 'জানুয়ারি_ফেব্রুয়ারি_মার্চ_এপ্রিল_মে_জুন_জুলাই_আগস্ট_সেপ্টেম্বর_অক্টোবর_নভেম্বর_ডিসেম্বর'.split(\n '_'\n ),\n monthsShort: 'জানু_ফেব্রু_মার্চ_এপ্রিল_মে_জুন_জুলাই_আগস্ট_সেপ্ট_অক্টো_নভে_ডিসে'.split(\n '_'\n ),\n weekdays: 'রবিবার_সোমবার_মঙ্গলবার_বুধবার_বৃহস্পতিবার_শুক্রবার_শনিবার'.split(\n '_'\n ),\n weekdaysShort: 'রবি_সোম_মঙ্গল_বুধ_বৃহস্পতি_শুক্র_শনি'.split('_'),\n weekdaysMin: 'রবি_সোম_মঙ্গল_বুধ_বৃহ_শুক্র_শনি'.split('_'),\n longDateFormat: {\n LT: 'A h:mm সময়',\n LTS: 'A h:mm:ss সময়',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm সময়',\n LLLL: 'dddd, D MMMM YYYY, A h:mm সময়',\n },\n calendar: {\n sameDay: '[আজ] LT',\n nextDay: '[আগামীকাল] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[গতকাল] LT',\n lastWeek: '[গত] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s পরে',\n past: '%s আগে',\n s: 'কয়েক সেকেন্ড',\n ss: '%d সেকেন্ড',\n m: 'এক মিনিট',\n mm: '%d মিনিট',\n h: 'এক ঘন্টা',\n hh: '%d ঘন্টা',\n d: 'এক দিন',\n dd: '%d দিন',\n M: 'এক মাস',\n MM: '%d মাস',\n y: 'এক বছর',\n yy: '%d বছর',\n },\n preparse: function (string) {\n return string.replace(/[১২৩৪৫৬৭৮৯০]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n meridiemParse: /রাত|সকাল|দুপুর|বিকাল|রাত/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (\n (meridiem === 'রাত' && hour >= 4) ||\n (meridiem === 'দুপুর' && hour < 5) ||\n meridiem === 'বিকাল'\n ) {\n return hour + 12;\n } else {\n return hour;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'রাত';\n } else if (hour < 10) {\n return 'সকাল';\n } else if (hour < 17) {\n return 'দুপুর';\n } else if (hour < 20) {\n return 'বিকাল';\n } else {\n return 'রাত';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return bn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Tibetan [bo]\n//! author : Thupten N. Chakrishar : https://github.com/vajradog\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '༡',\n 2: '༢',\n 3: '༣',\n 4: '༤',\n 5: '༥',\n 6: '༦',\n 7: '༧',\n 8: '༨',\n 9: '༩',\n 0: '༠',\n },\n numberMap = {\n '༡': '1',\n '༢': '2',\n '༣': '3',\n '༤': '4',\n '༥': '5',\n '༦': '6',\n '༧': '7',\n '༨': '8',\n '༩': '9',\n '༠': '0',\n };\n\n var bo = moment.defineLocale('bo', {\n months: 'ཟླ་བ་དང་པོ_ཟླ་བ་གཉིས་པ_ཟླ་བ་གསུམ་པ_ཟླ་བ་བཞི་པ_ཟླ་བ་ལྔ་པ_ཟླ་བ་དྲུག་པ_ཟླ་བ་བདུན་པ_ཟླ་བ་བརྒྱད་པ_ཟླ་བ་དགུ་པ_ཟླ་བ་བཅུ་པ_ཟླ་བ་བཅུ་གཅིག་པ_ཟླ་བ་བཅུ་གཉིས་པ'.split(\n '_'\n ),\n monthsShort: 'ཟླ་1_ཟླ་2_ཟླ་3_ཟླ་4_ཟླ་5_ཟླ་6_ཟླ་7_ཟླ་8_ཟླ་9_ཟླ་10_ཟླ་11_ཟླ་12'.split(\n '_'\n ),\n monthsShortRegex: /^(ཟླ་\\d{1,2})/,\n monthsParseExact: true,\n weekdays: 'གཟའ་ཉི་མ་_གཟའ་ཟླ་བ་_གཟའ་མིག་དམར་_གཟའ་ལྷག་པ་_གཟའ་ཕུར་བུ_གཟའ་པ་སངས་_གཟའ་སྤེན་པ་'.split(\n '_'\n ),\n weekdaysShort: 'ཉི་མ་_ཟླ་བ་_མིག་དམར་_ལྷག་པ་_ཕུར་བུ_པ་སངས་_སྤེན་པ་'.split(\n '_'\n ),\n weekdaysMin: 'ཉི_ཟླ_མིག_ལྷག_ཕུར_སངས_སྤེན'.split('_'),\n longDateFormat: {\n LT: 'A h:mm',\n LTS: 'A h:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm',\n LLLL: 'dddd, D MMMM YYYY, A h:mm',\n },\n calendar: {\n sameDay: '[དི་རིང] LT',\n nextDay: '[སང་ཉིན] LT',\n nextWeek: '[བདུན་ཕྲག་རྗེས་མ], LT',\n lastDay: '[ཁ་སང] LT',\n lastWeek: '[བདུན་ཕྲག་མཐའ་མ] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s ལ་',\n past: '%s སྔན་ལ',\n s: 'ལམ་སང',\n ss: '%d སྐར་ཆ།',\n m: 'སྐར་མ་གཅིག',\n mm: '%d སྐར་མ',\n h: 'ཆུ་ཚོད་གཅིག',\n hh: '%d ཆུ་ཚོད',\n d: 'ཉིན་གཅིག',\n dd: '%d ཉིན་',\n M: 'ཟླ་བ་གཅིག',\n MM: '%d ཟླ་བ',\n y: 'ལོ་གཅིག',\n yy: '%d ལོ',\n },\n preparse: function (string) {\n return string.replace(/[༡༢༣༤༥༦༧༨༩༠]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n meridiemParse: /མཚན་མོ|ཞོགས་ཀས|ཉིན་གུང|དགོང་དག|མཚན་མོ/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (\n (meridiem === 'མཚན་མོ' && hour >= 4) ||\n (meridiem === 'ཉིན་གུང' && hour < 5) ||\n meridiem === 'དགོང་དག'\n ) {\n return hour + 12;\n } else {\n return hour;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'མཚན་མོ';\n } else if (hour < 10) {\n return 'ཞོགས་ཀས';\n } else if (hour < 17) {\n return 'ཉིན་གུང';\n } else if (hour < 20) {\n return 'དགོང་དག';\n } else {\n return 'མཚན་མོ';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return bo;\n\n})));\n","//! moment.js locale configuration\n//! locale : Breton [br]\n//! author : Jean-Baptiste Le Duigou : https://github.com/jbleduigou\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function relativeTimeWithMutation(number, withoutSuffix, key) {\n var format = {\n mm: 'munutenn',\n MM: 'miz',\n dd: 'devezh',\n };\n return number + ' ' + mutation(format[key], number);\n }\n function specialMutationForYears(number) {\n switch (lastNumber(number)) {\n case 1:\n case 3:\n case 4:\n case 5:\n case 9:\n return number + ' bloaz';\n default:\n return number + ' vloaz';\n }\n }\n function lastNumber(number) {\n if (number > 9) {\n return lastNumber(number % 10);\n }\n return number;\n }\n function mutation(text, number) {\n if (number === 2) {\n return softMutation(text);\n }\n return text;\n }\n function softMutation(text) {\n var mutationTable = {\n m: 'v',\n b: 'v',\n d: 'z',\n };\n if (mutationTable[text.charAt(0)] === undefined) {\n return text;\n }\n return mutationTable[text.charAt(0)] + text.substring(1);\n }\n\n var monthsParse = [\n /^gen/i,\n /^c[ʼ\\']hwe/i,\n /^meu/i,\n /^ebr/i,\n /^mae/i,\n /^(mez|eve)/i,\n /^gou/i,\n /^eos/i,\n /^gwe/i,\n /^her/i,\n /^du/i,\n /^ker/i,\n ],\n monthsRegex = /^(genver|c[ʼ\\']hwevrer|meurzh|ebrel|mae|mezheven|gouere|eost|gwengolo|here|du|kerzu|gen|c[ʼ\\']hwe|meu|ebr|mae|eve|gou|eos|gwe|her|du|ker)/i,\n monthsStrictRegex = /^(genver|c[ʼ\\']hwevrer|meurzh|ebrel|mae|mezheven|gouere|eost|gwengolo|here|du|kerzu)/i,\n monthsShortStrictRegex = /^(gen|c[ʼ\\']hwe|meu|ebr|mae|eve|gou|eos|gwe|her|du|ker)/i,\n fullWeekdaysParse = [\n /^sul/i,\n /^lun/i,\n /^meurzh/i,\n /^merc[ʼ\\']her/i,\n /^yaou/i,\n /^gwener/i,\n /^sadorn/i,\n ],\n shortWeekdaysParse = [\n /^Sul/i,\n /^Lun/i,\n /^Meu/i,\n /^Mer/i,\n /^Yao/i,\n /^Gwe/i,\n /^Sad/i,\n ],\n minWeekdaysParse = [\n /^Su/i,\n /^Lu/i,\n /^Me([^r]|$)/i,\n /^Mer/i,\n /^Ya/i,\n /^Gw/i,\n /^Sa/i,\n ];\n\n var br = moment.defineLocale('br', {\n months: 'Genver_Cʼhwevrer_Meurzh_Ebrel_Mae_Mezheven_Gouere_Eost_Gwengolo_Here_Du_Kerzu'.split(\n '_'\n ),\n monthsShort: 'Gen_Cʼhwe_Meu_Ebr_Mae_Eve_Gou_Eos_Gwe_Her_Du_Ker'.split('_'),\n weekdays: 'Sul_Lun_Meurzh_Mercʼher_Yaou_Gwener_Sadorn'.split('_'),\n weekdaysShort: 'Sul_Lun_Meu_Mer_Yao_Gwe_Sad'.split('_'),\n weekdaysMin: 'Su_Lu_Me_Mer_Ya_Gw_Sa'.split('_'),\n weekdaysParse: minWeekdaysParse,\n fullWeekdaysParse: fullWeekdaysParse,\n shortWeekdaysParse: shortWeekdaysParse,\n minWeekdaysParse: minWeekdaysParse,\n\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: monthsStrictRegex,\n monthsShortStrictRegex: monthsShortStrictRegex,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D [a viz] MMMM YYYY',\n LLL: 'D [a viz] MMMM YYYY HH:mm',\n LLLL: 'dddd, D [a viz] MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Hiziv da] LT',\n nextDay: '[Warcʼhoazh da] LT',\n nextWeek: 'dddd [da] LT',\n lastDay: '[Decʼh da] LT',\n lastWeek: 'dddd [paset da] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'a-benn %s',\n past: '%s ʼzo',\n s: 'un nebeud segondennoù',\n ss: '%d eilenn',\n m: 'ur vunutenn',\n mm: relativeTimeWithMutation,\n h: 'un eur',\n hh: '%d eur',\n d: 'un devezh',\n dd: relativeTimeWithMutation,\n M: 'ur miz',\n MM: relativeTimeWithMutation,\n y: 'ur bloaz',\n yy: specialMutationForYears,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(añ|vet)/,\n ordinal: function (number) {\n var output = number === 1 ? 'añ' : 'vet';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n meridiemParse: /a.m.|g.m./, // goude merenn | a-raok merenn\n isPM: function (token) {\n return token === 'g.m.';\n },\n meridiem: function (hour, minute, isLower) {\n return hour < 12 ? 'a.m.' : 'g.m.';\n },\n });\n\n return br;\n\n})));\n","//! moment.js locale configuration\n//! locale : Bosnian [bs]\n//! author : Nedim Cholich : https://github.com/frontyard\n//! based on (hr) translation by Bojan Marković\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function translate(number, withoutSuffix, key) {\n var result = number + ' ';\n switch (key) {\n case 'ss':\n if (number === 1) {\n result += 'sekunda';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'sekunde';\n } else {\n result += 'sekundi';\n }\n return result;\n case 'm':\n return withoutSuffix ? 'jedna minuta' : 'jedne minute';\n case 'mm':\n if (number === 1) {\n result += 'minuta';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'minute';\n } else {\n result += 'minuta';\n }\n return result;\n case 'h':\n return withoutSuffix ? 'jedan sat' : 'jednog sata';\n case 'hh':\n if (number === 1) {\n result += 'sat';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'sata';\n } else {\n result += 'sati';\n }\n return result;\n case 'dd':\n if (number === 1) {\n result += 'dan';\n } else {\n result += 'dana';\n }\n return result;\n case 'MM':\n if (number === 1) {\n result += 'mjesec';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'mjeseca';\n } else {\n result += 'mjeseci';\n }\n return result;\n case 'yy':\n if (number === 1) {\n result += 'godina';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'godine';\n } else {\n result += 'godina';\n }\n return result;\n }\n }\n\n var bs = moment.defineLocale('bs', {\n months: 'januar_februar_mart_april_maj_juni_juli_august_septembar_oktobar_novembar_decembar'.split(\n '_'\n ),\n monthsShort: 'jan._feb._mar._apr._maj._jun._jul._aug._sep._okt._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'nedjelja_ponedjeljak_utorak_srijeda_četvrtak_petak_subota'.split(\n '_'\n ),\n weekdaysShort: 'ned._pon._uto._sri._čet._pet._sub.'.split('_'),\n weekdaysMin: 'ne_po_ut_sr_če_pe_su'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY H:mm',\n LLLL: 'dddd, D. MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[danas u] LT',\n nextDay: '[sutra u] LT',\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[u] [nedjelju] [u] LT';\n case 3:\n return '[u] [srijedu] [u] LT';\n case 6:\n return '[u] [subotu] [u] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[u] dddd [u] LT';\n }\n },\n lastDay: '[jučer u] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n case 3:\n return '[prošlu] dddd [u] LT';\n case 6:\n return '[prošle] [subote] [u] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[prošli] dddd [u] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'za %s',\n past: 'prije %s',\n s: 'par sekundi',\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: 'dan',\n dd: translate,\n M: 'mjesec',\n MM: translate,\n y: 'godinu',\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return bs;\n\n})));\n","//! moment.js locale configuration\n//! locale : Catalan [ca]\n//! author : Juan G. Hurtado : https://github.com/juanghurtado\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ca = moment.defineLocale('ca', {\n months: {\n standalone: 'gener_febrer_març_abril_maig_juny_juliol_agost_setembre_octubre_novembre_desembre'.split(\n '_'\n ),\n format: \"de gener_de febrer_de març_d'abril_de maig_de juny_de juliol_d'agost_de setembre_d'octubre_de novembre_de desembre\".split(\n '_'\n ),\n isFormat: /D[oD]?(\\s)+MMMM/,\n },\n monthsShort: 'gen._febr._març_abr._maig_juny_jul._ag._set._oct._nov._des.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'diumenge_dilluns_dimarts_dimecres_dijous_divendres_dissabte'.split(\n '_'\n ),\n weekdaysShort: 'dg._dl._dt._dc._dj._dv._ds.'.split('_'),\n weekdaysMin: 'dg_dl_dt_dc_dj_dv_ds'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM [de] YYYY',\n ll: 'D MMM YYYY',\n LLL: 'D MMMM [de] YYYY [a les] H:mm',\n lll: 'D MMM YYYY, H:mm',\n LLLL: 'dddd D MMMM [de] YYYY [a les] H:mm',\n llll: 'ddd D MMM YYYY, H:mm',\n },\n calendar: {\n sameDay: function () {\n return '[avui a ' + (this.hours() !== 1 ? 'les' : 'la') + '] LT';\n },\n nextDay: function () {\n return '[demà a ' + (this.hours() !== 1 ? 'les' : 'la') + '] LT';\n },\n nextWeek: function () {\n return 'dddd [a ' + (this.hours() !== 1 ? 'les' : 'la') + '] LT';\n },\n lastDay: function () {\n return '[ahir a ' + (this.hours() !== 1 ? 'les' : 'la') + '] LT';\n },\n lastWeek: function () {\n return (\n '[el] dddd [passat a ' +\n (this.hours() !== 1 ? 'les' : 'la') +\n '] LT'\n );\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: \"d'aquí %s\",\n past: 'fa %s',\n s: 'uns segons',\n ss: '%d segons',\n m: 'un minut',\n mm: '%d minuts',\n h: 'una hora',\n hh: '%d hores',\n d: 'un dia',\n dd: '%d dies',\n M: 'un mes',\n MM: '%d mesos',\n y: 'un any',\n yy: '%d anys',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(r|n|t|è|a)/,\n ordinal: function (number, period) {\n var output =\n number === 1\n ? 'r'\n : number === 2\n ? 'n'\n : number === 3\n ? 'r'\n : number === 4\n ? 't'\n : 'è';\n if (period === 'w' || period === 'W') {\n output = 'a';\n }\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return ca;\n\n})));\n","//! moment.js locale configuration\n//! locale : Czech [cs]\n//! author : petrbela : https://github.com/petrbela\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var months = 'leden_únor_březen_duben_květen_červen_červenec_srpen_září_říjen_listopad_prosinec'.split(\n '_'\n ),\n monthsShort = 'led_úno_bře_dub_kvě_čvn_čvc_srp_zář_říj_lis_pro'.split('_'),\n monthsParse = [\n /^led/i,\n /^úno/i,\n /^bře/i,\n /^dub/i,\n /^kvě/i,\n /^(čvn|červen$|června)/i,\n /^(čvc|červenec|července)/i,\n /^srp/i,\n /^zář/i,\n /^říj/i,\n /^lis/i,\n /^pro/i,\n ],\n // NOTE: 'červen' is substring of 'červenec'; therefore 'červenec' must precede 'červen' in the regex to be fully matched.\n // Otherwise parser matches '1. červenec' as '1. červen' + 'ec'.\n monthsRegex = /^(leden|únor|březen|duben|květen|červenec|července|červen|června|srpen|září|říjen|listopad|prosinec|led|úno|bře|dub|kvě|čvn|čvc|srp|zář|říj|lis|pro)/i;\n\n function plural(n) {\n return n > 1 && n < 5 && ~~(n / 10) !== 1;\n }\n function translate(number, withoutSuffix, key, isFuture) {\n var result = number + ' ';\n switch (key) {\n case 's': // a few seconds / in a few seconds / a few seconds ago\n return withoutSuffix || isFuture ? 'pár sekund' : 'pár sekundami';\n case 'ss': // 9 seconds / in 9 seconds / 9 seconds ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'sekundy' : 'sekund');\n } else {\n return result + 'sekundami';\n }\n case 'm': // a minute / in a minute / a minute ago\n return withoutSuffix ? 'minuta' : isFuture ? 'minutu' : 'minutou';\n case 'mm': // 9 minutes / in 9 minutes / 9 minutes ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'minuty' : 'minut');\n } else {\n return result + 'minutami';\n }\n case 'h': // an hour / in an hour / an hour ago\n return withoutSuffix ? 'hodina' : isFuture ? 'hodinu' : 'hodinou';\n case 'hh': // 9 hours / in 9 hours / 9 hours ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'hodiny' : 'hodin');\n } else {\n return result + 'hodinami';\n }\n case 'd': // a day / in a day / a day ago\n return withoutSuffix || isFuture ? 'den' : 'dnem';\n case 'dd': // 9 days / in 9 days / 9 days ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'dny' : 'dní');\n } else {\n return result + 'dny';\n }\n case 'M': // a month / in a month / a month ago\n return withoutSuffix || isFuture ? 'měsíc' : 'měsícem';\n case 'MM': // 9 months / in 9 months / 9 months ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'měsíce' : 'měsíců');\n } else {\n return result + 'měsíci';\n }\n case 'y': // a year / in a year / a year ago\n return withoutSuffix || isFuture ? 'rok' : 'rokem';\n case 'yy': // 9 years / in 9 years / 9 years ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'roky' : 'let');\n } else {\n return result + 'lety';\n }\n }\n }\n\n var cs = moment.defineLocale('cs', {\n months: months,\n monthsShort: monthsShort,\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n // NOTE: 'červen' is substring of 'červenec'; therefore 'červenec' must precede 'červen' in the regex to be fully matched.\n // Otherwise parser matches '1. červenec' as '1. červen' + 'ec'.\n monthsStrictRegex: /^(leden|ledna|února|únor|březen|března|duben|dubna|květen|května|červenec|července|červen|června|srpen|srpna|září|říjen|října|listopadu|listopad|prosinec|prosince)/i,\n monthsShortStrictRegex: /^(led|úno|bře|dub|kvě|čvn|čvc|srp|zář|říj|lis|pro)/i,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays: 'neděle_pondělí_úterý_středa_čtvrtek_pátek_sobota'.split('_'),\n weekdaysShort: 'ne_po_út_st_čt_pá_so'.split('_'),\n weekdaysMin: 'ne_po_út_st_čt_pá_so'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY H:mm',\n LLLL: 'dddd D. MMMM YYYY H:mm',\n l: 'D. M. YYYY',\n },\n calendar: {\n sameDay: '[dnes v] LT',\n nextDay: '[zítra v] LT',\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[v neděli v] LT';\n case 1:\n case 2:\n return '[v] dddd [v] LT';\n case 3:\n return '[ve středu v] LT';\n case 4:\n return '[ve čtvrtek v] LT';\n case 5:\n return '[v pátek v] LT';\n case 6:\n return '[v sobotu v] LT';\n }\n },\n lastDay: '[včera v] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[minulou neděli v] LT';\n case 1:\n case 2:\n return '[minulé] dddd [v] LT';\n case 3:\n return '[minulou středu v] LT';\n case 4:\n case 5:\n return '[minulý] dddd [v] LT';\n case 6:\n return '[minulou sobotu v] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'za %s',\n past: 'před %s',\n s: translate,\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: translate,\n dd: translate,\n M: translate,\n MM: translate,\n y: translate,\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return cs;\n\n})));\n","//! moment.js locale configuration\n//! locale : Chuvash [cv]\n//! author : Anatoly Mironov : https://github.com/mirontoli\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var cv = moment.defineLocale('cv', {\n months: 'кӑрлач_нарӑс_пуш_ака_май_ҫӗртме_утӑ_ҫурла_авӑн_юпа_чӳк_раштав'.split(\n '_'\n ),\n monthsShort: 'кӑр_нар_пуш_ака_май_ҫӗр_утӑ_ҫур_авн_юпа_чӳк_раш'.split('_'),\n weekdays: 'вырсарникун_тунтикун_ытларикун_юнкун_кӗҫнерникун_эрнекун_шӑматкун'.split(\n '_'\n ),\n weekdaysShort: 'выр_тун_ытл_юн_кӗҫ_эрн_шӑм'.split('_'),\n weekdaysMin: 'вр_тн_ыт_юн_кҫ_эр_шм'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD-MM-YYYY',\n LL: 'YYYY [ҫулхи] MMMM [уйӑхӗн] D[-мӗшӗ]',\n LLL: 'YYYY [ҫулхи] MMMM [уйӑхӗн] D[-мӗшӗ], HH:mm',\n LLLL: 'dddd, YYYY [ҫулхи] MMMM [уйӑхӗн] D[-мӗшӗ], HH:mm',\n },\n calendar: {\n sameDay: '[Паян] LT [сехетре]',\n nextDay: '[Ыран] LT [сехетре]',\n lastDay: '[Ӗнер] LT [сехетре]',\n nextWeek: '[Ҫитес] dddd LT [сехетре]',\n lastWeek: '[Иртнӗ] dddd LT [сехетре]',\n sameElse: 'L',\n },\n relativeTime: {\n future: function (output) {\n var affix = /сехет$/i.exec(output)\n ? 'рен'\n : /ҫул$/i.exec(output)\n ? 'тан'\n : 'ран';\n return output + affix;\n },\n past: '%s каялла',\n s: 'пӗр-ик ҫеккунт',\n ss: '%d ҫеккунт',\n m: 'пӗр минут',\n mm: '%d минут',\n h: 'пӗр сехет',\n hh: '%d сехет',\n d: 'пӗр кун',\n dd: '%d кун',\n M: 'пӗр уйӑх',\n MM: '%d уйӑх',\n y: 'пӗр ҫул',\n yy: '%d ҫул',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-мӗш/,\n ordinal: '%d-мӗш',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return cv;\n\n})));\n","//! moment.js locale configuration\n//! locale : Welsh [cy]\n//! author : Robert Allen : https://github.com/robgallen\n//! author : https://github.com/ryangreaves\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var cy = moment.defineLocale('cy', {\n months: 'Ionawr_Chwefror_Mawrth_Ebrill_Mai_Mehefin_Gorffennaf_Awst_Medi_Hydref_Tachwedd_Rhagfyr'.split(\n '_'\n ),\n monthsShort: 'Ion_Chwe_Maw_Ebr_Mai_Meh_Gor_Aws_Med_Hyd_Tach_Rhag'.split(\n '_'\n ),\n weekdays: 'Dydd Sul_Dydd Llun_Dydd Mawrth_Dydd Mercher_Dydd Iau_Dydd Gwener_Dydd Sadwrn'.split(\n '_'\n ),\n weekdaysShort: 'Sul_Llun_Maw_Mer_Iau_Gwe_Sad'.split('_'),\n weekdaysMin: 'Su_Ll_Ma_Me_Ia_Gw_Sa'.split('_'),\n weekdaysParseExact: true,\n // time formats are the same as en-gb\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Heddiw am] LT',\n nextDay: '[Yfory am] LT',\n nextWeek: 'dddd [am] LT',\n lastDay: '[Ddoe am] LT',\n lastWeek: 'dddd [diwethaf am] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'mewn %s',\n past: '%s yn ôl',\n s: 'ychydig eiliadau',\n ss: '%d eiliad',\n m: 'munud',\n mm: '%d munud',\n h: 'awr',\n hh: '%d awr',\n d: 'diwrnod',\n dd: '%d diwrnod',\n M: 'mis',\n MM: '%d mis',\n y: 'blwyddyn',\n yy: '%d flynedd',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(fed|ain|af|il|ydd|ed|eg)/,\n // traditional ordinal numbers above 31 are not commonly used in colloquial Welsh\n ordinal: function (number) {\n var b = number,\n output = '',\n lookup = [\n '',\n 'af',\n 'il',\n 'ydd',\n 'ydd',\n 'ed',\n 'ed',\n 'ed',\n 'fed',\n 'fed',\n 'fed', // 1af to 10fed\n 'eg',\n 'fed',\n 'eg',\n 'eg',\n 'fed',\n 'eg',\n 'eg',\n 'fed',\n 'eg',\n 'fed', // 11eg to 20fed\n ];\n if (b > 20) {\n if (b === 40 || b === 50 || b === 60 || b === 80 || b === 100) {\n output = 'fed'; // not 30ain, 70ain or 90ain\n } else {\n output = 'ain';\n }\n } else if (b > 0) {\n output = lookup[b];\n }\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return cy;\n\n})));\n","//! moment.js locale configuration\n//! locale : Danish [da]\n//! author : Ulrik Nielsen : https://github.com/mrbase\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var da = moment.defineLocale('da', {\n months: 'januar_februar_marts_april_maj_juni_juli_august_september_oktober_november_december'.split(\n '_'\n ),\n monthsShort: 'jan_feb_mar_apr_maj_jun_jul_aug_sep_okt_nov_dec'.split('_'),\n weekdays: 'søndag_mandag_tirsdag_onsdag_torsdag_fredag_lørdag'.split('_'),\n weekdaysShort: 'søn_man_tir_ons_tor_fre_lør'.split('_'),\n weekdaysMin: 'sø_ma_ti_on_to_fr_lø'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY HH:mm',\n LLLL: 'dddd [d.] D. MMMM YYYY [kl.] HH:mm',\n },\n calendar: {\n sameDay: '[i dag kl.] LT',\n nextDay: '[i morgen kl.] LT',\n nextWeek: 'på dddd [kl.] LT',\n lastDay: '[i går kl.] LT',\n lastWeek: '[i] dddd[s kl.] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'om %s',\n past: '%s siden',\n s: 'få sekunder',\n ss: '%d sekunder',\n m: 'et minut',\n mm: '%d minutter',\n h: 'en time',\n hh: '%d timer',\n d: 'en dag',\n dd: '%d dage',\n M: 'en måned',\n MM: '%d måneder',\n y: 'et år',\n yy: '%d år',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return da;\n\n})));\n","//! moment.js locale configuration\n//! locale : German (Austria) [de-at]\n//! author : lluchs : https://github.com/lluchs\n//! author: Menelion Elensúle: https://github.com/Oire\n//! author : Martin Groller : https://github.com/MadMG\n//! author : Mikolaj Dadela : https://github.com/mik01aj\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n m: ['eine Minute', 'einer Minute'],\n h: ['eine Stunde', 'einer Stunde'],\n d: ['ein Tag', 'einem Tag'],\n dd: [number + ' Tage', number + ' Tagen'],\n w: ['eine Woche', 'einer Woche'],\n M: ['ein Monat', 'einem Monat'],\n MM: [number + ' Monate', number + ' Monaten'],\n y: ['ein Jahr', 'einem Jahr'],\n yy: [number + ' Jahre', number + ' Jahren'],\n };\n return withoutSuffix ? format[key][0] : format[key][1];\n }\n\n var deAt = moment.defineLocale('de-at', {\n months: 'Jänner_Februar_März_April_Mai_Juni_Juli_August_September_Oktober_November_Dezember'.split(\n '_'\n ),\n monthsShort: 'Jän._Feb._März_Apr._Mai_Juni_Juli_Aug._Sep._Okt._Nov._Dez.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'Sonntag_Montag_Dienstag_Mittwoch_Donnerstag_Freitag_Samstag'.split(\n '_'\n ),\n weekdaysShort: 'So._Mo._Di._Mi._Do._Fr._Sa.'.split('_'),\n weekdaysMin: 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY HH:mm',\n LLLL: 'dddd, D. MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[heute um] LT [Uhr]',\n sameElse: 'L',\n nextDay: '[morgen um] LT [Uhr]',\n nextWeek: 'dddd [um] LT [Uhr]',\n lastDay: '[gestern um] LT [Uhr]',\n lastWeek: '[letzten] dddd [um] LT [Uhr]',\n },\n relativeTime: {\n future: 'in %s',\n past: 'vor %s',\n s: 'ein paar Sekunden',\n ss: '%d Sekunden',\n m: processRelativeTime,\n mm: '%d Minuten',\n h: processRelativeTime,\n hh: '%d Stunden',\n d: processRelativeTime,\n dd: processRelativeTime,\n w: processRelativeTime,\n ww: '%d Wochen',\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return deAt;\n\n})));\n","//! moment.js locale configuration\n//! locale : German (Switzerland) [de-ch]\n//! author : sschueller : https://github.com/sschueller\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n m: ['eine Minute', 'einer Minute'],\n h: ['eine Stunde', 'einer Stunde'],\n d: ['ein Tag', 'einem Tag'],\n dd: [number + ' Tage', number + ' Tagen'],\n w: ['eine Woche', 'einer Woche'],\n M: ['ein Monat', 'einem Monat'],\n MM: [number + ' Monate', number + ' Monaten'],\n y: ['ein Jahr', 'einem Jahr'],\n yy: [number + ' Jahre', number + ' Jahren'],\n };\n return withoutSuffix ? format[key][0] : format[key][1];\n }\n\n var deCh = moment.defineLocale('de-ch', {\n months: 'Januar_Februar_März_April_Mai_Juni_Juli_August_September_Oktober_November_Dezember'.split(\n '_'\n ),\n monthsShort: 'Jan._Feb._März_Apr._Mai_Juni_Juli_Aug._Sep._Okt._Nov._Dez.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'Sonntag_Montag_Dienstag_Mittwoch_Donnerstag_Freitag_Samstag'.split(\n '_'\n ),\n weekdaysShort: 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysMin: 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY HH:mm',\n LLLL: 'dddd, D. MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[heute um] LT [Uhr]',\n sameElse: 'L',\n nextDay: '[morgen um] LT [Uhr]',\n nextWeek: 'dddd [um] LT [Uhr]',\n lastDay: '[gestern um] LT [Uhr]',\n lastWeek: '[letzten] dddd [um] LT [Uhr]',\n },\n relativeTime: {\n future: 'in %s',\n past: 'vor %s',\n s: 'ein paar Sekunden',\n ss: '%d Sekunden',\n m: processRelativeTime,\n mm: '%d Minuten',\n h: processRelativeTime,\n hh: '%d Stunden',\n d: processRelativeTime,\n dd: processRelativeTime,\n w: processRelativeTime,\n ww: '%d Wochen',\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return deCh;\n\n})));\n","//! moment.js locale configuration\n//! locale : German [de]\n//! author : lluchs : https://github.com/lluchs\n//! author: Menelion Elensúle: https://github.com/Oire\n//! author : Mikolaj Dadela : https://github.com/mik01aj\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n m: ['eine Minute', 'einer Minute'],\n h: ['eine Stunde', 'einer Stunde'],\n d: ['ein Tag', 'einem Tag'],\n dd: [number + ' Tage', number + ' Tagen'],\n w: ['eine Woche', 'einer Woche'],\n M: ['ein Monat', 'einem Monat'],\n MM: [number + ' Monate', number + ' Monaten'],\n y: ['ein Jahr', 'einem Jahr'],\n yy: [number + ' Jahre', number + ' Jahren'],\n };\n return withoutSuffix ? format[key][0] : format[key][1];\n }\n\n var de = moment.defineLocale('de', {\n months: 'Januar_Februar_März_April_Mai_Juni_Juli_August_September_Oktober_November_Dezember'.split(\n '_'\n ),\n monthsShort: 'Jan._Feb._März_Apr._Mai_Juni_Juli_Aug._Sep._Okt._Nov._Dez.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'Sonntag_Montag_Dienstag_Mittwoch_Donnerstag_Freitag_Samstag'.split(\n '_'\n ),\n weekdaysShort: 'So._Mo._Di._Mi._Do._Fr._Sa.'.split('_'),\n weekdaysMin: 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY HH:mm',\n LLLL: 'dddd, D. MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[heute um] LT [Uhr]',\n sameElse: 'L',\n nextDay: '[morgen um] LT [Uhr]',\n nextWeek: 'dddd [um] LT [Uhr]',\n lastDay: '[gestern um] LT [Uhr]',\n lastWeek: '[letzten] dddd [um] LT [Uhr]',\n },\n relativeTime: {\n future: 'in %s',\n past: 'vor %s',\n s: 'ein paar Sekunden',\n ss: '%d Sekunden',\n m: processRelativeTime,\n mm: '%d Minuten',\n h: processRelativeTime,\n hh: '%d Stunden',\n d: processRelativeTime,\n dd: processRelativeTime,\n w: processRelativeTime,\n ww: '%d Wochen',\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return de;\n\n})));\n","//! moment.js locale configuration\n//! locale : Maldivian [dv]\n//! author : Jawish Hameed : https://github.com/jawish\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var months = [\n 'ޖެނުއަރީ',\n 'ފެބްރުއަރީ',\n 'މާރިޗު',\n 'އޭޕްރީލު',\n 'މޭ',\n 'ޖޫން',\n 'ޖުލައި',\n 'އޯގަސްޓު',\n 'ސެޕްޓެމްބަރު',\n 'އޮކްޓޯބަރު',\n 'ނޮވެމްބަރު',\n 'ޑިސެމްބަރު',\n ],\n weekdays = [\n 'އާދިއްތަ',\n 'ހޯމަ',\n 'އަންގާރަ',\n 'ބުދަ',\n 'ބުރާސްފަތި',\n 'ހުކުރު',\n 'ހޮނިހިރު',\n ];\n\n var dv = moment.defineLocale('dv', {\n months: months,\n monthsShort: months,\n weekdays: weekdays,\n weekdaysShort: weekdays,\n weekdaysMin: 'އާދި_ހޯމަ_އަން_ބުދަ_ބުރާ_ހުކު_ހޮނި'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'D/M/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n meridiemParse: /މކ|މފ/,\n isPM: function (input) {\n return 'މފ' === input;\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'މކ';\n } else {\n return 'މފ';\n }\n },\n calendar: {\n sameDay: '[މިއަދު] LT',\n nextDay: '[މާދަމާ] LT',\n nextWeek: 'dddd LT',\n lastDay: '[އިއްޔެ] LT',\n lastWeek: '[ފާއިތުވި] dddd LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'ތެރޭގައި %s',\n past: 'ކުރިން %s',\n s: 'ސިކުންތުކޮޅެއް',\n ss: 'd% ސިކުންތު',\n m: 'މިނިޓެއް',\n mm: 'މިނިޓު %d',\n h: 'ގަޑިއިރެއް',\n hh: 'ގަޑިއިރު %d',\n d: 'ދުވަހެއް',\n dd: 'ދުވަސް %d',\n M: 'މަހެއް',\n MM: 'މަސް %d',\n y: 'އަހަރެއް',\n yy: 'އަހަރު %d',\n },\n preparse: function (string) {\n return string.replace(/،/g, ',');\n },\n postformat: function (string) {\n return string.replace(/,/g, '،');\n },\n week: {\n dow: 7, // Sunday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return dv;\n\n})));\n","//! moment.js locale configuration\n//! locale : Greek [el]\n//! author : Aggelos Karalias : https://github.com/mehiel\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function isFunction(input) {\n return (\n (typeof Function !== 'undefined' && input instanceof Function) ||\n Object.prototype.toString.call(input) === '[object Function]'\n );\n }\n\n var el = moment.defineLocale('el', {\n monthsNominativeEl: 'Ιανουάριος_Φεβρουάριος_Μάρτιος_Απρίλιος_Μάιος_Ιούνιος_Ιούλιος_Αύγουστος_Σεπτέμβριος_Οκτώβριος_Νοέμβριος_Δεκέμβριος'.split(\n '_'\n ),\n monthsGenitiveEl: 'Ιανουαρίου_Φεβρουαρίου_Μαρτίου_Απριλίου_Μαΐου_Ιουνίου_Ιουλίου_Αυγούστου_Σεπτεμβρίου_Οκτωβρίου_Νοεμβρίου_Δεκεμβρίου'.split(\n '_'\n ),\n months: function (momentToFormat, format) {\n if (!momentToFormat) {\n return this._monthsNominativeEl;\n } else if (\n typeof format === 'string' &&\n /D/.test(format.substring(0, format.indexOf('MMMM')))\n ) {\n // if there is a day number before 'MMMM'\n return this._monthsGenitiveEl[momentToFormat.month()];\n } else {\n return this._monthsNominativeEl[momentToFormat.month()];\n }\n },\n monthsShort: 'Ιαν_Φεβ_Μαρ_Απρ_Μαϊ_Ιουν_Ιουλ_Αυγ_Σεπ_Οκτ_Νοε_Δεκ'.split('_'),\n weekdays: 'Κυριακή_Δευτέρα_Τρίτη_Τετάρτη_Πέμπτη_Παρασκευή_Σάββατο'.split(\n '_'\n ),\n weekdaysShort: 'Κυρ_Δευ_Τρι_Τετ_Πεμ_Παρ_Σαβ'.split('_'),\n weekdaysMin: 'Κυ_Δε_Τρ_Τε_Πε_Πα_Σα'.split('_'),\n meridiem: function (hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'μμ' : 'ΜΜ';\n } else {\n return isLower ? 'πμ' : 'ΠΜ';\n }\n },\n isPM: function (input) {\n return (input + '').toLowerCase()[0] === 'μ';\n },\n meridiemParse: /[ΠΜ]\\.?Μ?\\.?/i,\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY h:mm A',\n LLLL: 'dddd, D MMMM YYYY h:mm A',\n },\n calendarEl: {\n sameDay: '[Σήμερα {}] LT',\n nextDay: '[Αύριο {}] LT',\n nextWeek: 'dddd [{}] LT',\n lastDay: '[Χθες {}] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 6:\n return '[το προηγούμενο] dddd [{}] LT';\n default:\n return '[την προηγούμενη] dddd [{}] LT';\n }\n },\n sameElse: 'L',\n },\n calendar: function (key, mom) {\n var output = this._calendarEl[key],\n hours = mom && mom.hours();\n if (isFunction(output)) {\n output = output.apply(mom);\n }\n return output.replace('{}', hours % 12 === 1 ? 'στη' : 'στις');\n },\n relativeTime: {\n future: 'σε %s',\n past: '%s πριν',\n s: 'λίγα δευτερόλεπτα',\n ss: '%d δευτερόλεπτα',\n m: 'ένα λεπτό',\n mm: '%d λεπτά',\n h: 'μία ώρα',\n hh: '%d ώρες',\n d: 'μία μέρα',\n dd: '%d μέρες',\n M: 'ένας μήνας',\n MM: '%d μήνες',\n y: 'ένας χρόνος',\n yy: '%d χρόνια',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}η/,\n ordinal: '%dη',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4st is the first week of the year.\n },\n });\n\n return el;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (Australia) [en-au]\n//! author : Jared Morse : https://github.com/jarcoal\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enAu = moment.defineLocale('en-au', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY h:mm A',\n LLLL: 'dddd, D MMMM YYYY h:mm A',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return enAu;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (Canada) [en-ca]\n//! author : Jonathan Abourbih : https://github.com/jonbca\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enCa = moment.defineLocale('en-ca', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'YYYY-MM-DD',\n LL: 'MMMM D, YYYY',\n LLL: 'MMMM D, YYYY h:mm A',\n LLLL: 'dddd, MMMM D, YYYY h:mm A',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n });\n\n return enCa;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (United Kingdom) [en-gb]\n//! author : Chris Gedrim : https://github.com/chrisgedrim\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enGb = moment.defineLocale('en-gb', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return enGb;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (Ireland) [en-ie]\n//! author : Chris Cartlidge : https://github.com/chriscartlidge\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enIe = moment.defineLocale('en-ie', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return enIe;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (Israel) [en-il]\n//! author : Chris Gedrim : https://github.com/chrisgedrim\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enIl = moment.defineLocale('en-il', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n });\n\n return enIl;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (India) [en-in]\n//! author : Jatin Agrawal : https://github.com/jatinag22\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enIn = moment.defineLocale('en-in', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY h:mm A',\n LLLL: 'dddd, D MMMM YYYY h:mm A',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 1st is the first week of the year.\n },\n });\n\n return enIn;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (New Zealand) [en-nz]\n//! author : Luke McGregor : https://github.com/lukemcgregor\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enNz = moment.defineLocale('en-nz', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY h:mm A',\n LLLL: 'dddd, D MMMM YYYY h:mm A',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return enNz;\n\n})));\n","//! moment.js locale configuration\n//! locale : English (Singapore) [en-sg]\n//! author : Matthew Castrillon-Madrigal : https://github.com/techdimension\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var enSg = moment.defineLocale('en-sg', {\n months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n weekdaysShort: 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n weekdaysMin: 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return enSg;\n\n})));\n","//! moment.js locale configuration\n//! locale : Esperanto [eo]\n//! author : Colin Dean : https://github.com/colindean\n//! author : Mia Nordentoft Imperatori : https://github.com/miestasmia\n//! comment : miestasmia corrected the translation by colindean\n//! comment : Vivakvo corrected the translation by colindean and miestasmia\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var eo = moment.defineLocale('eo', {\n months: 'januaro_februaro_marto_aprilo_majo_junio_julio_aŭgusto_septembro_oktobro_novembro_decembro'.split(\n '_'\n ),\n monthsShort: 'jan_feb_mart_apr_maj_jun_jul_aŭg_sept_okt_nov_dec'.split('_'),\n weekdays: 'dimanĉo_lundo_mardo_merkredo_ĵaŭdo_vendredo_sabato'.split('_'),\n weekdaysShort: 'dim_lun_mard_merk_ĵaŭ_ven_sab'.split('_'),\n weekdaysMin: 'di_lu_ma_me_ĵa_ve_sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY-MM-DD',\n LL: '[la] D[-an de] MMMM, YYYY',\n LLL: '[la] D[-an de] MMMM, YYYY HH:mm',\n LLLL: 'dddd[n], [la] D[-an de] MMMM, YYYY HH:mm',\n llll: 'ddd, [la] D[-an de] MMM, YYYY HH:mm',\n },\n meridiemParse: /[ap]\\.t\\.m/i,\n isPM: function (input) {\n return input.charAt(0).toLowerCase() === 'p';\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'p.t.m.' : 'P.T.M.';\n } else {\n return isLower ? 'a.t.m.' : 'A.T.M.';\n }\n },\n calendar: {\n sameDay: '[Hodiaŭ je] LT',\n nextDay: '[Morgaŭ je] LT',\n nextWeek: 'dddd[n je] LT',\n lastDay: '[Hieraŭ je] LT',\n lastWeek: '[pasintan] dddd[n je] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'post %s',\n past: 'antaŭ %s',\n s: 'kelkaj sekundoj',\n ss: '%d sekundoj',\n m: 'unu minuto',\n mm: '%d minutoj',\n h: 'unu horo',\n hh: '%d horoj',\n d: 'unu tago', //ne 'diurno', ĉar estas uzita por proksimumo\n dd: '%d tagoj',\n M: 'unu monato',\n MM: '%d monatoj',\n y: 'unu jaro',\n yy: '%d jaroj',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}a/,\n ordinal: '%da',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return eo;\n\n})));\n","//! moment.js locale configuration\n//! locale : Spanish (Dominican Republic) [es-do]\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split(\n '_'\n ),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_'),\n monthsParse = [\n /^ene/i,\n /^feb/i,\n /^mar/i,\n /^abr/i,\n /^may/i,\n /^jun/i,\n /^jul/i,\n /^ago/i,\n /^sep/i,\n /^oct/i,\n /^nov/i,\n /^dic/i,\n ],\n monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var esDo = moment.defineLocale('es-do', {\n months: 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split(\n '_'\n ),\n monthsShort: function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex: /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays: 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort: 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin: 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'DD/MM/YYYY',\n LL: 'D [de] MMMM [de] YYYY',\n LLL: 'D [de] MMMM [de] YYYY h:mm A',\n LLLL: 'dddd, D [de] MMMM [de] YYYY h:mm A',\n },\n calendar: {\n sameDay: function () {\n return '[hoy a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextDay: function () {\n return '[mañana a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextWeek: function () {\n return 'dddd [a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastDay: function () {\n return '[ayer a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastWeek: function () {\n return (\n '[el] dddd [pasado a la' +\n (this.hours() !== 1 ? 's' : '') +\n '] LT'\n );\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'en %s',\n past: 'hace %s',\n s: 'unos segundos',\n ss: '%d segundos',\n m: 'un minuto',\n mm: '%d minutos',\n h: 'una hora',\n hh: '%d horas',\n d: 'un día',\n dd: '%d días',\n w: 'una semana',\n ww: '%d semanas',\n M: 'un mes',\n MM: '%d meses',\n y: 'un año',\n yy: '%d años',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return esDo;\n\n})));\n","//! moment.js locale configuration\n//! locale : Spanish (Mexico) [es-mx]\n//! author : JC Franco : https://github.com/jcfranco\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split(\n '_'\n ),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_'),\n monthsParse = [\n /^ene/i,\n /^feb/i,\n /^mar/i,\n /^abr/i,\n /^may/i,\n /^jun/i,\n /^jul/i,\n /^ago/i,\n /^sep/i,\n /^oct/i,\n /^nov/i,\n /^dic/i,\n ],\n monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var esMx = moment.defineLocale('es-mx', {\n months: 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split(\n '_'\n ),\n monthsShort: function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex: /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays: 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort: 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin: 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D [de] MMMM [de] YYYY',\n LLL: 'D [de] MMMM [de] YYYY H:mm',\n LLLL: 'dddd, D [de] MMMM [de] YYYY H:mm',\n },\n calendar: {\n sameDay: function () {\n return '[hoy a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextDay: function () {\n return '[mañana a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextWeek: function () {\n return 'dddd [a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastDay: function () {\n return '[ayer a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastWeek: function () {\n return (\n '[el] dddd [pasado a la' +\n (this.hours() !== 1 ? 's' : '') +\n '] LT'\n );\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'en %s',\n past: 'hace %s',\n s: 'unos segundos',\n ss: '%d segundos',\n m: 'un minuto',\n mm: '%d minutos',\n h: 'una hora',\n hh: '%d horas',\n d: 'un día',\n dd: '%d días',\n w: 'una semana',\n ww: '%d semanas',\n M: 'un mes',\n MM: '%d meses',\n y: 'un año',\n yy: '%d años',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n invalidDate: 'Fecha inválida',\n });\n\n return esMx;\n\n})));\n","//! moment.js locale configuration\n//! locale : Spanish (United States) [es-us]\n//! author : bustta : https://github.com/bustta\n//! author : chrisrodz : https://github.com/chrisrodz\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split(\n '_'\n ),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_'),\n monthsParse = [\n /^ene/i,\n /^feb/i,\n /^mar/i,\n /^abr/i,\n /^may/i,\n /^jun/i,\n /^jul/i,\n /^ago/i,\n /^sep/i,\n /^oct/i,\n /^nov/i,\n /^dic/i,\n ],\n monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var esUs = moment.defineLocale('es-us', {\n months: 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split(\n '_'\n ),\n monthsShort: function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex: /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays: 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort: 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin: 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'MM/DD/YYYY',\n LL: 'D [de] MMMM [de] YYYY',\n LLL: 'D [de] MMMM [de] YYYY h:mm A',\n LLLL: 'dddd, D [de] MMMM [de] YYYY h:mm A',\n },\n calendar: {\n sameDay: function () {\n return '[hoy a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextDay: function () {\n return '[mañana a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextWeek: function () {\n return 'dddd [a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastDay: function () {\n return '[ayer a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastWeek: function () {\n return (\n '[el] dddd [pasado a la' +\n (this.hours() !== 1 ? 's' : '') +\n '] LT'\n );\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'en %s',\n past: 'hace %s',\n s: 'unos segundos',\n ss: '%d segundos',\n m: 'un minuto',\n mm: '%d minutos',\n h: 'una hora',\n hh: '%d horas',\n d: 'un día',\n dd: '%d días',\n w: 'una semana',\n ww: '%d semanas',\n M: 'un mes',\n MM: '%d meses',\n y: 'un año',\n yy: '%d años',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return esUs;\n\n})));\n","//! moment.js locale configuration\n//! locale : Spanish [es]\n//! author : Julio Napurí : https://github.com/julionc\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split(\n '_'\n ),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_'),\n monthsParse = [\n /^ene/i,\n /^feb/i,\n /^mar/i,\n /^abr/i,\n /^may/i,\n /^jun/i,\n /^jul/i,\n /^ago/i,\n /^sep/i,\n /^oct/i,\n /^nov/i,\n /^dic/i,\n ],\n monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var es = moment.defineLocale('es', {\n months: 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split(\n '_'\n ),\n monthsShort: function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex: /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays: 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort: 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin: 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D [de] MMMM [de] YYYY',\n LLL: 'D [de] MMMM [de] YYYY H:mm',\n LLLL: 'dddd, D [de] MMMM [de] YYYY H:mm',\n },\n calendar: {\n sameDay: function () {\n return '[hoy a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextDay: function () {\n return '[mañana a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n nextWeek: function () {\n return 'dddd [a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastDay: function () {\n return '[ayer a la' + (this.hours() !== 1 ? 's' : '') + '] LT';\n },\n lastWeek: function () {\n return (\n '[el] dddd [pasado a la' +\n (this.hours() !== 1 ? 's' : '') +\n '] LT'\n );\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'en %s',\n past: 'hace %s',\n s: 'unos segundos',\n ss: '%d segundos',\n m: 'un minuto',\n mm: '%d minutos',\n h: 'una hora',\n hh: '%d horas',\n d: 'un día',\n dd: '%d días',\n w: 'una semana',\n ww: '%d semanas',\n M: 'un mes',\n MM: '%d meses',\n y: 'un año',\n yy: '%d años',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n invalidDate: 'Fecha inválida',\n });\n\n return es;\n\n})));\n","//! moment.js locale configuration\n//! locale : Estonian [et]\n//! author : Henry Kehlmann : https://github.com/madhenry\n//! improvements : Illimar Tambek : https://github.com/ragulka\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n s: ['mõne sekundi', 'mõni sekund', 'paar sekundit'],\n ss: [number + 'sekundi', number + 'sekundit'],\n m: ['ühe minuti', 'üks minut'],\n mm: [number + ' minuti', number + ' minutit'],\n h: ['ühe tunni', 'tund aega', 'üks tund'],\n hh: [number + ' tunni', number + ' tundi'],\n d: ['ühe päeva', 'üks päev'],\n M: ['kuu aja', 'kuu aega', 'üks kuu'],\n MM: [number + ' kuu', number + ' kuud'],\n y: ['ühe aasta', 'aasta', 'üks aasta'],\n yy: [number + ' aasta', number + ' aastat'],\n };\n if (withoutSuffix) {\n return format[key][2] ? format[key][2] : format[key][1];\n }\n return isFuture ? format[key][0] : format[key][1];\n }\n\n var et = moment.defineLocale('et', {\n months: 'jaanuar_veebruar_märts_aprill_mai_juuni_juuli_august_september_oktoober_november_detsember'.split(\n '_'\n ),\n monthsShort: 'jaan_veebr_märts_apr_mai_juuni_juuli_aug_sept_okt_nov_dets'.split(\n '_'\n ),\n weekdays: 'pühapäev_esmaspäev_teisipäev_kolmapäev_neljapäev_reede_laupäev'.split(\n '_'\n ),\n weekdaysShort: 'P_E_T_K_N_R_L'.split('_'),\n weekdaysMin: 'P_E_T_K_N_R_L'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY H:mm',\n LLLL: 'dddd, D. MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[Täna,] LT',\n nextDay: '[Homme,] LT',\n nextWeek: '[Järgmine] dddd LT',\n lastDay: '[Eile,] LT',\n lastWeek: '[Eelmine] dddd LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s pärast',\n past: '%s tagasi',\n s: processRelativeTime,\n ss: processRelativeTime,\n m: processRelativeTime,\n mm: processRelativeTime,\n h: processRelativeTime,\n hh: processRelativeTime,\n d: processRelativeTime,\n dd: '%d päeva',\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return et;\n\n})));\n","//! moment.js locale configuration\n//! locale : Basque [eu]\n//! author : Eneko Illarramendi : https://github.com/eillarra\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var eu = moment.defineLocale('eu', {\n months: 'urtarrila_otsaila_martxoa_apirila_maiatza_ekaina_uztaila_abuztua_iraila_urria_azaroa_abendua'.split(\n '_'\n ),\n monthsShort: 'urt._ots._mar._api._mai._eka._uzt._abu._ira._urr._aza._abe.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'igandea_astelehena_asteartea_asteazkena_osteguna_ostirala_larunbata'.split(\n '_'\n ),\n weekdaysShort: 'ig._al._ar._az._og._ol._lr.'.split('_'),\n weekdaysMin: 'ig_al_ar_az_og_ol_lr'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY-MM-DD',\n LL: 'YYYY[ko] MMMM[ren] D[a]',\n LLL: 'YYYY[ko] MMMM[ren] D[a] HH:mm',\n LLLL: 'dddd, YYYY[ko] MMMM[ren] D[a] HH:mm',\n l: 'YYYY-M-D',\n ll: 'YYYY[ko] MMM D[a]',\n lll: 'YYYY[ko] MMM D[a] HH:mm',\n llll: 'ddd, YYYY[ko] MMM D[a] HH:mm',\n },\n calendar: {\n sameDay: '[gaur] LT[etan]',\n nextDay: '[bihar] LT[etan]',\n nextWeek: 'dddd LT[etan]',\n lastDay: '[atzo] LT[etan]',\n lastWeek: '[aurreko] dddd LT[etan]',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s barru',\n past: 'duela %s',\n s: 'segundo batzuk',\n ss: '%d segundo',\n m: 'minutu bat',\n mm: '%d minutu',\n h: 'ordu bat',\n hh: '%d ordu',\n d: 'egun bat',\n dd: '%d egun',\n M: 'hilabete bat',\n MM: '%d hilabete',\n y: 'urte bat',\n yy: '%d urte',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return eu;\n\n})));\n","//! moment.js locale configuration\n//! locale : Persian [fa]\n//! author : Ebrahim Byagowi : https://github.com/ebraminio\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '۱',\n 2: '۲',\n 3: '۳',\n 4: '۴',\n 5: '۵',\n 6: '۶',\n 7: '۷',\n 8: '۸',\n 9: '۹',\n 0: '۰',\n },\n numberMap = {\n '۱': '1',\n '۲': '2',\n '۳': '3',\n '۴': '4',\n '۵': '5',\n '۶': '6',\n '۷': '7',\n '۸': '8',\n '۹': '9',\n '۰': '0',\n };\n\n var fa = moment.defineLocale('fa', {\n months: 'ژانویه_فوریه_مارس_آوریل_مه_ژوئن_ژوئیه_اوت_سپتامبر_اکتبر_نوامبر_دسامبر'.split(\n '_'\n ),\n monthsShort: 'ژانویه_فوریه_مارس_آوریل_مه_ژوئن_ژوئیه_اوت_سپتامبر_اکتبر_نوامبر_دسامبر'.split(\n '_'\n ),\n weekdays: 'یک\\u200cشنبه_دوشنبه_سه\\u200cشنبه_چهارشنبه_پنج\\u200cشنبه_جمعه_شنبه'.split(\n '_'\n ),\n weekdaysShort: 'یک\\u200cشنبه_دوشنبه_سه\\u200cشنبه_چهارشنبه_پنج\\u200cشنبه_جمعه_شنبه'.split(\n '_'\n ),\n weekdaysMin: 'ی_د_س_چ_پ_ج_ش'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n meridiemParse: /قبل از ظهر|بعد از ظهر/,\n isPM: function (input) {\n return /بعد از ظهر/.test(input);\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'قبل از ظهر';\n } else {\n return 'بعد از ظهر';\n }\n },\n calendar: {\n sameDay: '[امروز ساعت] LT',\n nextDay: '[فردا ساعت] LT',\n nextWeek: 'dddd [ساعت] LT',\n lastDay: '[دیروز ساعت] LT',\n lastWeek: 'dddd [پیش] [ساعت] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'در %s',\n past: '%s پیش',\n s: 'چند ثانیه',\n ss: '%d ثانیه',\n m: 'یک دقیقه',\n mm: '%d دقیقه',\n h: 'یک ساعت',\n hh: '%d ساعت',\n d: 'یک روز',\n dd: '%d روز',\n M: 'یک ماه',\n MM: '%d ماه',\n y: 'یک سال',\n yy: '%d سال',\n },\n preparse: function (string) {\n return string\n .replace(/[۰-۹]/g, function (match) {\n return numberMap[match];\n })\n .replace(/،/g, ',');\n },\n postformat: function (string) {\n return string\n .replace(/\\d/g, function (match) {\n return symbolMap[match];\n })\n .replace(/,/g, '،');\n },\n dayOfMonthOrdinalParse: /\\d{1,2}م/,\n ordinal: '%dم',\n week: {\n dow: 6, // Saturday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return fa;\n\n})));\n","//! moment.js locale configuration\n//! locale : Finnish [fi]\n//! author : Tarmo Aidantausta : https://github.com/bleadof\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var numbersPast = 'nolla yksi kaksi kolme neljä viisi kuusi seitsemän kahdeksan yhdeksän'.split(\n ' '\n ),\n numbersFuture = [\n 'nolla',\n 'yhden',\n 'kahden',\n 'kolmen',\n 'neljän',\n 'viiden',\n 'kuuden',\n numbersPast[7],\n numbersPast[8],\n numbersPast[9],\n ];\n function translate(number, withoutSuffix, key, isFuture) {\n var result = '';\n switch (key) {\n case 's':\n return isFuture ? 'muutaman sekunnin' : 'muutama sekunti';\n case 'ss':\n result = isFuture ? 'sekunnin' : 'sekuntia';\n break;\n case 'm':\n return isFuture ? 'minuutin' : 'minuutti';\n case 'mm':\n result = isFuture ? 'minuutin' : 'minuuttia';\n break;\n case 'h':\n return isFuture ? 'tunnin' : 'tunti';\n case 'hh':\n result = isFuture ? 'tunnin' : 'tuntia';\n break;\n case 'd':\n return isFuture ? 'päivän' : 'päivä';\n case 'dd':\n result = isFuture ? 'päivän' : 'päivää';\n break;\n case 'M':\n return isFuture ? 'kuukauden' : 'kuukausi';\n case 'MM':\n result = isFuture ? 'kuukauden' : 'kuukautta';\n break;\n case 'y':\n return isFuture ? 'vuoden' : 'vuosi';\n case 'yy':\n result = isFuture ? 'vuoden' : 'vuotta';\n break;\n }\n result = verbalNumber(number, isFuture) + ' ' + result;\n return result;\n }\n function verbalNumber(number, isFuture) {\n return number < 10\n ? isFuture\n ? numbersFuture[number]\n : numbersPast[number]\n : number;\n }\n\n var fi = moment.defineLocale('fi', {\n months: 'tammikuu_helmikuu_maaliskuu_huhtikuu_toukokuu_kesäkuu_heinäkuu_elokuu_syyskuu_lokakuu_marraskuu_joulukuu'.split(\n '_'\n ),\n monthsShort: 'tammi_helmi_maalis_huhti_touko_kesä_heinä_elo_syys_loka_marras_joulu'.split(\n '_'\n ),\n weekdays: 'sunnuntai_maanantai_tiistai_keskiviikko_torstai_perjantai_lauantai'.split(\n '_'\n ),\n weekdaysShort: 'su_ma_ti_ke_to_pe_la'.split('_'),\n weekdaysMin: 'su_ma_ti_ke_to_pe_la'.split('_'),\n longDateFormat: {\n LT: 'HH.mm',\n LTS: 'HH.mm.ss',\n L: 'DD.MM.YYYY',\n LL: 'Do MMMM[ta] YYYY',\n LLL: 'Do MMMM[ta] YYYY, [klo] HH.mm',\n LLLL: 'dddd, Do MMMM[ta] YYYY, [klo] HH.mm',\n l: 'D.M.YYYY',\n ll: 'Do MMM YYYY',\n lll: 'Do MMM YYYY, [klo] HH.mm',\n llll: 'ddd, Do MMM YYYY, [klo] HH.mm',\n },\n calendar: {\n sameDay: '[tänään] [klo] LT',\n nextDay: '[huomenna] [klo] LT',\n nextWeek: 'dddd [klo] LT',\n lastDay: '[eilen] [klo] LT',\n lastWeek: '[viime] dddd[na] [klo] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s päästä',\n past: '%s sitten',\n s: translate,\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: translate,\n dd: translate,\n M: translate,\n MM: translate,\n y: translate,\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return fi;\n\n})));\n","//! moment.js locale configuration\n//! locale : Filipino [fil]\n//! author : Dan Hagman : https://github.com/hagmandan\n//! author : Matthew Co : https://github.com/matthewdeeco\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var fil = moment.defineLocale('fil', {\n months: 'Enero_Pebrero_Marso_Abril_Mayo_Hunyo_Hulyo_Agosto_Setyembre_Oktubre_Nobyembre_Disyembre'.split(\n '_'\n ),\n monthsShort: 'Ene_Peb_Mar_Abr_May_Hun_Hul_Ago_Set_Okt_Nob_Dis'.split('_'),\n weekdays: 'Linggo_Lunes_Martes_Miyerkules_Huwebes_Biyernes_Sabado'.split(\n '_'\n ),\n weekdaysShort: 'Lin_Lun_Mar_Miy_Huw_Biy_Sab'.split('_'),\n weekdaysMin: 'Li_Lu_Ma_Mi_Hu_Bi_Sab'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'MM/D/YYYY',\n LL: 'MMMM D, YYYY',\n LLL: 'MMMM D, YYYY HH:mm',\n LLLL: 'dddd, MMMM DD, YYYY HH:mm',\n },\n calendar: {\n sameDay: 'LT [ngayong araw]',\n nextDay: '[Bukas ng] LT',\n nextWeek: 'LT [sa susunod na] dddd',\n lastDay: 'LT [kahapon]',\n lastWeek: 'LT [noong nakaraang] dddd',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'sa loob ng %s',\n past: '%s ang nakalipas',\n s: 'ilang segundo',\n ss: '%d segundo',\n m: 'isang minuto',\n mm: '%d minuto',\n h: 'isang oras',\n hh: '%d oras',\n d: 'isang araw',\n dd: '%d araw',\n M: 'isang buwan',\n MM: '%d buwan',\n y: 'isang taon',\n yy: '%d taon',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}/,\n ordinal: function (number) {\n return number;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return fil;\n\n})));\n","//! moment.js locale configuration\n//! locale : Faroese [fo]\n//! author : Ragnar Johannesen : https://github.com/ragnar123\n//! author : Kristian Sakarisson : https://github.com/sakarisson\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var fo = moment.defineLocale('fo', {\n months: 'januar_februar_mars_apríl_mai_juni_juli_august_september_oktober_november_desember'.split(\n '_'\n ),\n monthsShort: 'jan_feb_mar_apr_mai_jun_jul_aug_sep_okt_nov_des'.split('_'),\n weekdays: 'sunnudagur_mánadagur_týsdagur_mikudagur_hósdagur_fríggjadagur_leygardagur'.split(\n '_'\n ),\n weekdaysShort: 'sun_mán_týs_mik_hós_frí_ley'.split('_'),\n weekdaysMin: 'su_má_tý_mi_hó_fr_le'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D. MMMM, YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Í dag kl.] LT',\n nextDay: '[Í morgin kl.] LT',\n nextWeek: 'dddd [kl.] LT',\n lastDay: '[Í gjár kl.] LT',\n lastWeek: '[síðstu] dddd [kl] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'um %s',\n past: '%s síðani',\n s: 'fá sekund',\n ss: '%d sekundir',\n m: 'ein minuttur',\n mm: '%d minuttir',\n h: 'ein tími',\n hh: '%d tímar',\n d: 'ein dagur',\n dd: '%d dagar',\n M: 'ein mánaður',\n MM: '%d mánaðir',\n y: 'eitt ár',\n yy: '%d ár',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return fo;\n\n})));\n","//! moment.js locale configuration\n//! locale : French (Canada) [fr-ca]\n//! author : Jonathan Abourbih : https://github.com/jonbca\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var frCa = moment.defineLocale('fr-ca', {\n months: 'janvier_février_mars_avril_mai_juin_juillet_août_septembre_octobre_novembre_décembre'.split(\n '_'\n ),\n monthsShort: 'janv._févr._mars_avr._mai_juin_juil._août_sept._oct._nov._déc.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'dimanche_lundi_mardi_mercredi_jeudi_vendredi_samedi'.split('_'),\n weekdaysShort: 'dim._lun._mar._mer._jeu._ven._sam.'.split('_'),\n weekdaysMin: 'di_lu_ma_me_je_ve_sa'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY-MM-DD',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Aujourd’hui à] LT',\n nextDay: '[Demain à] LT',\n nextWeek: 'dddd [à] LT',\n lastDay: '[Hier à] LT',\n lastWeek: 'dddd [dernier à] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'dans %s',\n past: 'il y a %s',\n s: 'quelques secondes',\n ss: '%d secondes',\n m: 'une minute',\n mm: '%d minutes',\n h: 'une heure',\n hh: '%d heures',\n d: 'un jour',\n dd: '%d jours',\n M: 'un mois',\n MM: '%d mois',\n y: 'un an',\n yy: '%d ans',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(er|e)/,\n ordinal: function (number, period) {\n switch (period) {\n // Words with masculine grammatical gender: mois, trimestre, jour\n default:\n case 'M':\n case 'Q':\n case 'D':\n case 'DDD':\n case 'd':\n return number + (number === 1 ? 'er' : 'e');\n\n // Words with feminine grammatical gender: semaine\n case 'w':\n case 'W':\n return number + (number === 1 ? 're' : 'e');\n }\n },\n });\n\n return frCa;\n\n})));\n","//! moment.js locale configuration\n//! locale : French (Switzerland) [fr-ch]\n//! author : Gaspard Bucher : https://github.com/gaspard\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var frCh = moment.defineLocale('fr-ch', {\n months: 'janvier_février_mars_avril_mai_juin_juillet_août_septembre_octobre_novembre_décembre'.split(\n '_'\n ),\n monthsShort: 'janv._févr._mars_avr._mai_juin_juil._août_sept._oct._nov._déc.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'dimanche_lundi_mardi_mercredi_jeudi_vendredi_samedi'.split('_'),\n weekdaysShort: 'dim._lun._mar._mer._jeu._ven._sam.'.split('_'),\n weekdaysMin: 'di_lu_ma_me_je_ve_sa'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Aujourd’hui à] LT',\n nextDay: '[Demain à] LT',\n nextWeek: 'dddd [à] LT',\n lastDay: '[Hier à] LT',\n lastWeek: 'dddd [dernier à] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'dans %s',\n past: 'il y a %s',\n s: 'quelques secondes',\n ss: '%d secondes',\n m: 'une minute',\n mm: '%d minutes',\n h: 'une heure',\n hh: '%d heures',\n d: 'un jour',\n dd: '%d jours',\n M: 'un mois',\n MM: '%d mois',\n y: 'un an',\n yy: '%d ans',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(er|e)/,\n ordinal: function (number, period) {\n switch (period) {\n // Words with masculine grammatical gender: mois, trimestre, jour\n default:\n case 'M':\n case 'Q':\n case 'D':\n case 'DDD':\n case 'd':\n return number + (number === 1 ? 'er' : 'e');\n\n // Words with feminine grammatical gender: semaine\n case 'w':\n case 'W':\n return number + (number === 1 ? 're' : 'e');\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return frCh;\n\n})));\n","//! moment.js locale configuration\n//! locale : French [fr]\n//! author : John Fischer : https://github.com/jfroffice\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsStrictRegex = /^(janvier|février|mars|avril|mai|juin|juillet|août|septembre|octobre|novembre|décembre)/i,\n monthsShortStrictRegex = /(janv\\.?|févr\\.?|mars|avr\\.?|mai|juin|juil\\.?|août|sept\\.?|oct\\.?|nov\\.?|déc\\.?)/i,\n monthsRegex = /(janv\\.?|févr\\.?|mars|avr\\.?|mai|juin|juil\\.?|août|sept\\.?|oct\\.?|nov\\.?|déc\\.?|janvier|février|mars|avril|mai|juin|juillet|août|septembre|octobre|novembre|décembre)/i,\n monthsParse = [\n /^janv/i,\n /^févr/i,\n /^mars/i,\n /^avr/i,\n /^mai/i,\n /^juin/i,\n /^juil/i,\n /^août/i,\n /^sept/i,\n /^oct/i,\n /^nov/i,\n /^déc/i,\n ];\n\n var fr = moment.defineLocale('fr', {\n months: 'janvier_février_mars_avril_mai_juin_juillet_août_septembre_octobre_novembre_décembre'.split(\n '_'\n ),\n monthsShort: 'janv._févr._mars_avr._mai_juin_juil._août_sept._oct._nov._déc.'.split(\n '_'\n ),\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: monthsStrictRegex,\n monthsShortStrictRegex: monthsShortStrictRegex,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays: 'dimanche_lundi_mardi_mercredi_jeudi_vendredi_samedi'.split('_'),\n weekdaysShort: 'dim._lun._mar._mer._jeu._ven._sam.'.split('_'),\n weekdaysMin: 'di_lu_ma_me_je_ve_sa'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Aujourd’hui à] LT',\n nextDay: '[Demain à] LT',\n nextWeek: 'dddd [à] LT',\n lastDay: '[Hier à] LT',\n lastWeek: 'dddd [dernier à] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'dans %s',\n past: 'il y a %s',\n s: 'quelques secondes',\n ss: '%d secondes',\n m: 'une minute',\n mm: '%d minutes',\n h: 'une heure',\n hh: '%d heures',\n d: 'un jour',\n dd: '%d jours',\n w: 'une semaine',\n ww: '%d semaines',\n M: 'un mois',\n MM: '%d mois',\n y: 'un an',\n yy: '%d ans',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(er|)/,\n ordinal: function (number, period) {\n switch (period) {\n // TODO: Return 'e' when day of month > 1. Move this case inside\n // block for masculine words below.\n // See https://github.com/moment/moment/issues/3375\n case 'D':\n return number + (number === 1 ? 'er' : '');\n\n // Words with masculine grammatical gender: mois, trimestre, jour\n default:\n case 'M':\n case 'Q':\n case 'DDD':\n case 'd':\n return number + (number === 1 ? 'er' : 'e');\n\n // Words with feminine grammatical gender: semaine\n case 'w':\n case 'W':\n return number + (number === 1 ? 're' : 'e');\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return fr;\n\n})));\n","//! moment.js locale configuration\n//! locale : Frisian [fy]\n//! author : Robin van der Vliet : https://github.com/robin0van0der0v\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsShortWithDots = 'jan._feb._mrt._apr._mai_jun._jul._aug._sep._okt._nov._des.'.split(\n '_'\n ),\n monthsShortWithoutDots = 'jan_feb_mrt_apr_mai_jun_jul_aug_sep_okt_nov_des'.split(\n '_'\n );\n\n var fy = moment.defineLocale('fy', {\n months: 'jannewaris_febrewaris_maart_april_maaie_juny_july_augustus_septimber_oktober_novimber_desimber'.split(\n '_'\n ),\n monthsShort: function (m, format) {\n if (!m) {\n return monthsShortWithDots;\n } else if (/-MMM-/.test(format)) {\n return monthsShortWithoutDots[m.month()];\n } else {\n return monthsShortWithDots[m.month()];\n }\n },\n monthsParseExact: true,\n weekdays: 'snein_moandei_tiisdei_woansdei_tongersdei_freed_sneon'.split(\n '_'\n ),\n weekdaysShort: 'si._mo._ti._wo._to._fr._so.'.split('_'),\n weekdaysMin: 'Si_Mo_Ti_Wo_To_Fr_So'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD-MM-YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[hjoed om] LT',\n nextDay: '[moarn om] LT',\n nextWeek: 'dddd [om] LT',\n lastDay: '[juster om] LT',\n lastWeek: '[ôfrûne] dddd [om] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'oer %s',\n past: '%s lyn',\n s: 'in pear sekonden',\n ss: '%d sekonden',\n m: 'ien minút',\n mm: '%d minuten',\n h: 'ien oere',\n hh: '%d oeren',\n d: 'ien dei',\n dd: '%d dagen',\n M: 'ien moanne',\n MM: '%d moannen',\n y: 'ien jier',\n yy: '%d jierren',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(ste|de)/,\n ordinal: function (number) {\n return (\n number +\n (number === 1 || number === 8 || number >= 20 ? 'ste' : 'de')\n );\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return fy;\n\n})));\n","//! moment.js locale configuration\n//! locale : Irish or Irish Gaelic [ga]\n//! author : André Silva : https://github.com/askpt\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var months = [\n 'Eanáir',\n 'Feabhra',\n 'Márta',\n 'Aibreán',\n 'Bealtaine',\n 'Meitheamh',\n 'Iúil',\n 'Lúnasa',\n 'Meán Fómhair',\n 'Deireadh Fómhair',\n 'Samhain',\n 'Nollaig',\n ],\n monthsShort = [\n 'Ean',\n 'Feabh',\n 'Márt',\n 'Aib',\n 'Beal',\n 'Meith',\n 'Iúil',\n 'Lún',\n 'M.F.',\n 'D.F.',\n 'Samh',\n 'Noll',\n ],\n weekdays = [\n 'Dé Domhnaigh',\n 'Dé Luain',\n 'Dé Máirt',\n 'Dé Céadaoin',\n 'Déardaoin',\n 'Dé hAoine',\n 'Dé Sathairn',\n ],\n weekdaysShort = ['Domh', 'Luan', 'Máirt', 'Céad', 'Déar', 'Aoine', 'Sath'],\n weekdaysMin = ['Do', 'Lu', 'Má', 'Cé', 'Dé', 'A', 'Sa'];\n\n var ga = moment.defineLocale('ga', {\n months: months,\n monthsShort: monthsShort,\n monthsParseExact: true,\n weekdays: weekdays,\n weekdaysShort: weekdaysShort,\n weekdaysMin: weekdaysMin,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Inniu ag] LT',\n nextDay: '[Amárach ag] LT',\n nextWeek: 'dddd [ag] LT',\n lastDay: '[Inné ag] LT',\n lastWeek: 'dddd [seo caite] [ag] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'i %s',\n past: '%s ó shin',\n s: 'cúpla soicind',\n ss: '%d soicind',\n m: 'nóiméad',\n mm: '%d nóiméad',\n h: 'uair an chloig',\n hh: '%d uair an chloig',\n d: 'lá',\n dd: '%d lá',\n M: 'mí',\n MM: '%d míonna',\n y: 'bliain',\n yy: '%d bliain',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(d|na|mh)/,\n ordinal: function (number) {\n var output = number === 1 ? 'd' : number % 10 === 2 ? 'na' : 'mh';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return ga;\n\n})));\n","//! moment.js locale configuration\n//! locale : Scottish Gaelic [gd]\n//! author : Jon Ashdown : https://github.com/jonashdown\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var months = [\n 'Am Faoilleach',\n 'An Gearran',\n 'Am Màrt',\n 'An Giblean',\n 'An Cèitean',\n 'An t-Ògmhios',\n 'An t-Iuchar',\n 'An Lùnastal',\n 'An t-Sultain',\n 'An Dàmhair',\n 'An t-Samhain',\n 'An Dùbhlachd',\n ],\n monthsShort = [\n 'Faoi',\n 'Gear',\n 'Màrt',\n 'Gibl',\n 'Cèit',\n 'Ògmh',\n 'Iuch',\n 'Lùn',\n 'Sult',\n 'Dàmh',\n 'Samh',\n 'Dùbh',\n ],\n weekdays = [\n 'Didòmhnaich',\n 'Diluain',\n 'Dimàirt',\n 'Diciadain',\n 'Diardaoin',\n 'Dihaoine',\n 'Disathairne',\n ],\n weekdaysShort = ['Did', 'Dil', 'Dim', 'Dic', 'Dia', 'Dih', 'Dis'],\n weekdaysMin = ['Dò', 'Lu', 'Mà', 'Ci', 'Ar', 'Ha', 'Sa'];\n\n var gd = moment.defineLocale('gd', {\n months: months,\n monthsShort: monthsShort,\n monthsParseExact: true,\n weekdays: weekdays,\n weekdaysShort: weekdaysShort,\n weekdaysMin: weekdaysMin,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[An-diugh aig] LT',\n nextDay: '[A-màireach aig] LT',\n nextWeek: 'dddd [aig] LT',\n lastDay: '[An-dè aig] LT',\n lastWeek: 'dddd [seo chaidh] [aig] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'ann an %s',\n past: 'bho chionn %s',\n s: 'beagan diogan',\n ss: '%d diogan',\n m: 'mionaid',\n mm: '%d mionaidean',\n h: 'uair',\n hh: '%d uairean',\n d: 'latha',\n dd: '%d latha',\n M: 'mìos',\n MM: '%d mìosan',\n y: 'bliadhna',\n yy: '%d bliadhna',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(d|na|mh)/,\n ordinal: function (number) {\n var output = number === 1 ? 'd' : number % 10 === 2 ? 'na' : 'mh';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return gd;\n\n})));\n","//! moment.js locale configuration\n//! locale : Galician [gl]\n//! author : Juan G. Hurtado : https://github.com/juanghurtado\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var gl = moment.defineLocale('gl', {\n months: 'xaneiro_febreiro_marzo_abril_maio_xuño_xullo_agosto_setembro_outubro_novembro_decembro'.split(\n '_'\n ),\n monthsShort: 'xan._feb._mar._abr._mai._xuñ._xul._ago._set._out._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'domingo_luns_martes_mércores_xoves_venres_sábado'.split('_'),\n weekdaysShort: 'dom._lun._mar._mér._xov._ven._sáb.'.split('_'),\n weekdaysMin: 'do_lu_ma_mé_xo_ve_sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D [de] MMMM [de] YYYY',\n LLL: 'D [de] MMMM [de] YYYY H:mm',\n LLLL: 'dddd, D [de] MMMM [de] YYYY H:mm',\n },\n calendar: {\n sameDay: function () {\n return '[hoxe ' + (this.hours() !== 1 ? 'ás' : 'á') + '] LT';\n },\n nextDay: function () {\n return '[mañá ' + (this.hours() !== 1 ? 'ás' : 'á') + '] LT';\n },\n nextWeek: function () {\n return 'dddd [' + (this.hours() !== 1 ? 'ás' : 'a') + '] LT';\n },\n lastDay: function () {\n return '[onte ' + (this.hours() !== 1 ? 'á' : 'a') + '] LT';\n },\n lastWeek: function () {\n return (\n '[o] dddd [pasado ' + (this.hours() !== 1 ? 'ás' : 'a') + '] LT'\n );\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: function (str) {\n if (str.indexOf('un') === 0) {\n return 'n' + str;\n }\n return 'en ' + str;\n },\n past: 'hai %s',\n s: 'uns segundos',\n ss: '%d segundos',\n m: 'un minuto',\n mm: '%d minutos',\n h: 'unha hora',\n hh: '%d horas',\n d: 'un día',\n dd: '%d días',\n M: 'un mes',\n MM: '%d meses',\n y: 'un ano',\n yy: '%d anos',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return gl;\n\n})));\n","//! moment.js locale configuration\n//! locale : Konkani Devanagari script [gom-deva]\n//! author : The Discoverer : https://github.com/WikiDiscoverer\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n s: ['थोडया सॅकंडांनी', 'थोडे सॅकंड'],\n ss: [number + ' सॅकंडांनी', number + ' सॅकंड'],\n m: ['एका मिणटान', 'एक मिनूट'],\n mm: [number + ' मिणटांनी', number + ' मिणटां'],\n h: ['एका वरान', 'एक वर'],\n hh: [number + ' वरांनी', number + ' वरां'],\n d: ['एका दिसान', 'एक दीस'],\n dd: [number + ' दिसांनी', number + ' दीस'],\n M: ['एका म्हयन्यान', 'एक म्हयनो'],\n MM: [number + ' म्हयन्यानी', number + ' म्हयने'],\n y: ['एका वर्सान', 'एक वर्स'],\n yy: [number + ' वर्सांनी', number + ' वर्सां'],\n };\n return isFuture ? format[key][0] : format[key][1];\n }\n\n var gomDeva = moment.defineLocale('gom-deva', {\n months: {\n standalone: 'जानेवारी_फेब्रुवारी_मार्च_एप्रील_मे_जून_जुलय_ऑगस्ट_सप्टेंबर_ऑक्टोबर_नोव्हेंबर_डिसेंबर'.split(\n '_'\n ),\n format: 'जानेवारीच्या_फेब्रुवारीच्या_मार्चाच्या_एप्रीलाच्या_मेयाच्या_जूनाच्या_जुलयाच्या_ऑगस्टाच्या_सप्टेंबराच्या_ऑक्टोबराच्या_नोव्हेंबराच्या_डिसेंबराच्या'.split(\n '_'\n ),\n isFormat: /MMMM(\\s)+D[oD]?/,\n },\n monthsShort: 'जाने._फेब्रु._मार्च_एप्री._मे_जून_जुल._ऑग._सप्टें._ऑक्टो._नोव्हें._डिसें.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'आयतार_सोमार_मंगळार_बुधवार_बिरेस्तार_सुक्रार_शेनवार'.split('_'),\n weekdaysShort: 'आयत._सोम._मंगळ._बुध._ब्रेस्त._सुक्र._शेन.'.split('_'),\n weekdaysMin: 'आ_सो_मं_बु_ब्रे_सु_शे'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'A h:mm [वाजतां]',\n LTS: 'A h:mm:ss [वाजतां]',\n L: 'DD-MM-YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY A h:mm [वाजतां]',\n LLLL: 'dddd, MMMM Do, YYYY, A h:mm [वाजतां]',\n llll: 'ddd, D MMM YYYY, A h:mm [वाजतां]',\n },\n calendar: {\n sameDay: '[आयज] LT',\n nextDay: '[फाल्यां] LT',\n nextWeek: '[फुडलो] dddd[,] LT',\n lastDay: '[काल] LT',\n lastWeek: '[फाटलो] dddd[,] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s',\n past: '%s आदीं',\n s: processRelativeTime,\n ss: processRelativeTime,\n m: processRelativeTime,\n mm: processRelativeTime,\n h: processRelativeTime,\n hh: processRelativeTime,\n d: processRelativeTime,\n dd: processRelativeTime,\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(वेर)/,\n ordinal: function (number, period) {\n switch (period) {\n // the ordinal 'वेर' only applies to day of the month\n case 'D':\n return number + 'वेर';\n default:\n case 'M':\n case 'Q':\n case 'DDD':\n case 'd':\n case 'w':\n case 'W':\n return number;\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week\n doy: 3, // The week that contains Jan 4th is the first week of the year (7 + 0 - 4)\n },\n meridiemParse: /राती|सकाळीं|दनपारां|सांजे/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'राती') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'सकाळीं') {\n return hour;\n } else if (meridiem === 'दनपारां') {\n return hour > 12 ? hour : hour + 12;\n } else if (meridiem === 'सांजे') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'राती';\n } else if (hour < 12) {\n return 'सकाळीं';\n } else if (hour < 16) {\n return 'दनपारां';\n } else if (hour < 20) {\n return 'सांजे';\n } else {\n return 'राती';\n }\n },\n });\n\n return gomDeva;\n\n})));\n","//! moment.js locale configuration\n//! locale : Konkani Latin script [gom-latn]\n//! author : The Discoverer : https://github.com/WikiDiscoverer\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n s: ['thoddea sekondamni', 'thodde sekond'],\n ss: [number + ' sekondamni', number + ' sekond'],\n m: ['eka mintan', 'ek minut'],\n mm: [number + ' mintamni', number + ' mintam'],\n h: ['eka voran', 'ek vor'],\n hh: [number + ' voramni', number + ' voram'],\n d: ['eka disan', 'ek dis'],\n dd: [number + ' disamni', number + ' dis'],\n M: ['eka mhoinean', 'ek mhoino'],\n MM: [number + ' mhoineamni', number + ' mhoine'],\n y: ['eka vorsan', 'ek voros'],\n yy: [number + ' vorsamni', number + ' vorsam'],\n };\n return isFuture ? format[key][0] : format[key][1];\n }\n\n var gomLatn = moment.defineLocale('gom-latn', {\n months: {\n standalone: 'Janer_Febrer_Mars_Abril_Mai_Jun_Julai_Agost_Setembr_Otubr_Novembr_Dezembr'.split(\n '_'\n ),\n format: 'Janerachea_Febrerachea_Marsachea_Abrilachea_Maiachea_Junachea_Julaiachea_Agostachea_Setembrachea_Otubrachea_Novembrachea_Dezembrachea'.split(\n '_'\n ),\n isFormat: /MMMM(\\s)+D[oD]?/,\n },\n monthsShort: 'Jan._Feb._Mars_Abr._Mai_Jun_Jul._Ago._Set._Otu._Nov._Dez.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: \"Aitar_Somar_Mongllar_Budhvar_Birestar_Sukrar_Son'var\".split('_'),\n weekdaysShort: 'Ait._Som._Mon._Bud._Bre._Suk._Son.'.split('_'),\n weekdaysMin: 'Ai_Sm_Mo_Bu_Br_Su_Sn'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'A h:mm [vazta]',\n LTS: 'A h:mm:ss [vazta]',\n L: 'DD-MM-YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY A h:mm [vazta]',\n LLLL: 'dddd, MMMM Do, YYYY, A h:mm [vazta]',\n llll: 'ddd, D MMM YYYY, A h:mm [vazta]',\n },\n calendar: {\n sameDay: '[Aiz] LT',\n nextDay: '[Faleam] LT',\n nextWeek: '[Fuddlo] dddd[,] LT',\n lastDay: '[Kal] LT',\n lastWeek: '[Fattlo] dddd[,] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s',\n past: '%s adim',\n s: processRelativeTime,\n ss: processRelativeTime,\n m: processRelativeTime,\n mm: processRelativeTime,\n h: processRelativeTime,\n hh: processRelativeTime,\n d: processRelativeTime,\n dd: processRelativeTime,\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(er)/,\n ordinal: function (number, period) {\n switch (period) {\n // the ordinal 'er' only applies to day of the month\n case 'D':\n return number + 'er';\n default:\n case 'M':\n case 'Q':\n case 'DDD':\n case 'd':\n case 'w':\n case 'W':\n return number;\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week\n doy: 3, // The week that contains Jan 4th is the first week of the year (7 + 0 - 4)\n },\n meridiemParse: /rati|sokallim|donparam|sanje/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'rati') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'sokallim') {\n return hour;\n } else if (meridiem === 'donparam') {\n return hour > 12 ? hour : hour + 12;\n } else if (meridiem === 'sanje') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'rati';\n } else if (hour < 12) {\n return 'sokallim';\n } else if (hour < 16) {\n return 'donparam';\n } else if (hour < 20) {\n return 'sanje';\n } else {\n return 'rati';\n }\n },\n });\n\n return gomLatn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Gujarati [gu]\n//! author : Kaushik Thanki : https://github.com/Kaushik1987\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '૧',\n 2: '૨',\n 3: '૩',\n 4: '૪',\n 5: '૫',\n 6: '૬',\n 7: '૭',\n 8: '૮',\n 9: '૯',\n 0: '૦',\n },\n numberMap = {\n '૧': '1',\n '૨': '2',\n '૩': '3',\n '૪': '4',\n '૫': '5',\n '૬': '6',\n '૭': '7',\n '૮': '8',\n '૯': '9',\n '૦': '0',\n };\n\n var gu = moment.defineLocale('gu', {\n months: 'જાન્યુઆરી_ફેબ્રુઆરી_માર્ચ_એપ્રિલ_મે_જૂન_જુલાઈ_ઑગસ્ટ_સપ્ટેમ્બર_ઑક્ટ્બર_નવેમ્બર_ડિસેમ્બર'.split(\n '_'\n ),\n monthsShort: 'જાન્યુ._ફેબ્રુ._માર્ચ_એપ્રિ._મે_જૂન_જુલા._ઑગ._સપ્ટે._ઑક્ટ્._નવે._ડિસે.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'રવિવાર_સોમવાર_મંગળવાર_બુધ્વાર_ગુરુવાર_શુક્રવાર_શનિવાર'.split(\n '_'\n ),\n weekdaysShort: 'રવિ_સોમ_મંગળ_બુધ્_ગુરુ_શુક્ર_શનિ'.split('_'),\n weekdaysMin: 'ર_સો_મં_બુ_ગુ_શુ_શ'.split('_'),\n longDateFormat: {\n LT: 'A h:mm વાગ્યે',\n LTS: 'A h:mm:ss વાગ્યે',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm વાગ્યે',\n LLLL: 'dddd, D MMMM YYYY, A h:mm વાગ્યે',\n },\n calendar: {\n sameDay: '[આજ] LT',\n nextDay: '[કાલે] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[ગઇકાલે] LT',\n lastWeek: '[પાછલા] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s મા',\n past: '%s પહેલા',\n s: 'અમુક પળો',\n ss: '%d સેકંડ',\n m: 'એક મિનિટ',\n mm: '%d મિનિટ',\n h: 'એક કલાક',\n hh: '%d કલાક',\n d: 'એક દિવસ',\n dd: '%d દિવસ',\n M: 'એક મહિનો',\n MM: '%d મહિનો',\n y: 'એક વર્ષ',\n yy: '%d વર્ષ',\n },\n preparse: function (string) {\n return string.replace(/[૧૨૩૪૫૬૭૮૯૦]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n // Gujarati notation for meridiems are quite fuzzy in practice. While there exists\n // a rigid notion of a 'Pahar' it is not used as rigidly in modern Gujarati.\n meridiemParse: /રાત|બપોર|સવાર|સાંજ/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'રાત') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'સવાર') {\n return hour;\n } else if (meridiem === 'બપોર') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'સાંજ') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'રાત';\n } else if (hour < 10) {\n return 'સવાર';\n } else if (hour < 17) {\n return 'બપોર';\n } else if (hour < 20) {\n return 'સાંજ';\n } else {\n return 'રાત';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return gu;\n\n})));\n","//! moment.js locale configuration\n//! locale : Hebrew [he]\n//! author : Tomer Cohen : https://github.com/tomer\n//! author : Moshe Simantov : https://github.com/DevelopmentIL\n//! author : Tal Ater : https://github.com/TalAter\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var he = moment.defineLocale('he', {\n months: 'ינואר_פברואר_מרץ_אפריל_מאי_יוני_יולי_אוגוסט_ספטמבר_אוקטובר_נובמבר_דצמבר'.split(\n '_'\n ),\n monthsShort: 'ינו׳_פבר׳_מרץ_אפר׳_מאי_יוני_יולי_אוג׳_ספט׳_אוק׳_נוב׳_דצמ׳'.split(\n '_'\n ),\n weekdays: 'ראשון_שני_שלישי_רביעי_חמישי_שישי_שבת'.split('_'),\n weekdaysShort: 'א׳_ב׳_ג׳_ד׳_ה׳_ו׳_ש׳'.split('_'),\n weekdaysMin: 'א_ב_ג_ד_ה_ו_ש'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D [ב]MMMM YYYY',\n LLL: 'D [ב]MMMM YYYY HH:mm',\n LLLL: 'dddd, D [ב]MMMM YYYY HH:mm',\n l: 'D/M/YYYY',\n ll: 'D MMM YYYY',\n lll: 'D MMM YYYY HH:mm',\n llll: 'ddd, D MMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[היום ב־]LT',\n nextDay: '[מחר ב־]LT',\n nextWeek: 'dddd [בשעה] LT',\n lastDay: '[אתמול ב־]LT',\n lastWeek: '[ביום] dddd [האחרון בשעה] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'בעוד %s',\n past: 'לפני %s',\n s: 'מספר שניות',\n ss: '%d שניות',\n m: 'דקה',\n mm: '%d דקות',\n h: 'שעה',\n hh: function (number) {\n if (number === 2) {\n return 'שעתיים';\n }\n return number + ' שעות';\n },\n d: 'יום',\n dd: function (number) {\n if (number === 2) {\n return 'יומיים';\n }\n return number + ' ימים';\n },\n M: 'חודש',\n MM: function (number) {\n if (number === 2) {\n return 'חודשיים';\n }\n return number + ' חודשים';\n },\n y: 'שנה',\n yy: function (number) {\n if (number === 2) {\n return 'שנתיים';\n } else if (number % 10 === 0 && number !== 10) {\n return number + ' שנה';\n }\n return number + ' שנים';\n },\n },\n meridiemParse: /אחה\"צ|לפנה\"צ|אחרי הצהריים|לפני הצהריים|לפנות בוקר|בבוקר|בערב/i,\n isPM: function (input) {\n return /^(אחה\"צ|אחרי הצהריים|בערב)$/.test(input);\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 5) {\n return 'לפנות בוקר';\n } else if (hour < 10) {\n return 'בבוקר';\n } else if (hour < 12) {\n return isLower ? 'לפנה\"צ' : 'לפני הצהריים';\n } else if (hour < 18) {\n return isLower ? 'אחה\"צ' : 'אחרי הצהריים';\n } else {\n return 'בערב';\n }\n },\n });\n\n return he;\n\n})));\n","//! moment.js locale configuration\n//! locale : Hindi [hi]\n//! author : Mayank Singhal : https://github.com/mayanksinghal\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '१',\n 2: '२',\n 3: '३',\n 4: '४',\n 5: '५',\n 6: '६',\n 7: '७',\n 8: '८',\n 9: '९',\n 0: '०',\n },\n numberMap = {\n '१': '1',\n '२': '2',\n '३': '3',\n '४': '4',\n '५': '5',\n '६': '6',\n '७': '7',\n '८': '8',\n '९': '9',\n '०': '0',\n },\n monthsParse = [\n /^जन/i,\n /^फ़र|फर/i,\n /^मार्च/i,\n /^अप्रै/i,\n /^मई/i,\n /^जून/i,\n /^जुल/i,\n /^अग/i,\n /^सितं|सित/i,\n /^अक्टू/i,\n /^नव|नवं/i,\n /^दिसं|दिस/i,\n ],\n shortMonthsParse = [\n /^जन/i,\n /^फ़र/i,\n /^मार्च/i,\n /^अप्रै/i,\n /^मई/i,\n /^जून/i,\n /^जुल/i,\n /^अग/i,\n /^सित/i,\n /^अक्टू/i,\n /^नव/i,\n /^दिस/i,\n ];\n\n var hi = moment.defineLocale('hi', {\n months: {\n format: 'जनवरी_फ़रवरी_मार्च_अप्रैल_मई_जून_जुलाई_अगस्त_सितम्बर_अक्टूबर_नवम्बर_दिसम्बर'.split(\n '_'\n ),\n standalone: 'जनवरी_फरवरी_मार्च_अप्रैल_मई_जून_जुलाई_अगस्त_सितंबर_अक्टूबर_नवंबर_दिसंबर'.split(\n '_'\n ),\n },\n monthsShort: 'जन._फ़र._मार्च_अप्रै._मई_जून_जुल._अग._सित._अक्टू._नव._दिस.'.split(\n '_'\n ),\n weekdays: 'रविवार_सोमवार_मंगलवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split('_'),\n weekdaysShort: 'रवि_सोम_मंगल_बुध_गुरू_शुक्र_शनि'.split('_'),\n weekdaysMin: 'र_सो_मं_बु_गु_शु_श'.split('_'),\n longDateFormat: {\n LT: 'A h:mm बजे',\n LTS: 'A h:mm:ss बजे',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm बजे',\n LLLL: 'dddd, D MMMM YYYY, A h:mm बजे',\n },\n\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: shortMonthsParse,\n\n monthsRegex: /^(जनवरी|जन\\.?|फ़रवरी|फरवरी|फ़र\\.?|मार्च?|अप्रैल|अप्रै\\.?|मई?|जून?|जुलाई|जुल\\.?|अगस्त|अग\\.?|सितम्बर|सितंबर|सित\\.?|अक्टूबर|अक्टू\\.?|नवम्बर|नवंबर|नव\\.?|दिसम्बर|दिसंबर|दिस\\.?)/i,\n\n monthsShortRegex: /^(जनवरी|जन\\.?|फ़रवरी|फरवरी|फ़र\\.?|मार्च?|अप्रैल|अप्रै\\.?|मई?|जून?|जुलाई|जुल\\.?|अगस्त|अग\\.?|सितम्बर|सितंबर|सित\\.?|अक्टूबर|अक्टू\\.?|नवम्बर|नवंबर|नव\\.?|दिसम्बर|दिसंबर|दिस\\.?)/i,\n\n monthsStrictRegex: /^(जनवरी?|फ़रवरी|फरवरी?|मार्च?|अप्रैल?|मई?|जून?|जुलाई?|अगस्त?|सितम्बर|सितंबर|सित?\\.?|अक्टूबर|अक्टू\\.?|नवम्बर|नवंबर?|दिसम्बर|दिसंबर?)/i,\n\n monthsShortStrictRegex: /^(जन\\.?|फ़र\\.?|मार्च?|अप्रै\\.?|मई?|जून?|जुल\\.?|अग\\.?|सित\\.?|अक्टू\\.?|नव\\.?|दिस\\.?)/i,\n\n calendar: {\n sameDay: '[आज] LT',\n nextDay: '[कल] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[कल] LT',\n lastWeek: '[पिछले] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s में',\n past: '%s पहले',\n s: 'कुछ ही क्षण',\n ss: '%d सेकंड',\n m: 'एक मिनट',\n mm: '%d मिनट',\n h: 'एक घंटा',\n hh: '%d घंटे',\n d: 'एक दिन',\n dd: '%d दिन',\n M: 'एक महीने',\n MM: '%d महीने',\n y: 'एक वर्ष',\n yy: '%d वर्ष',\n },\n preparse: function (string) {\n return string.replace(/[१२३४५६७८९०]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n // Hindi notation for meridiems are quite fuzzy in practice. While there exists\n // a rigid notion of a 'Pahar' it is not used as rigidly in modern Hindi.\n meridiemParse: /रात|सुबह|दोपहर|शाम/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'रात') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'सुबह') {\n return hour;\n } else if (meridiem === 'दोपहर') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'शाम') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'रात';\n } else if (hour < 10) {\n return 'सुबह';\n } else if (hour < 17) {\n return 'दोपहर';\n } else if (hour < 20) {\n return 'शाम';\n } else {\n return 'रात';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return hi;\n\n})));\n","//! moment.js locale configuration\n//! locale : Croatian [hr]\n//! author : Bojan Marković : https://github.com/bmarkovic\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function translate(number, withoutSuffix, key) {\n var result = number + ' ';\n switch (key) {\n case 'ss':\n if (number === 1) {\n result += 'sekunda';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'sekunde';\n } else {\n result += 'sekundi';\n }\n return result;\n case 'm':\n return withoutSuffix ? 'jedna minuta' : 'jedne minute';\n case 'mm':\n if (number === 1) {\n result += 'minuta';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'minute';\n } else {\n result += 'minuta';\n }\n return result;\n case 'h':\n return withoutSuffix ? 'jedan sat' : 'jednog sata';\n case 'hh':\n if (number === 1) {\n result += 'sat';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'sata';\n } else {\n result += 'sati';\n }\n return result;\n case 'dd':\n if (number === 1) {\n result += 'dan';\n } else {\n result += 'dana';\n }\n return result;\n case 'MM':\n if (number === 1) {\n result += 'mjesec';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'mjeseca';\n } else {\n result += 'mjeseci';\n }\n return result;\n case 'yy':\n if (number === 1) {\n result += 'godina';\n } else if (number === 2 || number === 3 || number === 4) {\n result += 'godine';\n } else {\n result += 'godina';\n }\n return result;\n }\n }\n\n var hr = moment.defineLocale('hr', {\n months: {\n format: 'siječnja_veljače_ožujka_travnja_svibnja_lipnja_srpnja_kolovoza_rujna_listopada_studenoga_prosinca'.split(\n '_'\n ),\n standalone: 'siječanj_veljača_ožujak_travanj_svibanj_lipanj_srpanj_kolovoz_rujan_listopad_studeni_prosinac'.split(\n '_'\n ),\n },\n monthsShort: 'sij._velj._ožu._tra._svi._lip._srp._kol._ruj._lis._stu._pro.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'nedjelja_ponedjeljak_utorak_srijeda_četvrtak_petak_subota'.split(\n '_'\n ),\n weekdaysShort: 'ned._pon._uto._sri._čet._pet._sub.'.split('_'),\n weekdaysMin: 'ne_po_ut_sr_če_pe_su'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'Do MMMM YYYY',\n LLL: 'Do MMMM YYYY H:mm',\n LLLL: 'dddd, Do MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[danas u] LT',\n nextDay: '[sutra u] LT',\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[u] [nedjelju] [u] LT';\n case 3:\n return '[u] [srijedu] [u] LT';\n case 6:\n return '[u] [subotu] [u] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[u] dddd [u] LT';\n }\n },\n lastDay: '[jučer u] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[prošlu] [nedjelju] [u] LT';\n case 3:\n return '[prošlu] [srijedu] [u] LT';\n case 6:\n return '[prošle] [subote] [u] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[prošli] dddd [u] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'za %s',\n past: 'prije %s',\n s: 'par sekundi',\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: 'dan',\n dd: translate,\n M: 'mjesec',\n MM: translate,\n y: 'godinu',\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return hr;\n\n})));\n","//! moment.js locale configuration\n//! locale : Hungarian [hu]\n//! author : Adam Brunner : https://github.com/adambrunner\n//! author : Peter Viszt : https://github.com/passatgt\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var weekEndings = 'vasárnap hétfőn kedden szerdán csütörtökön pénteken szombaton'.split(\n ' '\n );\n function translate(number, withoutSuffix, key, isFuture) {\n var num = number;\n switch (key) {\n case 's':\n return isFuture || withoutSuffix\n ? 'néhány másodperc'\n : 'néhány másodperce';\n case 'ss':\n return num + (isFuture || withoutSuffix)\n ? ' másodperc'\n : ' másodperce';\n case 'm':\n return 'egy' + (isFuture || withoutSuffix ? ' perc' : ' perce');\n case 'mm':\n return num + (isFuture || withoutSuffix ? ' perc' : ' perce');\n case 'h':\n return 'egy' + (isFuture || withoutSuffix ? ' óra' : ' órája');\n case 'hh':\n return num + (isFuture || withoutSuffix ? ' óra' : ' órája');\n case 'd':\n return 'egy' + (isFuture || withoutSuffix ? ' nap' : ' napja');\n case 'dd':\n return num + (isFuture || withoutSuffix ? ' nap' : ' napja');\n case 'M':\n return 'egy' + (isFuture || withoutSuffix ? ' hónap' : ' hónapja');\n case 'MM':\n return num + (isFuture || withoutSuffix ? ' hónap' : ' hónapja');\n case 'y':\n return 'egy' + (isFuture || withoutSuffix ? ' év' : ' éve');\n case 'yy':\n return num + (isFuture || withoutSuffix ? ' év' : ' éve');\n }\n return '';\n }\n function week(isFuture) {\n return (\n (isFuture ? '' : '[múlt] ') +\n '[' +\n weekEndings[this.day()] +\n '] LT[-kor]'\n );\n }\n\n var hu = moment.defineLocale('hu', {\n months: 'január_február_március_április_május_június_július_augusztus_szeptember_október_november_december'.split(\n '_'\n ),\n monthsShort: 'jan._feb._márc._ápr._máj._jún._júl._aug._szept._okt._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'vasárnap_hétfő_kedd_szerda_csütörtök_péntek_szombat'.split('_'),\n weekdaysShort: 'vas_hét_kedd_sze_csüt_pén_szo'.split('_'),\n weekdaysMin: 'v_h_k_sze_cs_p_szo'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'YYYY.MM.DD.',\n LL: 'YYYY. MMMM D.',\n LLL: 'YYYY. MMMM D. H:mm',\n LLLL: 'YYYY. MMMM D., dddd H:mm',\n },\n meridiemParse: /de|du/i,\n isPM: function (input) {\n return input.charAt(1).toLowerCase() === 'u';\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours < 12) {\n return isLower === true ? 'de' : 'DE';\n } else {\n return isLower === true ? 'du' : 'DU';\n }\n },\n calendar: {\n sameDay: '[ma] LT[-kor]',\n nextDay: '[holnap] LT[-kor]',\n nextWeek: function () {\n return week.call(this, true);\n },\n lastDay: '[tegnap] LT[-kor]',\n lastWeek: function () {\n return week.call(this, false);\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s múlva',\n past: '%s',\n s: translate,\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: translate,\n dd: translate,\n M: translate,\n MM: translate,\n y: translate,\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return hu;\n\n})));\n","//! moment.js locale configuration\n//! locale : Armenian [hy-am]\n//! author : Armendarabyan : https://github.com/armendarabyan\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var hyAm = moment.defineLocale('hy-am', {\n months: {\n format: 'հունվարի_փետրվարի_մարտի_ապրիլի_մայիսի_հունիսի_հուլիսի_օգոստոսի_սեպտեմբերի_հոկտեմբերի_նոյեմբերի_դեկտեմբերի'.split(\n '_'\n ),\n standalone: 'հունվար_փետրվար_մարտ_ապրիլ_մայիս_հունիս_հուլիս_օգոստոս_սեպտեմբեր_հոկտեմբեր_նոյեմբեր_դեկտեմբեր'.split(\n '_'\n ),\n },\n monthsShort: 'հնվ_փտր_մրտ_ապր_մյս_հնս_հլս_օգս_սպտ_հկտ_նմբ_դկտ'.split('_'),\n weekdays: 'կիրակի_երկուշաբթի_երեքշաբթի_չորեքշաբթի_հինգշաբթի_ուրբաթ_շաբաթ'.split(\n '_'\n ),\n weekdaysShort: 'կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ'.split('_'),\n weekdaysMin: 'կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY թ.',\n LLL: 'D MMMM YYYY թ., HH:mm',\n LLLL: 'dddd, D MMMM YYYY թ., HH:mm',\n },\n calendar: {\n sameDay: '[այսօր] LT',\n nextDay: '[վաղը] LT',\n lastDay: '[երեկ] LT',\n nextWeek: function () {\n return 'dddd [օրը ժամը] LT';\n },\n lastWeek: function () {\n return '[անցած] dddd [օրը ժամը] LT';\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s հետո',\n past: '%s առաջ',\n s: 'մի քանի վայրկյան',\n ss: '%d վայրկյան',\n m: 'րոպե',\n mm: '%d րոպե',\n h: 'ժամ',\n hh: '%d ժամ',\n d: 'օր',\n dd: '%d օր',\n M: 'ամիս',\n MM: '%d ամիս',\n y: 'տարի',\n yy: '%d տարի',\n },\n meridiemParse: /գիշերվա|առավոտվա|ցերեկվա|երեկոյան/,\n isPM: function (input) {\n return /^(ցերեկվա|երեկոյան)$/.test(input);\n },\n meridiem: function (hour) {\n if (hour < 4) {\n return 'գիշերվա';\n } else if (hour < 12) {\n return 'առավոտվա';\n } else if (hour < 17) {\n return 'ցերեկվա';\n } else {\n return 'երեկոյան';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}|\\d{1,2}-(ին|րդ)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'DDD':\n case 'w':\n case 'W':\n case 'DDDo':\n if (number === 1) {\n return number + '-ին';\n }\n return number + '-րդ';\n default:\n return number;\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return hyAm;\n\n})));\n","//! moment.js locale configuration\n//! locale : Indonesian [id]\n//! author : Mohammad Satrio Utomo : https://github.com/tyok\n//! reference: http://id.wikisource.org/wiki/Pedoman_Umum_Ejaan_Bahasa_Indonesia_yang_Disempurnakan\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var id = moment.defineLocale('id', {\n months: 'Januari_Februari_Maret_April_Mei_Juni_Juli_Agustus_September_Oktober_November_Desember'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_Mei_Jun_Jul_Agt_Sep_Okt_Nov_Des'.split('_'),\n weekdays: 'Minggu_Senin_Selasa_Rabu_Kamis_Jumat_Sabtu'.split('_'),\n weekdaysShort: 'Min_Sen_Sel_Rab_Kam_Jum_Sab'.split('_'),\n weekdaysMin: 'Mg_Sn_Sl_Rb_Km_Jm_Sb'.split('_'),\n longDateFormat: {\n LT: 'HH.mm',\n LTS: 'HH.mm.ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY [pukul] HH.mm',\n LLLL: 'dddd, D MMMM YYYY [pukul] HH.mm',\n },\n meridiemParse: /pagi|siang|sore|malam/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'pagi') {\n return hour;\n } else if (meridiem === 'siang') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'sore' || meridiem === 'malam') {\n return hour + 12;\n }\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'pagi';\n } else if (hours < 15) {\n return 'siang';\n } else if (hours < 19) {\n return 'sore';\n } else {\n return 'malam';\n }\n },\n calendar: {\n sameDay: '[Hari ini pukul] LT',\n nextDay: '[Besok pukul] LT',\n nextWeek: 'dddd [pukul] LT',\n lastDay: '[Kemarin pukul] LT',\n lastWeek: 'dddd [lalu pukul] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'dalam %s',\n past: '%s yang lalu',\n s: 'beberapa detik',\n ss: '%d detik',\n m: 'semenit',\n mm: '%d menit',\n h: 'sejam',\n hh: '%d jam',\n d: 'sehari',\n dd: '%d hari',\n M: 'sebulan',\n MM: '%d bulan',\n y: 'setahun',\n yy: '%d tahun',\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return id;\n\n})));\n","//! moment.js locale configuration\n//! locale : Icelandic [is]\n//! author : Hinrik Örn Sigurðsson : https://github.com/hinrik\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function plural(n) {\n if (n % 100 === 11) {\n return true;\n } else if (n % 10 === 1) {\n return false;\n }\n return true;\n }\n function translate(number, withoutSuffix, key, isFuture) {\n var result = number + ' ';\n switch (key) {\n case 's':\n return withoutSuffix || isFuture\n ? 'nokkrar sekúndur'\n : 'nokkrum sekúndum';\n case 'ss':\n if (plural(number)) {\n return (\n result +\n (withoutSuffix || isFuture ? 'sekúndur' : 'sekúndum')\n );\n }\n return result + 'sekúnda';\n case 'm':\n return withoutSuffix ? 'mínúta' : 'mínútu';\n case 'mm':\n if (plural(number)) {\n return (\n result + (withoutSuffix || isFuture ? 'mínútur' : 'mínútum')\n );\n } else if (withoutSuffix) {\n return result + 'mínúta';\n }\n return result + 'mínútu';\n case 'hh':\n if (plural(number)) {\n return (\n result +\n (withoutSuffix || isFuture\n ? 'klukkustundir'\n : 'klukkustundum')\n );\n }\n return result + 'klukkustund';\n case 'd':\n if (withoutSuffix) {\n return 'dagur';\n }\n return isFuture ? 'dag' : 'degi';\n case 'dd':\n if (plural(number)) {\n if (withoutSuffix) {\n return result + 'dagar';\n }\n return result + (isFuture ? 'daga' : 'dögum');\n } else if (withoutSuffix) {\n return result + 'dagur';\n }\n return result + (isFuture ? 'dag' : 'degi');\n case 'M':\n if (withoutSuffix) {\n return 'mánuður';\n }\n return isFuture ? 'mánuð' : 'mánuði';\n case 'MM':\n if (plural(number)) {\n if (withoutSuffix) {\n return result + 'mánuðir';\n }\n return result + (isFuture ? 'mánuði' : 'mánuðum');\n } else if (withoutSuffix) {\n return result + 'mánuður';\n }\n return result + (isFuture ? 'mánuð' : 'mánuði');\n case 'y':\n return withoutSuffix || isFuture ? 'ár' : 'ári';\n case 'yy':\n if (plural(number)) {\n return result + (withoutSuffix || isFuture ? 'ár' : 'árum');\n }\n return result + (withoutSuffix || isFuture ? 'ár' : 'ári');\n }\n }\n\n var is = moment.defineLocale('is', {\n months: 'janúar_febrúar_mars_apríl_maí_júní_júlí_ágúst_september_október_nóvember_desember'.split(\n '_'\n ),\n monthsShort: 'jan_feb_mar_apr_maí_jún_júl_ágú_sep_okt_nóv_des'.split('_'),\n weekdays: 'sunnudagur_mánudagur_þriðjudagur_miðvikudagur_fimmtudagur_föstudagur_laugardagur'.split(\n '_'\n ),\n weekdaysShort: 'sun_mán_þri_mið_fim_fös_lau'.split('_'),\n weekdaysMin: 'Su_Má_Þr_Mi_Fi_Fö_La'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY [kl.] H:mm',\n LLLL: 'dddd, D. MMMM YYYY [kl.] H:mm',\n },\n calendar: {\n sameDay: '[í dag kl.] LT',\n nextDay: '[á morgun kl.] LT',\n nextWeek: 'dddd [kl.] LT',\n lastDay: '[í gær kl.] LT',\n lastWeek: '[síðasta] dddd [kl.] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'eftir %s',\n past: 'fyrir %s síðan',\n s: translate,\n ss: translate,\n m: translate,\n mm: translate,\n h: 'klukkustund',\n hh: translate,\n d: translate,\n dd: translate,\n M: translate,\n MM: translate,\n y: translate,\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return is;\n\n})));\n","//! moment.js locale configuration\n//! locale : Italian (Switzerland) [it-ch]\n//! author : xfh : https://github.com/xfh\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var itCh = moment.defineLocale('it-ch', {\n months: 'gennaio_febbraio_marzo_aprile_maggio_giugno_luglio_agosto_settembre_ottobre_novembre_dicembre'.split(\n '_'\n ),\n monthsShort: 'gen_feb_mar_apr_mag_giu_lug_ago_set_ott_nov_dic'.split('_'),\n weekdays: 'domenica_lunedì_martedì_mercoledì_giovedì_venerdì_sabato'.split(\n '_'\n ),\n weekdaysShort: 'dom_lun_mar_mer_gio_ven_sab'.split('_'),\n weekdaysMin: 'do_lu_ma_me_gi_ve_sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Oggi alle] LT',\n nextDay: '[Domani alle] LT',\n nextWeek: 'dddd [alle] LT',\n lastDay: '[Ieri alle] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[la scorsa] dddd [alle] LT';\n default:\n return '[lo scorso] dddd [alle] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: function (s) {\n return (/^[0-9].+$/.test(s) ? 'tra' : 'in') + ' ' + s;\n },\n past: '%s fa',\n s: 'alcuni secondi',\n ss: '%d secondi',\n m: 'un minuto',\n mm: '%d minuti',\n h: \"un'ora\",\n hh: '%d ore',\n d: 'un giorno',\n dd: '%d giorni',\n M: 'un mese',\n MM: '%d mesi',\n y: 'un anno',\n yy: '%d anni',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return itCh;\n\n})));\n","//! moment.js locale configuration\n//! locale : Italian [it]\n//! author : Lorenzo : https://github.com/aliem\n//! author: Mattia Larentis: https://github.com/nostalgiaz\n//! author: Marco : https://github.com/Manfre98\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var it = moment.defineLocale('it', {\n months: 'gennaio_febbraio_marzo_aprile_maggio_giugno_luglio_agosto_settembre_ottobre_novembre_dicembre'.split(\n '_'\n ),\n monthsShort: 'gen_feb_mar_apr_mag_giu_lug_ago_set_ott_nov_dic'.split('_'),\n weekdays: 'domenica_lunedì_martedì_mercoledì_giovedì_venerdì_sabato'.split(\n '_'\n ),\n weekdaysShort: 'dom_lun_mar_mer_gio_ven_sab'.split('_'),\n weekdaysMin: 'do_lu_ma_me_gi_ve_sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: function () {\n return (\n '[Oggi a' +\n (this.hours() > 1 ? 'lle ' : this.hours() === 0 ? ' ' : \"ll'\") +\n ']LT'\n );\n },\n nextDay: function () {\n return (\n '[Domani a' +\n (this.hours() > 1 ? 'lle ' : this.hours() === 0 ? ' ' : \"ll'\") +\n ']LT'\n );\n },\n nextWeek: function () {\n return (\n 'dddd [a' +\n (this.hours() > 1 ? 'lle ' : this.hours() === 0 ? ' ' : \"ll'\") +\n ']LT'\n );\n },\n lastDay: function () {\n return (\n '[Ieri a' +\n (this.hours() > 1 ? 'lle ' : this.hours() === 0 ? ' ' : \"ll'\") +\n ']LT'\n );\n },\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return (\n '[La scorsa] dddd [a' +\n (this.hours() > 1\n ? 'lle '\n : this.hours() === 0\n ? ' '\n : \"ll'\") +\n ']LT'\n );\n default:\n return (\n '[Lo scorso] dddd [a' +\n (this.hours() > 1\n ? 'lle '\n : this.hours() === 0\n ? ' '\n : \"ll'\") +\n ']LT'\n );\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'tra %s',\n past: '%s fa',\n s: 'alcuni secondi',\n ss: '%d secondi',\n m: 'un minuto',\n mm: '%d minuti',\n h: \"un'ora\",\n hh: '%d ore',\n d: 'un giorno',\n dd: '%d giorni',\n w: 'una settimana',\n ww: '%d settimane',\n M: 'un mese',\n MM: '%d mesi',\n y: 'un anno',\n yy: '%d anni',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return it;\n\n})));\n","//! moment.js locale configuration\n//! locale : Japanese [ja]\n//! author : LI Long : https://github.com/baryon\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ja = moment.defineLocale('ja', {\n eras: [\n {\n since: '2019-05-01',\n offset: 1,\n name: '令和',\n narrow: '㋿',\n abbr: 'R',\n },\n {\n since: '1989-01-08',\n until: '2019-04-30',\n offset: 1,\n name: '平成',\n narrow: '㍻',\n abbr: 'H',\n },\n {\n since: '1926-12-25',\n until: '1989-01-07',\n offset: 1,\n name: '昭和',\n narrow: '㍼',\n abbr: 'S',\n },\n {\n since: '1912-07-30',\n until: '1926-12-24',\n offset: 1,\n name: '大正',\n narrow: '㍽',\n abbr: 'T',\n },\n {\n since: '1873-01-01',\n until: '1912-07-29',\n offset: 6,\n name: '明治',\n narrow: '㍾',\n abbr: 'M',\n },\n {\n since: '0001-01-01',\n until: '1873-12-31',\n offset: 1,\n name: '西暦',\n narrow: 'AD',\n abbr: 'AD',\n },\n {\n since: '0000-12-31',\n until: -Infinity,\n offset: 1,\n name: '紀元前',\n narrow: 'BC',\n abbr: 'BC',\n },\n ],\n eraYearOrdinalRegex: /(元|\\d+)年/,\n eraYearOrdinalParse: function (input, match) {\n return match[1] === '元' ? 1 : parseInt(match[1] || input, 10);\n },\n months: '1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月'.split('_'),\n monthsShort: '1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月'.split(\n '_'\n ),\n weekdays: '日曜日_月曜日_火曜日_水曜日_木曜日_金曜日_土曜日'.split('_'),\n weekdaysShort: '日_月_火_水_木_金_土'.split('_'),\n weekdaysMin: '日_月_火_水_木_金_土'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY/MM/DD',\n LL: 'YYYY年M月D日',\n LLL: 'YYYY年M月D日 HH:mm',\n LLLL: 'YYYY年M月D日 dddd HH:mm',\n l: 'YYYY/MM/DD',\n ll: 'YYYY年M月D日',\n lll: 'YYYY年M月D日 HH:mm',\n llll: 'YYYY年M月D日(ddd) HH:mm',\n },\n meridiemParse: /午前|午後/i,\n isPM: function (input) {\n return input === '午後';\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return '午前';\n } else {\n return '午後';\n }\n },\n calendar: {\n sameDay: '[今日] LT',\n nextDay: '[明日] LT',\n nextWeek: function (now) {\n if (now.week() !== this.week()) {\n return '[来週]dddd LT';\n } else {\n return 'dddd LT';\n }\n },\n lastDay: '[昨日] LT',\n lastWeek: function (now) {\n if (this.week() !== now.week()) {\n return '[先週]dddd LT';\n } else {\n return 'dddd LT';\n }\n },\n sameElse: 'L',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}日/,\n ordinal: function (number, period) {\n switch (period) {\n case 'y':\n return number === 1 ? '元年' : number + '年';\n case 'd':\n case 'D':\n case 'DDD':\n return number + '日';\n default:\n return number;\n }\n },\n relativeTime: {\n future: '%s後',\n past: '%s前',\n s: '数秒',\n ss: '%d秒',\n m: '1分',\n mm: '%d分',\n h: '1時間',\n hh: '%d時間',\n d: '1日',\n dd: '%d日',\n M: '1ヶ月',\n MM: '%dヶ月',\n y: '1年',\n yy: '%d年',\n },\n });\n\n return ja;\n\n})));\n","//! moment.js locale configuration\n//! locale : Javanese [jv]\n//! author : Rony Lantip : https://github.com/lantip\n//! reference: http://jv.wikipedia.org/wiki/Basa_Jawa\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var jv = moment.defineLocale('jv', {\n months: 'Januari_Februari_Maret_April_Mei_Juni_Juli_Agustus_September_Oktober_Nopember_Desember'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mar_Apr_Mei_Jun_Jul_Ags_Sep_Okt_Nop_Des'.split('_'),\n weekdays: 'Minggu_Senen_Seloso_Rebu_Kemis_Jemuwah_Septu'.split('_'),\n weekdaysShort: 'Min_Sen_Sel_Reb_Kem_Jem_Sep'.split('_'),\n weekdaysMin: 'Mg_Sn_Sl_Rb_Km_Jm_Sp'.split('_'),\n longDateFormat: {\n LT: 'HH.mm',\n LTS: 'HH.mm.ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY [pukul] HH.mm',\n LLLL: 'dddd, D MMMM YYYY [pukul] HH.mm',\n },\n meridiemParse: /enjing|siyang|sonten|ndalu/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'enjing') {\n return hour;\n } else if (meridiem === 'siyang') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'sonten' || meridiem === 'ndalu') {\n return hour + 12;\n }\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'enjing';\n } else if (hours < 15) {\n return 'siyang';\n } else if (hours < 19) {\n return 'sonten';\n } else {\n return 'ndalu';\n }\n },\n calendar: {\n sameDay: '[Dinten puniko pukul] LT',\n nextDay: '[Mbenjang pukul] LT',\n nextWeek: 'dddd [pukul] LT',\n lastDay: '[Kala wingi pukul] LT',\n lastWeek: 'dddd [kepengker pukul] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'wonten ing %s',\n past: '%s ingkang kepengker',\n s: 'sawetawis detik',\n ss: '%d detik',\n m: 'setunggal menit',\n mm: '%d menit',\n h: 'setunggal jam',\n hh: '%d jam',\n d: 'sedinten',\n dd: '%d dinten',\n M: 'sewulan',\n MM: '%d wulan',\n y: 'setaun',\n yy: '%d taun',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return jv;\n\n})));\n","//! moment.js locale configuration\n//! locale : Georgian [ka]\n//! author : Irakli Janiashvili : https://github.com/IrakliJani\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ka = moment.defineLocale('ka', {\n months: 'იანვარი_თებერვალი_მარტი_აპრილი_მაისი_ივნისი_ივლისი_აგვისტო_სექტემბერი_ოქტომბერი_ნოემბერი_დეკემბერი'.split(\n '_'\n ),\n monthsShort: 'იან_თებ_მარ_აპრ_მაი_ივნ_ივლ_აგვ_სექ_ოქტ_ნოე_დეკ'.split('_'),\n weekdays: {\n standalone: 'კვირა_ორშაბათი_სამშაბათი_ოთხშაბათი_ხუთშაბათი_პარასკევი_შაბათი'.split(\n '_'\n ),\n format: 'კვირას_ორშაბათს_სამშაბათს_ოთხშაბათს_ხუთშაბათს_პარასკევს_შაბათს'.split(\n '_'\n ),\n isFormat: /(წინა|შემდეგ)/,\n },\n weekdaysShort: 'კვი_ორშ_სამ_ოთხ_ხუთ_პარ_შაბ'.split('_'),\n weekdaysMin: 'კვ_ორ_სა_ოთ_ხუ_პა_შა'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[დღეს] LT[-ზე]',\n nextDay: '[ხვალ] LT[-ზე]',\n lastDay: '[გუშინ] LT[-ზე]',\n nextWeek: '[შემდეგ] dddd LT[-ზე]',\n lastWeek: '[წინა] dddd LT-ზე',\n sameElse: 'L',\n },\n relativeTime: {\n future: function (s) {\n return s.replace(/(წამ|წუთ|საათ|წელ|დღ|თვ)(ი|ე)/, function (\n $0,\n $1,\n $2\n ) {\n return $2 === 'ი' ? $1 + 'ში' : $1 + $2 + 'ში';\n });\n },\n past: function (s) {\n if (/(წამი|წუთი|საათი|დღე|თვე)/.test(s)) {\n return s.replace(/(ი|ე)$/, 'ის წინ');\n }\n if (/წელი/.test(s)) {\n return s.replace(/წელი$/, 'წლის წინ');\n }\n return s;\n },\n s: 'რამდენიმე წამი',\n ss: '%d წამი',\n m: 'წუთი',\n mm: '%d წუთი',\n h: 'საათი',\n hh: '%d საათი',\n d: 'დღე',\n dd: '%d დღე',\n M: 'თვე',\n MM: '%d თვე',\n y: 'წელი',\n yy: '%d წელი',\n },\n dayOfMonthOrdinalParse: /0|1-ლი|მე-\\d{1,2}|\\d{1,2}-ე/,\n ordinal: function (number) {\n if (number === 0) {\n return number;\n }\n if (number === 1) {\n return number + '-ლი';\n }\n if (\n number < 20 ||\n (number <= 100 && number % 20 === 0) ||\n number % 100 === 0\n ) {\n return 'მე-' + number;\n }\n return number + '-ე';\n },\n week: {\n dow: 1,\n doy: 7,\n },\n });\n\n return ka;\n\n})));\n","//! moment.js locale configuration\n//! locale : Kazakh [kk]\n//! authors : Nurlan Rakhimzhanov : https://github.com/nurlan\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var suffixes = {\n 0: '-ші',\n 1: '-ші',\n 2: '-ші',\n 3: '-ші',\n 4: '-ші',\n 5: '-ші',\n 6: '-шы',\n 7: '-ші',\n 8: '-ші',\n 9: '-шы',\n 10: '-шы',\n 20: '-шы',\n 30: '-шы',\n 40: '-шы',\n 50: '-ші',\n 60: '-шы',\n 70: '-ші',\n 80: '-ші',\n 90: '-шы',\n 100: '-ші',\n };\n\n var kk = moment.defineLocale('kk', {\n months: 'қаңтар_ақпан_наурыз_сәуір_мамыр_маусым_шілде_тамыз_қыркүйек_қазан_қараша_желтоқсан'.split(\n '_'\n ),\n monthsShort: 'қаң_ақп_нау_сәу_мам_мау_шіл_там_қыр_қаз_қар_жел'.split('_'),\n weekdays: 'жексенбі_дүйсенбі_сейсенбі_сәрсенбі_бейсенбі_жұма_сенбі'.split(\n '_'\n ),\n weekdaysShort: 'жек_дүй_сей_сәр_бей_жұм_сен'.split('_'),\n weekdaysMin: 'жк_дй_сй_ср_бй_жм_сн'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Бүгін сағат] LT',\n nextDay: '[Ертең сағат] LT',\n nextWeek: 'dddd [сағат] LT',\n lastDay: '[Кеше сағат] LT',\n lastWeek: '[Өткен аптаның] dddd [сағат] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s ішінде',\n past: '%s бұрын',\n s: 'бірнеше секунд',\n ss: '%d секунд',\n m: 'бір минут',\n mm: '%d минут',\n h: 'бір сағат',\n hh: '%d сағат',\n d: 'бір күн',\n dd: '%d күн',\n M: 'бір ай',\n MM: '%d ай',\n y: 'бір жыл',\n yy: '%d жыл',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(ші|шы)/,\n ordinal: function (number) {\n var a = number % 10,\n b = number >= 100 ? 100 : null;\n return number + (suffixes[number] || suffixes[a] || suffixes[b]);\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return kk;\n\n})));\n","//! moment.js locale configuration\n//! locale : Cambodian [km]\n//! author : Kruy Vanna : https://github.com/kruyvanna\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '១',\n 2: '២',\n 3: '៣',\n 4: '៤',\n 5: '៥',\n 6: '៦',\n 7: '៧',\n 8: '៨',\n 9: '៩',\n 0: '០',\n },\n numberMap = {\n '១': '1',\n '២': '2',\n '៣': '3',\n '៤': '4',\n '៥': '5',\n '៦': '6',\n '៧': '7',\n '៨': '8',\n '៩': '9',\n '០': '0',\n };\n\n var km = moment.defineLocale('km', {\n months: 'មករា_កុម្ភៈ_មីនា_មេសា_ឧសភា_មិថុនា_កក្កដា_សីហា_កញ្ញា_តុលា_វិច្ឆិកា_ធ្នូ'.split(\n '_'\n ),\n monthsShort: 'មករា_កុម្ភៈ_មីនា_មេសា_ឧសភា_មិថុនា_កក្កដា_សីហា_កញ្ញា_តុលា_វិច្ឆិកា_ធ្នូ'.split(\n '_'\n ),\n weekdays: 'អាទិត្យ_ច័ន្ទ_អង្គារ_ពុធ_ព្រហស្បតិ៍_សុក្រ_សៅរ៍'.split('_'),\n weekdaysShort: 'អា_ច_អ_ព_ព្រ_សុ_ស'.split('_'),\n weekdaysMin: 'អា_ច_អ_ព_ព្រ_សុ_ស'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n meridiemParse: /ព្រឹក|ល្ងាច/,\n isPM: function (input) {\n return input === 'ល្ងាច';\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ព្រឹក';\n } else {\n return 'ល្ងាច';\n }\n },\n calendar: {\n sameDay: '[ថ្ងៃនេះ ម៉ោង] LT',\n nextDay: '[ស្អែក ម៉ោង] LT',\n nextWeek: 'dddd [ម៉ោង] LT',\n lastDay: '[ម្សិលមិញ ម៉ោង] LT',\n lastWeek: 'dddd [សប្តាហ៍មុន] [ម៉ោង] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%sទៀត',\n past: '%sមុន',\n s: 'ប៉ុន្មានវិនាទី',\n ss: '%d វិនាទី',\n m: 'មួយនាទី',\n mm: '%d នាទី',\n h: 'មួយម៉ោង',\n hh: '%d ម៉ោង',\n d: 'មួយថ្ងៃ',\n dd: '%d ថ្ងៃ',\n M: 'មួយខែ',\n MM: '%d ខែ',\n y: 'មួយឆ្នាំ',\n yy: '%d ឆ្នាំ',\n },\n dayOfMonthOrdinalParse: /ទី\\d{1,2}/,\n ordinal: 'ទី%d',\n preparse: function (string) {\n return string.replace(/[១២៣៤៥៦៧៨៩០]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return km;\n\n})));\n","//! moment.js locale configuration\n//! locale : Kannada [kn]\n//! author : Rajeev Naik : https://github.com/rajeevnaikte\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '೧',\n 2: '೨',\n 3: '೩',\n 4: '೪',\n 5: '೫',\n 6: '೬',\n 7: '೭',\n 8: '೮',\n 9: '೯',\n 0: '೦',\n },\n numberMap = {\n '೧': '1',\n '೨': '2',\n '೩': '3',\n '೪': '4',\n '೫': '5',\n '೬': '6',\n '೭': '7',\n '೮': '8',\n '೯': '9',\n '೦': '0',\n };\n\n var kn = moment.defineLocale('kn', {\n months: 'ಜನವರಿ_ಫೆಬ್ರವರಿ_ಮಾರ್ಚ್_ಏಪ್ರಿಲ್_ಮೇ_ಜೂನ್_ಜುಲೈ_ಆಗಸ್ಟ್_ಸೆಪ್ಟೆಂಬರ್_ಅಕ್ಟೋಬರ್_ನವೆಂಬರ್_ಡಿಸೆಂಬರ್'.split(\n '_'\n ),\n monthsShort: 'ಜನ_ಫೆಬ್ರ_ಮಾರ್ಚ್_ಏಪ್ರಿಲ್_ಮೇ_ಜೂನ್_ಜುಲೈ_ಆಗಸ್ಟ್_ಸೆಪ್ಟೆಂ_ಅಕ್ಟೋ_ನವೆಂ_ಡಿಸೆಂ'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'ಭಾನುವಾರ_ಸೋಮವಾರ_ಮಂಗಳವಾರ_ಬುಧವಾರ_ಗುರುವಾರ_ಶುಕ್ರವಾರ_ಶನಿವಾರ'.split(\n '_'\n ),\n weekdaysShort: 'ಭಾನು_ಸೋಮ_ಮಂಗಳ_ಬುಧ_ಗುರು_ಶುಕ್ರ_ಶನಿ'.split('_'),\n weekdaysMin: 'ಭಾ_ಸೋ_ಮಂ_ಬು_ಗು_ಶು_ಶ'.split('_'),\n longDateFormat: {\n LT: 'A h:mm',\n LTS: 'A h:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm',\n LLLL: 'dddd, D MMMM YYYY, A h:mm',\n },\n calendar: {\n sameDay: '[ಇಂದು] LT',\n nextDay: '[ನಾಳೆ] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[ನಿನ್ನೆ] LT',\n lastWeek: '[ಕೊನೆಯ] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s ನಂತರ',\n past: '%s ಹಿಂದೆ',\n s: 'ಕೆಲವು ಕ್ಷಣಗಳು',\n ss: '%d ಸೆಕೆಂಡುಗಳು',\n m: 'ಒಂದು ನಿಮಿಷ',\n mm: '%d ನಿಮಿಷ',\n h: 'ಒಂದು ಗಂಟೆ',\n hh: '%d ಗಂಟೆ',\n d: 'ಒಂದು ದಿನ',\n dd: '%d ದಿನ',\n M: 'ಒಂದು ತಿಂಗಳು',\n MM: '%d ತಿಂಗಳು',\n y: 'ಒಂದು ವರ್ಷ',\n yy: '%d ವರ್ಷ',\n },\n preparse: function (string) {\n return string.replace(/[೧೨೩೪೫೬೭೮೯೦]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n meridiemParse: /ರಾತ್ರಿ|ಬೆಳಿಗ್ಗೆ|ಮಧ್ಯಾಹ್ನ|ಸಂಜೆ/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'ರಾತ್ರಿ') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'ಬೆಳಿಗ್ಗೆ') {\n return hour;\n } else if (meridiem === 'ಮಧ್ಯಾಹ್ನ') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'ಸಂಜೆ') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'ರಾತ್ರಿ';\n } else if (hour < 10) {\n return 'ಬೆಳಿಗ್ಗೆ';\n } else if (hour < 17) {\n return 'ಮಧ್ಯಾಹ್ನ';\n } else if (hour < 20) {\n return 'ಸಂಜೆ';\n } else {\n return 'ರಾತ್ರಿ';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(ನೇ)/,\n ordinal: function (number) {\n return number + 'ನೇ';\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return kn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Korean [ko]\n//! author : Kyungwook, Park : https://github.com/kyungw00k\n//! author : Jeeeyul Lee \n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ko = moment.defineLocale('ko', {\n months: '1월_2월_3월_4월_5월_6월_7월_8월_9월_10월_11월_12월'.split('_'),\n monthsShort: '1월_2월_3월_4월_5월_6월_7월_8월_9월_10월_11월_12월'.split(\n '_'\n ),\n weekdays: '일요일_월요일_화요일_수요일_목요일_금요일_토요일'.split('_'),\n weekdaysShort: '일_월_화_수_목_금_토'.split('_'),\n weekdaysMin: '일_월_화_수_목_금_토'.split('_'),\n longDateFormat: {\n LT: 'A h:mm',\n LTS: 'A h:mm:ss',\n L: 'YYYY.MM.DD.',\n LL: 'YYYY년 MMMM D일',\n LLL: 'YYYY년 MMMM D일 A h:mm',\n LLLL: 'YYYY년 MMMM D일 dddd A h:mm',\n l: 'YYYY.MM.DD.',\n ll: 'YYYY년 MMMM D일',\n lll: 'YYYY년 MMMM D일 A h:mm',\n llll: 'YYYY년 MMMM D일 dddd A h:mm',\n },\n calendar: {\n sameDay: '오늘 LT',\n nextDay: '내일 LT',\n nextWeek: 'dddd LT',\n lastDay: '어제 LT',\n lastWeek: '지난주 dddd LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s 후',\n past: '%s 전',\n s: '몇 초',\n ss: '%d초',\n m: '1분',\n mm: '%d분',\n h: '한 시간',\n hh: '%d시간',\n d: '하루',\n dd: '%d일',\n M: '한 달',\n MM: '%d달',\n y: '일 년',\n yy: '%d년',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(일|월|주)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + '일';\n case 'M':\n return number + '월';\n case 'w':\n case 'W':\n return number + '주';\n default:\n return number;\n }\n },\n meridiemParse: /오전|오후/,\n isPM: function (token) {\n return token === '오후';\n },\n meridiem: function (hour, minute, isUpper) {\n return hour < 12 ? '오전' : '오후';\n },\n });\n\n return ko;\n\n})));\n","//! moment.js locale configuration\n//! locale : Kurdish [ku]\n//! author : Shahram Mebashar : https://github.com/ShahramMebashar\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '١',\n 2: '٢',\n 3: '٣',\n 4: '٤',\n 5: '٥',\n 6: '٦',\n 7: '٧',\n 8: '٨',\n 9: '٩',\n 0: '٠',\n },\n numberMap = {\n '١': '1',\n '٢': '2',\n '٣': '3',\n '٤': '4',\n '٥': '5',\n '٦': '6',\n '٧': '7',\n '٨': '8',\n '٩': '9',\n '٠': '0',\n },\n months = [\n 'کانونی دووەم',\n 'شوبات',\n 'ئازار',\n 'نیسان',\n 'ئایار',\n 'حوزەیران',\n 'تەمموز',\n 'ئاب',\n 'ئەیلوول',\n 'تشرینی یەكەم',\n 'تشرینی دووەم',\n 'كانونی یەکەم',\n ];\n\n var ku = moment.defineLocale('ku', {\n months: months,\n monthsShort: months,\n weekdays: 'یهكشهممه_دووشهممه_سێشهممه_چوارشهممه_پێنجشهممه_ههینی_شهممه'.split(\n '_'\n ),\n weekdaysShort: 'یهكشهم_دووشهم_سێشهم_چوارشهم_پێنجشهم_ههینی_شهممه'.split(\n '_'\n ),\n weekdaysMin: 'ی_د_س_چ_پ_ه_ش'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n meridiemParse: /ئێواره|بهیانی/,\n isPM: function (input) {\n return /ئێواره/.test(input);\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'بهیانی';\n } else {\n return 'ئێواره';\n }\n },\n calendar: {\n sameDay: '[ئهمرۆ كاتژمێر] LT',\n nextDay: '[بهیانی كاتژمێر] LT',\n nextWeek: 'dddd [كاتژمێر] LT',\n lastDay: '[دوێنێ كاتژمێر] LT',\n lastWeek: 'dddd [كاتژمێر] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'له %s',\n past: '%s',\n s: 'چهند چركهیهك',\n ss: 'چركه %d',\n m: 'یهك خولهك',\n mm: '%d خولهك',\n h: 'یهك كاتژمێر',\n hh: '%d كاتژمێر',\n d: 'یهك ڕۆژ',\n dd: '%d ڕۆژ',\n M: 'یهك مانگ',\n MM: '%d مانگ',\n y: 'یهك ساڵ',\n yy: '%d ساڵ',\n },\n preparse: function (string) {\n return string\n .replace(/[١٢٣٤٥٦٧٨٩٠]/g, function (match) {\n return numberMap[match];\n })\n .replace(/،/g, ',');\n },\n postformat: function (string) {\n return string\n .replace(/\\d/g, function (match) {\n return symbolMap[match];\n })\n .replace(/,/g, '،');\n },\n week: {\n dow: 6, // Saturday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return ku;\n\n})));\n","//! moment.js locale configuration\n//! locale : Kyrgyz [ky]\n//! author : Chyngyz Arystan uulu : https://github.com/chyngyz\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var suffixes = {\n 0: '-чү',\n 1: '-чи',\n 2: '-чи',\n 3: '-чү',\n 4: '-чү',\n 5: '-чи',\n 6: '-чы',\n 7: '-чи',\n 8: '-чи',\n 9: '-чу',\n 10: '-чу',\n 20: '-чы',\n 30: '-чу',\n 40: '-чы',\n 50: '-чү',\n 60: '-чы',\n 70: '-чи',\n 80: '-чи',\n 90: '-чу',\n 100: '-чү',\n };\n\n var ky = moment.defineLocale('ky', {\n months: 'январь_февраль_март_апрель_май_июнь_июль_август_сентябрь_октябрь_ноябрь_декабрь'.split(\n '_'\n ),\n monthsShort: 'янв_фев_март_апр_май_июнь_июль_авг_сен_окт_ноя_дек'.split(\n '_'\n ),\n weekdays: 'Жекшемби_Дүйшөмбү_Шейшемби_Шаршемби_Бейшемби_Жума_Ишемби'.split(\n '_'\n ),\n weekdaysShort: 'Жек_Дүй_Шей_Шар_Бей_Жум_Ише'.split('_'),\n weekdaysMin: 'Жк_Дй_Шй_Шр_Бй_Жм_Иш'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Бүгүн саат] LT',\n nextDay: '[Эртең саат] LT',\n nextWeek: 'dddd [саат] LT',\n lastDay: '[Кечээ саат] LT',\n lastWeek: '[Өткөн аптанын] dddd [күнү] [саат] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s ичинде',\n past: '%s мурун',\n s: 'бирнече секунд',\n ss: '%d секунд',\n m: 'бир мүнөт',\n mm: '%d мүнөт',\n h: 'бир саат',\n hh: '%d саат',\n d: 'бир күн',\n dd: '%d күн',\n M: 'бир ай',\n MM: '%d ай',\n y: 'бир жыл',\n yy: '%d жыл',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(чи|чы|чү|чу)/,\n ordinal: function (number) {\n var a = number % 10,\n b = number >= 100 ? 100 : null;\n return number + (suffixes[number] || suffixes[a] || suffixes[b]);\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return ky;\n\n})));\n","//! moment.js locale configuration\n//! locale : Luxembourgish [lb]\n//! author : mweimerskirch : https://github.com/mweimerskirch\n//! author : David Raison : https://github.com/kwisatz\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n m: ['eng Minutt', 'enger Minutt'],\n h: ['eng Stonn', 'enger Stonn'],\n d: ['een Dag', 'engem Dag'],\n M: ['ee Mount', 'engem Mount'],\n y: ['ee Joer', 'engem Joer'],\n };\n return withoutSuffix ? format[key][0] : format[key][1];\n }\n function processFutureTime(string) {\n var number = string.substr(0, string.indexOf(' '));\n if (eifelerRegelAppliesToNumber(number)) {\n return 'a ' + string;\n }\n return 'an ' + string;\n }\n function processPastTime(string) {\n var number = string.substr(0, string.indexOf(' '));\n if (eifelerRegelAppliesToNumber(number)) {\n return 'viru ' + string;\n }\n return 'virun ' + string;\n }\n /**\n * Returns true if the word before the given number loses the '-n' ending.\n * e.g. 'an 10 Deeg' but 'a 5 Deeg'\n *\n * @param number {integer}\n * @returns {boolean}\n */\n function eifelerRegelAppliesToNumber(number) {\n number = parseInt(number, 10);\n if (isNaN(number)) {\n return false;\n }\n if (number < 0) {\n // Negative Number --> always true\n return true;\n } else if (number < 10) {\n // Only 1 digit\n if (4 <= number && number <= 7) {\n return true;\n }\n return false;\n } else if (number < 100) {\n // 2 digits\n var lastDigit = number % 10,\n firstDigit = number / 10;\n if (lastDigit === 0) {\n return eifelerRegelAppliesToNumber(firstDigit);\n }\n return eifelerRegelAppliesToNumber(lastDigit);\n } else if (number < 10000) {\n // 3 or 4 digits --> recursively check first digit\n while (number >= 10) {\n number = number / 10;\n }\n return eifelerRegelAppliesToNumber(number);\n } else {\n // Anything larger than 4 digits: recursively check first n-3 digits\n number = number / 1000;\n return eifelerRegelAppliesToNumber(number);\n }\n }\n\n var lb = moment.defineLocale('lb', {\n months: 'Januar_Februar_Mäerz_Abrëll_Mee_Juni_Juli_August_September_Oktober_November_Dezember'.split(\n '_'\n ),\n monthsShort: 'Jan._Febr._Mrz._Abr._Mee_Jun._Jul._Aug._Sept._Okt._Nov._Dez.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'Sonndeg_Méindeg_Dënschdeg_Mëttwoch_Donneschdeg_Freideg_Samschdeg'.split(\n '_'\n ),\n weekdaysShort: 'So._Mé._Dë._Më._Do._Fr._Sa.'.split('_'),\n weekdaysMin: 'So_Mé_Dë_Më_Do_Fr_Sa'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm [Auer]',\n LTS: 'H:mm:ss [Auer]',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY H:mm [Auer]',\n LLLL: 'dddd, D. MMMM YYYY H:mm [Auer]',\n },\n calendar: {\n sameDay: '[Haut um] LT',\n sameElse: 'L',\n nextDay: '[Muer um] LT',\n nextWeek: 'dddd [um] LT',\n lastDay: '[Gëschter um] LT',\n lastWeek: function () {\n // Different date string for 'Dënschdeg' (Tuesday) and 'Donneschdeg' (Thursday) due to phonological rule\n switch (this.day()) {\n case 2:\n case 4:\n return '[Leschten] dddd [um] LT';\n default:\n return '[Leschte] dddd [um] LT';\n }\n },\n },\n relativeTime: {\n future: processFutureTime,\n past: processPastTime,\n s: 'e puer Sekonnen',\n ss: '%d Sekonnen',\n m: processRelativeTime,\n mm: '%d Minutten',\n h: processRelativeTime,\n hh: '%d Stonnen',\n d: processRelativeTime,\n dd: '%d Deeg',\n M: processRelativeTime,\n MM: '%d Méint',\n y: processRelativeTime,\n yy: '%d Joer',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return lb;\n\n})));\n","//! moment.js locale configuration\n//! locale : Lao [lo]\n//! author : Ryan Hart : https://github.com/ryanhart2\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var lo = moment.defineLocale('lo', {\n months: 'ມັງກອນ_ກຸມພາ_ມີນາ_ເມສາ_ພຶດສະພາ_ມິຖຸນາ_ກໍລະກົດ_ສິງຫາ_ກັນຍາ_ຕຸລາ_ພະຈິກ_ທັນວາ'.split(\n '_'\n ),\n monthsShort: 'ມັງກອນ_ກຸມພາ_ມີນາ_ເມສາ_ພຶດສະພາ_ມິຖຸນາ_ກໍລະກົດ_ສິງຫາ_ກັນຍາ_ຕຸລາ_ພະຈິກ_ທັນວາ'.split(\n '_'\n ),\n weekdays: 'ອາທິດ_ຈັນ_ອັງຄານ_ພຸດ_ພະຫັດ_ສຸກ_ເສົາ'.split('_'),\n weekdaysShort: 'ທິດ_ຈັນ_ອັງຄານ_ພຸດ_ພະຫັດ_ສຸກ_ເສົາ'.split('_'),\n weekdaysMin: 'ທ_ຈ_ອຄ_ພ_ພຫ_ສກ_ສ'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'ວັນdddd D MMMM YYYY HH:mm',\n },\n meridiemParse: /ຕອນເຊົ້າ|ຕອນແລງ/,\n isPM: function (input) {\n return input === 'ຕອນແລງ';\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ຕອນເຊົ້າ';\n } else {\n return 'ຕອນແລງ';\n }\n },\n calendar: {\n sameDay: '[ມື້ນີ້ເວລາ] LT',\n nextDay: '[ມື້ອື່ນເວລາ] LT',\n nextWeek: '[ວັນ]dddd[ໜ້າເວລາ] LT',\n lastDay: '[ມື້ວານນີ້ເວລາ] LT',\n lastWeek: '[ວັນ]dddd[ແລ້ວນີ້ເວລາ] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'ອີກ %s',\n past: '%sຜ່ານມາ',\n s: 'ບໍ່ເທົ່າໃດວິນາທີ',\n ss: '%d ວິນາທີ',\n m: '1 ນາທີ',\n mm: '%d ນາທີ',\n h: '1 ຊົ່ວໂມງ',\n hh: '%d ຊົ່ວໂມງ',\n d: '1 ມື້',\n dd: '%d ມື້',\n M: '1 ເດືອນ',\n MM: '%d ເດືອນ',\n y: '1 ປີ',\n yy: '%d ປີ',\n },\n dayOfMonthOrdinalParse: /(ທີ່)\\d{1,2}/,\n ordinal: function (number) {\n return 'ທີ່' + number;\n },\n });\n\n return lo;\n\n})));\n","//! moment.js locale configuration\n//! locale : Lithuanian [lt]\n//! author : Mindaugas Mozūras : https://github.com/mmozuras\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var units = {\n ss: 'sekundė_sekundžių_sekundes',\n m: 'minutė_minutės_minutę',\n mm: 'minutės_minučių_minutes',\n h: 'valanda_valandos_valandą',\n hh: 'valandos_valandų_valandas',\n d: 'diena_dienos_dieną',\n dd: 'dienos_dienų_dienas',\n M: 'mėnuo_mėnesio_mėnesį',\n MM: 'mėnesiai_mėnesių_mėnesius',\n y: 'metai_metų_metus',\n yy: 'metai_metų_metus',\n };\n function translateSeconds(number, withoutSuffix, key, isFuture) {\n if (withoutSuffix) {\n return 'kelios sekundės';\n } else {\n return isFuture ? 'kelių sekundžių' : 'kelias sekundes';\n }\n }\n function translateSingular(number, withoutSuffix, key, isFuture) {\n return withoutSuffix\n ? forms(key)[0]\n : isFuture\n ? forms(key)[1]\n : forms(key)[2];\n }\n function special(number) {\n return number % 10 === 0 || (number > 10 && number < 20);\n }\n function forms(key) {\n return units[key].split('_');\n }\n function translate(number, withoutSuffix, key, isFuture) {\n var result = number + ' ';\n if (number === 1) {\n return (\n result + translateSingular(number, withoutSuffix, key[0], isFuture)\n );\n } else if (withoutSuffix) {\n return result + (special(number) ? forms(key)[1] : forms(key)[0]);\n } else {\n if (isFuture) {\n return result + forms(key)[1];\n } else {\n return result + (special(number) ? forms(key)[1] : forms(key)[2]);\n }\n }\n }\n var lt = moment.defineLocale('lt', {\n months: {\n format: 'sausio_vasario_kovo_balandžio_gegužės_birželio_liepos_rugpjūčio_rugsėjo_spalio_lapkričio_gruodžio'.split(\n '_'\n ),\n standalone: 'sausis_vasaris_kovas_balandis_gegužė_birželis_liepa_rugpjūtis_rugsėjis_spalis_lapkritis_gruodis'.split(\n '_'\n ),\n isFormat: /D[oD]?(\\[[^\\[\\]]*\\]|\\s)+MMMM?|MMMM?(\\[[^\\[\\]]*\\]|\\s)+D[oD]?/,\n },\n monthsShort: 'sau_vas_kov_bal_geg_bir_lie_rgp_rgs_spa_lap_grd'.split('_'),\n weekdays: {\n format: 'sekmadienį_pirmadienį_antradienį_trečiadienį_ketvirtadienį_penktadienį_šeštadienį'.split(\n '_'\n ),\n standalone: 'sekmadienis_pirmadienis_antradienis_trečiadienis_ketvirtadienis_penktadienis_šeštadienis'.split(\n '_'\n ),\n isFormat: /dddd HH:mm/,\n },\n weekdaysShort: 'Sek_Pir_Ant_Tre_Ket_Pen_Šeš'.split('_'),\n weekdaysMin: 'S_P_A_T_K_Pn_Š'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY-MM-DD',\n LL: 'YYYY [m.] MMMM D [d.]',\n LLL: 'YYYY [m.] MMMM D [d.], HH:mm [val.]',\n LLLL: 'YYYY [m.] MMMM D [d.], dddd, HH:mm [val.]',\n l: 'YYYY-MM-DD',\n ll: 'YYYY [m.] MMMM D [d.]',\n lll: 'YYYY [m.] MMMM D [d.], HH:mm [val.]',\n llll: 'YYYY [m.] MMMM D [d.], ddd, HH:mm [val.]',\n },\n calendar: {\n sameDay: '[Šiandien] LT',\n nextDay: '[Rytoj] LT',\n nextWeek: 'dddd LT',\n lastDay: '[Vakar] LT',\n lastWeek: '[Praėjusį] dddd LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'po %s',\n past: 'prieš %s',\n s: translateSeconds,\n ss: translate,\n m: translateSingular,\n mm: translate,\n h: translateSingular,\n hh: translate,\n d: translateSingular,\n dd: translate,\n M: translateSingular,\n MM: translate,\n y: translateSingular,\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-oji/,\n ordinal: function (number) {\n return number + '-oji';\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return lt;\n\n})));\n","//! moment.js locale configuration\n//! locale : Latvian [lv]\n//! author : Kristaps Karlsons : https://github.com/skakri\n//! author : Jānis Elmeris : https://github.com/JanisE\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var units = {\n ss: 'sekundes_sekundēm_sekunde_sekundes'.split('_'),\n m: 'minūtes_minūtēm_minūte_minūtes'.split('_'),\n mm: 'minūtes_minūtēm_minūte_minūtes'.split('_'),\n h: 'stundas_stundām_stunda_stundas'.split('_'),\n hh: 'stundas_stundām_stunda_stundas'.split('_'),\n d: 'dienas_dienām_diena_dienas'.split('_'),\n dd: 'dienas_dienām_diena_dienas'.split('_'),\n M: 'mēneša_mēnešiem_mēnesis_mēneši'.split('_'),\n MM: 'mēneša_mēnešiem_mēnesis_mēneši'.split('_'),\n y: 'gada_gadiem_gads_gadi'.split('_'),\n yy: 'gada_gadiem_gads_gadi'.split('_'),\n };\n /**\n * @param withoutSuffix boolean true = a length of time; false = before/after a period of time.\n */\n function format(forms, number, withoutSuffix) {\n if (withoutSuffix) {\n // E.g. \"21 minūte\", \"3 minūtes\".\n return number % 10 === 1 && number % 100 !== 11 ? forms[2] : forms[3];\n } else {\n // E.g. \"21 minūtes\" as in \"pēc 21 minūtes\".\n // E.g. \"3 minūtēm\" as in \"pēc 3 minūtēm\".\n return number % 10 === 1 && number % 100 !== 11 ? forms[0] : forms[1];\n }\n }\n function relativeTimeWithPlural(number, withoutSuffix, key) {\n return number + ' ' + format(units[key], number, withoutSuffix);\n }\n function relativeTimeWithSingular(number, withoutSuffix, key) {\n return format(units[key], number, withoutSuffix);\n }\n function relativeSeconds(number, withoutSuffix) {\n return withoutSuffix ? 'dažas sekundes' : 'dažām sekundēm';\n }\n\n var lv = moment.defineLocale('lv', {\n months: 'janvāris_februāris_marts_aprīlis_maijs_jūnijs_jūlijs_augusts_septembris_oktobris_novembris_decembris'.split(\n '_'\n ),\n monthsShort: 'jan_feb_mar_apr_mai_jūn_jūl_aug_sep_okt_nov_dec'.split('_'),\n weekdays: 'svētdiena_pirmdiena_otrdiena_trešdiena_ceturtdiena_piektdiena_sestdiena'.split(\n '_'\n ),\n weekdaysShort: 'Sv_P_O_T_C_Pk_S'.split('_'),\n weekdaysMin: 'Sv_P_O_T_C_Pk_S'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY.',\n LL: 'YYYY. [gada] D. MMMM',\n LLL: 'YYYY. [gada] D. MMMM, HH:mm',\n LLLL: 'YYYY. [gada] D. MMMM, dddd, HH:mm',\n },\n calendar: {\n sameDay: '[Šodien pulksten] LT',\n nextDay: '[Rīt pulksten] LT',\n nextWeek: 'dddd [pulksten] LT',\n lastDay: '[Vakar pulksten] LT',\n lastWeek: '[Pagājušā] dddd [pulksten] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'pēc %s',\n past: 'pirms %s',\n s: relativeSeconds,\n ss: relativeTimeWithPlural,\n m: relativeTimeWithSingular,\n mm: relativeTimeWithPlural,\n h: relativeTimeWithSingular,\n hh: relativeTimeWithPlural,\n d: relativeTimeWithSingular,\n dd: relativeTimeWithPlural,\n M: relativeTimeWithSingular,\n MM: relativeTimeWithPlural,\n y: relativeTimeWithSingular,\n yy: relativeTimeWithPlural,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return lv;\n\n})));\n","//! moment.js locale configuration\n//! locale : Montenegrin [me]\n//! author : Miodrag Nikač : https://github.com/miodragnikac\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var translator = {\n words: {\n //Different grammatical cases\n ss: ['sekund', 'sekunda', 'sekundi'],\n m: ['jedan minut', 'jednog minuta'],\n mm: ['minut', 'minuta', 'minuta'],\n h: ['jedan sat', 'jednog sata'],\n hh: ['sat', 'sata', 'sati'],\n dd: ['dan', 'dana', 'dana'],\n MM: ['mjesec', 'mjeseca', 'mjeseci'],\n yy: ['godina', 'godine', 'godina'],\n },\n correctGrammaticalCase: function (number, wordKey) {\n return number === 1\n ? wordKey[0]\n : number >= 2 && number <= 4\n ? wordKey[1]\n : wordKey[2];\n },\n translate: function (number, withoutSuffix, key) {\n var wordKey = translator.words[key];\n if (key.length === 1) {\n return withoutSuffix ? wordKey[0] : wordKey[1];\n } else {\n return (\n number +\n ' ' +\n translator.correctGrammaticalCase(number, wordKey)\n );\n }\n },\n };\n\n var me = moment.defineLocale('me', {\n months: 'januar_februar_mart_april_maj_jun_jul_avgust_septembar_oktobar_novembar_decembar'.split(\n '_'\n ),\n monthsShort: 'jan._feb._mar._apr._maj_jun_jul_avg._sep._okt._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'nedjelja_ponedjeljak_utorak_srijeda_četvrtak_petak_subota'.split(\n '_'\n ),\n weekdaysShort: 'ned._pon._uto._sri._čet._pet._sub.'.split('_'),\n weekdaysMin: 'ne_po_ut_sr_če_pe_su'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY H:mm',\n LLLL: 'dddd, D. MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[danas u] LT',\n nextDay: '[sjutra u] LT',\n\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[u] [nedjelju] [u] LT';\n case 3:\n return '[u] [srijedu] [u] LT';\n case 6:\n return '[u] [subotu] [u] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[u] dddd [u] LT';\n }\n },\n lastDay: '[juče u] LT',\n lastWeek: function () {\n var lastWeekDays = [\n '[prošle] [nedjelje] [u] LT',\n '[prošlog] [ponedjeljka] [u] LT',\n '[prošlog] [utorka] [u] LT',\n '[prošle] [srijede] [u] LT',\n '[prošlog] [četvrtka] [u] LT',\n '[prošlog] [petka] [u] LT',\n '[prošle] [subote] [u] LT',\n ];\n return lastWeekDays[this.day()];\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'za %s',\n past: 'prije %s',\n s: 'nekoliko sekundi',\n ss: translator.translate,\n m: translator.translate,\n mm: translator.translate,\n h: translator.translate,\n hh: translator.translate,\n d: 'dan',\n dd: translator.translate,\n M: 'mjesec',\n MM: translator.translate,\n y: 'godinu',\n yy: translator.translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return me;\n\n})));\n","//! moment.js locale configuration\n//! locale : Maori [mi]\n//! author : John Corrigan : https://github.com/johnideal\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var mi = moment.defineLocale('mi', {\n months: 'Kohi-tāte_Hui-tanguru_Poutū-te-rangi_Paenga-whāwhā_Haratua_Pipiri_Hōngoingoi_Here-turi-kōkā_Mahuru_Whiringa-ā-nuku_Whiringa-ā-rangi_Hakihea'.split(\n '_'\n ),\n monthsShort: 'Kohi_Hui_Pou_Pae_Hara_Pipi_Hōngoi_Here_Mahu_Whi-nu_Whi-ra_Haki'.split(\n '_'\n ),\n monthsRegex: /(?:['a-z\\u0101\\u014D\\u016B]+\\-?){1,3}/i,\n monthsStrictRegex: /(?:['a-z\\u0101\\u014D\\u016B]+\\-?){1,3}/i,\n monthsShortRegex: /(?:['a-z\\u0101\\u014D\\u016B]+\\-?){1,3}/i,\n monthsShortStrictRegex: /(?:['a-z\\u0101\\u014D\\u016B]+\\-?){1,2}/i,\n weekdays: 'Rātapu_Mane_Tūrei_Wenerei_Tāite_Paraire_Hātarei'.split('_'),\n weekdaysShort: 'Ta_Ma_Tū_We_Tāi_Pa_Hā'.split('_'),\n weekdaysMin: 'Ta_Ma_Tū_We_Tāi_Pa_Hā'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY [i] HH:mm',\n LLLL: 'dddd, D MMMM YYYY [i] HH:mm',\n },\n calendar: {\n sameDay: '[i teie mahana, i] LT',\n nextDay: '[apopo i] LT',\n nextWeek: 'dddd [i] LT',\n lastDay: '[inanahi i] LT',\n lastWeek: 'dddd [whakamutunga i] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'i roto i %s',\n past: '%s i mua',\n s: 'te hēkona ruarua',\n ss: '%d hēkona',\n m: 'he meneti',\n mm: '%d meneti',\n h: 'te haora',\n hh: '%d haora',\n d: 'he ra',\n dd: '%d ra',\n M: 'he marama',\n MM: '%d marama',\n y: 'he tau',\n yy: '%d tau',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return mi;\n\n})));\n","//! moment.js locale configuration\n//! locale : Macedonian [mk]\n//! author : Borislav Mickov : https://github.com/B0k0\n//! author : Sashko Todorov : https://github.com/bkyceh\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var mk = moment.defineLocale('mk', {\n months: 'јануари_февруари_март_април_мај_јуни_јули_август_септември_октомври_ноември_декември'.split(\n '_'\n ),\n monthsShort: 'јан_фев_мар_апр_мај_јун_јул_авг_сеп_окт_ное_дек'.split('_'),\n weekdays: 'недела_понеделник_вторник_среда_четврток_петок_сабота'.split(\n '_'\n ),\n weekdaysShort: 'нед_пон_вто_сре_чет_пет_саб'.split('_'),\n weekdaysMin: 'нe_пo_вт_ср_че_пе_сa'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'D.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY H:mm',\n LLLL: 'dddd, D MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[Денес во] LT',\n nextDay: '[Утре во] LT',\n nextWeek: '[Во] dddd [во] LT',\n lastDay: '[Вчера во] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n case 3:\n case 6:\n return '[Изминатата] dddd [во] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[Изминатиот] dddd [во] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'за %s',\n past: 'пред %s',\n s: 'неколку секунди',\n ss: '%d секунди',\n m: 'една минута',\n mm: '%d минути',\n h: 'еден час',\n hh: '%d часа',\n d: 'еден ден',\n dd: '%d дена',\n M: 'еден месец',\n MM: '%d месеци',\n y: 'една година',\n yy: '%d години',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(ев|ен|ти|ви|ри|ми)/,\n ordinal: function (number) {\n var lastDigit = number % 10,\n last2Digits = number % 100;\n if (number === 0) {\n return number + '-ев';\n } else if (last2Digits === 0) {\n return number + '-ен';\n } else if (last2Digits > 10 && last2Digits < 20) {\n return number + '-ти';\n } else if (lastDigit === 1) {\n return number + '-ви';\n } else if (lastDigit === 2) {\n return number + '-ри';\n } else if (lastDigit === 7 || lastDigit === 8) {\n return number + '-ми';\n } else {\n return number + '-ти';\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return mk;\n\n})));\n","//! moment.js locale configuration\n//! locale : Malayalam [ml]\n//! author : Floyd Pink : https://github.com/floydpink\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ml = moment.defineLocale('ml', {\n months: 'ജനുവരി_ഫെബ്രുവരി_മാർച്ച്_ഏപ്രിൽ_മേയ്_ജൂൺ_ജൂലൈ_ഓഗസ്റ്റ്_സെപ്റ്റംബർ_ഒക്ടോബർ_നവംബർ_ഡിസംബർ'.split(\n '_'\n ),\n monthsShort: 'ജനു._ഫെബ്രു._മാർ._ഏപ്രി._മേയ്_ജൂൺ_ജൂലൈ._ഓഗ._സെപ്റ്റ._ഒക്ടോ._നവം._ഡിസം.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'ഞായറാഴ്ച_തിങ്കളാഴ്ച_ചൊവ്വാഴ്ച_ബുധനാഴ്ച_വ്യാഴാഴ്ച_വെള്ളിയാഴ്ച_ശനിയാഴ്ച'.split(\n '_'\n ),\n weekdaysShort: 'ഞായർ_തിങ്കൾ_ചൊവ്വ_ബുധൻ_വ്യാഴം_വെള്ളി_ശനി'.split('_'),\n weekdaysMin: 'ഞാ_തി_ചൊ_ബു_വ്യാ_വെ_ശ'.split('_'),\n longDateFormat: {\n LT: 'A h:mm -നു',\n LTS: 'A h:mm:ss -നു',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm -നു',\n LLLL: 'dddd, D MMMM YYYY, A h:mm -നു',\n },\n calendar: {\n sameDay: '[ഇന്ന്] LT',\n nextDay: '[നാളെ] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[ഇന്നലെ] LT',\n lastWeek: '[കഴിഞ്ഞ] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s കഴിഞ്ഞ്',\n past: '%s മുൻപ്',\n s: 'അൽപ നിമിഷങ്ങൾ',\n ss: '%d സെക്കൻഡ്',\n m: 'ഒരു മിനിറ്റ്',\n mm: '%d മിനിറ്റ്',\n h: 'ഒരു മണിക്കൂർ',\n hh: '%d മണിക്കൂർ',\n d: 'ഒരു ദിവസം',\n dd: '%d ദിവസം',\n M: 'ഒരു മാസം',\n MM: '%d മാസം',\n y: 'ഒരു വർഷം',\n yy: '%d വർഷം',\n },\n meridiemParse: /രാത്രി|രാവിലെ|ഉച്ച കഴിഞ്ഞ്|വൈകുന്നേരം|രാത്രി/i,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (\n (meridiem === 'രാത്രി' && hour >= 4) ||\n meridiem === 'ഉച്ച കഴിഞ്ഞ്' ||\n meridiem === 'വൈകുന്നേരം'\n ) {\n return hour + 12;\n } else {\n return hour;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'രാത്രി';\n } else if (hour < 12) {\n return 'രാവിലെ';\n } else if (hour < 17) {\n return 'ഉച്ച കഴിഞ്ഞ്';\n } else if (hour < 20) {\n return 'വൈകുന്നേരം';\n } else {\n return 'രാത്രി';\n }\n },\n });\n\n return ml;\n\n})));\n","//! moment.js locale configuration\n//! locale : Mongolian [mn]\n//! author : Javkhlantugs Nyamdorj : https://github.com/javkhaanj7\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function translate(number, withoutSuffix, key, isFuture) {\n switch (key) {\n case 's':\n return withoutSuffix ? 'хэдхэн секунд' : 'хэдхэн секундын';\n case 'ss':\n return number + (withoutSuffix ? ' секунд' : ' секундын');\n case 'm':\n case 'mm':\n return number + (withoutSuffix ? ' минут' : ' минутын');\n case 'h':\n case 'hh':\n return number + (withoutSuffix ? ' цаг' : ' цагийн');\n case 'd':\n case 'dd':\n return number + (withoutSuffix ? ' өдөр' : ' өдрийн');\n case 'M':\n case 'MM':\n return number + (withoutSuffix ? ' сар' : ' сарын');\n case 'y':\n case 'yy':\n return number + (withoutSuffix ? ' жил' : ' жилийн');\n default:\n return number;\n }\n }\n\n var mn = moment.defineLocale('mn', {\n months: 'Нэгдүгээр сар_Хоёрдугаар сар_Гуравдугаар сар_Дөрөвдүгээр сар_Тавдугаар сар_Зургадугаар сар_Долдугаар сар_Наймдугаар сар_Есдүгээр сар_Аравдугаар сар_Арван нэгдүгээр сар_Арван хоёрдугаар сар'.split(\n '_'\n ),\n monthsShort: '1 сар_2 сар_3 сар_4 сар_5 сар_6 сар_7 сар_8 сар_9 сар_10 сар_11 сар_12 сар'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'Ням_Даваа_Мягмар_Лхагва_Пүрэв_Баасан_Бямба'.split('_'),\n weekdaysShort: 'Ням_Дав_Мяг_Лха_Пүр_Баа_Бям'.split('_'),\n weekdaysMin: 'Ня_Да_Мя_Лх_Пү_Ба_Бя'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY-MM-DD',\n LL: 'YYYY оны MMMMын D',\n LLL: 'YYYY оны MMMMын D HH:mm',\n LLLL: 'dddd, YYYY оны MMMMын D HH:mm',\n },\n meridiemParse: /ҮӨ|ҮХ/i,\n isPM: function (input) {\n return input === 'ҮХ';\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ҮӨ';\n } else {\n return 'ҮХ';\n }\n },\n calendar: {\n sameDay: '[Өнөөдөр] LT',\n nextDay: '[Маргааш] LT',\n nextWeek: '[Ирэх] dddd LT',\n lastDay: '[Өчигдөр] LT',\n lastWeek: '[Өнгөрсөн] dddd LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s дараа',\n past: '%s өмнө',\n s: translate,\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: translate,\n dd: translate,\n M: translate,\n MM: translate,\n y: translate,\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2} өдөр/,\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + ' өдөр';\n default:\n return number;\n }\n },\n });\n\n return mn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Marathi [mr]\n//! author : Harshad Kale : https://github.com/kalehv\n//! author : Vivek Athalye : https://github.com/vnathalye\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '१',\n 2: '२',\n 3: '३',\n 4: '४',\n 5: '५',\n 6: '६',\n 7: '७',\n 8: '८',\n 9: '९',\n 0: '०',\n },\n numberMap = {\n '१': '1',\n '२': '2',\n '३': '3',\n '४': '4',\n '५': '5',\n '६': '6',\n '७': '7',\n '८': '8',\n '९': '9',\n '०': '0',\n };\n\n function relativeTimeMr(number, withoutSuffix, string, isFuture) {\n var output = '';\n if (withoutSuffix) {\n switch (string) {\n case 's':\n output = 'काही सेकंद';\n break;\n case 'ss':\n output = '%d सेकंद';\n break;\n case 'm':\n output = 'एक मिनिट';\n break;\n case 'mm':\n output = '%d मिनिटे';\n break;\n case 'h':\n output = 'एक तास';\n break;\n case 'hh':\n output = '%d तास';\n break;\n case 'd':\n output = 'एक दिवस';\n break;\n case 'dd':\n output = '%d दिवस';\n break;\n case 'M':\n output = 'एक महिना';\n break;\n case 'MM':\n output = '%d महिने';\n break;\n case 'y':\n output = 'एक वर्ष';\n break;\n case 'yy':\n output = '%d वर्षे';\n break;\n }\n } else {\n switch (string) {\n case 's':\n output = 'काही सेकंदां';\n break;\n case 'ss':\n output = '%d सेकंदां';\n break;\n case 'm':\n output = 'एका मिनिटा';\n break;\n case 'mm':\n output = '%d मिनिटां';\n break;\n case 'h':\n output = 'एका तासा';\n break;\n case 'hh':\n output = '%d तासां';\n break;\n case 'd':\n output = 'एका दिवसा';\n break;\n case 'dd':\n output = '%d दिवसां';\n break;\n case 'M':\n output = 'एका महिन्या';\n break;\n case 'MM':\n output = '%d महिन्यां';\n break;\n case 'y':\n output = 'एका वर्षा';\n break;\n case 'yy':\n output = '%d वर्षां';\n break;\n }\n }\n return output.replace(/%d/i, number);\n }\n\n var mr = moment.defineLocale('mr', {\n months: 'जानेवारी_फेब्रुवारी_मार्च_एप्रिल_मे_जून_जुलै_ऑगस्ट_सप्टेंबर_ऑक्टोबर_नोव्हेंबर_डिसेंबर'.split(\n '_'\n ),\n monthsShort: 'जाने._फेब्रु._मार्च._एप्रि._मे._जून._जुलै._ऑग._सप्टें._ऑक्टो._नोव्हें._डिसें.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'रविवार_सोमवार_मंगळवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split('_'),\n weekdaysShort: 'रवि_सोम_मंगळ_बुध_गुरू_शुक्र_शनि'.split('_'),\n weekdaysMin: 'र_सो_मं_बु_गु_शु_श'.split('_'),\n longDateFormat: {\n LT: 'A h:mm वाजता',\n LTS: 'A h:mm:ss वाजता',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm वाजता',\n LLLL: 'dddd, D MMMM YYYY, A h:mm वाजता',\n },\n calendar: {\n sameDay: '[आज] LT',\n nextDay: '[उद्या] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[काल] LT',\n lastWeek: '[मागील] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%sमध्ये',\n past: '%sपूर्वी',\n s: relativeTimeMr,\n ss: relativeTimeMr,\n m: relativeTimeMr,\n mm: relativeTimeMr,\n h: relativeTimeMr,\n hh: relativeTimeMr,\n d: relativeTimeMr,\n dd: relativeTimeMr,\n M: relativeTimeMr,\n MM: relativeTimeMr,\n y: relativeTimeMr,\n yy: relativeTimeMr,\n },\n preparse: function (string) {\n return string.replace(/[१२३४५६७८९०]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n meridiemParse: /पहाटे|सकाळी|दुपारी|सायंकाळी|रात्री/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'पहाटे' || meridiem === 'सकाळी') {\n return hour;\n } else if (\n meridiem === 'दुपारी' ||\n meridiem === 'सायंकाळी' ||\n meridiem === 'रात्री'\n ) {\n return hour >= 12 ? hour : hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour >= 0 && hour < 6) {\n return 'पहाटे';\n } else if (hour < 12) {\n return 'सकाळी';\n } else if (hour < 17) {\n return 'दुपारी';\n } else if (hour < 20) {\n return 'सायंकाळी';\n } else {\n return 'रात्री';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return mr;\n\n})));\n","//! moment.js locale configuration\n//! locale : Malay [ms-my]\n//! note : DEPRECATED, the correct one is [ms]\n//! author : Weldan Jamili : https://github.com/weldan\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var msMy = moment.defineLocale('ms-my', {\n months: 'Januari_Februari_Mac_April_Mei_Jun_Julai_Ogos_September_Oktober_November_Disember'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mac_Apr_Mei_Jun_Jul_Ogs_Sep_Okt_Nov_Dis'.split('_'),\n weekdays: 'Ahad_Isnin_Selasa_Rabu_Khamis_Jumaat_Sabtu'.split('_'),\n weekdaysShort: 'Ahd_Isn_Sel_Rab_Kha_Jum_Sab'.split('_'),\n weekdaysMin: 'Ah_Is_Sl_Rb_Km_Jm_Sb'.split('_'),\n longDateFormat: {\n LT: 'HH.mm',\n LTS: 'HH.mm.ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY [pukul] HH.mm',\n LLLL: 'dddd, D MMMM YYYY [pukul] HH.mm',\n },\n meridiemParse: /pagi|tengahari|petang|malam/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'pagi') {\n return hour;\n } else if (meridiem === 'tengahari') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'petang' || meridiem === 'malam') {\n return hour + 12;\n }\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'pagi';\n } else if (hours < 15) {\n return 'tengahari';\n } else if (hours < 19) {\n return 'petang';\n } else {\n return 'malam';\n }\n },\n calendar: {\n sameDay: '[Hari ini pukul] LT',\n nextDay: '[Esok pukul] LT',\n nextWeek: 'dddd [pukul] LT',\n lastDay: '[Kelmarin pukul] LT',\n lastWeek: 'dddd [lepas pukul] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'dalam %s',\n past: '%s yang lepas',\n s: 'beberapa saat',\n ss: '%d saat',\n m: 'seminit',\n mm: '%d minit',\n h: 'sejam',\n hh: '%d jam',\n d: 'sehari',\n dd: '%d hari',\n M: 'sebulan',\n MM: '%d bulan',\n y: 'setahun',\n yy: '%d tahun',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return msMy;\n\n})));\n","//! moment.js locale configuration\n//! locale : Malay [ms]\n//! author : Weldan Jamili : https://github.com/weldan\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ms = moment.defineLocale('ms', {\n months: 'Januari_Februari_Mac_April_Mei_Jun_Julai_Ogos_September_Oktober_November_Disember'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mac_Apr_Mei_Jun_Jul_Ogs_Sep_Okt_Nov_Dis'.split('_'),\n weekdays: 'Ahad_Isnin_Selasa_Rabu_Khamis_Jumaat_Sabtu'.split('_'),\n weekdaysShort: 'Ahd_Isn_Sel_Rab_Kha_Jum_Sab'.split('_'),\n weekdaysMin: 'Ah_Is_Sl_Rb_Km_Jm_Sb'.split('_'),\n longDateFormat: {\n LT: 'HH.mm',\n LTS: 'HH.mm.ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY [pukul] HH.mm',\n LLLL: 'dddd, D MMMM YYYY [pukul] HH.mm',\n },\n meridiemParse: /pagi|tengahari|petang|malam/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'pagi') {\n return hour;\n } else if (meridiem === 'tengahari') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'petang' || meridiem === 'malam') {\n return hour + 12;\n }\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'pagi';\n } else if (hours < 15) {\n return 'tengahari';\n } else if (hours < 19) {\n return 'petang';\n } else {\n return 'malam';\n }\n },\n calendar: {\n sameDay: '[Hari ini pukul] LT',\n nextDay: '[Esok pukul] LT',\n nextWeek: 'dddd [pukul] LT',\n lastDay: '[Kelmarin pukul] LT',\n lastWeek: 'dddd [lepas pukul] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'dalam %s',\n past: '%s yang lepas',\n s: 'beberapa saat',\n ss: '%d saat',\n m: 'seminit',\n mm: '%d minit',\n h: 'sejam',\n hh: '%d jam',\n d: 'sehari',\n dd: '%d hari',\n M: 'sebulan',\n MM: '%d bulan',\n y: 'setahun',\n yy: '%d tahun',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return ms;\n\n})));\n","//! moment.js locale configuration\n//! locale : Maltese (Malta) [mt]\n//! author : Alessandro Maruccia : https://github.com/alesma\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var mt = moment.defineLocale('mt', {\n months: 'Jannar_Frar_Marzu_April_Mejju_Ġunju_Lulju_Awwissu_Settembru_Ottubru_Novembru_Diċembru'.split(\n '_'\n ),\n monthsShort: 'Jan_Fra_Mar_Apr_Mej_Ġun_Lul_Aww_Set_Ott_Nov_Diċ'.split('_'),\n weekdays: 'Il-Ħadd_It-Tnejn_It-Tlieta_L-Erbgħa_Il-Ħamis_Il-Ġimgħa_Is-Sibt'.split(\n '_'\n ),\n weekdaysShort: 'Ħad_Tne_Tli_Erb_Ħam_Ġim_Sib'.split('_'),\n weekdaysMin: 'Ħa_Tn_Tl_Er_Ħa_Ġi_Si'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Illum fil-]LT',\n nextDay: '[Għada fil-]LT',\n nextWeek: 'dddd [fil-]LT',\n lastDay: '[Il-bieraħ fil-]LT',\n lastWeek: 'dddd [li għadda] [fil-]LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'f’ %s',\n past: '%s ilu',\n s: 'ftit sekondi',\n ss: '%d sekondi',\n m: 'minuta',\n mm: '%d minuti',\n h: 'siegħa',\n hh: '%d siegħat',\n d: 'ġurnata',\n dd: '%d ġranet',\n M: 'xahar',\n MM: '%d xhur',\n y: 'sena',\n yy: '%d sni',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return mt;\n\n})));\n","//! moment.js locale configuration\n//! locale : Burmese [my]\n//! author : Squar team, mysquar.com\n//! author : David Rossellat : https://github.com/gholadr\n//! author : Tin Aung Lin : https://github.com/thanyawzinmin\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '၁',\n 2: '၂',\n 3: '၃',\n 4: '၄',\n 5: '၅',\n 6: '၆',\n 7: '၇',\n 8: '၈',\n 9: '၉',\n 0: '၀',\n },\n numberMap = {\n '၁': '1',\n '၂': '2',\n '၃': '3',\n '၄': '4',\n '၅': '5',\n '၆': '6',\n '၇': '7',\n '၈': '8',\n '၉': '9',\n '၀': '0',\n };\n\n var my = moment.defineLocale('my', {\n months: 'ဇန်နဝါရီ_ဖေဖော်ဝါရီ_မတ်_ဧပြီ_မေ_ဇွန်_ဇူလိုင်_သြဂုတ်_စက်တင်ဘာ_အောက်တိုဘာ_နိုဝင်ဘာ_ဒီဇင်ဘာ'.split(\n '_'\n ),\n monthsShort: 'ဇန်_ဖေ_မတ်_ပြီ_မေ_ဇွန်_လိုင်_သြ_စက်_အောက်_နို_ဒီ'.split('_'),\n weekdays: 'တနင်္ဂနွေ_တနင်္လာ_အင်္ဂါ_ဗုဒ္ဓဟူး_ကြာသပတေး_သောကြာ_စနေ'.split(\n '_'\n ),\n weekdaysShort: 'နွေ_လာ_ဂါ_ဟူး_ကြာ_သော_နေ'.split('_'),\n weekdaysMin: 'နွေ_လာ_ဂါ_ဟူး_ကြာ_သော_နေ'.split('_'),\n\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[ယနေ.] LT [မှာ]',\n nextDay: '[မနက်ဖြန်] LT [မှာ]',\n nextWeek: 'dddd LT [မှာ]',\n lastDay: '[မနေ.က] LT [မှာ]',\n lastWeek: '[ပြီးခဲ့သော] dddd LT [မှာ]',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'လာမည့် %s မှာ',\n past: 'လွန်ခဲ့သော %s က',\n s: 'စက္ကန်.အနည်းငယ်',\n ss: '%d စက္ကန့်',\n m: 'တစ်မိနစ်',\n mm: '%d မိနစ်',\n h: 'တစ်နာရီ',\n hh: '%d နာရီ',\n d: 'တစ်ရက်',\n dd: '%d ရက်',\n M: 'တစ်လ',\n MM: '%d လ',\n y: 'တစ်နှစ်',\n yy: '%d နှစ်',\n },\n preparse: function (string) {\n return string.replace(/[၁၂၃၄၅၆၇၈၉၀]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return my;\n\n})));\n","//! moment.js locale configuration\n//! locale : Norwegian Bokmål [nb]\n//! authors : Espen Hovlandsdal : https://github.com/rexxars\n//! Sigurd Gartmann : https://github.com/sigurdga\n//! Stephen Ramthun : https://github.com/stephenramthun\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var nb = moment.defineLocale('nb', {\n months: 'januar_februar_mars_april_mai_juni_juli_august_september_oktober_november_desember'.split(\n '_'\n ),\n monthsShort: 'jan._feb._mars_apr._mai_juni_juli_aug._sep._okt._nov._des.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'søndag_mandag_tirsdag_onsdag_torsdag_fredag_lørdag'.split('_'),\n weekdaysShort: 'sø._ma._ti._on._to._fr._lø.'.split('_'),\n weekdaysMin: 'sø_ma_ti_on_to_fr_lø'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY [kl.] HH:mm',\n LLLL: 'dddd D. MMMM YYYY [kl.] HH:mm',\n },\n calendar: {\n sameDay: '[i dag kl.] LT',\n nextDay: '[i morgen kl.] LT',\n nextWeek: 'dddd [kl.] LT',\n lastDay: '[i går kl.] LT',\n lastWeek: '[forrige] dddd [kl.] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'om %s',\n past: '%s siden',\n s: 'noen sekunder',\n ss: '%d sekunder',\n m: 'ett minutt',\n mm: '%d minutter',\n h: 'en time',\n hh: '%d timer',\n d: 'en dag',\n dd: '%d dager',\n w: 'en uke',\n ww: '%d uker',\n M: 'en måned',\n MM: '%d måneder',\n y: 'ett år',\n yy: '%d år',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return nb;\n\n})));\n","//! moment.js locale configuration\n//! locale : Nepalese [ne]\n//! author : suvash : https://github.com/suvash\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '१',\n 2: '२',\n 3: '३',\n 4: '४',\n 5: '५',\n 6: '६',\n 7: '७',\n 8: '८',\n 9: '९',\n 0: '०',\n },\n numberMap = {\n '१': '1',\n '२': '2',\n '३': '3',\n '४': '4',\n '५': '5',\n '६': '6',\n '७': '7',\n '८': '8',\n '९': '9',\n '०': '0',\n };\n\n var ne = moment.defineLocale('ne', {\n months: 'जनवरी_फेब्रुवरी_मार्च_अप्रिल_मई_जुन_जुलाई_अगष्ट_सेप्टेम्बर_अक्टोबर_नोभेम्बर_डिसेम्बर'.split(\n '_'\n ),\n monthsShort: 'जन._फेब्रु._मार्च_अप्रि._मई_जुन_जुलाई._अग._सेप्ट._अक्टो._नोभे._डिसे.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'आइतबार_सोमबार_मङ्गलबार_बुधबार_बिहिबार_शुक्रबार_शनिबार'.split(\n '_'\n ),\n weekdaysShort: 'आइत._सोम._मङ्गल._बुध._बिहि._शुक्र._शनि.'.split('_'),\n weekdaysMin: 'आ._सो._मं._बु._बि._शु._श.'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'Aको h:mm बजे',\n LTS: 'Aको h:mm:ss बजे',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, Aको h:mm बजे',\n LLLL: 'dddd, D MMMM YYYY, Aको h:mm बजे',\n },\n preparse: function (string) {\n return string.replace(/[१२३४५६७८९०]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n meridiemParse: /राति|बिहान|दिउँसो|साँझ/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'राति') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'बिहान') {\n return hour;\n } else if (meridiem === 'दिउँसो') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'साँझ') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 3) {\n return 'राति';\n } else if (hour < 12) {\n return 'बिहान';\n } else if (hour < 16) {\n return 'दिउँसो';\n } else if (hour < 20) {\n return 'साँझ';\n } else {\n return 'राति';\n }\n },\n calendar: {\n sameDay: '[आज] LT',\n nextDay: '[भोलि] LT',\n nextWeek: '[आउँदो] dddd[,] LT',\n lastDay: '[हिजो] LT',\n lastWeek: '[गएको] dddd[,] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%sमा',\n past: '%s अगाडि',\n s: 'केही क्षण',\n ss: '%d सेकेण्ड',\n m: 'एक मिनेट',\n mm: '%d मिनेट',\n h: 'एक घण्टा',\n hh: '%d घण्टा',\n d: 'एक दिन',\n dd: '%d दिन',\n M: 'एक महिना',\n MM: '%d महिना',\n y: 'एक बर्ष',\n yy: '%d बर्ष',\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return ne;\n\n})));\n","//! moment.js locale configuration\n//! locale : Dutch (Belgium) [nl-be]\n//! author : Joris Röling : https://github.com/jorisroling\n//! author : Jacob Middag : https://github.com/middagj\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsShortWithDots = 'jan._feb._mrt._apr._mei_jun._jul._aug._sep._okt._nov._dec.'.split(\n '_'\n ),\n monthsShortWithoutDots = 'jan_feb_mrt_apr_mei_jun_jul_aug_sep_okt_nov_dec'.split(\n '_'\n ),\n monthsParse = [\n /^jan/i,\n /^feb/i,\n /^maart|mrt.?$/i,\n /^apr/i,\n /^mei$/i,\n /^jun[i.]?$/i,\n /^jul[i.]?$/i,\n /^aug/i,\n /^sep/i,\n /^okt/i,\n /^nov/i,\n /^dec/i,\n ],\n monthsRegex = /^(januari|februari|maart|april|mei|ju[nl]i|augustus|september|oktober|november|december|jan\\.?|feb\\.?|mrt\\.?|apr\\.?|ju[nl]\\.?|aug\\.?|sep\\.?|okt\\.?|nov\\.?|dec\\.?)/i;\n\n var nlBe = moment.defineLocale('nl-be', {\n months: 'januari_februari_maart_april_mei_juni_juli_augustus_september_oktober_november_december'.split(\n '_'\n ),\n monthsShort: function (m, format) {\n if (!m) {\n return monthsShortWithDots;\n } else if (/-MMM-/.test(format)) {\n return monthsShortWithoutDots[m.month()];\n } else {\n return monthsShortWithDots[m.month()];\n }\n },\n\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(januari|februari|maart|april|mei|ju[nl]i|augustus|september|oktober|november|december)/i,\n monthsShortStrictRegex: /^(jan\\.?|feb\\.?|mrt\\.?|apr\\.?|mei|ju[nl]\\.?|aug\\.?|sep\\.?|okt\\.?|nov\\.?|dec\\.?)/i,\n\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n\n weekdays: 'zondag_maandag_dinsdag_woensdag_donderdag_vrijdag_zaterdag'.split(\n '_'\n ),\n weekdaysShort: 'zo._ma._di._wo._do._vr._za.'.split('_'),\n weekdaysMin: 'zo_ma_di_wo_do_vr_za'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[vandaag om] LT',\n nextDay: '[morgen om] LT',\n nextWeek: 'dddd [om] LT',\n lastDay: '[gisteren om] LT',\n lastWeek: '[afgelopen] dddd [om] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'over %s',\n past: '%s geleden',\n s: 'een paar seconden',\n ss: '%d seconden',\n m: 'één minuut',\n mm: '%d minuten',\n h: 'één uur',\n hh: '%d uur',\n d: 'één dag',\n dd: '%d dagen',\n M: 'één maand',\n MM: '%d maanden',\n y: 'één jaar',\n yy: '%d jaar',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(ste|de)/,\n ordinal: function (number) {\n return (\n number +\n (number === 1 || number === 8 || number >= 20 ? 'ste' : 'de')\n );\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return nlBe;\n\n})));\n","//! moment.js locale configuration\n//! locale : Dutch [nl]\n//! author : Joris Röling : https://github.com/jorisroling\n//! author : Jacob Middag : https://github.com/middagj\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsShortWithDots = 'jan._feb._mrt._apr._mei_jun._jul._aug._sep._okt._nov._dec.'.split(\n '_'\n ),\n monthsShortWithoutDots = 'jan_feb_mrt_apr_mei_jun_jul_aug_sep_okt_nov_dec'.split(\n '_'\n ),\n monthsParse = [\n /^jan/i,\n /^feb/i,\n /^maart|mrt.?$/i,\n /^apr/i,\n /^mei$/i,\n /^jun[i.]?$/i,\n /^jul[i.]?$/i,\n /^aug/i,\n /^sep/i,\n /^okt/i,\n /^nov/i,\n /^dec/i,\n ],\n monthsRegex = /^(januari|februari|maart|april|mei|ju[nl]i|augustus|september|oktober|november|december|jan\\.?|feb\\.?|mrt\\.?|apr\\.?|ju[nl]\\.?|aug\\.?|sep\\.?|okt\\.?|nov\\.?|dec\\.?)/i;\n\n var nl = moment.defineLocale('nl', {\n months: 'januari_februari_maart_april_mei_juni_juli_augustus_september_oktober_november_december'.split(\n '_'\n ),\n monthsShort: function (m, format) {\n if (!m) {\n return monthsShortWithDots;\n } else if (/-MMM-/.test(format)) {\n return monthsShortWithoutDots[m.month()];\n } else {\n return monthsShortWithDots[m.month()];\n }\n },\n\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(januari|februari|maart|april|mei|ju[nl]i|augustus|september|oktober|november|december)/i,\n monthsShortStrictRegex: /^(jan\\.?|feb\\.?|mrt\\.?|apr\\.?|mei|ju[nl]\\.?|aug\\.?|sep\\.?|okt\\.?|nov\\.?|dec\\.?)/i,\n\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n\n weekdays: 'zondag_maandag_dinsdag_woensdag_donderdag_vrijdag_zaterdag'.split(\n '_'\n ),\n weekdaysShort: 'zo._ma._di._wo._do._vr._za.'.split('_'),\n weekdaysMin: 'zo_ma_di_wo_do_vr_za'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD-MM-YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[vandaag om] LT',\n nextDay: '[morgen om] LT',\n nextWeek: 'dddd [om] LT',\n lastDay: '[gisteren om] LT',\n lastWeek: '[afgelopen] dddd [om] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'over %s',\n past: '%s geleden',\n s: 'een paar seconden',\n ss: '%d seconden',\n m: 'één minuut',\n mm: '%d minuten',\n h: 'één uur',\n hh: '%d uur',\n d: 'één dag',\n dd: '%d dagen',\n w: 'één week',\n ww: '%d weken',\n M: 'één maand',\n MM: '%d maanden',\n y: 'één jaar',\n yy: '%d jaar',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(ste|de)/,\n ordinal: function (number) {\n return (\n number +\n (number === 1 || number === 8 || number >= 20 ? 'ste' : 'de')\n );\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return nl;\n\n})));\n","//! moment.js locale configuration\n//! locale : Nynorsk [nn]\n//! authors : https://github.com/mechuwind\n//! Stephen Ramthun : https://github.com/stephenramthun\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var nn = moment.defineLocale('nn', {\n months: 'januar_februar_mars_april_mai_juni_juli_august_september_oktober_november_desember'.split(\n '_'\n ),\n monthsShort: 'jan._feb._mars_apr._mai_juni_juli_aug._sep._okt._nov._des.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'sundag_måndag_tysdag_onsdag_torsdag_fredag_laurdag'.split('_'),\n weekdaysShort: 'su._må._ty._on._to._fr._lau.'.split('_'),\n weekdaysMin: 'su_må_ty_on_to_fr_la'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY [kl.] H:mm',\n LLLL: 'dddd D. MMMM YYYY [kl.] HH:mm',\n },\n calendar: {\n sameDay: '[I dag klokka] LT',\n nextDay: '[I morgon klokka] LT',\n nextWeek: 'dddd [klokka] LT',\n lastDay: '[I går klokka] LT',\n lastWeek: '[Føregåande] dddd [klokka] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'om %s',\n past: '%s sidan',\n s: 'nokre sekund',\n ss: '%d sekund',\n m: 'eit minutt',\n mm: '%d minutt',\n h: 'ein time',\n hh: '%d timar',\n d: 'ein dag',\n dd: '%d dagar',\n w: 'ei veke',\n ww: '%d veker',\n M: 'ein månad',\n MM: '%d månader',\n y: 'eit år',\n yy: '%d år',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return nn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Occitan, lengadocian dialecte [oc-lnc]\n//! author : Quentin PAGÈS : https://github.com/Quenty31\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ocLnc = moment.defineLocale('oc-lnc', {\n months: {\n standalone: 'genièr_febrièr_març_abril_mai_junh_julhet_agost_setembre_octòbre_novembre_decembre'.split(\n '_'\n ),\n format: \"de genièr_de febrièr_de març_d'abril_de mai_de junh_de julhet_d'agost_de setembre_d'octòbre_de novembre_de decembre\".split(\n '_'\n ),\n isFormat: /D[oD]?(\\s)+MMMM/,\n },\n monthsShort: 'gen._febr._març_abr._mai_junh_julh._ago._set._oct._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'dimenge_diluns_dimars_dimècres_dijòus_divendres_dissabte'.split(\n '_'\n ),\n weekdaysShort: 'dg._dl._dm._dc._dj._dv._ds.'.split('_'),\n weekdaysMin: 'dg_dl_dm_dc_dj_dv_ds'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM [de] YYYY',\n ll: 'D MMM YYYY',\n LLL: 'D MMMM [de] YYYY [a] H:mm',\n lll: 'D MMM YYYY, H:mm',\n LLLL: 'dddd D MMMM [de] YYYY [a] H:mm',\n llll: 'ddd D MMM YYYY, H:mm',\n },\n calendar: {\n sameDay: '[uèi a] LT',\n nextDay: '[deman a] LT',\n nextWeek: 'dddd [a] LT',\n lastDay: '[ièr a] LT',\n lastWeek: 'dddd [passat a] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: \"d'aquí %s\",\n past: 'fa %s',\n s: 'unas segondas',\n ss: '%d segondas',\n m: 'una minuta',\n mm: '%d minutas',\n h: 'una ora',\n hh: '%d oras',\n d: 'un jorn',\n dd: '%d jorns',\n M: 'un mes',\n MM: '%d meses',\n y: 'un an',\n yy: '%d ans',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(r|n|t|è|a)/,\n ordinal: function (number, period) {\n var output =\n number === 1\n ? 'r'\n : number === 2\n ? 'n'\n : number === 3\n ? 'r'\n : number === 4\n ? 't'\n : 'è';\n if (period === 'w' || period === 'W') {\n output = 'a';\n }\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4,\n },\n });\n\n return ocLnc;\n\n})));\n","//! moment.js locale configuration\n//! locale : Punjabi (India) [pa-in]\n//! author : Harpreet Singh : https://github.com/harpreetkhalsagtbit\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '੧',\n 2: '੨',\n 3: '੩',\n 4: '੪',\n 5: '੫',\n 6: '੬',\n 7: '੭',\n 8: '੮',\n 9: '੯',\n 0: '੦',\n },\n numberMap = {\n '੧': '1',\n '੨': '2',\n '੩': '3',\n '੪': '4',\n '੫': '5',\n '੬': '6',\n '੭': '7',\n '੮': '8',\n '੯': '9',\n '੦': '0',\n };\n\n var paIn = moment.defineLocale('pa-in', {\n // There are months name as per Nanakshahi Calendar but they are not used as rigidly in modern Punjabi.\n months: 'ਜਨਵਰੀ_ਫ਼ਰਵਰੀ_ਮਾਰਚ_ਅਪ੍ਰੈਲ_ਮਈ_ਜੂਨ_ਜੁਲਾਈ_ਅਗਸਤ_ਸਤੰਬਰ_ਅਕਤੂਬਰ_ਨਵੰਬਰ_ਦਸੰਬਰ'.split(\n '_'\n ),\n monthsShort: 'ਜਨਵਰੀ_ਫ਼ਰਵਰੀ_ਮਾਰਚ_ਅਪ੍ਰੈਲ_ਮਈ_ਜੂਨ_ਜੁਲਾਈ_ਅਗਸਤ_ਸਤੰਬਰ_ਅਕਤੂਬਰ_ਨਵੰਬਰ_ਦਸੰਬਰ'.split(\n '_'\n ),\n weekdays: 'ਐਤਵਾਰ_ਸੋਮਵਾਰ_ਮੰਗਲਵਾਰ_ਬੁਧਵਾਰ_ਵੀਰਵਾਰ_ਸ਼ੁੱਕਰਵਾਰ_ਸ਼ਨੀਚਰਵਾਰ'.split(\n '_'\n ),\n weekdaysShort: 'ਐਤ_ਸੋਮ_ਮੰਗਲ_ਬੁਧ_ਵੀਰ_ਸ਼ੁਕਰ_ਸ਼ਨੀ'.split('_'),\n weekdaysMin: 'ਐਤ_ਸੋਮ_ਮੰਗਲ_ਬੁਧ_ਵੀਰ_ਸ਼ੁਕਰ_ਸ਼ਨੀ'.split('_'),\n longDateFormat: {\n LT: 'A h:mm ਵਜੇ',\n LTS: 'A h:mm:ss ਵਜੇ',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm ਵਜੇ',\n LLLL: 'dddd, D MMMM YYYY, A h:mm ਵਜੇ',\n },\n calendar: {\n sameDay: '[ਅਜ] LT',\n nextDay: '[ਕਲ] LT',\n nextWeek: '[ਅਗਲਾ] dddd, LT',\n lastDay: '[ਕਲ] LT',\n lastWeek: '[ਪਿਛਲੇ] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s ਵਿੱਚ',\n past: '%s ਪਿਛਲੇ',\n s: 'ਕੁਝ ਸਕਿੰਟ',\n ss: '%d ਸਕਿੰਟ',\n m: 'ਇਕ ਮਿੰਟ',\n mm: '%d ਮਿੰਟ',\n h: 'ਇੱਕ ਘੰਟਾ',\n hh: '%d ਘੰਟੇ',\n d: 'ਇੱਕ ਦਿਨ',\n dd: '%d ਦਿਨ',\n M: 'ਇੱਕ ਮਹੀਨਾ',\n MM: '%d ਮਹੀਨੇ',\n y: 'ਇੱਕ ਸਾਲ',\n yy: '%d ਸਾਲ',\n },\n preparse: function (string) {\n return string.replace(/[੧੨੩੪੫੬੭੮੯੦]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n // Punjabi notation for meridiems are quite fuzzy in practice. While there exists\n // a rigid notion of a 'Pahar' it is not used as rigidly in modern Punjabi.\n meridiemParse: /ਰਾਤ|ਸਵੇਰ|ਦੁਪਹਿਰ|ਸ਼ਾਮ/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'ਰਾਤ') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'ਸਵੇਰ') {\n return hour;\n } else if (meridiem === 'ਦੁਪਹਿਰ') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'ਸ਼ਾਮ') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'ਰਾਤ';\n } else if (hour < 10) {\n return 'ਸਵੇਰ';\n } else if (hour < 17) {\n return 'ਦੁਪਹਿਰ';\n } else if (hour < 20) {\n return 'ਸ਼ਾਮ';\n } else {\n return 'ਰਾਤ';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return paIn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Polish [pl]\n//! author : Rafal Hirsz : https://github.com/evoL\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var monthsNominative = 'styczeń_luty_marzec_kwiecień_maj_czerwiec_lipiec_sierpień_wrzesień_październik_listopad_grudzień'.split(\n '_'\n ),\n monthsSubjective = 'stycznia_lutego_marca_kwietnia_maja_czerwca_lipca_sierpnia_września_października_listopada_grudnia'.split(\n '_'\n ),\n monthsParse = [\n /^sty/i,\n /^lut/i,\n /^mar/i,\n /^kwi/i,\n /^maj/i,\n /^cze/i,\n /^lip/i,\n /^sie/i,\n /^wrz/i,\n /^paź/i,\n /^lis/i,\n /^gru/i,\n ];\n function plural(n) {\n return n % 10 < 5 && n % 10 > 1 && ~~(n / 10) % 10 !== 1;\n }\n function translate(number, withoutSuffix, key) {\n var result = number + ' ';\n switch (key) {\n case 'ss':\n return result + (plural(number) ? 'sekundy' : 'sekund');\n case 'm':\n return withoutSuffix ? 'minuta' : 'minutę';\n case 'mm':\n return result + (plural(number) ? 'minuty' : 'minut');\n case 'h':\n return withoutSuffix ? 'godzina' : 'godzinę';\n case 'hh':\n return result + (plural(number) ? 'godziny' : 'godzin');\n case 'ww':\n return result + (plural(number) ? 'tygodnie' : 'tygodni');\n case 'MM':\n return result + (plural(number) ? 'miesiące' : 'miesięcy');\n case 'yy':\n return result + (plural(number) ? 'lata' : 'lat');\n }\n }\n\n var pl = moment.defineLocale('pl', {\n months: function (momentToFormat, format) {\n if (!momentToFormat) {\n return monthsNominative;\n } else if (/D MMMM/.test(format)) {\n return monthsSubjective[momentToFormat.month()];\n } else {\n return monthsNominative[momentToFormat.month()];\n }\n },\n monthsShort: 'sty_lut_mar_kwi_maj_cze_lip_sie_wrz_paź_lis_gru'.split('_'),\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays: 'niedziela_poniedziałek_wtorek_środa_czwartek_piątek_sobota'.split(\n '_'\n ),\n weekdaysShort: 'ndz_pon_wt_śr_czw_pt_sob'.split('_'),\n weekdaysMin: 'Nd_Pn_Wt_Śr_Cz_Pt_So'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Dziś o] LT',\n nextDay: '[Jutro o] LT',\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[W niedzielę o] LT';\n\n case 2:\n return '[We wtorek o] LT';\n\n case 3:\n return '[W środę o] LT';\n\n case 6:\n return '[W sobotę o] LT';\n\n default:\n return '[W] dddd [o] LT';\n }\n },\n lastDay: '[Wczoraj o] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[W zeszłą niedzielę o] LT';\n case 3:\n return '[W zeszłą środę o] LT';\n case 6:\n return '[W zeszłą sobotę o] LT';\n default:\n return '[W zeszły] dddd [o] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'za %s',\n past: '%s temu',\n s: 'kilka sekund',\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: '1 dzień',\n dd: '%d dni',\n w: 'tydzień',\n ww: translate,\n M: 'miesiąc',\n MM: translate,\n y: 'rok',\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return pl;\n\n})));\n","//! moment.js locale configuration\n//! locale : Portuguese (Brazil) [pt-br]\n//! author : Caio Ribeiro Pereira : https://github.com/caio-ribeiro-pereira\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ptBr = moment.defineLocale('pt-br', {\n months: 'janeiro_fevereiro_março_abril_maio_junho_julho_agosto_setembro_outubro_novembro_dezembro'.split(\n '_'\n ),\n monthsShort: 'jan_fev_mar_abr_mai_jun_jul_ago_set_out_nov_dez'.split('_'),\n weekdays: 'domingo_segunda-feira_terça-feira_quarta-feira_quinta-feira_sexta-feira_sábado'.split(\n '_'\n ),\n weekdaysShort: 'dom_seg_ter_qua_qui_sex_sáb'.split('_'),\n weekdaysMin: 'do_2ª_3ª_4ª_5ª_6ª_sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D [de] MMMM [de] YYYY',\n LLL: 'D [de] MMMM [de] YYYY [às] HH:mm',\n LLLL: 'dddd, D [de] MMMM [de] YYYY [às] HH:mm',\n },\n calendar: {\n sameDay: '[Hoje às] LT',\n nextDay: '[Amanhã às] LT',\n nextWeek: 'dddd [às] LT',\n lastDay: '[Ontem às] LT',\n lastWeek: function () {\n return this.day() === 0 || this.day() === 6\n ? '[Último] dddd [às] LT' // Saturday + Sunday\n : '[Última] dddd [às] LT'; // Monday - Friday\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'em %s',\n past: 'há %s',\n s: 'poucos segundos',\n ss: '%d segundos',\n m: 'um minuto',\n mm: '%d minutos',\n h: 'uma hora',\n hh: '%d horas',\n d: 'um dia',\n dd: '%d dias',\n M: 'um mês',\n MM: '%d meses',\n y: 'um ano',\n yy: '%d anos',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n invalidDate: 'Data inválida',\n });\n\n return ptBr;\n\n})));\n","//! moment.js locale configuration\n//! locale : Portuguese [pt]\n//! author : Jefferson : https://github.com/jalex79\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var pt = moment.defineLocale('pt', {\n months: 'janeiro_fevereiro_março_abril_maio_junho_julho_agosto_setembro_outubro_novembro_dezembro'.split(\n '_'\n ),\n monthsShort: 'jan_fev_mar_abr_mai_jun_jul_ago_set_out_nov_dez'.split('_'),\n weekdays: 'Domingo_Segunda-feira_Terça-feira_Quarta-feira_Quinta-feira_Sexta-feira_Sábado'.split(\n '_'\n ),\n weekdaysShort: 'Dom_Seg_Ter_Qua_Qui_Sex_Sáb'.split('_'),\n weekdaysMin: 'Do_2ª_3ª_4ª_5ª_6ª_Sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D [de] MMMM [de] YYYY',\n LLL: 'D [de] MMMM [de] YYYY HH:mm',\n LLLL: 'dddd, D [de] MMMM [de] YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Hoje às] LT',\n nextDay: '[Amanhã às] LT',\n nextWeek: 'dddd [às] LT',\n lastDay: '[Ontem às] LT',\n lastWeek: function () {\n return this.day() === 0 || this.day() === 6\n ? '[Último] dddd [às] LT' // Saturday + Sunday\n : '[Última] dddd [às] LT'; // Monday - Friday\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'em %s',\n past: 'há %s',\n s: 'segundos',\n ss: '%d segundos',\n m: 'um minuto',\n mm: '%d minutos',\n h: 'uma hora',\n hh: '%d horas',\n d: 'um dia',\n dd: '%d dias',\n w: 'uma semana',\n ww: '%d semanas',\n M: 'um mês',\n MM: '%d meses',\n y: 'um ano',\n yy: '%d anos',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}º/,\n ordinal: '%dº',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return pt;\n\n})));\n","//! moment.js locale configuration\n//! locale : Romanian [ro]\n//! author : Vlad Gurdiga : https://github.com/gurdiga\n//! author : Valentin Agachi : https://github.com/avaly\n//! author : Emanuel Cepoi : https://github.com/cepem\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function relativeTimeWithPlural(number, withoutSuffix, key) {\n var format = {\n ss: 'secunde',\n mm: 'minute',\n hh: 'ore',\n dd: 'zile',\n ww: 'săptămâni',\n MM: 'luni',\n yy: 'ani',\n },\n separator = ' ';\n if (number % 100 >= 20 || (number >= 100 && number % 100 === 0)) {\n separator = ' de ';\n }\n return number + separator + format[key];\n }\n\n var ro = moment.defineLocale('ro', {\n months: 'ianuarie_februarie_martie_aprilie_mai_iunie_iulie_august_septembrie_octombrie_noiembrie_decembrie'.split(\n '_'\n ),\n monthsShort: 'ian._feb._mart._apr._mai_iun._iul._aug._sept._oct._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'duminică_luni_marți_miercuri_joi_vineri_sâmbătă'.split('_'),\n weekdaysShort: 'Dum_Lun_Mar_Mie_Joi_Vin_Sâm'.split('_'),\n weekdaysMin: 'Du_Lu_Ma_Mi_Jo_Vi_Sâ'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY H:mm',\n LLLL: 'dddd, D MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[azi la] LT',\n nextDay: '[mâine la] LT',\n nextWeek: 'dddd [la] LT',\n lastDay: '[ieri la] LT',\n lastWeek: '[fosta] dddd [la] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'peste %s',\n past: '%s în urmă',\n s: 'câteva secunde',\n ss: relativeTimeWithPlural,\n m: 'un minut',\n mm: relativeTimeWithPlural,\n h: 'o oră',\n hh: relativeTimeWithPlural,\n d: 'o zi',\n dd: relativeTimeWithPlural,\n w: 'o săptămână',\n ww: relativeTimeWithPlural,\n M: 'o lună',\n MM: relativeTimeWithPlural,\n y: 'un an',\n yy: relativeTimeWithPlural,\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return ro;\n\n})));\n","//! moment.js locale configuration\n//! locale : Russian [ru]\n//! author : Viktorminator : https://github.com/Viktorminator\n//! author : Menelion Elensúle : https://github.com/Oire\n//! author : Коренберг Марк : https://github.com/socketpair\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function plural(word, num) {\n var forms = word.split('_');\n return num % 10 === 1 && num % 100 !== 11\n ? forms[0]\n : num % 10 >= 2 && num % 10 <= 4 && (num % 100 < 10 || num % 100 >= 20)\n ? forms[1]\n : forms[2];\n }\n function relativeTimeWithPlural(number, withoutSuffix, key) {\n var format = {\n ss: withoutSuffix ? 'секунда_секунды_секунд' : 'секунду_секунды_секунд',\n mm: withoutSuffix ? 'минута_минуты_минут' : 'минуту_минуты_минут',\n hh: 'час_часа_часов',\n dd: 'день_дня_дней',\n ww: 'неделя_недели_недель',\n MM: 'месяц_месяца_месяцев',\n yy: 'год_года_лет',\n };\n if (key === 'm') {\n return withoutSuffix ? 'минута' : 'минуту';\n } else {\n return number + ' ' + plural(format[key], +number);\n }\n }\n var monthsParse = [\n /^янв/i,\n /^фев/i,\n /^мар/i,\n /^апр/i,\n /^ма[йя]/i,\n /^июн/i,\n /^июл/i,\n /^авг/i,\n /^сен/i,\n /^окт/i,\n /^ноя/i,\n /^дек/i,\n ];\n\n // http://new.gramota.ru/spravka/rules/139-prop : § 103\n // Сокращения месяцев: http://new.gramota.ru/spravka/buro/search-answer?s=242637\n // CLDR data: http://www.unicode.org/cldr/charts/28/summary/ru.html#1753\n var ru = moment.defineLocale('ru', {\n months: {\n format: 'января_февраля_марта_апреля_мая_июня_июля_августа_сентября_октября_ноября_декабря'.split(\n '_'\n ),\n standalone: 'январь_февраль_март_апрель_май_июнь_июль_август_сентябрь_октябрь_ноябрь_декабрь'.split(\n '_'\n ),\n },\n monthsShort: {\n // по CLDR именно \"июл.\" и \"июн.\", но какой смысл менять букву на точку?\n format: 'янв._февр._мар._апр._мая_июня_июля_авг._сент._окт._нояб._дек.'.split(\n '_'\n ),\n standalone: 'янв._февр._март_апр._май_июнь_июль_авг._сент._окт._нояб._дек.'.split(\n '_'\n ),\n },\n weekdays: {\n standalone: 'воскресенье_понедельник_вторник_среда_четверг_пятница_суббота'.split(\n '_'\n ),\n format: 'воскресенье_понедельник_вторник_среду_четверг_пятницу_субботу'.split(\n '_'\n ),\n isFormat: /\\[ ?[Вв] ?(?:прошлую|следующую|эту)? ?] ?dddd/,\n },\n weekdaysShort: 'вс_пн_вт_ср_чт_пт_сб'.split('_'),\n weekdaysMin: 'вс_пн_вт_ср_чт_пт_сб'.split('_'),\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n\n // полные названия с падежами, по три буквы, для некоторых, по 4 буквы, сокращения с точкой и без точки\n monthsRegex: /^(январ[ья]|янв\\.?|феврал[ья]|февр?\\.?|марта?|мар\\.?|апрел[ья]|апр\\.?|ма[йя]|июн[ья]|июн\\.?|июл[ья]|июл\\.?|августа?|авг\\.?|сентябр[ья]|сент?\\.?|октябр[ья]|окт\\.?|ноябр[ья]|нояб?\\.?|декабр[ья]|дек\\.?)/i,\n\n // копия предыдущего\n monthsShortRegex: /^(январ[ья]|янв\\.?|феврал[ья]|февр?\\.?|марта?|мар\\.?|апрел[ья]|апр\\.?|ма[йя]|июн[ья]|июн\\.?|июл[ья]|июл\\.?|августа?|авг\\.?|сентябр[ья]|сент?\\.?|октябр[ья]|окт\\.?|ноябр[ья]|нояб?\\.?|декабр[ья]|дек\\.?)/i,\n\n // полные названия с падежами\n monthsStrictRegex: /^(январ[яь]|феврал[яь]|марта?|апрел[яь]|ма[яй]|июн[яь]|июл[яь]|августа?|сентябр[яь]|октябр[яь]|ноябр[яь]|декабр[яь])/i,\n\n // Выражение, которое соответствует только сокращённым формам\n monthsShortStrictRegex: /^(янв\\.|февр?\\.|мар[т.]|апр\\.|ма[яй]|июн[ья.]|июл[ья.]|авг\\.|сент?\\.|окт\\.|нояб?\\.|дек\\.)/i,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY г.',\n LLL: 'D MMMM YYYY г., H:mm',\n LLLL: 'dddd, D MMMM YYYY г., H:mm',\n },\n calendar: {\n sameDay: '[Сегодня, в] LT',\n nextDay: '[Завтра, в] LT',\n lastDay: '[Вчера, в] LT',\n nextWeek: function (now) {\n if (now.week() !== this.week()) {\n switch (this.day()) {\n case 0:\n return '[В следующее] dddd, [в] LT';\n case 1:\n case 2:\n case 4:\n return '[В следующий] dddd, [в] LT';\n case 3:\n case 5:\n case 6:\n return '[В следующую] dddd, [в] LT';\n }\n } else {\n if (this.day() === 2) {\n return '[Во] dddd, [в] LT';\n } else {\n return '[В] dddd, [в] LT';\n }\n }\n },\n lastWeek: function (now) {\n if (now.week() !== this.week()) {\n switch (this.day()) {\n case 0:\n return '[В прошлое] dddd, [в] LT';\n case 1:\n case 2:\n case 4:\n return '[В прошлый] dddd, [в] LT';\n case 3:\n case 5:\n case 6:\n return '[В прошлую] dddd, [в] LT';\n }\n } else {\n if (this.day() === 2) {\n return '[Во] dddd, [в] LT';\n } else {\n return '[В] dddd, [в] LT';\n }\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'через %s',\n past: '%s назад',\n s: 'несколько секунд',\n ss: relativeTimeWithPlural,\n m: relativeTimeWithPlural,\n mm: relativeTimeWithPlural,\n h: 'час',\n hh: relativeTimeWithPlural,\n d: 'день',\n dd: relativeTimeWithPlural,\n w: 'неделя',\n ww: relativeTimeWithPlural,\n M: 'месяц',\n MM: relativeTimeWithPlural,\n y: 'год',\n yy: relativeTimeWithPlural,\n },\n meridiemParse: /ночи|утра|дня|вечера/i,\n isPM: function (input) {\n return /^(дня|вечера)$/.test(input);\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'ночи';\n } else if (hour < 12) {\n return 'утра';\n } else if (hour < 17) {\n return 'дня';\n } else {\n return 'вечера';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(й|го|я)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'M':\n case 'd':\n case 'DDD':\n return number + '-й';\n case 'D':\n return number + '-го';\n case 'w':\n case 'W':\n return number + '-я';\n default:\n return number;\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return ru;\n\n})));\n","//! moment.js locale configuration\n//! locale : Sindhi [sd]\n//! author : Narain Sagar : https://github.com/narainsagar\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var months = [\n 'جنوري',\n 'فيبروري',\n 'مارچ',\n 'اپريل',\n 'مئي',\n 'جون',\n 'جولاءِ',\n 'آگسٽ',\n 'سيپٽمبر',\n 'آڪٽوبر',\n 'نومبر',\n 'ڊسمبر',\n ],\n days = ['آچر', 'سومر', 'اڱارو', 'اربع', 'خميس', 'جمع', 'ڇنڇر'];\n\n var sd = moment.defineLocale('sd', {\n months: months,\n monthsShort: months,\n weekdays: days,\n weekdaysShort: days,\n weekdaysMin: days,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd، D MMMM YYYY HH:mm',\n },\n meridiemParse: /صبح|شام/,\n isPM: function (input) {\n return 'شام' === input;\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'صبح';\n }\n return 'شام';\n },\n calendar: {\n sameDay: '[اڄ] LT',\n nextDay: '[سڀاڻي] LT',\n nextWeek: 'dddd [اڳين هفتي تي] LT',\n lastDay: '[ڪالهه] LT',\n lastWeek: '[گزريل هفتي] dddd [تي] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s پوء',\n past: '%s اڳ',\n s: 'چند سيڪنڊ',\n ss: '%d سيڪنڊ',\n m: 'هڪ منٽ',\n mm: '%d منٽ',\n h: 'هڪ ڪلاڪ',\n hh: '%d ڪلاڪ',\n d: 'هڪ ڏينهن',\n dd: '%d ڏينهن',\n M: 'هڪ مهينو',\n MM: '%d مهينا',\n y: 'هڪ سال',\n yy: '%d سال',\n },\n preparse: function (string) {\n return string.replace(/،/g, ',');\n },\n postformat: function (string) {\n return string.replace(/,/g, '،');\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return sd;\n\n})));\n","//! moment.js locale configuration\n//! locale : Northern Sami [se]\n//! authors : Bård Rolstad Henriksen : https://github.com/karamell\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var se = moment.defineLocale('se', {\n months: 'ođđajagemánnu_guovvamánnu_njukčamánnu_cuoŋománnu_miessemánnu_geassemánnu_suoidnemánnu_borgemánnu_čakčamánnu_golggotmánnu_skábmamánnu_juovlamánnu'.split(\n '_'\n ),\n monthsShort: 'ođđj_guov_njuk_cuo_mies_geas_suoi_borg_čakč_golg_skáb_juov'.split(\n '_'\n ),\n weekdays: 'sotnabeaivi_vuossárga_maŋŋebárga_gaskavahkku_duorastat_bearjadat_lávvardat'.split(\n '_'\n ),\n weekdaysShort: 'sotn_vuos_maŋ_gask_duor_bear_láv'.split('_'),\n weekdaysMin: 's_v_m_g_d_b_L'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'MMMM D. [b.] YYYY',\n LLL: 'MMMM D. [b.] YYYY [ti.] HH:mm',\n LLLL: 'dddd, MMMM D. [b.] YYYY [ti.] HH:mm',\n },\n calendar: {\n sameDay: '[otne ti] LT',\n nextDay: '[ihttin ti] LT',\n nextWeek: 'dddd [ti] LT',\n lastDay: '[ikte ti] LT',\n lastWeek: '[ovddit] dddd [ti] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s geažes',\n past: 'maŋit %s',\n s: 'moadde sekunddat',\n ss: '%d sekunddat',\n m: 'okta minuhta',\n mm: '%d minuhtat',\n h: 'okta diimmu',\n hh: '%d diimmut',\n d: 'okta beaivi',\n dd: '%d beaivvit',\n M: 'okta mánnu',\n MM: '%d mánut',\n y: 'okta jahki',\n yy: '%d jagit',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return se;\n\n})));\n","//! moment.js locale configuration\n//! locale : Sinhalese [si]\n//! author : Sampath Sitinamaluwa : https://github.com/sampathsris\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n /*jshint -W100*/\n var si = moment.defineLocale('si', {\n months: 'ජනවාරි_පෙබරවාරි_මාර්තු_අප්රේල්_මැයි_ජූනි_ජූලි_අගෝස්තු_සැප්තැම්බර්_ඔක්තෝබර්_නොවැම්බර්_දෙසැම්බර්'.split(\n '_'\n ),\n monthsShort: 'ජන_පෙබ_මාර්_අප්_මැයි_ජූනි_ජූලි_අගෝ_සැප්_ඔක්_නොවැ_දෙසැ'.split(\n '_'\n ),\n weekdays: 'ඉරිදා_සඳුදා_අඟහරුවාදා_බදාදා_බ්රහස්පතින්දා_සිකුරාදා_සෙනසුරාදා'.split(\n '_'\n ),\n weekdaysShort: 'ඉරි_සඳු_අඟ_බදා_බ්රහ_සිකු_සෙන'.split('_'),\n weekdaysMin: 'ඉ_ස_අ_බ_බ්ර_සි_සෙ'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'a h:mm',\n LTS: 'a h:mm:ss',\n L: 'YYYY/MM/DD',\n LL: 'YYYY MMMM D',\n LLL: 'YYYY MMMM D, a h:mm',\n LLLL: 'YYYY MMMM D [වැනි] dddd, a h:mm:ss',\n },\n calendar: {\n sameDay: '[අද] LT[ට]',\n nextDay: '[හෙට] LT[ට]',\n nextWeek: 'dddd LT[ට]',\n lastDay: '[ඊයේ] LT[ට]',\n lastWeek: '[පසුගිය] dddd LT[ට]',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%sකින්',\n past: '%sකට පෙර',\n s: 'තත්පර කිහිපය',\n ss: 'තත්පර %d',\n m: 'මිනිත්තුව',\n mm: 'මිනිත්තු %d',\n h: 'පැය',\n hh: 'පැය %d',\n d: 'දිනය',\n dd: 'දින %d',\n M: 'මාසය',\n MM: 'මාස %d',\n y: 'වසර',\n yy: 'වසර %d',\n },\n dayOfMonthOrdinalParse: /\\d{1,2} වැනි/,\n ordinal: function (number) {\n return number + ' වැනි';\n },\n meridiemParse: /පෙර වරු|පස් වරු|පෙ.ව|ප.ව./,\n isPM: function (input) {\n return input === 'ප.ව.' || input === 'පස් වරු';\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'ප.ව.' : 'පස් වරු';\n } else {\n return isLower ? 'පෙ.ව.' : 'පෙර වරු';\n }\n },\n });\n\n return si;\n\n})));\n","//! moment.js locale configuration\n//! locale : Slovak [sk]\n//! author : Martin Minka : https://github.com/k2s\n//! based on work of petrbela : https://github.com/petrbela\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var months = 'január_február_marec_apríl_máj_jún_júl_august_september_október_november_december'.split(\n '_'\n ),\n monthsShort = 'jan_feb_mar_apr_máj_jún_júl_aug_sep_okt_nov_dec'.split('_');\n function plural(n) {\n return n > 1 && n < 5;\n }\n function translate(number, withoutSuffix, key, isFuture) {\n var result = number + ' ';\n switch (key) {\n case 's': // a few seconds / in a few seconds / a few seconds ago\n return withoutSuffix || isFuture ? 'pár sekúnd' : 'pár sekundami';\n case 'ss': // 9 seconds / in 9 seconds / 9 seconds ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'sekundy' : 'sekúnd');\n } else {\n return result + 'sekundami';\n }\n case 'm': // a minute / in a minute / a minute ago\n return withoutSuffix ? 'minúta' : isFuture ? 'minútu' : 'minútou';\n case 'mm': // 9 minutes / in 9 minutes / 9 minutes ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'minúty' : 'minút');\n } else {\n return result + 'minútami';\n }\n case 'h': // an hour / in an hour / an hour ago\n return withoutSuffix ? 'hodina' : isFuture ? 'hodinu' : 'hodinou';\n case 'hh': // 9 hours / in 9 hours / 9 hours ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'hodiny' : 'hodín');\n } else {\n return result + 'hodinami';\n }\n case 'd': // a day / in a day / a day ago\n return withoutSuffix || isFuture ? 'deň' : 'dňom';\n case 'dd': // 9 days / in 9 days / 9 days ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'dni' : 'dní');\n } else {\n return result + 'dňami';\n }\n case 'M': // a month / in a month / a month ago\n return withoutSuffix || isFuture ? 'mesiac' : 'mesiacom';\n case 'MM': // 9 months / in 9 months / 9 months ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'mesiace' : 'mesiacov');\n } else {\n return result + 'mesiacmi';\n }\n case 'y': // a year / in a year / a year ago\n return withoutSuffix || isFuture ? 'rok' : 'rokom';\n case 'yy': // 9 years / in 9 years / 9 years ago\n if (withoutSuffix || isFuture) {\n return result + (plural(number) ? 'roky' : 'rokov');\n } else {\n return result + 'rokmi';\n }\n }\n }\n\n var sk = moment.defineLocale('sk', {\n months: months,\n monthsShort: monthsShort,\n weekdays: 'nedeľa_pondelok_utorok_streda_štvrtok_piatok_sobota'.split('_'),\n weekdaysShort: 'ne_po_ut_st_št_pi_so'.split('_'),\n weekdaysMin: 'ne_po_ut_st_št_pi_so'.split('_'),\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY H:mm',\n LLLL: 'dddd D. MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[dnes o] LT',\n nextDay: '[zajtra o] LT',\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[v nedeľu o] LT';\n case 1:\n case 2:\n return '[v] dddd [o] LT';\n case 3:\n return '[v stredu o] LT';\n case 4:\n return '[vo štvrtok o] LT';\n case 5:\n return '[v piatok o] LT';\n case 6:\n return '[v sobotu o] LT';\n }\n },\n lastDay: '[včera o] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[minulú nedeľu o] LT';\n case 1:\n case 2:\n return '[minulý] dddd [o] LT';\n case 3:\n return '[minulú stredu o] LT';\n case 4:\n case 5:\n return '[minulý] dddd [o] LT';\n case 6:\n return '[minulú sobotu o] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'za %s',\n past: 'pred %s',\n s: translate,\n ss: translate,\n m: translate,\n mm: translate,\n h: translate,\n hh: translate,\n d: translate,\n dd: translate,\n M: translate,\n MM: translate,\n y: translate,\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return sk;\n\n})));\n","//! moment.js locale configuration\n//! locale : Slovenian [sl]\n//! author : Robert Sedovšek : https://github.com/sedovsek\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var result = number + ' ';\n switch (key) {\n case 's':\n return withoutSuffix || isFuture\n ? 'nekaj sekund'\n : 'nekaj sekundami';\n case 'ss':\n if (number === 1) {\n result += withoutSuffix ? 'sekundo' : 'sekundi';\n } else if (number === 2) {\n result += withoutSuffix || isFuture ? 'sekundi' : 'sekundah';\n } else if (number < 5) {\n result += withoutSuffix || isFuture ? 'sekunde' : 'sekundah';\n } else {\n result += 'sekund';\n }\n return result;\n case 'm':\n return withoutSuffix ? 'ena minuta' : 'eno minuto';\n case 'mm':\n if (number === 1) {\n result += withoutSuffix ? 'minuta' : 'minuto';\n } else if (number === 2) {\n result += withoutSuffix || isFuture ? 'minuti' : 'minutama';\n } else if (number < 5) {\n result += withoutSuffix || isFuture ? 'minute' : 'minutami';\n } else {\n result += withoutSuffix || isFuture ? 'minut' : 'minutami';\n }\n return result;\n case 'h':\n return withoutSuffix ? 'ena ura' : 'eno uro';\n case 'hh':\n if (number === 1) {\n result += withoutSuffix ? 'ura' : 'uro';\n } else if (number === 2) {\n result += withoutSuffix || isFuture ? 'uri' : 'urama';\n } else if (number < 5) {\n result += withoutSuffix || isFuture ? 'ure' : 'urami';\n } else {\n result += withoutSuffix || isFuture ? 'ur' : 'urami';\n }\n return result;\n case 'd':\n return withoutSuffix || isFuture ? 'en dan' : 'enim dnem';\n case 'dd':\n if (number === 1) {\n result += withoutSuffix || isFuture ? 'dan' : 'dnem';\n } else if (number === 2) {\n result += withoutSuffix || isFuture ? 'dni' : 'dnevoma';\n } else {\n result += withoutSuffix || isFuture ? 'dni' : 'dnevi';\n }\n return result;\n case 'M':\n return withoutSuffix || isFuture ? 'en mesec' : 'enim mesecem';\n case 'MM':\n if (number === 1) {\n result += withoutSuffix || isFuture ? 'mesec' : 'mesecem';\n } else if (number === 2) {\n result += withoutSuffix || isFuture ? 'meseca' : 'mesecema';\n } else if (number < 5) {\n result += withoutSuffix || isFuture ? 'mesece' : 'meseci';\n } else {\n result += withoutSuffix || isFuture ? 'mesecev' : 'meseci';\n }\n return result;\n case 'y':\n return withoutSuffix || isFuture ? 'eno leto' : 'enim letom';\n case 'yy':\n if (number === 1) {\n result += withoutSuffix || isFuture ? 'leto' : 'letom';\n } else if (number === 2) {\n result += withoutSuffix || isFuture ? 'leti' : 'letoma';\n } else if (number < 5) {\n result += withoutSuffix || isFuture ? 'leta' : 'leti';\n } else {\n result += withoutSuffix || isFuture ? 'let' : 'leti';\n }\n return result;\n }\n }\n\n var sl = moment.defineLocale('sl', {\n months: 'januar_februar_marec_april_maj_junij_julij_avgust_september_oktober_november_december'.split(\n '_'\n ),\n monthsShort: 'jan._feb._mar._apr._maj._jun._jul._avg._sep._okt._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'nedelja_ponedeljek_torek_sreda_četrtek_petek_sobota'.split('_'),\n weekdaysShort: 'ned._pon._tor._sre._čet._pet._sob.'.split('_'),\n weekdaysMin: 'ne_po_to_sr_če_pe_so'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD. MM. YYYY',\n LL: 'D. MMMM YYYY',\n LLL: 'D. MMMM YYYY H:mm',\n LLLL: 'dddd, D. MMMM YYYY H:mm',\n },\n calendar: {\n sameDay: '[danes ob] LT',\n nextDay: '[jutri ob] LT',\n\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[v] [nedeljo] [ob] LT';\n case 3:\n return '[v] [sredo] [ob] LT';\n case 6:\n return '[v] [soboto] [ob] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[v] dddd [ob] LT';\n }\n },\n lastDay: '[včeraj ob] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[prejšnjo] [nedeljo] [ob] LT';\n case 3:\n return '[prejšnjo] [sredo] [ob] LT';\n case 6:\n return '[prejšnjo] [soboto] [ob] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[prejšnji] dddd [ob] LT';\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'čez %s',\n past: 'pred %s',\n s: processRelativeTime,\n ss: processRelativeTime,\n m: processRelativeTime,\n mm: processRelativeTime,\n h: processRelativeTime,\n hh: processRelativeTime,\n d: processRelativeTime,\n dd: processRelativeTime,\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return sl;\n\n})));\n","//! moment.js locale configuration\n//! locale : Albanian [sq]\n//! author : Flakërim Ismani : https://github.com/flakerimi\n//! author : Menelion Elensúle : https://github.com/Oire\n//! author : Oerd Cukalla : https://github.com/oerd\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var sq = moment.defineLocale('sq', {\n months: 'Janar_Shkurt_Mars_Prill_Maj_Qershor_Korrik_Gusht_Shtator_Tetor_Nëntor_Dhjetor'.split(\n '_'\n ),\n monthsShort: 'Jan_Shk_Mar_Pri_Maj_Qer_Kor_Gus_Sht_Tet_Nën_Dhj'.split('_'),\n weekdays: 'E Diel_E Hënë_E Martë_E Mërkurë_E Enjte_E Premte_E Shtunë'.split(\n '_'\n ),\n weekdaysShort: 'Die_Hën_Mar_Mër_Enj_Pre_Sht'.split('_'),\n weekdaysMin: 'D_H_Ma_Më_E_P_Sh'.split('_'),\n weekdaysParseExact: true,\n meridiemParse: /PD|MD/,\n isPM: function (input) {\n return input.charAt(0) === 'M';\n },\n meridiem: function (hours, minutes, isLower) {\n return hours < 12 ? 'PD' : 'MD';\n },\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Sot në] LT',\n nextDay: '[Nesër në] LT',\n nextWeek: 'dddd [në] LT',\n lastDay: '[Dje në] LT',\n lastWeek: 'dddd [e kaluar në] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'në %s',\n past: '%s më parë',\n s: 'disa sekonda',\n ss: '%d sekonda',\n m: 'një minutë',\n mm: '%d minuta',\n h: 'një orë',\n hh: '%d orë',\n d: 'një ditë',\n dd: '%d ditë',\n M: 'një muaj',\n MM: '%d muaj',\n y: 'një vit',\n yy: '%d vite',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return sq;\n\n})));\n","//! moment.js locale configuration\n//! locale : Serbian Cyrillic [sr-cyrl]\n//! author : Milan Janačković : https://github.com/milan-j\n//! author : Stefan Crnjaković : https://github.com/crnjakovic\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var translator = {\n words: {\n //Different grammatical cases\n ss: ['секунда', 'секунде', 'секунди'],\n m: ['један минут', 'једне минуте'],\n mm: ['минут', 'минуте', 'минута'],\n h: ['један сат', 'једног сата'],\n hh: ['сат', 'сата', 'сати'],\n dd: ['дан', 'дана', 'дана'],\n MM: ['месец', 'месеца', 'месеци'],\n yy: ['година', 'године', 'година'],\n },\n correctGrammaticalCase: function (number, wordKey) {\n return number === 1\n ? wordKey[0]\n : number >= 2 && number <= 4\n ? wordKey[1]\n : wordKey[2];\n },\n translate: function (number, withoutSuffix, key) {\n var wordKey = translator.words[key];\n if (key.length === 1) {\n return withoutSuffix ? wordKey[0] : wordKey[1];\n } else {\n return (\n number +\n ' ' +\n translator.correctGrammaticalCase(number, wordKey)\n );\n }\n },\n };\n\n var srCyrl = moment.defineLocale('sr-cyrl', {\n months: 'јануар_фебруар_март_април_мај_јун_јул_август_септембар_октобар_новембар_децембар'.split(\n '_'\n ),\n monthsShort: 'јан._феб._мар._апр._мај_јун_јул_авг._сеп._окт._нов._дец.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'недеља_понедељак_уторак_среда_четвртак_петак_субота'.split('_'),\n weekdaysShort: 'нед._пон._уто._сре._чет._пет._суб.'.split('_'),\n weekdaysMin: 'не_по_ут_ср_че_пе_су'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'D. M. YYYY.',\n LL: 'D. MMMM YYYY.',\n LLL: 'D. MMMM YYYY. H:mm',\n LLLL: 'dddd, D. MMMM YYYY. H:mm',\n },\n calendar: {\n sameDay: '[данас у] LT',\n nextDay: '[сутра у] LT',\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[у] [недељу] [у] LT';\n case 3:\n return '[у] [среду] [у] LT';\n case 6:\n return '[у] [суботу] [у] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[у] dddd [у] LT';\n }\n },\n lastDay: '[јуче у] LT',\n lastWeek: function () {\n var lastWeekDays = [\n '[прошле] [недеље] [у] LT',\n '[прошлог] [понедељка] [у] LT',\n '[прошлог] [уторка] [у] LT',\n '[прошле] [среде] [у] LT',\n '[прошлог] [четвртка] [у] LT',\n '[прошлог] [петка] [у] LT',\n '[прошле] [суботе] [у] LT',\n ];\n return lastWeekDays[this.day()];\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'за %s',\n past: 'пре %s',\n s: 'неколико секунди',\n ss: translator.translate,\n m: translator.translate,\n mm: translator.translate,\n h: translator.translate,\n hh: translator.translate,\n d: 'дан',\n dd: translator.translate,\n M: 'месец',\n MM: translator.translate,\n y: 'годину',\n yy: translator.translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 1st is the first week of the year.\n },\n });\n\n return srCyrl;\n\n})));\n","//! moment.js locale configuration\n//! locale : Serbian [sr]\n//! author : Milan Janačković : https://github.com/milan-j\n//! author : Stefan Crnjaković : https://github.com/crnjakovic\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var translator = {\n words: {\n //Different grammatical cases\n ss: ['sekunda', 'sekunde', 'sekundi'],\n m: ['jedan minut', 'jedne minute'],\n mm: ['minut', 'minute', 'minuta'],\n h: ['jedan sat', 'jednog sata'],\n hh: ['sat', 'sata', 'sati'],\n dd: ['dan', 'dana', 'dana'],\n MM: ['mesec', 'meseca', 'meseci'],\n yy: ['godina', 'godine', 'godina'],\n },\n correctGrammaticalCase: function (number, wordKey) {\n return number === 1\n ? wordKey[0]\n : number >= 2 && number <= 4\n ? wordKey[1]\n : wordKey[2];\n },\n translate: function (number, withoutSuffix, key) {\n var wordKey = translator.words[key];\n if (key.length === 1) {\n return withoutSuffix ? wordKey[0] : wordKey[1];\n } else {\n return (\n number +\n ' ' +\n translator.correctGrammaticalCase(number, wordKey)\n );\n }\n },\n };\n\n var sr = moment.defineLocale('sr', {\n months: 'januar_februar_mart_april_maj_jun_jul_avgust_septembar_oktobar_novembar_decembar'.split(\n '_'\n ),\n monthsShort: 'jan._feb._mar._apr._maj_jun_jul_avg._sep._okt._nov._dec.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'nedelja_ponedeljak_utorak_sreda_četvrtak_petak_subota'.split(\n '_'\n ),\n weekdaysShort: 'ned._pon._uto._sre._čet._pet._sub.'.split('_'),\n weekdaysMin: 'ne_po_ut_sr_če_pe_su'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'D. M. YYYY.',\n LL: 'D. MMMM YYYY.',\n LLL: 'D. MMMM YYYY. H:mm',\n LLLL: 'dddd, D. MMMM YYYY. H:mm',\n },\n calendar: {\n sameDay: '[danas u] LT',\n nextDay: '[sutra u] LT',\n nextWeek: function () {\n switch (this.day()) {\n case 0:\n return '[u] [nedelju] [u] LT';\n case 3:\n return '[u] [sredu] [u] LT';\n case 6:\n return '[u] [subotu] [u] LT';\n case 1:\n case 2:\n case 4:\n case 5:\n return '[u] dddd [u] LT';\n }\n },\n lastDay: '[juče u] LT',\n lastWeek: function () {\n var lastWeekDays = [\n '[prošle] [nedelje] [u] LT',\n '[prošlog] [ponedeljka] [u] LT',\n '[prošlog] [utorka] [u] LT',\n '[prošle] [srede] [u] LT',\n '[prošlog] [četvrtka] [u] LT',\n '[prošlog] [petka] [u] LT',\n '[prošle] [subote] [u] LT',\n ];\n return lastWeekDays[this.day()];\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'za %s',\n past: 'pre %s',\n s: 'nekoliko sekundi',\n ss: translator.translate,\n m: translator.translate,\n mm: translator.translate,\n h: translator.translate,\n hh: translator.translate,\n d: 'dan',\n dd: translator.translate,\n M: 'mesec',\n MM: translator.translate,\n y: 'godinu',\n yy: translator.translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return sr;\n\n})));\n","//! moment.js locale configuration\n//! locale : siSwati [ss]\n//! author : Nicolai Davies : https://github.com/nicolaidavies\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ss = moment.defineLocale('ss', {\n months: \"Bhimbidvwane_Indlovana_Indlov'lenkhulu_Mabasa_Inkhwekhweti_Inhlaba_Kholwane_Ingci_Inyoni_Imphala_Lweti_Ingongoni\".split(\n '_'\n ),\n monthsShort: 'Bhi_Ina_Inu_Mab_Ink_Inh_Kho_Igc_Iny_Imp_Lwe_Igo'.split('_'),\n weekdays: 'Lisontfo_Umsombuluko_Lesibili_Lesitsatfu_Lesine_Lesihlanu_Umgcibelo'.split(\n '_'\n ),\n weekdaysShort: 'Lis_Umb_Lsb_Les_Lsi_Lsh_Umg'.split('_'),\n weekdaysMin: 'Li_Us_Lb_Lt_Ls_Lh_Ug'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY h:mm A',\n LLLL: 'dddd, D MMMM YYYY h:mm A',\n },\n calendar: {\n sameDay: '[Namuhla nga] LT',\n nextDay: '[Kusasa nga] LT',\n nextWeek: 'dddd [nga] LT',\n lastDay: '[Itolo nga] LT',\n lastWeek: 'dddd [leliphelile] [nga] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'nga %s',\n past: 'wenteka nga %s',\n s: 'emizuzwana lomcane',\n ss: '%d mzuzwana',\n m: 'umzuzu',\n mm: '%d emizuzu',\n h: 'lihora',\n hh: '%d emahora',\n d: 'lilanga',\n dd: '%d emalanga',\n M: 'inyanga',\n MM: '%d tinyanga',\n y: 'umnyaka',\n yy: '%d iminyaka',\n },\n meridiemParse: /ekuseni|emini|entsambama|ebusuku/,\n meridiem: function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'ekuseni';\n } else if (hours < 15) {\n return 'emini';\n } else if (hours < 19) {\n return 'entsambama';\n } else {\n return 'ebusuku';\n }\n },\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'ekuseni') {\n return hour;\n } else if (meridiem === 'emini') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'entsambama' || meridiem === 'ebusuku') {\n if (hour === 0) {\n return 0;\n }\n return hour + 12;\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}/,\n ordinal: '%d',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return ss;\n\n})));\n","//! moment.js locale configuration\n//! locale : Swedish [sv]\n//! author : Jens Alm : https://github.com/ulmus\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var sv = moment.defineLocale('sv', {\n months: 'januari_februari_mars_april_maj_juni_juli_augusti_september_oktober_november_december'.split(\n '_'\n ),\n monthsShort: 'jan_feb_mar_apr_maj_jun_jul_aug_sep_okt_nov_dec'.split('_'),\n weekdays: 'söndag_måndag_tisdag_onsdag_torsdag_fredag_lördag'.split('_'),\n weekdaysShort: 'sön_mån_tis_ons_tor_fre_lör'.split('_'),\n weekdaysMin: 'sö_må_ti_on_to_fr_lö'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY-MM-DD',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY [kl.] HH:mm',\n LLLL: 'dddd D MMMM YYYY [kl.] HH:mm',\n lll: 'D MMM YYYY HH:mm',\n llll: 'ddd D MMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Idag] LT',\n nextDay: '[Imorgon] LT',\n lastDay: '[Igår] LT',\n nextWeek: '[På] dddd LT',\n lastWeek: '[I] dddd[s] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'om %s',\n past: 'för %s sedan',\n s: 'några sekunder',\n ss: '%d sekunder',\n m: 'en minut',\n mm: '%d minuter',\n h: 'en timme',\n hh: '%d timmar',\n d: 'en dag',\n dd: '%d dagar',\n M: 'en månad',\n MM: '%d månader',\n y: 'ett år',\n yy: '%d år',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(\\:e|\\:a)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? ':e'\n : b === 1\n ? ':a'\n : b === 2\n ? ':a'\n : b === 3\n ? ':e'\n : ':e';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return sv;\n\n})));\n","//! moment.js locale configuration\n//! locale : Swahili [sw]\n//! author : Fahad Kassim : https://github.com/fadsel\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var sw = moment.defineLocale('sw', {\n months: 'Januari_Februari_Machi_Aprili_Mei_Juni_Julai_Agosti_Septemba_Oktoba_Novemba_Desemba'.split(\n '_'\n ),\n monthsShort: 'Jan_Feb_Mac_Apr_Mei_Jun_Jul_Ago_Sep_Okt_Nov_Des'.split('_'),\n weekdays: 'Jumapili_Jumatatu_Jumanne_Jumatano_Alhamisi_Ijumaa_Jumamosi'.split(\n '_'\n ),\n weekdaysShort: 'Jpl_Jtat_Jnne_Jtan_Alh_Ijm_Jmos'.split('_'),\n weekdaysMin: 'J2_J3_J4_J5_Al_Ij_J1'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'hh:mm A',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[leo saa] LT',\n nextDay: '[kesho saa] LT',\n nextWeek: '[wiki ijayo] dddd [saat] LT',\n lastDay: '[jana] LT',\n lastWeek: '[wiki iliyopita] dddd [saat] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s baadaye',\n past: 'tokea %s',\n s: 'hivi punde',\n ss: 'sekunde %d',\n m: 'dakika moja',\n mm: 'dakika %d',\n h: 'saa limoja',\n hh: 'masaa %d',\n d: 'siku moja',\n dd: 'siku %d',\n M: 'mwezi mmoja',\n MM: 'miezi %d',\n y: 'mwaka mmoja',\n yy: 'miaka %d',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return sw;\n\n})));\n","//! moment.js locale configuration\n//! locale : Tamil [ta]\n//! author : Arjunkumar Krishnamoorthy : https://github.com/tk120404\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var symbolMap = {\n 1: '௧',\n 2: '௨',\n 3: '௩',\n 4: '௪',\n 5: '௫',\n 6: '௬',\n 7: '௭',\n 8: '௮',\n 9: '௯',\n 0: '௦',\n },\n numberMap = {\n '௧': '1',\n '௨': '2',\n '௩': '3',\n '௪': '4',\n '௫': '5',\n '௬': '6',\n '௭': '7',\n '௮': '8',\n '௯': '9',\n '௦': '0',\n };\n\n var ta = moment.defineLocale('ta', {\n months: 'ஜனவரி_பிப்ரவரி_மார்ச்_ஏப்ரல்_மே_ஜூன்_ஜூலை_ஆகஸ்ட்_செப்டெம்பர்_அக்டோபர்_நவம்பர்_டிசம்பர்'.split(\n '_'\n ),\n monthsShort: 'ஜனவரி_பிப்ரவரி_மார்ச்_ஏப்ரல்_மே_ஜூன்_ஜூலை_ஆகஸ்ட்_செப்டெம்பர்_அக்டோபர்_நவம்பர்_டிசம்பர்'.split(\n '_'\n ),\n weekdays: 'ஞாயிற்றுக்கிழமை_திங்கட்கிழமை_செவ்வாய்கிழமை_புதன்கிழமை_வியாழக்கிழமை_வெள்ளிக்கிழமை_சனிக்கிழமை'.split(\n '_'\n ),\n weekdaysShort: 'ஞாயிறு_திங்கள்_செவ்வாய்_புதன்_வியாழன்_வெள்ளி_சனி'.split(\n '_'\n ),\n weekdaysMin: 'ஞா_தி_செ_பு_வி_வெ_ச'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, HH:mm',\n LLLL: 'dddd, D MMMM YYYY, HH:mm',\n },\n calendar: {\n sameDay: '[இன்று] LT',\n nextDay: '[நாளை] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[நேற்று] LT',\n lastWeek: '[கடந்த வாரம்] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s இல்',\n past: '%s முன்',\n s: 'ஒரு சில விநாடிகள்',\n ss: '%d விநாடிகள்',\n m: 'ஒரு நிமிடம்',\n mm: '%d நிமிடங்கள்',\n h: 'ஒரு மணி நேரம்',\n hh: '%d மணி நேரம்',\n d: 'ஒரு நாள்',\n dd: '%d நாட்கள்',\n M: 'ஒரு மாதம்',\n MM: '%d மாதங்கள்',\n y: 'ஒரு வருடம்',\n yy: '%d ஆண்டுகள்',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}வது/,\n ordinal: function (number) {\n return number + 'வது';\n },\n preparse: function (string) {\n return string.replace(/[௧௨௩௪௫௬௭௮௯௦]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n // refer http://ta.wikipedia.org/s/1er1\n meridiemParse: /யாமம்|வைகறை|காலை|நண்பகல்|எற்பாடு|மாலை/,\n meridiem: function (hour, minute, isLower) {\n if (hour < 2) {\n return ' யாமம்';\n } else if (hour < 6) {\n return ' வைகறை'; // வைகறை\n } else if (hour < 10) {\n return ' காலை'; // காலை\n } else if (hour < 14) {\n return ' நண்பகல்'; // நண்பகல்\n } else if (hour < 18) {\n return ' எற்பாடு'; // எற்பாடு\n } else if (hour < 22) {\n return ' மாலை'; // மாலை\n } else {\n return ' யாமம்';\n }\n },\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'யாமம்') {\n return hour < 2 ? hour : hour + 12;\n } else if (meridiem === 'வைகறை' || meridiem === 'காலை') {\n return hour;\n } else if (meridiem === 'நண்பகல்') {\n return hour >= 10 ? hour : hour + 12;\n } else {\n return hour + 12;\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return ta;\n\n})));\n","//! moment.js locale configuration\n//! locale : Telugu [te]\n//! author : Krishna Chaitanya Thota : https://github.com/kcthota\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var te = moment.defineLocale('te', {\n months: 'జనవరి_ఫిబ్రవరి_మార్చి_ఏప్రిల్_మే_జూన్_జులై_ఆగస్టు_సెప్టెంబర్_అక్టోబర్_నవంబర్_డిసెంబర్'.split(\n '_'\n ),\n monthsShort: 'జన._ఫిబ్ర._మార్చి_ఏప్రి._మే_జూన్_జులై_ఆగ._సెప్._అక్టో._నవ._డిసె.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'ఆదివారం_సోమవారం_మంగళవారం_బుధవారం_గురువారం_శుక్రవారం_శనివారం'.split(\n '_'\n ),\n weekdaysShort: 'ఆది_సోమ_మంగళ_బుధ_గురు_శుక్ర_శని'.split('_'),\n weekdaysMin: 'ఆ_సో_మం_బు_గు_శు_శ'.split('_'),\n longDateFormat: {\n LT: 'A h:mm',\n LTS: 'A h:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY, A h:mm',\n LLLL: 'dddd, D MMMM YYYY, A h:mm',\n },\n calendar: {\n sameDay: '[నేడు] LT',\n nextDay: '[రేపు] LT',\n nextWeek: 'dddd, LT',\n lastDay: '[నిన్న] LT',\n lastWeek: '[గత] dddd, LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s లో',\n past: '%s క్రితం',\n s: 'కొన్ని క్షణాలు',\n ss: '%d సెకన్లు',\n m: 'ఒక నిమిషం',\n mm: '%d నిమిషాలు',\n h: 'ఒక గంట',\n hh: '%d గంటలు',\n d: 'ఒక రోజు',\n dd: '%d రోజులు',\n M: 'ఒక నెల',\n MM: '%d నెలలు',\n y: 'ఒక సంవత్సరం',\n yy: '%d సంవత్సరాలు',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}వ/,\n ordinal: '%dవ',\n meridiemParse: /రాత్రి|ఉదయం|మధ్యాహ్నం|సాయంత్రం/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'రాత్రి') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'ఉదయం') {\n return hour;\n } else if (meridiem === 'మధ్యాహ్నం') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'సాయంత్రం') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'రాత్రి';\n } else if (hour < 10) {\n return 'ఉదయం';\n } else if (hour < 17) {\n return 'మధ్యాహ్నం';\n } else if (hour < 20) {\n return 'సాయంత్రం';\n } else {\n return 'రాత్రి';\n }\n },\n week: {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n },\n });\n\n return te;\n\n})));\n","//! moment.js locale configuration\n//! locale : Tetun Dili (East Timor) [tet]\n//! author : Joshua Brooks : https://github.com/joshbrooks\n//! author : Onorio De J. Afonso : https://github.com/marobo\n//! author : Sonia Simoes : https://github.com/soniasimoes\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var tet = moment.defineLocale('tet', {\n months: 'Janeiru_Fevereiru_Marsu_Abril_Maiu_Juñu_Jullu_Agustu_Setembru_Outubru_Novembru_Dezembru'.split(\n '_'\n ),\n monthsShort: 'Jan_Fev_Mar_Abr_Mai_Jun_Jul_Ago_Set_Out_Nov_Dez'.split('_'),\n weekdays: 'Domingu_Segunda_Tersa_Kuarta_Kinta_Sesta_Sabadu'.split('_'),\n weekdaysShort: 'Dom_Seg_Ters_Kua_Kint_Sest_Sab'.split('_'),\n weekdaysMin: 'Do_Seg_Te_Ku_Ki_Ses_Sa'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Ohin iha] LT',\n nextDay: '[Aban iha] LT',\n nextWeek: 'dddd [iha] LT',\n lastDay: '[Horiseik iha] LT',\n lastWeek: 'dddd [semana kotuk] [iha] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'iha %s',\n past: '%s liuba',\n s: 'segundu balun',\n ss: 'segundu %d',\n m: 'minutu ida',\n mm: 'minutu %d',\n h: 'oras ida',\n hh: 'oras %d',\n d: 'loron ida',\n dd: 'loron %d',\n M: 'fulan ida',\n MM: 'fulan %d',\n y: 'tinan ida',\n yy: 'tinan %d',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(st|nd|rd|th)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return tet;\n\n})));\n","//! moment.js locale configuration\n//! locale : Tajik [tg]\n//! author : Orif N. Jr. : https://github.com/orif-jr\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var suffixes = {\n 0: '-ум',\n 1: '-ум',\n 2: '-юм',\n 3: '-юм',\n 4: '-ум',\n 5: '-ум',\n 6: '-ум',\n 7: '-ум',\n 8: '-ум',\n 9: '-ум',\n 10: '-ум',\n 12: '-ум',\n 13: '-ум',\n 20: '-ум',\n 30: '-юм',\n 40: '-ум',\n 50: '-ум',\n 60: '-ум',\n 70: '-ум',\n 80: '-ум',\n 90: '-ум',\n 100: '-ум',\n };\n\n var tg = moment.defineLocale('tg', {\n months: {\n format: 'январи_феврали_марти_апрели_майи_июни_июли_августи_сентябри_октябри_ноябри_декабри'.split(\n '_'\n ),\n standalone: 'январ_феврал_март_апрел_май_июн_июл_август_сентябр_октябр_ноябр_декабр'.split(\n '_'\n ),\n },\n monthsShort: 'янв_фев_мар_апр_май_июн_июл_авг_сен_окт_ноя_дек'.split('_'),\n weekdays: 'якшанбе_душанбе_сешанбе_чоршанбе_панҷшанбе_ҷумъа_шанбе'.split(\n '_'\n ),\n weekdaysShort: 'яшб_дшб_сшб_чшб_пшб_ҷум_шнб'.split('_'),\n weekdaysMin: 'яш_дш_сш_чш_пш_ҷм_шб'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Имрӯз соати] LT',\n nextDay: '[Фардо соати] LT',\n lastDay: '[Дирӯз соати] LT',\n nextWeek: 'dddd[и] [ҳафтаи оянда соати] LT',\n lastWeek: 'dddd[и] [ҳафтаи гузашта соати] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'баъди %s',\n past: '%s пеш',\n s: 'якчанд сония',\n m: 'як дақиқа',\n mm: '%d дақиқа',\n h: 'як соат',\n hh: '%d соат',\n d: 'як рӯз',\n dd: '%d рӯз',\n M: 'як моҳ',\n MM: '%d моҳ',\n y: 'як сол',\n yy: '%d сол',\n },\n meridiemParse: /шаб|субҳ|рӯз|бегоҳ/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'шаб') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'субҳ') {\n return hour;\n } else if (meridiem === 'рӯз') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'бегоҳ') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'шаб';\n } else if (hour < 11) {\n return 'субҳ';\n } else if (hour < 16) {\n return 'рӯз';\n } else if (hour < 19) {\n return 'бегоҳ';\n } else {\n return 'шаб';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(ум|юм)/,\n ordinal: function (number) {\n var a = number % 10,\n b = number >= 100 ? 100 : null;\n return number + (suffixes[number] || suffixes[a] || suffixes[b]);\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 1th is the first week of the year.\n },\n });\n\n return tg;\n\n})));\n","//! moment.js locale configuration\n//! locale : Thai [th]\n//! author : Kridsada Thanabulpong : https://github.com/sirn\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var th = moment.defineLocale('th', {\n months: 'มกราคม_กุมภาพันธ์_มีนาคม_เมษายน_พฤษภาคม_มิถุนายน_กรกฎาคม_สิงหาคม_กันยายน_ตุลาคม_พฤศจิกายน_ธันวาคม'.split(\n '_'\n ),\n monthsShort: 'ม.ค._ก.พ._มี.ค._เม.ย._พ.ค._มิ.ย._ก.ค._ส.ค._ก.ย._ต.ค._พ.ย._ธ.ค.'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'อาทิตย์_จันทร์_อังคาร_พุธ_พฤหัสบดี_ศุกร์_เสาร์'.split('_'),\n weekdaysShort: 'อาทิตย์_จันทร์_อังคาร_พุธ_พฤหัส_ศุกร์_เสาร์'.split('_'), // yes, three characters difference\n weekdaysMin: 'อา._จ._อ._พ._พฤ._ศ._ส.'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'H:mm',\n LTS: 'H:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY เวลา H:mm',\n LLLL: 'วันddddที่ D MMMM YYYY เวลา H:mm',\n },\n meridiemParse: /ก่อนเที่ยง|หลังเที่ยง/,\n isPM: function (input) {\n return input === 'หลังเที่ยง';\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ก่อนเที่ยง';\n } else {\n return 'หลังเที่ยง';\n }\n },\n calendar: {\n sameDay: '[วันนี้ เวลา] LT',\n nextDay: '[พรุ่งนี้ เวลา] LT',\n nextWeek: 'dddd[หน้า เวลา] LT',\n lastDay: '[เมื่อวานนี้ เวลา] LT',\n lastWeek: '[วัน]dddd[ที่แล้ว เวลา] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'อีก %s',\n past: '%sที่แล้ว',\n s: 'ไม่กี่วินาที',\n ss: '%d วินาที',\n m: '1 นาที',\n mm: '%d นาที',\n h: '1 ชั่วโมง',\n hh: '%d ชั่วโมง',\n d: '1 วัน',\n dd: '%d วัน',\n w: '1 สัปดาห์',\n ww: '%d สัปดาห์',\n M: '1 เดือน',\n MM: '%d เดือน',\n y: '1 ปี',\n yy: '%d ปี',\n },\n });\n\n return th;\n\n})));\n","//! moment.js locale configuration\n//! locale : Turkmen [tk]\n//! author : Atamyrat Abdyrahmanov : https://github.com/atamyratabdy\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var suffixes = {\n 1: \"'inji\",\n 5: \"'inji\",\n 8: \"'inji\",\n 70: \"'inji\",\n 80: \"'inji\",\n 2: \"'nji\",\n 7: \"'nji\",\n 20: \"'nji\",\n 50: \"'nji\",\n 3: \"'ünji\",\n 4: \"'ünji\",\n 100: \"'ünji\",\n 6: \"'njy\",\n 9: \"'unjy\",\n 10: \"'unjy\",\n 30: \"'unjy\",\n 60: \"'ynjy\",\n 90: \"'ynjy\",\n };\n\n var tk = moment.defineLocale('tk', {\n months: 'Ýanwar_Fewral_Mart_Aprel_Maý_Iýun_Iýul_Awgust_Sentýabr_Oktýabr_Noýabr_Dekabr'.split(\n '_'\n ),\n monthsShort: 'Ýan_Few_Mar_Apr_Maý_Iýn_Iýl_Awg_Sen_Okt_Noý_Dek'.split('_'),\n weekdays: 'Ýekşenbe_Duşenbe_Sişenbe_Çarşenbe_Penşenbe_Anna_Şenbe'.split(\n '_'\n ),\n weekdaysShort: 'Ýek_Duş_Siş_Çar_Pen_Ann_Şen'.split('_'),\n weekdaysMin: 'Ýk_Dş_Sş_Çr_Pn_An_Şn'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[bugün sagat] LT',\n nextDay: '[ertir sagat] LT',\n nextWeek: '[indiki] dddd [sagat] LT',\n lastDay: '[düýn] LT',\n lastWeek: '[geçen] dddd [sagat] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s soň',\n past: '%s öň',\n s: 'birnäçe sekunt',\n m: 'bir minut',\n mm: '%d minut',\n h: 'bir sagat',\n hh: '%d sagat',\n d: 'bir gün',\n dd: '%d gün',\n M: 'bir aý',\n MM: '%d aý',\n y: 'bir ýyl',\n yy: '%d ýyl',\n },\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'Do':\n case 'DD':\n return number;\n default:\n if (number === 0) {\n // special case for zero\n return number + \"'unjy\";\n }\n var a = number % 10,\n b = (number % 100) - a,\n c = number >= 100 ? 100 : null;\n return number + (suffixes[a] || suffixes[b] || suffixes[c]);\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return tk;\n\n})));\n","//! moment.js locale configuration\n//! locale : Tagalog (Philippines) [tl-ph]\n//! author : Dan Hagman : https://github.com/hagmandan\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var tlPh = moment.defineLocale('tl-ph', {\n months: 'Enero_Pebrero_Marso_Abril_Mayo_Hunyo_Hulyo_Agosto_Setyembre_Oktubre_Nobyembre_Disyembre'.split(\n '_'\n ),\n monthsShort: 'Ene_Peb_Mar_Abr_May_Hun_Hul_Ago_Set_Okt_Nob_Dis'.split('_'),\n weekdays: 'Linggo_Lunes_Martes_Miyerkules_Huwebes_Biyernes_Sabado'.split(\n '_'\n ),\n weekdaysShort: 'Lin_Lun_Mar_Miy_Huw_Biy_Sab'.split('_'),\n weekdaysMin: 'Li_Lu_Ma_Mi_Hu_Bi_Sab'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'MM/D/YYYY',\n LL: 'MMMM D, YYYY',\n LLL: 'MMMM D, YYYY HH:mm',\n LLLL: 'dddd, MMMM DD, YYYY HH:mm',\n },\n calendar: {\n sameDay: 'LT [ngayong araw]',\n nextDay: '[Bukas ng] LT',\n nextWeek: 'LT [sa susunod na] dddd',\n lastDay: 'LT [kahapon]',\n lastWeek: 'LT [noong nakaraang] dddd',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'sa loob ng %s',\n past: '%s ang nakalipas',\n s: 'ilang segundo',\n ss: '%d segundo',\n m: 'isang minuto',\n mm: '%d minuto',\n h: 'isang oras',\n hh: '%d oras',\n d: 'isang araw',\n dd: '%d araw',\n M: 'isang buwan',\n MM: '%d buwan',\n y: 'isang taon',\n yy: '%d taon',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}/,\n ordinal: function (number) {\n return number;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return tlPh;\n\n})));\n","//! moment.js locale configuration\n//! locale : Klingon [tlh]\n//! author : Dominika Kruk : https://github.com/amaranthrose\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var numbersNouns = 'pagh_wa’_cha’_wej_loS_vagh_jav_Soch_chorgh_Hut'.split('_');\n\n function translateFuture(output) {\n var time = output;\n time =\n output.indexOf('jaj') !== -1\n ? time.slice(0, -3) + 'leS'\n : output.indexOf('jar') !== -1\n ? time.slice(0, -3) + 'waQ'\n : output.indexOf('DIS') !== -1\n ? time.slice(0, -3) + 'nem'\n : time + ' pIq';\n return time;\n }\n\n function translatePast(output) {\n var time = output;\n time =\n output.indexOf('jaj') !== -1\n ? time.slice(0, -3) + 'Hu’'\n : output.indexOf('jar') !== -1\n ? time.slice(0, -3) + 'wen'\n : output.indexOf('DIS') !== -1\n ? time.slice(0, -3) + 'ben'\n : time + ' ret';\n return time;\n }\n\n function translate(number, withoutSuffix, string, isFuture) {\n var numberNoun = numberAsNoun(number);\n switch (string) {\n case 'ss':\n return numberNoun + ' lup';\n case 'mm':\n return numberNoun + ' tup';\n case 'hh':\n return numberNoun + ' rep';\n case 'dd':\n return numberNoun + ' jaj';\n case 'MM':\n return numberNoun + ' jar';\n case 'yy':\n return numberNoun + ' DIS';\n }\n }\n\n function numberAsNoun(number) {\n var hundred = Math.floor((number % 1000) / 100),\n ten = Math.floor((number % 100) / 10),\n one = number % 10,\n word = '';\n if (hundred > 0) {\n word += numbersNouns[hundred] + 'vatlh';\n }\n if (ten > 0) {\n word += (word !== '' ? ' ' : '') + numbersNouns[ten] + 'maH';\n }\n if (one > 0) {\n word += (word !== '' ? ' ' : '') + numbersNouns[one];\n }\n return word === '' ? 'pagh' : word;\n }\n\n var tlh = moment.defineLocale('tlh', {\n months: 'tera’ jar wa’_tera’ jar cha’_tera’ jar wej_tera’ jar loS_tera’ jar vagh_tera’ jar jav_tera’ jar Soch_tera’ jar chorgh_tera’ jar Hut_tera’ jar wa’maH_tera’ jar wa’maH wa’_tera’ jar wa’maH cha’'.split(\n '_'\n ),\n monthsShort: 'jar wa’_jar cha’_jar wej_jar loS_jar vagh_jar jav_jar Soch_jar chorgh_jar Hut_jar wa’maH_jar wa’maH wa’_jar wa’maH cha’'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'lojmItjaj_DaSjaj_povjaj_ghItlhjaj_loghjaj_buqjaj_ghInjaj'.split(\n '_'\n ),\n weekdaysShort: 'lojmItjaj_DaSjaj_povjaj_ghItlhjaj_loghjaj_buqjaj_ghInjaj'.split(\n '_'\n ),\n weekdaysMin: 'lojmItjaj_DaSjaj_povjaj_ghItlhjaj_loghjaj_buqjaj_ghInjaj'.split(\n '_'\n ),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[DaHjaj] LT',\n nextDay: '[wa’leS] LT',\n nextWeek: 'LLL',\n lastDay: '[wa’Hu’] LT',\n lastWeek: 'LLL',\n sameElse: 'L',\n },\n relativeTime: {\n future: translateFuture,\n past: translatePast,\n s: 'puS lup',\n ss: translate,\n m: 'wa’ tup',\n mm: translate,\n h: 'wa’ rep',\n hh: translate,\n d: 'wa’ jaj',\n dd: translate,\n M: 'wa’ jar',\n MM: translate,\n y: 'wa’ DIS',\n yy: translate,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return tlh;\n\n})));\n","//! moment.js locale configuration\n//! locale : Turkish [tr]\n//! authors : Erhan Gundogan : https://github.com/erhangundogan,\n//! Burak Yiğit Kaya: https://github.com/BYK\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var suffixes = {\n 1: \"'inci\",\n 5: \"'inci\",\n 8: \"'inci\",\n 70: \"'inci\",\n 80: \"'inci\",\n 2: \"'nci\",\n 7: \"'nci\",\n 20: \"'nci\",\n 50: \"'nci\",\n 3: \"'üncü\",\n 4: \"'üncü\",\n 100: \"'üncü\",\n 6: \"'ncı\",\n 9: \"'uncu\",\n 10: \"'uncu\",\n 30: \"'uncu\",\n 60: \"'ıncı\",\n 90: \"'ıncı\",\n };\n\n var tr = moment.defineLocale('tr', {\n months: 'Ocak_Şubat_Mart_Nisan_Mayıs_Haziran_Temmuz_Ağustos_Eylül_Ekim_Kasım_Aralık'.split(\n '_'\n ),\n monthsShort: 'Oca_Şub_Mar_Nis_May_Haz_Tem_Ağu_Eyl_Eki_Kas_Ara'.split('_'),\n weekdays: 'Pazar_Pazartesi_Salı_Çarşamba_Perşembe_Cuma_Cumartesi'.split(\n '_'\n ),\n weekdaysShort: 'Paz_Pts_Sal_Çar_Per_Cum_Cts'.split('_'),\n weekdaysMin: 'Pz_Pt_Sa_Ça_Pe_Cu_Ct'.split('_'),\n meridiem: function (hours, minutes, isLower) {\n if (hours < 12) {\n return isLower ? 'öö' : 'ÖÖ';\n } else {\n return isLower ? 'ös' : 'ÖS';\n }\n },\n meridiemParse: /öö|ÖÖ|ös|ÖS/,\n isPM: function (input) {\n return input === 'ös' || input === 'ÖS';\n },\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[bugün saat] LT',\n nextDay: '[yarın saat] LT',\n nextWeek: '[gelecek] dddd [saat] LT',\n lastDay: '[dün] LT',\n lastWeek: '[geçen] dddd [saat] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s sonra',\n past: '%s önce',\n s: 'birkaç saniye',\n ss: '%d saniye',\n m: 'bir dakika',\n mm: '%d dakika',\n h: 'bir saat',\n hh: '%d saat',\n d: 'bir gün',\n dd: '%d gün',\n w: 'bir hafta',\n ww: '%d hafta',\n M: 'bir ay',\n MM: '%d ay',\n y: 'bir yıl',\n yy: '%d yıl',\n },\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'Do':\n case 'DD':\n return number;\n default:\n if (number === 0) {\n // special case for zero\n return number + \"'ıncı\";\n }\n var a = number % 10,\n b = (number % 100) - a,\n c = number >= 100 ? 100 : null;\n return number + (suffixes[a] || suffixes[b] || suffixes[c]);\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return tr;\n\n})));\n","//! moment.js locale configuration\n//! locale : Talossan [tzl]\n//! author : Robin van der Vliet : https://github.com/robin0van0der0v\n//! author : Iustì Canun\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n // After the year there should be a slash and the amount of years since December 26, 1979 in Roman numerals.\n // This is currently too difficult (maybe even impossible) to add.\n var tzl = moment.defineLocale('tzl', {\n months: 'Januar_Fevraglh_Març_Avrïu_Mai_Gün_Julia_Guscht_Setemvar_Listopäts_Noemvar_Zecemvar'.split(\n '_'\n ),\n monthsShort: 'Jan_Fev_Mar_Avr_Mai_Gün_Jul_Gus_Set_Lis_Noe_Zec'.split('_'),\n weekdays: 'Súladi_Lúneçi_Maitzi_Márcuri_Xhúadi_Viénerçi_Sáturi'.split('_'),\n weekdaysShort: 'Súl_Lún_Mai_Már_Xhú_Vié_Sát'.split('_'),\n weekdaysMin: 'Sú_Lú_Ma_Má_Xh_Vi_Sá'.split('_'),\n longDateFormat: {\n LT: 'HH.mm',\n LTS: 'HH.mm.ss',\n L: 'DD.MM.YYYY',\n LL: 'D. MMMM [dallas] YYYY',\n LLL: 'D. MMMM [dallas] YYYY HH.mm',\n LLLL: 'dddd, [li] D. MMMM [dallas] YYYY HH.mm',\n },\n meridiemParse: /d\\'o|d\\'a/i,\n isPM: function (input) {\n return \"d'o\" === input.toLowerCase();\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? \"d'o\" : \"D'O\";\n } else {\n return isLower ? \"d'a\" : \"D'A\";\n }\n },\n calendar: {\n sameDay: '[oxhi à] LT',\n nextDay: '[demà à] LT',\n nextWeek: 'dddd [à] LT',\n lastDay: '[ieiri à] LT',\n lastWeek: '[sür el] dddd [lasteu à] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'osprei %s',\n past: 'ja%s',\n s: processRelativeTime,\n ss: processRelativeTime,\n m: processRelativeTime,\n mm: processRelativeTime,\n h: processRelativeTime,\n hh: processRelativeTime,\n d: processRelativeTime,\n dd: processRelativeTime,\n M: processRelativeTime,\n MM: processRelativeTime,\n y: processRelativeTime,\n yy: processRelativeTime,\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal: '%d.',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n s: ['viensas secunds', \"'iensas secunds\"],\n ss: [number + ' secunds', '' + number + ' secunds'],\n m: [\"'n míut\", \"'iens míut\"],\n mm: [number + ' míuts', '' + number + ' míuts'],\n h: [\"'n þora\", \"'iensa þora\"],\n hh: [number + ' þoras', '' + number + ' þoras'],\n d: [\"'n ziua\", \"'iensa ziua\"],\n dd: [number + ' ziuas', '' + number + ' ziuas'],\n M: [\"'n mes\", \"'iens mes\"],\n MM: [number + ' mesen', '' + number + ' mesen'],\n y: [\"'n ar\", \"'iens ar\"],\n yy: [number + ' ars', '' + number + ' ars'],\n };\n return isFuture\n ? format[key][0]\n : withoutSuffix\n ? format[key][0]\n : format[key][1];\n }\n\n return tzl;\n\n})));\n","//! moment.js locale configuration\n//! locale : Central Atlas Tamazight Latin [tzm-latn]\n//! author : Abdel Said : https://github.com/abdelsaid\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var tzmLatn = moment.defineLocale('tzm-latn', {\n months: 'innayr_brˤayrˤ_marˤsˤ_ibrir_mayyw_ywnyw_ywlywz_ɣwšt_šwtanbir_ktˤwbrˤ_nwwanbir_dwjnbir'.split(\n '_'\n ),\n monthsShort: 'innayr_brˤayrˤ_marˤsˤ_ibrir_mayyw_ywnyw_ywlywz_ɣwšt_šwtanbir_ktˤwbrˤ_nwwanbir_dwjnbir'.split(\n '_'\n ),\n weekdays: 'asamas_aynas_asinas_akras_akwas_asimwas_asiḍyas'.split('_'),\n weekdaysShort: 'asamas_aynas_asinas_akras_akwas_asimwas_asiḍyas'.split('_'),\n weekdaysMin: 'asamas_aynas_asinas_akras_akwas_asimwas_asiḍyas'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[asdkh g] LT',\n nextDay: '[aska g] LT',\n nextWeek: 'dddd [g] LT',\n lastDay: '[assant g] LT',\n lastWeek: 'dddd [g] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'dadkh s yan %s',\n past: 'yan %s',\n s: 'imik',\n ss: '%d imik',\n m: 'minuḍ',\n mm: '%d minuḍ',\n h: 'saɛa',\n hh: '%d tassaɛin',\n d: 'ass',\n dd: '%d ossan',\n M: 'ayowr',\n MM: '%d iyyirn',\n y: 'asgas',\n yy: '%d isgasn',\n },\n week: {\n dow: 6, // Saturday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return tzmLatn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Central Atlas Tamazight [tzm]\n//! author : Abdel Said : https://github.com/abdelsaid\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var tzm = moment.defineLocale('tzm', {\n months: 'ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ'.split(\n '_'\n ),\n monthsShort: 'ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ'.split(\n '_'\n ),\n weekdays: 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n weekdaysShort: 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n weekdaysMin: 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[ⴰⵙⴷⵅ ⴴ] LT',\n nextDay: '[ⴰⵙⴽⴰ ⴴ] LT',\n nextWeek: 'dddd [ⴴ] LT',\n lastDay: '[ⴰⵚⴰⵏⵜ ⴴ] LT',\n lastWeek: 'dddd [ⴴ] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'ⴷⴰⴷⵅ ⵙ ⵢⴰⵏ %s',\n past: 'ⵢⴰⵏ %s',\n s: 'ⵉⵎⵉⴽ',\n ss: '%d ⵉⵎⵉⴽ',\n m: 'ⵎⵉⵏⵓⴺ',\n mm: '%d ⵎⵉⵏⵓⴺ',\n h: 'ⵙⴰⵄⴰ',\n hh: '%d ⵜⴰⵙⵙⴰⵄⵉⵏ',\n d: 'ⴰⵙⵙ',\n dd: '%d oⵙⵙⴰⵏ',\n M: 'ⴰⵢoⵓⵔ',\n MM: '%d ⵉⵢⵢⵉⵔⵏ',\n y: 'ⴰⵙⴳⴰⵙ',\n yy: '%d ⵉⵙⴳⴰⵙⵏ',\n },\n week: {\n dow: 6, // Saturday is the first day of the week.\n doy: 12, // The week that contains Jan 12th is the first week of the year.\n },\n });\n\n return tzm;\n\n})));\n","//! moment.js locale configuration\n//! locale : Uyghur (China) [ug-cn]\n//! author: boyaq : https://github.com/boyaq\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var ugCn = moment.defineLocale('ug-cn', {\n months: 'يانۋار_فېۋرال_مارت_ئاپرېل_ماي_ئىيۇن_ئىيۇل_ئاۋغۇست_سېنتەبىر_ئۆكتەبىر_نويابىر_دېكابىر'.split(\n '_'\n ),\n monthsShort: 'يانۋار_فېۋرال_مارت_ئاپرېل_ماي_ئىيۇن_ئىيۇل_ئاۋغۇست_سېنتەبىر_ئۆكتەبىر_نويابىر_دېكابىر'.split(\n '_'\n ),\n weekdays: 'يەكشەنبە_دۈشەنبە_سەيشەنبە_چارشەنبە_پەيشەنبە_جۈمە_شەنبە'.split(\n '_'\n ),\n weekdaysShort: 'يە_دۈ_سە_چا_پە_جۈ_شە'.split('_'),\n weekdaysMin: 'يە_دۈ_سە_چا_پە_جۈ_شە'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY-MM-DD',\n LL: 'YYYY-يىلىM-ئاينىڭD-كۈنى',\n LLL: 'YYYY-يىلىM-ئاينىڭD-كۈنى، HH:mm',\n LLLL: 'dddd، YYYY-يىلىM-ئاينىڭD-كۈنى، HH:mm',\n },\n meridiemParse: /يېرىم كېچە|سەھەر|چۈشتىن بۇرۇن|چۈش|چۈشتىن كېيىن|كەچ/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (\n meridiem === 'يېرىم كېچە' ||\n meridiem === 'سەھەر' ||\n meridiem === 'چۈشتىن بۇرۇن'\n ) {\n return hour;\n } else if (meridiem === 'چۈشتىن كېيىن' || meridiem === 'كەچ') {\n return hour + 12;\n } else {\n return hour >= 11 ? hour : hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n var hm = hour * 100 + minute;\n if (hm < 600) {\n return 'يېرىم كېچە';\n } else if (hm < 900) {\n return 'سەھەر';\n } else if (hm < 1130) {\n return 'چۈشتىن بۇرۇن';\n } else if (hm < 1230) {\n return 'چۈش';\n } else if (hm < 1800) {\n return 'چۈشتىن كېيىن';\n } else {\n return 'كەچ';\n }\n },\n calendar: {\n sameDay: '[بۈگۈن سائەت] LT',\n nextDay: '[ئەتە سائەت] LT',\n nextWeek: '[كېلەركى] dddd [سائەت] LT',\n lastDay: '[تۆنۈگۈن] LT',\n lastWeek: '[ئالدىنقى] dddd [سائەت] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s كېيىن',\n past: '%s بۇرۇن',\n s: 'نەچچە سېكونت',\n ss: '%d سېكونت',\n m: 'بىر مىنۇت',\n mm: '%d مىنۇت',\n h: 'بىر سائەت',\n hh: '%d سائەت',\n d: 'بىر كۈن',\n dd: '%d كۈن',\n M: 'بىر ئاي',\n MM: '%d ئاي',\n y: 'بىر يىل',\n yy: '%d يىل',\n },\n\n dayOfMonthOrdinalParse: /\\d{1,2}(-كۈنى|-ئاي|-ھەپتە)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + '-كۈنى';\n case 'w':\n case 'W':\n return number + '-ھەپتە';\n default:\n return number;\n }\n },\n preparse: function (string) {\n return string.replace(/،/g, ',');\n },\n postformat: function (string) {\n return string.replace(/,/g, '،');\n },\n week: {\n // GB/T 7408-1994《数据元和交换格式·信息交换·日期和时间表示法》与ISO 8601:1988等效\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 1st is the first week of the year.\n },\n });\n\n return ugCn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Ukrainian [uk]\n//! author : zemlanin : https://github.com/zemlanin\n//! Author : Menelion Elensúle : https://github.com/Oire\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n function plural(word, num) {\n var forms = word.split('_');\n return num % 10 === 1 && num % 100 !== 11\n ? forms[0]\n : num % 10 >= 2 && num % 10 <= 4 && (num % 100 < 10 || num % 100 >= 20)\n ? forms[1]\n : forms[2];\n }\n function relativeTimeWithPlural(number, withoutSuffix, key) {\n var format = {\n ss: withoutSuffix ? 'секунда_секунди_секунд' : 'секунду_секунди_секунд',\n mm: withoutSuffix ? 'хвилина_хвилини_хвилин' : 'хвилину_хвилини_хвилин',\n hh: withoutSuffix ? 'година_години_годин' : 'годину_години_годин',\n dd: 'день_дні_днів',\n MM: 'місяць_місяці_місяців',\n yy: 'рік_роки_років',\n };\n if (key === 'm') {\n return withoutSuffix ? 'хвилина' : 'хвилину';\n } else if (key === 'h') {\n return withoutSuffix ? 'година' : 'годину';\n } else {\n return number + ' ' + plural(format[key], +number);\n }\n }\n function weekdaysCaseReplace(m, format) {\n var weekdays = {\n nominative: 'неділя_понеділок_вівторок_середа_четвер_п’ятниця_субота'.split(\n '_'\n ),\n accusative: 'неділю_понеділок_вівторок_середу_четвер_п’ятницю_суботу'.split(\n '_'\n ),\n genitive: 'неділі_понеділка_вівторка_середи_четверга_п’ятниці_суботи'.split(\n '_'\n ),\n },\n nounCase;\n\n if (m === true) {\n return weekdays['nominative']\n .slice(1, 7)\n .concat(weekdays['nominative'].slice(0, 1));\n }\n if (!m) {\n return weekdays['nominative'];\n }\n\n nounCase = /(\\[[ВвУу]\\]) ?dddd/.test(format)\n ? 'accusative'\n : /\\[?(?:минулої|наступної)? ?\\] ?dddd/.test(format)\n ? 'genitive'\n : 'nominative';\n return weekdays[nounCase][m.day()];\n }\n function processHoursFunction(str) {\n return function () {\n return str + 'о' + (this.hours() === 11 ? 'б' : '') + '] LT';\n };\n }\n\n var uk = moment.defineLocale('uk', {\n months: {\n format: 'січня_лютого_березня_квітня_травня_червня_липня_серпня_вересня_жовтня_листопада_грудня'.split(\n '_'\n ),\n standalone: 'січень_лютий_березень_квітень_травень_червень_липень_серпень_вересень_жовтень_листопад_грудень'.split(\n '_'\n ),\n },\n monthsShort: 'січ_лют_бер_квіт_трав_черв_лип_серп_вер_жовт_лист_груд'.split(\n '_'\n ),\n weekdays: weekdaysCaseReplace,\n weekdaysShort: 'нд_пн_вт_ср_чт_пт_сб'.split('_'),\n weekdaysMin: 'нд_пн_вт_ср_чт_пт_сб'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD.MM.YYYY',\n LL: 'D MMMM YYYY р.',\n LLL: 'D MMMM YYYY р., HH:mm',\n LLLL: 'dddd, D MMMM YYYY р., HH:mm',\n },\n calendar: {\n sameDay: processHoursFunction('[Сьогодні '),\n nextDay: processHoursFunction('[Завтра '),\n lastDay: processHoursFunction('[Вчора '),\n nextWeek: processHoursFunction('[У] dddd ['),\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n case 3:\n case 5:\n case 6:\n return processHoursFunction('[Минулої] dddd [').call(this);\n case 1:\n case 2:\n case 4:\n return processHoursFunction('[Минулого] dddd [').call(this);\n }\n },\n sameElse: 'L',\n },\n relativeTime: {\n future: 'за %s',\n past: '%s тому',\n s: 'декілька секунд',\n ss: relativeTimeWithPlural,\n m: relativeTimeWithPlural,\n mm: relativeTimeWithPlural,\n h: 'годину',\n hh: relativeTimeWithPlural,\n d: 'день',\n dd: relativeTimeWithPlural,\n M: 'місяць',\n MM: relativeTimeWithPlural,\n y: 'рік',\n yy: relativeTimeWithPlural,\n },\n // M. E.: those two are virtually unused but a user might want to implement them for his/her website for some reason\n meridiemParse: /ночі|ранку|дня|вечора/,\n isPM: function (input) {\n return /^(дня|вечора)$/.test(input);\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 4) {\n return 'ночі';\n } else if (hour < 12) {\n return 'ранку';\n } else if (hour < 17) {\n return 'дня';\n } else {\n return 'вечора';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}-(й|го)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'M':\n case 'd':\n case 'DDD':\n case 'w':\n case 'W':\n return number + '-й';\n case 'D':\n return number + '-го';\n default:\n return number;\n }\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return uk;\n\n})));\n","//! moment.js locale configuration\n//! locale : Urdu [ur]\n//! author : Sawood Alam : https://github.com/ibnesayeed\n//! author : Zack : https://github.com/ZackVision\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var months = [\n 'جنوری',\n 'فروری',\n 'مارچ',\n 'اپریل',\n 'مئی',\n 'جون',\n 'جولائی',\n 'اگست',\n 'ستمبر',\n 'اکتوبر',\n 'نومبر',\n 'دسمبر',\n ],\n days = ['اتوار', 'پیر', 'منگل', 'بدھ', 'جمعرات', 'جمعہ', 'ہفتہ'];\n\n var ur = moment.defineLocale('ur', {\n months: months,\n monthsShort: months,\n weekdays: days,\n weekdaysShort: days,\n weekdaysMin: days,\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd، D MMMM YYYY HH:mm',\n },\n meridiemParse: /صبح|شام/,\n isPM: function (input) {\n return 'شام' === input;\n },\n meridiem: function (hour, minute, isLower) {\n if (hour < 12) {\n return 'صبح';\n }\n return 'شام';\n },\n calendar: {\n sameDay: '[آج بوقت] LT',\n nextDay: '[کل بوقت] LT',\n nextWeek: 'dddd [بوقت] LT',\n lastDay: '[گذشتہ روز بوقت] LT',\n lastWeek: '[گذشتہ] dddd [بوقت] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s بعد',\n past: '%s قبل',\n s: 'چند سیکنڈ',\n ss: '%d سیکنڈ',\n m: 'ایک منٹ',\n mm: '%d منٹ',\n h: 'ایک گھنٹہ',\n hh: '%d گھنٹے',\n d: 'ایک دن',\n dd: '%d دن',\n M: 'ایک ماہ',\n MM: '%d ماہ',\n y: 'ایک سال',\n yy: '%d سال',\n },\n preparse: function (string) {\n return string.replace(/،/g, ',');\n },\n postformat: function (string) {\n return string.replace(/,/g, '،');\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return ur;\n\n})));\n","//! moment.js locale configuration\n//! locale : Uzbek Latin [uz-latn]\n//! author : Rasulbek Mirzayev : github.com/Rasulbeeek\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var uzLatn = moment.defineLocale('uz-latn', {\n months: 'Yanvar_Fevral_Mart_Aprel_May_Iyun_Iyul_Avgust_Sentabr_Oktabr_Noyabr_Dekabr'.split(\n '_'\n ),\n monthsShort: 'Yan_Fev_Mar_Apr_May_Iyun_Iyul_Avg_Sen_Okt_Noy_Dek'.split('_'),\n weekdays: 'Yakshanba_Dushanba_Seshanba_Chorshanba_Payshanba_Juma_Shanba'.split(\n '_'\n ),\n weekdaysShort: 'Yak_Dush_Sesh_Chor_Pay_Jum_Shan'.split('_'),\n weekdaysMin: 'Ya_Du_Se_Cho_Pa_Ju_Sha'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'D MMMM YYYY, dddd HH:mm',\n },\n calendar: {\n sameDay: '[Bugun soat] LT [da]',\n nextDay: '[Ertaga] LT [da]',\n nextWeek: 'dddd [kuni soat] LT [da]',\n lastDay: '[Kecha soat] LT [da]',\n lastWeek: \"[O'tgan] dddd [kuni soat] LT [da]\",\n sameElse: 'L',\n },\n relativeTime: {\n future: 'Yaqin %s ichida',\n past: 'Bir necha %s oldin',\n s: 'soniya',\n ss: '%d soniya',\n m: 'bir daqiqa',\n mm: '%d daqiqa',\n h: 'bir soat',\n hh: '%d soat',\n d: 'bir kun',\n dd: '%d kun',\n M: 'bir oy',\n MM: '%d oy',\n y: 'bir yil',\n yy: '%d yil',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 7th is the first week of the year.\n },\n });\n\n return uzLatn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Uzbek [uz]\n//! author : Sardor Muminov : https://github.com/muminoff\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var uz = moment.defineLocale('uz', {\n months: 'январ_феврал_март_апрел_май_июн_июл_август_сентябр_октябр_ноябр_декабр'.split(\n '_'\n ),\n monthsShort: 'янв_фев_мар_апр_май_июн_июл_авг_сен_окт_ноя_дек'.split('_'),\n weekdays: 'Якшанба_Душанба_Сешанба_Чоршанба_Пайшанба_Жума_Шанба'.split('_'),\n weekdaysShort: 'Якш_Душ_Сеш_Чор_Пай_Жум_Шан'.split('_'),\n weekdaysMin: 'Як_Ду_Се_Чо_Па_Жу_Ша'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'D MMMM YYYY, dddd HH:mm',\n },\n calendar: {\n sameDay: '[Бугун соат] LT [да]',\n nextDay: '[Эртага] LT [да]',\n nextWeek: 'dddd [куни соат] LT [да]',\n lastDay: '[Кеча соат] LT [да]',\n lastWeek: '[Утган] dddd [куни соат] LT [да]',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'Якин %s ичида',\n past: 'Бир неча %s олдин',\n s: 'фурсат',\n ss: '%d фурсат',\n m: 'бир дакика',\n mm: '%d дакика',\n h: 'бир соат',\n hh: '%d соат',\n d: 'бир кун',\n dd: '%d кун',\n M: 'бир ой',\n MM: '%d ой',\n y: 'бир йил',\n yy: '%d йил',\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 7, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return uz;\n\n})));\n","//! moment.js locale configuration\n//! locale : Vietnamese [vi]\n//! author : Bang Nguyen : https://github.com/bangnk\n//! author : Chien Kira : https://github.com/chienkira\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var vi = moment.defineLocale('vi', {\n months: 'tháng 1_tháng 2_tháng 3_tháng 4_tháng 5_tháng 6_tháng 7_tháng 8_tháng 9_tháng 10_tháng 11_tháng 12'.split(\n '_'\n ),\n monthsShort: 'Thg 01_Thg 02_Thg 03_Thg 04_Thg 05_Thg 06_Thg 07_Thg 08_Thg 09_Thg 10_Thg 11_Thg 12'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'chủ nhật_thứ hai_thứ ba_thứ tư_thứ năm_thứ sáu_thứ bảy'.split(\n '_'\n ),\n weekdaysShort: 'CN_T2_T3_T4_T5_T6_T7'.split('_'),\n weekdaysMin: 'CN_T2_T3_T4_T5_T6_T7'.split('_'),\n weekdaysParseExact: true,\n meridiemParse: /sa|ch/i,\n isPM: function (input) {\n return /^ch$/i.test(input);\n },\n meridiem: function (hours, minutes, isLower) {\n if (hours < 12) {\n return isLower ? 'sa' : 'SA';\n } else {\n return isLower ? 'ch' : 'CH';\n }\n },\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM [năm] YYYY',\n LLL: 'D MMMM [năm] YYYY HH:mm',\n LLLL: 'dddd, D MMMM [năm] YYYY HH:mm',\n l: 'DD/M/YYYY',\n ll: 'D MMM YYYY',\n lll: 'D MMM YYYY HH:mm',\n llll: 'ddd, D MMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[Hôm nay lúc] LT',\n nextDay: '[Ngày mai lúc] LT',\n nextWeek: 'dddd [tuần tới lúc] LT',\n lastDay: '[Hôm qua lúc] LT',\n lastWeek: 'dddd [tuần trước lúc] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: '%s tới',\n past: '%s trước',\n s: 'vài giây',\n ss: '%d giây',\n m: 'một phút',\n mm: '%d phút',\n h: 'một giờ',\n hh: '%d giờ',\n d: 'một ngày',\n dd: '%d ngày',\n w: 'một tuần',\n ww: '%d tuần',\n M: 'một tháng',\n MM: '%d tháng',\n y: 'một năm',\n yy: '%d năm',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}/,\n ordinal: function (number) {\n return number;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return vi;\n\n})));\n","//! moment.js locale configuration\n//! locale : Pseudo [x-pseudo]\n//! author : Andrew Hood : https://github.com/andrewhood125\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var xPseudo = moment.defineLocale('x-pseudo', {\n months: 'J~áñúá~rý_F~ébrú~árý_~Márc~h_Áp~ríl_~Máý_~Júñé~_Júl~ý_Áú~gúst~_Sép~témb~ér_Ó~ctób~ér_Ñ~óvém~bér_~Décé~mbér'.split(\n '_'\n ),\n monthsShort: 'J~áñ_~Féb_~Már_~Ápr_~Máý_~Júñ_~Júl_~Áúg_~Sép_~Óct_~Ñóv_~Déc'.split(\n '_'\n ),\n monthsParseExact: true,\n weekdays: 'S~úñdá~ý_Mó~ñdáý~_Túé~sdáý~_Wéd~ñésd~áý_T~húrs~dáý_~Fríd~áý_S~átúr~dáý'.split(\n '_'\n ),\n weekdaysShort: 'S~úñ_~Móñ_~Túé_~Wéd_~Thú_~Frí_~Sát'.split('_'),\n weekdaysMin: 'S~ú_Mó~_Tú_~Wé_T~h_Fr~_Sá'.split('_'),\n weekdaysParseExact: true,\n longDateFormat: {\n LT: 'HH:mm',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd, D MMMM YYYY HH:mm',\n },\n calendar: {\n sameDay: '[T~ódá~ý át] LT',\n nextDay: '[T~ómó~rró~w át] LT',\n nextWeek: 'dddd [át] LT',\n lastDay: '[Ý~ést~érdá~ý át] LT',\n lastWeek: '[L~ást] dddd [át] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'í~ñ %s',\n past: '%s á~gó',\n s: 'á ~féw ~sécó~ñds',\n ss: '%d s~écóñ~ds',\n m: 'á ~míñ~úté',\n mm: '%d m~íñú~tés',\n h: 'á~ñ hó~úr',\n hh: '%d h~óúrs',\n d: 'á ~dáý',\n dd: '%d d~áýs',\n M: 'á ~móñ~th',\n MM: '%d m~óñt~hs',\n y: 'á ~ýéár',\n yy: '%d ý~éárs',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(th|st|nd|rd)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n ~~((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return xPseudo;\n\n})));\n","//! moment.js locale configuration\n//! locale : Yoruba Nigeria [yo]\n//! author : Atolagbe Abisoye : https://github.com/andela-batolagbe\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var yo = moment.defineLocale('yo', {\n months: 'Sẹ́rẹ́_Èrèlè_Ẹrẹ̀nà_Ìgbé_Èbibi_Òkùdu_Agẹmo_Ògún_Owewe_Ọ̀wàrà_Bélú_Ọ̀pẹ̀̀'.split(\n '_'\n ),\n monthsShort: 'Sẹ́r_Èrl_Ẹrn_Ìgb_Èbi_Òkù_Agẹ_Ògú_Owe_Ọ̀wà_Bél_Ọ̀pẹ̀̀'.split('_'),\n weekdays: 'Àìkú_Ajé_Ìsẹ́gun_Ọjọ́rú_Ọjọ́bọ_Ẹtì_Àbámẹ́ta'.split('_'),\n weekdaysShort: 'Àìk_Ajé_Ìsẹ́_Ọjr_Ọjb_Ẹtì_Àbá'.split('_'),\n weekdaysMin: 'Àì_Aj_Ìs_Ọr_Ọb_Ẹt_Àb'.split('_'),\n longDateFormat: {\n LT: 'h:mm A',\n LTS: 'h:mm:ss A',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY h:mm A',\n LLLL: 'dddd, D MMMM YYYY h:mm A',\n },\n calendar: {\n sameDay: '[Ònì ni] LT',\n nextDay: '[Ọ̀la ni] LT',\n nextWeek: \"dddd [Ọsẹ̀ tón'bọ] [ni] LT\",\n lastDay: '[Àna ni] LT',\n lastWeek: 'dddd [Ọsẹ̀ tólọ́] [ni] LT',\n sameElse: 'L',\n },\n relativeTime: {\n future: 'ní %s',\n past: '%s kọjá',\n s: 'ìsẹjú aayá die',\n ss: 'aayá %d',\n m: 'ìsẹjú kan',\n mm: 'ìsẹjú %d',\n h: 'wákati kan',\n hh: 'wákati %d',\n d: 'ọjọ́ kan',\n dd: 'ọjọ́ %d',\n M: 'osù kan',\n MM: 'osù %d',\n y: 'ọdún kan',\n yy: 'ọdún %d',\n },\n dayOfMonthOrdinalParse: /ọjọ́\\s\\d{1,2}/,\n ordinal: 'ọjọ́ %d',\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return yo;\n\n})));\n","//! moment.js locale configuration\n//! locale : Chinese (China) [zh-cn]\n//! author : suupic : https://github.com/suupic\n//! author : Zeno Zeng : https://github.com/zenozeng\n//! author : uu109 : https://github.com/uu109\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var zhCn = moment.defineLocale('zh-cn', {\n months: '一月_二月_三月_四月_五月_六月_七月_八月_九月_十月_十一月_十二月'.split(\n '_'\n ),\n monthsShort: '1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月'.split(\n '_'\n ),\n weekdays: '星期日_星期一_星期二_星期三_星期四_星期五_星期六'.split('_'),\n weekdaysShort: '周日_周一_周二_周三_周四_周五_周六'.split('_'),\n weekdaysMin: '日_一_二_三_四_五_六'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY/MM/DD',\n LL: 'YYYY年M月D日',\n LLL: 'YYYY年M月D日Ah点mm分',\n LLLL: 'YYYY年M月D日ddddAh点mm分',\n l: 'YYYY/M/D',\n ll: 'YYYY年M月D日',\n lll: 'YYYY年M月D日 HH:mm',\n llll: 'YYYY年M月D日dddd HH:mm',\n },\n meridiemParse: /凌晨|早上|上午|中午|下午|晚上/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === '凌晨' || meridiem === '早上' || meridiem === '上午') {\n return hour;\n } else if (meridiem === '下午' || meridiem === '晚上') {\n return hour + 12;\n } else {\n // '中午'\n return hour >= 11 ? hour : hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n var hm = hour * 100 + minute;\n if (hm < 600) {\n return '凌晨';\n } else if (hm < 900) {\n return '早上';\n } else if (hm < 1130) {\n return '上午';\n } else if (hm < 1230) {\n return '中午';\n } else if (hm < 1800) {\n return '下午';\n } else {\n return '晚上';\n }\n },\n calendar: {\n sameDay: '[今天]LT',\n nextDay: '[明天]LT',\n nextWeek: function (now) {\n if (now.week() !== this.week()) {\n return '[下]dddLT';\n } else {\n return '[本]dddLT';\n }\n },\n lastDay: '[昨天]LT',\n lastWeek: function (now) {\n if (this.week() !== now.week()) {\n return '[上]dddLT';\n } else {\n return '[本]dddLT';\n }\n },\n sameElse: 'L',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(日|月|周)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + '日';\n case 'M':\n return number + '月';\n case 'w':\n case 'W':\n return number + '周';\n default:\n return number;\n }\n },\n relativeTime: {\n future: '%s后',\n past: '%s前',\n s: '几秒',\n ss: '%d 秒',\n m: '1 分钟',\n mm: '%d 分钟',\n h: '1 小时',\n hh: '%d 小时',\n d: '1 天',\n dd: '%d 天',\n w: '1 周',\n ww: '%d 周',\n M: '1 个月',\n MM: '%d 个月',\n y: '1 年',\n yy: '%d 年',\n },\n week: {\n // GB/T 7408-1994《数据元和交换格式·信息交换·日期和时间表示法》与ISO 8601:1988等效\n dow: 1, // Monday is the first day of the week.\n doy: 4, // The week that contains Jan 4th is the first week of the year.\n },\n });\n\n return zhCn;\n\n})));\n","//! moment.js locale configuration\n//! locale : Chinese (Hong Kong) [zh-hk]\n//! author : Ben : https://github.com/ben-lin\n//! author : Chris Lam : https://github.com/hehachris\n//! author : Konstantin : https://github.com/skfd\n//! author : Anthony : https://github.com/anthonylau\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var zhHk = moment.defineLocale('zh-hk', {\n months: '一月_二月_三月_四月_五月_六月_七月_八月_九月_十月_十一月_十二月'.split(\n '_'\n ),\n monthsShort: '1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月'.split(\n '_'\n ),\n weekdays: '星期日_星期一_星期二_星期三_星期四_星期五_星期六'.split('_'),\n weekdaysShort: '週日_週一_週二_週三_週四_週五_週六'.split('_'),\n weekdaysMin: '日_一_二_三_四_五_六'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY/MM/DD',\n LL: 'YYYY年M月D日',\n LLL: 'YYYY年M月D日 HH:mm',\n LLLL: 'YYYY年M月D日dddd HH:mm',\n l: 'YYYY/M/D',\n ll: 'YYYY年M月D日',\n lll: 'YYYY年M月D日 HH:mm',\n llll: 'YYYY年M月D日dddd HH:mm',\n },\n meridiemParse: /凌晨|早上|上午|中午|下午|晚上/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === '凌晨' || meridiem === '早上' || meridiem === '上午') {\n return hour;\n } else if (meridiem === '中午') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === '下午' || meridiem === '晚上') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n var hm = hour * 100 + minute;\n if (hm < 600) {\n return '凌晨';\n } else if (hm < 900) {\n return '早上';\n } else if (hm < 1200) {\n return '上午';\n } else if (hm === 1200) {\n return '中午';\n } else if (hm < 1800) {\n return '下午';\n } else {\n return '晚上';\n }\n },\n calendar: {\n sameDay: '[今天]LT',\n nextDay: '[明天]LT',\n nextWeek: '[下]ddddLT',\n lastDay: '[昨天]LT',\n lastWeek: '[上]ddddLT',\n sameElse: 'L',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(日|月|週)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + '日';\n case 'M':\n return number + '月';\n case 'w':\n case 'W':\n return number + '週';\n default:\n return number;\n }\n },\n relativeTime: {\n future: '%s後',\n past: '%s前',\n s: '幾秒',\n ss: '%d 秒',\n m: '1 分鐘',\n mm: '%d 分鐘',\n h: '1 小時',\n hh: '%d 小時',\n d: '1 天',\n dd: '%d 天',\n M: '1 個月',\n MM: '%d 個月',\n y: '1 年',\n yy: '%d 年',\n },\n });\n\n return zhHk;\n\n})));\n","//! moment.js locale configuration\n//! locale : Chinese (Macau) [zh-mo]\n//! author : Ben : https://github.com/ben-lin\n//! author : Chris Lam : https://github.com/hehachris\n//! author : Tan Yuanhong : https://github.com/le0tan\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var zhMo = moment.defineLocale('zh-mo', {\n months: '一月_二月_三月_四月_五月_六月_七月_八月_九月_十月_十一月_十二月'.split(\n '_'\n ),\n monthsShort: '1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月'.split(\n '_'\n ),\n weekdays: '星期日_星期一_星期二_星期三_星期四_星期五_星期六'.split('_'),\n weekdaysShort: '週日_週一_週二_週三_週四_週五_週六'.split('_'),\n weekdaysMin: '日_一_二_三_四_五_六'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'YYYY年M月D日',\n LLL: 'YYYY年M月D日 HH:mm',\n LLLL: 'YYYY年M月D日dddd HH:mm',\n l: 'D/M/YYYY',\n ll: 'YYYY年M月D日',\n lll: 'YYYY年M月D日 HH:mm',\n llll: 'YYYY年M月D日dddd HH:mm',\n },\n meridiemParse: /凌晨|早上|上午|中午|下午|晚上/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === '凌晨' || meridiem === '早上' || meridiem === '上午') {\n return hour;\n } else if (meridiem === '中午') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === '下午' || meridiem === '晚上') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n var hm = hour * 100 + minute;\n if (hm < 600) {\n return '凌晨';\n } else if (hm < 900) {\n return '早上';\n } else if (hm < 1130) {\n return '上午';\n } else if (hm < 1230) {\n return '中午';\n } else if (hm < 1800) {\n return '下午';\n } else {\n return '晚上';\n }\n },\n calendar: {\n sameDay: '[今天] LT',\n nextDay: '[明天] LT',\n nextWeek: '[下]dddd LT',\n lastDay: '[昨天] LT',\n lastWeek: '[上]dddd LT',\n sameElse: 'L',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(日|月|週)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + '日';\n case 'M':\n return number + '月';\n case 'w':\n case 'W':\n return number + '週';\n default:\n return number;\n }\n },\n relativeTime: {\n future: '%s內',\n past: '%s前',\n s: '幾秒',\n ss: '%d 秒',\n m: '1 分鐘',\n mm: '%d 分鐘',\n h: '1 小時',\n hh: '%d 小時',\n d: '1 天',\n dd: '%d 天',\n M: '1 個月',\n MM: '%d 個月',\n y: '1 年',\n yy: '%d 年',\n },\n });\n\n return zhMo;\n\n})));\n","//! moment.js locale configuration\n//! locale : Chinese (Taiwan) [zh-tw]\n//! author : Ben : https://github.com/ben-lin\n//! author : Chris Lam : https://github.com/hehachris\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n //! moment.js locale configuration\n\n var zhTw = moment.defineLocale('zh-tw', {\n months: '一月_二月_三月_四月_五月_六月_七月_八月_九月_十月_十一月_十二月'.split(\n '_'\n ),\n monthsShort: '1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月'.split(\n '_'\n ),\n weekdays: '星期日_星期一_星期二_星期三_星期四_星期五_星期六'.split('_'),\n weekdaysShort: '週日_週一_週二_週三_週四_週五_週六'.split('_'),\n weekdaysMin: '日_一_二_三_四_五_六'.split('_'),\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'YYYY/MM/DD',\n LL: 'YYYY年M月D日',\n LLL: 'YYYY年M月D日 HH:mm',\n LLLL: 'YYYY年M月D日dddd HH:mm',\n l: 'YYYY/M/D',\n ll: 'YYYY年M月D日',\n lll: 'YYYY年M月D日 HH:mm',\n llll: 'YYYY年M月D日dddd HH:mm',\n },\n meridiemParse: /凌晨|早上|上午|中午|下午|晚上/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === '凌晨' || meridiem === '早上' || meridiem === '上午') {\n return hour;\n } else if (meridiem === '中午') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === '下午' || meridiem === '晚上') {\n return hour + 12;\n }\n },\n meridiem: function (hour, minute, isLower) {\n var hm = hour * 100 + minute;\n if (hm < 600) {\n return '凌晨';\n } else if (hm < 900) {\n return '早上';\n } else if (hm < 1130) {\n return '上午';\n } else if (hm < 1230) {\n return '中午';\n } else if (hm < 1800) {\n return '下午';\n } else {\n return '晚上';\n }\n },\n calendar: {\n sameDay: '[今天] LT',\n nextDay: '[明天] LT',\n nextWeek: '[下]dddd LT',\n lastDay: '[昨天] LT',\n lastWeek: '[上]dddd LT',\n sameElse: 'L',\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(日|月|週)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + '日';\n case 'M':\n return number + '月';\n case 'w':\n case 'W':\n return number + '週';\n default:\n return number;\n }\n },\n relativeTime: {\n future: '%s後',\n past: '%s前',\n s: '幾秒',\n ss: '%d 秒',\n m: '1 分鐘',\n mm: '%d 分鐘',\n h: '1 小時',\n hh: '%d 小時',\n d: '1 天',\n dd: '%d 天',\n M: '1 個月',\n MM: '%d 個月',\n y: '1 年',\n yy: '%d 年',\n },\n });\n\n return zhTw;\n\n})));\n","//! moment.js\n//! version : 2.29.1\n//! authors : Tim Wood, Iskren Chernev, Moment.js contributors\n//! license : MIT\n//! momentjs.com\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :\n typeof define === 'function' && define.amd ? define(factory) :\n global.moment = factory()\n}(this, (function () { 'use strict';\n\n var hookCallback;\n\n function hooks() {\n return hookCallback.apply(null, arguments);\n }\n\n // This is done to register the method called with moment()\n // without creating circular dependencies.\n function setHookCallback(callback) {\n hookCallback = callback;\n }\n\n function isArray(input) {\n return (\n input instanceof Array ||\n Object.prototype.toString.call(input) === '[object Array]'\n );\n }\n\n function isObject(input) {\n // IE8 will treat undefined and null as object if it wasn't for\n // input != null\n return (\n input != null &&\n Object.prototype.toString.call(input) === '[object Object]'\n );\n }\n\n function hasOwnProp(a, b) {\n return Object.prototype.hasOwnProperty.call(a, b);\n }\n\n function isObjectEmpty(obj) {\n if (Object.getOwnPropertyNames) {\n return Object.getOwnPropertyNames(obj).length === 0;\n } else {\n var k;\n for (k in obj) {\n if (hasOwnProp(obj, k)) {\n return false;\n }\n }\n return true;\n }\n }\n\n function isUndefined(input) {\n return input === void 0;\n }\n\n function isNumber(input) {\n return (\n typeof input === 'number' ||\n Object.prototype.toString.call(input) === '[object Number]'\n );\n }\n\n function isDate(input) {\n return (\n input instanceof Date ||\n Object.prototype.toString.call(input) === '[object Date]'\n );\n }\n\n function map(arr, fn) {\n var res = [],\n i;\n for (i = 0; i < arr.length; ++i) {\n res.push(fn(arr[i], i));\n }\n return res;\n }\n\n function extend(a, b) {\n for (var i in b) {\n if (hasOwnProp(b, i)) {\n a[i] = b[i];\n }\n }\n\n if (hasOwnProp(b, 'toString')) {\n a.toString = b.toString;\n }\n\n if (hasOwnProp(b, 'valueOf')) {\n a.valueOf = b.valueOf;\n }\n\n return a;\n }\n\n function createUTC(input, format, locale, strict) {\n return createLocalOrUTC(input, format, locale, strict, true).utc();\n }\n\n function defaultParsingFlags() {\n // We need to deep clone this object.\n return {\n empty: false,\n unusedTokens: [],\n unusedInput: [],\n overflow: -2,\n charsLeftOver: 0,\n nullInput: false,\n invalidEra: null,\n invalidMonth: null,\n invalidFormat: false,\n userInvalidated: false,\n iso: false,\n parsedDateParts: [],\n era: null,\n meridiem: null,\n rfc2822: false,\n weekdayMismatch: false,\n };\n }\n\n function getParsingFlags(m) {\n if (m._pf == null) {\n m._pf = defaultParsingFlags();\n }\n return m._pf;\n }\n\n var some;\n if (Array.prototype.some) {\n some = Array.prototype.some;\n } else {\n some = function (fun) {\n var t = Object(this),\n len = t.length >>> 0,\n i;\n\n for (i = 0; i < len; i++) {\n if (i in t && fun.call(this, t[i], i, t)) {\n return true;\n }\n }\n\n return false;\n };\n }\n\n function isValid(m) {\n if (m._isValid == null) {\n var flags = getParsingFlags(m),\n parsedParts = some.call(flags.parsedDateParts, function (i) {\n return i != null;\n }),\n isNowValid =\n !isNaN(m._d.getTime()) &&\n flags.overflow < 0 &&\n !flags.empty &&\n !flags.invalidEra &&\n !flags.invalidMonth &&\n !flags.invalidWeekday &&\n !flags.weekdayMismatch &&\n !flags.nullInput &&\n !flags.invalidFormat &&\n !flags.userInvalidated &&\n (!flags.meridiem || (flags.meridiem && parsedParts));\n\n if (m._strict) {\n isNowValid =\n isNowValid &&\n flags.charsLeftOver === 0 &&\n flags.unusedTokens.length === 0 &&\n flags.bigHour === undefined;\n }\n\n if (Object.isFrozen == null || !Object.isFrozen(m)) {\n m._isValid = isNowValid;\n } else {\n return isNowValid;\n }\n }\n return m._isValid;\n }\n\n function createInvalid(flags) {\n var m = createUTC(NaN);\n if (flags != null) {\n extend(getParsingFlags(m), flags);\n } else {\n getParsingFlags(m).userInvalidated = true;\n }\n\n return m;\n }\n\n // Plugins that add properties should also add the key here (null value),\n // so we can properly clone ourselves.\n var momentProperties = (hooks.momentProperties = []),\n updateInProgress = false;\n\n function copyConfig(to, from) {\n var i, prop, val;\n\n if (!isUndefined(from._isAMomentObject)) {\n to._isAMomentObject = from._isAMomentObject;\n }\n if (!isUndefined(from._i)) {\n to._i = from._i;\n }\n if (!isUndefined(from._f)) {\n to._f = from._f;\n }\n if (!isUndefined(from._l)) {\n to._l = from._l;\n }\n if (!isUndefined(from._strict)) {\n to._strict = from._strict;\n }\n if (!isUndefined(from._tzm)) {\n to._tzm = from._tzm;\n }\n if (!isUndefined(from._isUTC)) {\n to._isUTC = from._isUTC;\n }\n if (!isUndefined(from._offset)) {\n to._offset = from._offset;\n }\n if (!isUndefined(from._pf)) {\n to._pf = getParsingFlags(from);\n }\n if (!isUndefined(from._locale)) {\n to._locale = from._locale;\n }\n\n if (momentProperties.length > 0) {\n for (i = 0; i < momentProperties.length; i++) {\n prop = momentProperties[i];\n val = from[prop];\n if (!isUndefined(val)) {\n to[prop] = val;\n }\n }\n }\n\n return to;\n }\n\n // Moment prototype object\n function Moment(config) {\n copyConfig(this, config);\n this._d = new Date(config._d != null ? config._d.getTime() : NaN);\n if (!this.isValid()) {\n this._d = new Date(NaN);\n }\n // Prevent infinite loop in case updateOffset creates new moment\n // objects.\n if (updateInProgress === false) {\n updateInProgress = true;\n hooks.updateOffset(this);\n updateInProgress = false;\n }\n }\n\n function isMoment(obj) {\n return (\n obj instanceof Moment || (obj != null && obj._isAMomentObject != null)\n );\n }\n\n function warn(msg) {\n if (\n hooks.suppressDeprecationWarnings === false &&\n typeof console !== 'undefined' &&\n console.warn\n ) {\n console.warn('Deprecation warning: ' + msg);\n }\n }\n\n function deprecate(msg, fn) {\n var firstTime = true;\n\n return extend(function () {\n if (hooks.deprecationHandler != null) {\n hooks.deprecationHandler(null, msg);\n }\n if (firstTime) {\n var args = [],\n arg,\n i,\n key;\n for (i = 0; i < arguments.length; i++) {\n arg = '';\n if (typeof arguments[i] === 'object') {\n arg += '\\n[' + i + '] ';\n for (key in arguments[0]) {\n if (hasOwnProp(arguments[0], key)) {\n arg += key + ': ' + arguments[0][key] + ', ';\n }\n }\n arg = arg.slice(0, -2); // Remove trailing comma and space\n } else {\n arg = arguments[i];\n }\n args.push(arg);\n }\n warn(\n msg +\n '\\nArguments: ' +\n Array.prototype.slice.call(args).join('') +\n '\\n' +\n new Error().stack\n );\n firstTime = false;\n }\n return fn.apply(this, arguments);\n }, fn);\n }\n\n var deprecations = {};\n\n function deprecateSimple(name, msg) {\n if (hooks.deprecationHandler != null) {\n hooks.deprecationHandler(name, msg);\n }\n if (!deprecations[name]) {\n warn(msg);\n deprecations[name] = true;\n }\n }\n\n hooks.suppressDeprecationWarnings = false;\n hooks.deprecationHandler = null;\n\n function isFunction(input) {\n return (\n (typeof Function !== 'undefined' && input instanceof Function) ||\n Object.prototype.toString.call(input) === '[object Function]'\n );\n }\n\n function set(config) {\n var prop, i;\n for (i in config) {\n if (hasOwnProp(config, i)) {\n prop = config[i];\n if (isFunction(prop)) {\n this[i] = prop;\n } else {\n this['_' + i] = prop;\n }\n }\n }\n this._config = config;\n // Lenient ordinal parsing accepts just a number in addition to\n // number + (possibly) stuff coming from _dayOfMonthOrdinalParse.\n // TODO: Remove \"ordinalParse\" fallback in next major release.\n this._dayOfMonthOrdinalParseLenient = new RegExp(\n (this._dayOfMonthOrdinalParse.source || this._ordinalParse.source) +\n '|' +\n /\\d{1,2}/.source\n );\n }\n\n function mergeConfigs(parentConfig, childConfig) {\n var res = extend({}, parentConfig),\n prop;\n for (prop in childConfig) {\n if (hasOwnProp(childConfig, prop)) {\n if (isObject(parentConfig[prop]) && isObject(childConfig[prop])) {\n res[prop] = {};\n extend(res[prop], parentConfig[prop]);\n extend(res[prop], childConfig[prop]);\n } else if (childConfig[prop] != null) {\n res[prop] = childConfig[prop];\n } else {\n delete res[prop];\n }\n }\n }\n for (prop in parentConfig) {\n if (\n hasOwnProp(parentConfig, prop) &&\n !hasOwnProp(childConfig, prop) &&\n isObject(parentConfig[prop])\n ) {\n // make sure changes to properties don't modify parent config\n res[prop] = extend({}, res[prop]);\n }\n }\n return res;\n }\n\n function Locale(config) {\n if (config != null) {\n this.set(config);\n }\n }\n\n var keys;\n\n if (Object.keys) {\n keys = Object.keys;\n } else {\n keys = function (obj) {\n var i,\n res = [];\n for (i in obj) {\n if (hasOwnProp(obj, i)) {\n res.push(i);\n }\n }\n return res;\n };\n }\n\n var defaultCalendar = {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n };\n\n function calendar(key, mom, now) {\n var output = this._calendar[key] || this._calendar['sameElse'];\n return isFunction(output) ? output.call(mom, now) : output;\n }\n\n function zeroFill(number, targetLength, forceSign) {\n var absNumber = '' + Math.abs(number),\n zerosToFill = targetLength - absNumber.length,\n sign = number >= 0;\n return (\n (sign ? (forceSign ? '+' : '') : '-') +\n Math.pow(10, Math.max(0, zerosToFill)).toString().substr(1) +\n absNumber\n );\n }\n\n var formattingTokens = /(\\[[^\\[]*\\])|(\\\\)?([Hh]mm(ss)?|Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|W[o|W]?|Qo?|N{1,5}|YYYYYY|YYYYY|YYYY|YY|y{2,4}|yo?|gg(ggg?)?|GG(GGG?)?|e|E|a|A|hh?|HH?|kk?|mm?|ss?|S{1,9}|x|X|zz?|ZZ?|.)/g,\n localFormattingTokens = /(\\[[^\\[]*\\])|(\\\\)?(LTS|LT|LL?L?L?|l{1,4})/g,\n formatFunctions = {},\n formatTokenFunctions = {};\n\n // token: 'M'\n // padded: ['MM', 2]\n // ordinal: 'Mo'\n // callback: function () { this.month() + 1 }\n function addFormatToken(token, padded, ordinal, callback) {\n var func = callback;\n if (typeof callback === 'string') {\n func = function () {\n return this[callback]();\n };\n }\n if (token) {\n formatTokenFunctions[token] = func;\n }\n if (padded) {\n formatTokenFunctions[padded[0]] = function () {\n return zeroFill(func.apply(this, arguments), padded[1], padded[2]);\n };\n }\n if (ordinal) {\n formatTokenFunctions[ordinal] = function () {\n return this.localeData().ordinal(\n func.apply(this, arguments),\n token\n );\n };\n }\n }\n\n function removeFormattingTokens(input) {\n if (input.match(/\\[[\\s\\S]/)) {\n return input.replace(/^\\[|\\]$/g, '');\n }\n return input.replace(/\\\\/g, '');\n }\n\n function makeFormatFunction(format) {\n var array = format.match(formattingTokens),\n i,\n length;\n\n for (i = 0, length = array.length; i < length; i++) {\n if (formatTokenFunctions[array[i]]) {\n array[i] = formatTokenFunctions[array[i]];\n } else {\n array[i] = removeFormattingTokens(array[i]);\n }\n }\n\n return function (mom) {\n var output = '',\n i;\n for (i = 0; i < length; i++) {\n output += isFunction(array[i])\n ? array[i].call(mom, format)\n : array[i];\n }\n return output;\n };\n }\n\n // format date using native date object\n function formatMoment(m, format) {\n if (!m.isValid()) {\n return m.localeData().invalidDate();\n }\n\n format = expandFormat(format, m.localeData());\n formatFunctions[format] =\n formatFunctions[format] || makeFormatFunction(format);\n\n return formatFunctions[format](m);\n }\n\n function expandFormat(format, locale) {\n var i = 5;\n\n function replaceLongDateFormatTokens(input) {\n return locale.longDateFormat(input) || input;\n }\n\n localFormattingTokens.lastIndex = 0;\n while (i >= 0 && localFormattingTokens.test(format)) {\n format = format.replace(\n localFormattingTokens,\n replaceLongDateFormatTokens\n );\n localFormattingTokens.lastIndex = 0;\n i -= 1;\n }\n\n return format;\n }\n\n var defaultLongDateFormat = {\n LTS: 'h:mm:ss A',\n LT: 'h:mm A',\n L: 'MM/DD/YYYY',\n LL: 'MMMM D, YYYY',\n LLL: 'MMMM D, YYYY h:mm A',\n LLLL: 'dddd, MMMM D, YYYY h:mm A',\n };\n\n function longDateFormat(key) {\n var format = this._longDateFormat[key],\n formatUpper = this._longDateFormat[key.toUpperCase()];\n\n if (format || !formatUpper) {\n return format;\n }\n\n this._longDateFormat[key] = formatUpper\n .match(formattingTokens)\n .map(function (tok) {\n if (\n tok === 'MMMM' ||\n tok === 'MM' ||\n tok === 'DD' ||\n tok === 'dddd'\n ) {\n return tok.slice(1);\n }\n return tok;\n })\n .join('');\n\n return this._longDateFormat[key];\n }\n\n var defaultInvalidDate = 'Invalid date';\n\n function invalidDate() {\n return this._invalidDate;\n }\n\n var defaultOrdinal = '%d',\n defaultDayOfMonthOrdinalParse = /\\d{1,2}/;\n\n function ordinal(number) {\n return this._ordinal.replace('%d', number);\n }\n\n var defaultRelativeTime = {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n w: 'a week',\n ww: '%d weeks',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n };\n\n function relativeTime(number, withoutSuffix, string, isFuture) {\n var output = this._relativeTime[string];\n return isFunction(output)\n ? output(number, withoutSuffix, string, isFuture)\n : output.replace(/%d/i, number);\n }\n\n function pastFuture(diff, output) {\n var format = this._relativeTime[diff > 0 ? 'future' : 'past'];\n return isFunction(format) ? format(output) : format.replace(/%s/i, output);\n }\n\n var aliases = {};\n\n function addUnitAlias(unit, shorthand) {\n var lowerCase = unit.toLowerCase();\n aliases[lowerCase] = aliases[lowerCase + 's'] = aliases[shorthand] = unit;\n }\n\n function normalizeUnits(units) {\n return typeof units === 'string'\n ? aliases[units] || aliases[units.toLowerCase()]\n : undefined;\n }\n\n function normalizeObjectUnits(inputObject) {\n var normalizedInput = {},\n normalizedProp,\n prop;\n\n for (prop in inputObject) {\n if (hasOwnProp(inputObject, prop)) {\n normalizedProp = normalizeUnits(prop);\n if (normalizedProp) {\n normalizedInput[normalizedProp] = inputObject[prop];\n }\n }\n }\n\n return normalizedInput;\n }\n\n var priorities = {};\n\n function addUnitPriority(unit, priority) {\n priorities[unit] = priority;\n }\n\n function getPrioritizedUnits(unitsObj) {\n var units = [],\n u;\n for (u in unitsObj) {\n if (hasOwnProp(unitsObj, u)) {\n units.push({ unit: u, priority: priorities[u] });\n }\n }\n units.sort(function (a, b) {\n return a.priority - b.priority;\n });\n return units;\n }\n\n function isLeapYear(year) {\n return (year % 4 === 0 && year % 100 !== 0) || year % 400 === 0;\n }\n\n function absFloor(number) {\n if (number < 0) {\n // -0 -> 0\n return Math.ceil(number) || 0;\n } else {\n return Math.floor(number);\n }\n }\n\n function toInt(argumentForCoercion) {\n var coercedNumber = +argumentForCoercion,\n value = 0;\n\n if (coercedNumber !== 0 && isFinite(coercedNumber)) {\n value = absFloor(coercedNumber);\n }\n\n return value;\n }\n\n function makeGetSet(unit, keepTime) {\n return function (value) {\n if (value != null) {\n set$1(this, unit, value);\n hooks.updateOffset(this, keepTime);\n return this;\n } else {\n return get(this, unit);\n }\n };\n }\n\n function get(mom, unit) {\n return mom.isValid()\n ? mom._d['get' + (mom._isUTC ? 'UTC' : '') + unit]()\n : NaN;\n }\n\n function set$1(mom, unit, value) {\n if (mom.isValid() && !isNaN(value)) {\n if (\n unit === 'FullYear' &&\n isLeapYear(mom.year()) &&\n mom.month() === 1 &&\n mom.date() === 29\n ) {\n value = toInt(value);\n mom._d['set' + (mom._isUTC ? 'UTC' : '') + unit](\n value,\n mom.month(),\n daysInMonth(value, mom.month())\n );\n } else {\n mom._d['set' + (mom._isUTC ? 'UTC' : '') + unit](value);\n }\n }\n }\n\n // MOMENTS\n\n function stringGet(units) {\n units = normalizeUnits(units);\n if (isFunction(this[units])) {\n return this[units]();\n }\n return this;\n }\n\n function stringSet(units, value) {\n if (typeof units === 'object') {\n units = normalizeObjectUnits(units);\n var prioritized = getPrioritizedUnits(units),\n i;\n for (i = 0; i < prioritized.length; i++) {\n this[prioritized[i].unit](units[prioritized[i].unit]);\n }\n } else {\n units = normalizeUnits(units);\n if (isFunction(this[units])) {\n return this[units](value);\n }\n }\n return this;\n }\n\n var match1 = /\\d/, // 0 - 9\n match2 = /\\d\\d/, // 00 - 99\n match3 = /\\d{3}/, // 000 - 999\n match4 = /\\d{4}/, // 0000 - 9999\n match6 = /[+-]?\\d{6}/, // -999999 - 999999\n match1to2 = /\\d\\d?/, // 0 - 99\n match3to4 = /\\d\\d\\d\\d?/, // 999 - 9999\n match5to6 = /\\d\\d\\d\\d\\d\\d?/, // 99999 - 999999\n match1to3 = /\\d{1,3}/, // 0 - 999\n match1to4 = /\\d{1,4}/, // 0 - 9999\n match1to6 = /[+-]?\\d{1,6}/, // -999999 - 999999\n matchUnsigned = /\\d+/, // 0 - inf\n matchSigned = /[+-]?\\d+/, // -inf - inf\n matchOffset = /Z|[+-]\\d\\d:?\\d\\d/gi, // +00:00 -00:00 +0000 -0000 or Z\n matchShortOffset = /Z|[+-]\\d\\d(?::?\\d\\d)?/gi, // +00 -00 +00:00 -00:00 +0000 -0000 or Z\n matchTimestamp = /[+-]?\\d+(\\.\\d{1,3})?/, // 123456789 123456789.123\n // any word (or two) characters or numbers including two/three word month in arabic.\n // includes scottish gaelic two word and hyphenated months\n matchWord = /[0-9]{0,256}['a-z\\u00A0-\\u05FF\\u0700-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFF07\\uFF10-\\uFFEF]{1,256}|[\\u0600-\\u06FF\\/]{1,256}(\\s*?[\\u0600-\\u06FF]{1,256}){1,2}/i,\n regexes;\n\n regexes = {};\n\n function addRegexToken(token, regex, strictRegex) {\n regexes[token] = isFunction(regex)\n ? regex\n : function (isStrict, localeData) {\n return isStrict && strictRegex ? strictRegex : regex;\n };\n }\n\n function getParseRegexForToken(token, config) {\n if (!hasOwnProp(regexes, token)) {\n return new RegExp(unescapeFormat(token));\n }\n\n return regexes[token](config._strict, config._locale);\n }\n\n // Code from http://stackoverflow.com/questions/3561493/is-there-a-regexp-escape-function-in-javascript\n function unescapeFormat(s) {\n return regexEscape(\n s\n .replace('\\\\', '')\n .replace(/\\\\(\\[)|\\\\(\\])|\\[([^\\]\\[]*)\\]|\\\\(.)/g, function (\n matched,\n p1,\n p2,\n p3,\n p4\n ) {\n return p1 || p2 || p3 || p4;\n })\n );\n }\n\n function regexEscape(s) {\n return s.replace(/[-\\/\\\\^$*+?.()|[\\]{}]/g, '\\\\$&');\n }\n\n var tokens = {};\n\n function addParseToken(token, callback) {\n var i,\n func = callback;\n if (typeof token === 'string') {\n token = [token];\n }\n if (isNumber(callback)) {\n func = function (input, array) {\n array[callback] = toInt(input);\n };\n }\n for (i = 0; i < token.length; i++) {\n tokens[token[i]] = func;\n }\n }\n\n function addWeekParseToken(token, callback) {\n addParseToken(token, function (input, array, config, token) {\n config._w = config._w || {};\n callback(input, config._w, config, token);\n });\n }\n\n function addTimeToArrayFromToken(token, input, config) {\n if (input != null && hasOwnProp(tokens, token)) {\n tokens[token](input, config._a, config, token);\n }\n }\n\n var YEAR = 0,\n MONTH = 1,\n DATE = 2,\n HOUR = 3,\n MINUTE = 4,\n SECOND = 5,\n MILLISECOND = 6,\n WEEK = 7,\n WEEKDAY = 8;\n\n function mod(n, x) {\n return ((n % x) + x) % x;\n }\n\n var indexOf;\n\n if (Array.prototype.indexOf) {\n indexOf = Array.prototype.indexOf;\n } else {\n indexOf = function (o) {\n // I know\n var i;\n for (i = 0; i < this.length; ++i) {\n if (this[i] === o) {\n return i;\n }\n }\n return -1;\n };\n }\n\n function daysInMonth(year, month) {\n if (isNaN(year) || isNaN(month)) {\n return NaN;\n }\n var modMonth = mod(month, 12);\n year += (month - modMonth) / 12;\n return modMonth === 1\n ? isLeapYear(year)\n ? 29\n : 28\n : 31 - ((modMonth % 7) % 2);\n }\n\n // FORMATTING\n\n addFormatToken('M', ['MM', 2], 'Mo', function () {\n return this.month() + 1;\n });\n\n addFormatToken('MMM', 0, 0, function (format) {\n return this.localeData().monthsShort(this, format);\n });\n\n addFormatToken('MMMM', 0, 0, function (format) {\n return this.localeData().months(this, format);\n });\n\n // ALIASES\n\n addUnitAlias('month', 'M');\n\n // PRIORITY\n\n addUnitPriority('month', 8);\n\n // PARSING\n\n addRegexToken('M', match1to2);\n addRegexToken('MM', match1to2, match2);\n addRegexToken('MMM', function (isStrict, locale) {\n return locale.monthsShortRegex(isStrict);\n });\n addRegexToken('MMMM', function (isStrict, locale) {\n return locale.monthsRegex(isStrict);\n });\n\n addParseToken(['M', 'MM'], function (input, array) {\n array[MONTH] = toInt(input) - 1;\n });\n\n addParseToken(['MMM', 'MMMM'], function (input, array, config, token) {\n var month = config._locale.monthsParse(input, token, config._strict);\n // if we didn't find a month name, mark the date as invalid.\n if (month != null) {\n array[MONTH] = month;\n } else {\n getParsingFlags(config).invalidMonth = input;\n }\n });\n\n // LOCALES\n\n var defaultLocaleMonths = 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n defaultLocaleMonthsShort = 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split(\n '_'\n ),\n MONTHS_IN_FORMAT = /D[oD]?(\\[[^\\[\\]]*\\]|\\s)+MMMM?/,\n defaultMonthsShortRegex = matchWord,\n defaultMonthsRegex = matchWord;\n\n function localeMonths(m, format) {\n if (!m) {\n return isArray(this._months)\n ? this._months\n : this._months['standalone'];\n }\n return isArray(this._months)\n ? this._months[m.month()]\n : this._months[\n (this._months.isFormat || MONTHS_IN_FORMAT).test(format)\n ? 'format'\n : 'standalone'\n ][m.month()];\n }\n\n function localeMonthsShort(m, format) {\n if (!m) {\n return isArray(this._monthsShort)\n ? this._monthsShort\n : this._monthsShort['standalone'];\n }\n return isArray(this._monthsShort)\n ? this._monthsShort[m.month()]\n : this._monthsShort[\n MONTHS_IN_FORMAT.test(format) ? 'format' : 'standalone'\n ][m.month()];\n }\n\n function handleStrictParse(monthName, format, strict) {\n var i,\n ii,\n mom,\n llc = monthName.toLocaleLowerCase();\n if (!this._monthsParse) {\n // this is not used\n this._monthsParse = [];\n this._longMonthsParse = [];\n this._shortMonthsParse = [];\n for (i = 0; i < 12; ++i) {\n mom = createUTC([2000, i]);\n this._shortMonthsParse[i] = this.monthsShort(\n mom,\n ''\n ).toLocaleLowerCase();\n this._longMonthsParse[i] = this.months(mom, '').toLocaleLowerCase();\n }\n }\n\n if (strict) {\n if (format === 'MMM') {\n ii = indexOf.call(this._shortMonthsParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._longMonthsParse, llc);\n return ii !== -1 ? ii : null;\n }\n } else {\n if (format === 'MMM') {\n ii = indexOf.call(this._shortMonthsParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._longMonthsParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._longMonthsParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortMonthsParse, llc);\n return ii !== -1 ? ii : null;\n }\n }\n }\n\n function localeMonthsParse(monthName, format, strict) {\n var i, mom, regex;\n\n if (this._monthsParseExact) {\n return handleStrictParse.call(this, monthName, format, strict);\n }\n\n if (!this._monthsParse) {\n this._monthsParse = [];\n this._longMonthsParse = [];\n this._shortMonthsParse = [];\n }\n\n // TODO: add sorting\n // Sorting makes sure if one month (or abbr) is a prefix of another\n // see sorting in computeMonthsParse\n for (i = 0; i < 12; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, i]);\n if (strict && !this._longMonthsParse[i]) {\n this._longMonthsParse[i] = new RegExp(\n '^' + this.months(mom, '').replace('.', '') + '$',\n 'i'\n );\n this._shortMonthsParse[i] = new RegExp(\n '^' + this.monthsShort(mom, '').replace('.', '') + '$',\n 'i'\n );\n }\n if (!strict && !this._monthsParse[i]) {\n regex =\n '^' + this.months(mom, '') + '|^' + this.monthsShort(mom, '');\n this._monthsParse[i] = new RegExp(regex.replace('.', ''), 'i');\n }\n // test the regex\n if (\n strict &&\n format === 'MMMM' &&\n this._longMonthsParse[i].test(monthName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'MMM' &&\n this._shortMonthsParse[i].test(monthName)\n ) {\n return i;\n } else if (!strict && this._monthsParse[i].test(monthName)) {\n return i;\n }\n }\n }\n\n // MOMENTS\n\n function setMonth(mom, value) {\n var dayOfMonth;\n\n if (!mom.isValid()) {\n // No op\n return mom;\n }\n\n if (typeof value === 'string') {\n if (/^\\d+$/.test(value)) {\n value = toInt(value);\n } else {\n value = mom.localeData().monthsParse(value);\n // TODO: Another silent failure?\n if (!isNumber(value)) {\n return mom;\n }\n }\n }\n\n dayOfMonth = Math.min(mom.date(), daysInMonth(mom.year(), value));\n mom._d['set' + (mom._isUTC ? 'UTC' : '') + 'Month'](value, dayOfMonth);\n return mom;\n }\n\n function getSetMonth(value) {\n if (value != null) {\n setMonth(this, value);\n hooks.updateOffset(this, true);\n return this;\n } else {\n return get(this, 'Month');\n }\n }\n\n function getDaysInMonth() {\n return daysInMonth(this.year(), this.month());\n }\n\n function monthsShortRegex(isStrict) {\n if (this._monthsParseExact) {\n if (!hasOwnProp(this, '_monthsRegex')) {\n computeMonthsParse.call(this);\n }\n if (isStrict) {\n return this._monthsShortStrictRegex;\n } else {\n return this._monthsShortRegex;\n }\n } else {\n if (!hasOwnProp(this, '_monthsShortRegex')) {\n this._monthsShortRegex = defaultMonthsShortRegex;\n }\n return this._monthsShortStrictRegex && isStrict\n ? this._monthsShortStrictRegex\n : this._monthsShortRegex;\n }\n }\n\n function monthsRegex(isStrict) {\n if (this._monthsParseExact) {\n if (!hasOwnProp(this, '_monthsRegex')) {\n computeMonthsParse.call(this);\n }\n if (isStrict) {\n return this._monthsStrictRegex;\n } else {\n return this._monthsRegex;\n }\n } else {\n if (!hasOwnProp(this, '_monthsRegex')) {\n this._monthsRegex = defaultMonthsRegex;\n }\n return this._monthsStrictRegex && isStrict\n ? this._monthsStrictRegex\n : this._monthsRegex;\n }\n }\n\n function computeMonthsParse() {\n function cmpLenRev(a, b) {\n return b.length - a.length;\n }\n\n var shortPieces = [],\n longPieces = [],\n mixedPieces = [],\n i,\n mom;\n for (i = 0; i < 12; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, i]);\n shortPieces.push(this.monthsShort(mom, ''));\n longPieces.push(this.months(mom, ''));\n mixedPieces.push(this.months(mom, ''));\n mixedPieces.push(this.monthsShort(mom, ''));\n }\n // Sorting makes sure if one month (or abbr) is a prefix of another it\n // will match the longer piece.\n shortPieces.sort(cmpLenRev);\n longPieces.sort(cmpLenRev);\n mixedPieces.sort(cmpLenRev);\n for (i = 0; i < 12; i++) {\n shortPieces[i] = regexEscape(shortPieces[i]);\n longPieces[i] = regexEscape(longPieces[i]);\n }\n for (i = 0; i < 24; i++) {\n mixedPieces[i] = regexEscape(mixedPieces[i]);\n }\n\n this._monthsRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._monthsShortRegex = this._monthsRegex;\n this._monthsStrictRegex = new RegExp(\n '^(' + longPieces.join('|') + ')',\n 'i'\n );\n this._monthsShortStrictRegex = new RegExp(\n '^(' + shortPieces.join('|') + ')',\n 'i'\n );\n }\n\n // FORMATTING\n\n addFormatToken('Y', 0, 0, function () {\n var y = this.year();\n return y <= 9999 ? zeroFill(y, 4) : '+' + y;\n });\n\n addFormatToken(0, ['YY', 2], 0, function () {\n return this.year() % 100;\n });\n\n addFormatToken(0, ['YYYY', 4], 0, 'year');\n addFormatToken(0, ['YYYYY', 5], 0, 'year');\n addFormatToken(0, ['YYYYYY', 6, true], 0, 'year');\n\n // ALIASES\n\n addUnitAlias('year', 'y');\n\n // PRIORITIES\n\n addUnitPriority('year', 1);\n\n // PARSING\n\n addRegexToken('Y', matchSigned);\n addRegexToken('YY', match1to2, match2);\n addRegexToken('YYYY', match1to4, match4);\n addRegexToken('YYYYY', match1to6, match6);\n addRegexToken('YYYYYY', match1to6, match6);\n\n addParseToken(['YYYYY', 'YYYYYY'], YEAR);\n addParseToken('YYYY', function (input, array) {\n array[YEAR] =\n input.length === 2 ? hooks.parseTwoDigitYear(input) : toInt(input);\n });\n addParseToken('YY', function (input, array) {\n array[YEAR] = hooks.parseTwoDigitYear(input);\n });\n addParseToken('Y', function (input, array) {\n array[YEAR] = parseInt(input, 10);\n });\n\n // HELPERS\n\n function daysInYear(year) {\n return isLeapYear(year) ? 366 : 365;\n }\n\n // HOOKS\n\n hooks.parseTwoDigitYear = function (input) {\n return toInt(input) + (toInt(input) > 68 ? 1900 : 2000);\n };\n\n // MOMENTS\n\n var getSetYear = makeGetSet('FullYear', true);\n\n function getIsLeapYear() {\n return isLeapYear(this.year());\n }\n\n function createDate(y, m, d, h, M, s, ms) {\n // can't just apply() to create a date:\n // https://stackoverflow.com/q/181348\n var date;\n // the date constructor remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n date = new Date(y + 400, m, d, h, M, s, ms);\n if (isFinite(date.getFullYear())) {\n date.setFullYear(y);\n }\n } else {\n date = new Date(y, m, d, h, M, s, ms);\n }\n\n return date;\n }\n\n function createUTCDate(y) {\n var date, args;\n // the Date.UTC function remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n args = Array.prototype.slice.call(arguments);\n // preserve leap years using a full 400 year cycle, then reset\n args[0] = y + 400;\n date = new Date(Date.UTC.apply(null, args));\n if (isFinite(date.getUTCFullYear())) {\n date.setUTCFullYear(y);\n }\n } else {\n date = new Date(Date.UTC.apply(null, arguments));\n }\n\n return date;\n }\n\n // start-of-first-week - start-of-year\n function firstWeekOffset(year, dow, doy) {\n var // first-week day -- which january is always in the first week (4 for iso, 1 for other)\n fwd = 7 + dow - doy,\n // first-week day local weekday -- which local weekday is fwd\n fwdlw = (7 + createUTCDate(year, 0, fwd).getUTCDay() - dow) % 7;\n\n return -fwdlw + fwd - 1;\n }\n\n // https://en.wikipedia.org/wiki/ISO_week_date#Calculating_a_date_given_the_year.2C_week_number_and_weekday\n function dayOfYearFromWeeks(year, week, weekday, dow, doy) {\n var localWeekday = (7 + weekday - dow) % 7,\n weekOffset = firstWeekOffset(year, dow, doy),\n dayOfYear = 1 + 7 * (week - 1) + localWeekday + weekOffset,\n resYear,\n resDayOfYear;\n\n if (dayOfYear <= 0) {\n resYear = year - 1;\n resDayOfYear = daysInYear(resYear) + dayOfYear;\n } else if (dayOfYear > daysInYear(year)) {\n resYear = year + 1;\n resDayOfYear = dayOfYear - daysInYear(year);\n } else {\n resYear = year;\n resDayOfYear = dayOfYear;\n }\n\n return {\n year: resYear,\n dayOfYear: resDayOfYear,\n };\n }\n\n function weekOfYear(mom, dow, doy) {\n var weekOffset = firstWeekOffset(mom.year(), dow, doy),\n week = Math.floor((mom.dayOfYear() - weekOffset - 1) / 7) + 1,\n resWeek,\n resYear;\n\n if (week < 1) {\n resYear = mom.year() - 1;\n resWeek = week + weeksInYear(resYear, dow, doy);\n } else if (week > weeksInYear(mom.year(), dow, doy)) {\n resWeek = week - weeksInYear(mom.year(), dow, doy);\n resYear = mom.year() + 1;\n } else {\n resYear = mom.year();\n resWeek = week;\n }\n\n return {\n week: resWeek,\n year: resYear,\n };\n }\n\n function weeksInYear(year, dow, doy) {\n var weekOffset = firstWeekOffset(year, dow, doy),\n weekOffsetNext = firstWeekOffset(year + 1, dow, doy);\n return (daysInYear(year) - weekOffset + weekOffsetNext) / 7;\n }\n\n // FORMATTING\n\n addFormatToken('w', ['ww', 2], 'wo', 'week');\n addFormatToken('W', ['WW', 2], 'Wo', 'isoWeek');\n\n // ALIASES\n\n addUnitAlias('week', 'w');\n addUnitAlias('isoWeek', 'W');\n\n // PRIORITIES\n\n addUnitPriority('week', 5);\n addUnitPriority('isoWeek', 5);\n\n // PARSING\n\n addRegexToken('w', match1to2);\n addRegexToken('ww', match1to2, match2);\n addRegexToken('W', match1to2);\n addRegexToken('WW', match1to2, match2);\n\n addWeekParseToken(['w', 'ww', 'W', 'WW'], function (\n input,\n week,\n config,\n token\n ) {\n week[token.substr(0, 1)] = toInt(input);\n });\n\n // HELPERS\n\n // LOCALES\n\n function localeWeek(mom) {\n return weekOfYear(mom, this._week.dow, this._week.doy).week;\n }\n\n var defaultLocaleWeek = {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n };\n\n function localeFirstDayOfWeek() {\n return this._week.dow;\n }\n\n function localeFirstDayOfYear() {\n return this._week.doy;\n }\n\n // MOMENTS\n\n function getSetWeek(input) {\n var week = this.localeData().week(this);\n return input == null ? week : this.add((input - week) * 7, 'd');\n }\n\n function getSetISOWeek(input) {\n var week = weekOfYear(this, 1, 4).week;\n return input == null ? week : this.add((input - week) * 7, 'd');\n }\n\n // FORMATTING\n\n addFormatToken('d', 0, 'do', 'day');\n\n addFormatToken('dd', 0, 0, function (format) {\n return this.localeData().weekdaysMin(this, format);\n });\n\n addFormatToken('ddd', 0, 0, function (format) {\n return this.localeData().weekdaysShort(this, format);\n });\n\n addFormatToken('dddd', 0, 0, function (format) {\n return this.localeData().weekdays(this, format);\n });\n\n addFormatToken('e', 0, 0, 'weekday');\n addFormatToken('E', 0, 0, 'isoWeekday');\n\n // ALIASES\n\n addUnitAlias('day', 'd');\n addUnitAlias('weekday', 'e');\n addUnitAlias('isoWeekday', 'E');\n\n // PRIORITY\n addUnitPriority('day', 11);\n addUnitPriority('weekday', 11);\n addUnitPriority('isoWeekday', 11);\n\n // PARSING\n\n addRegexToken('d', match1to2);\n addRegexToken('e', match1to2);\n addRegexToken('E', match1to2);\n addRegexToken('dd', function (isStrict, locale) {\n return locale.weekdaysMinRegex(isStrict);\n });\n addRegexToken('ddd', function (isStrict, locale) {\n return locale.weekdaysShortRegex(isStrict);\n });\n addRegexToken('dddd', function (isStrict, locale) {\n return locale.weekdaysRegex(isStrict);\n });\n\n addWeekParseToken(['dd', 'ddd', 'dddd'], function (input, week, config, token) {\n var weekday = config._locale.weekdaysParse(input, token, config._strict);\n // if we didn't get a weekday name, mark the date as invalid\n if (weekday != null) {\n week.d = weekday;\n } else {\n getParsingFlags(config).invalidWeekday = input;\n }\n });\n\n addWeekParseToken(['d', 'e', 'E'], function (input, week, config, token) {\n week[token] = toInt(input);\n });\n\n // HELPERS\n\n function parseWeekday(input, locale) {\n if (typeof input !== 'string') {\n return input;\n }\n\n if (!isNaN(input)) {\n return parseInt(input, 10);\n }\n\n input = locale.weekdaysParse(input);\n if (typeof input === 'number') {\n return input;\n }\n\n return null;\n }\n\n function parseIsoWeekday(input, locale) {\n if (typeof input === 'string') {\n return locale.weekdaysParse(input) % 7 || 7;\n }\n return isNaN(input) ? null : input;\n }\n\n // LOCALES\n function shiftWeekdays(ws, n) {\n return ws.slice(n, 7).concat(ws.slice(0, n));\n }\n\n var defaultLocaleWeekdays = 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split(\n '_'\n ),\n defaultLocaleWeekdaysShort = 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n defaultLocaleWeekdaysMin = 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n defaultWeekdaysRegex = matchWord,\n defaultWeekdaysShortRegex = matchWord,\n defaultWeekdaysMinRegex = matchWord;\n\n function localeWeekdays(m, format) {\n var weekdays = isArray(this._weekdays)\n ? this._weekdays\n : this._weekdays[\n m && m !== true && this._weekdays.isFormat.test(format)\n ? 'format'\n : 'standalone'\n ];\n return m === true\n ? shiftWeekdays(weekdays, this._week.dow)\n : m\n ? weekdays[m.day()]\n : weekdays;\n }\n\n function localeWeekdaysShort(m) {\n return m === true\n ? shiftWeekdays(this._weekdaysShort, this._week.dow)\n : m\n ? this._weekdaysShort[m.day()]\n : this._weekdaysShort;\n }\n\n function localeWeekdaysMin(m) {\n return m === true\n ? shiftWeekdays(this._weekdaysMin, this._week.dow)\n : m\n ? this._weekdaysMin[m.day()]\n : this._weekdaysMin;\n }\n\n function handleStrictParse$1(weekdayName, format, strict) {\n var i,\n ii,\n mom,\n llc = weekdayName.toLocaleLowerCase();\n if (!this._weekdaysParse) {\n this._weekdaysParse = [];\n this._shortWeekdaysParse = [];\n this._minWeekdaysParse = [];\n\n for (i = 0; i < 7; ++i) {\n mom = createUTC([2000, 1]).day(i);\n this._minWeekdaysParse[i] = this.weekdaysMin(\n mom,\n ''\n ).toLocaleLowerCase();\n this._shortWeekdaysParse[i] = this.weekdaysShort(\n mom,\n ''\n ).toLocaleLowerCase();\n this._weekdaysParse[i] = this.weekdays(mom, '').toLocaleLowerCase();\n }\n }\n\n if (strict) {\n if (format === 'dddd') {\n ii = indexOf.call(this._weekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else if (format === 'ddd') {\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n }\n } else {\n if (format === 'dddd') {\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else if (format === 'ddd') {\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._minWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n }\n }\n }\n\n function localeWeekdaysParse(weekdayName, format, strict) {\n var i, mom, regex;\n\n if (this._weekdaysParseExact) {\n return handleStrictParse$1.call(this, weekdayName, format, strict);\n }\n\n if (!this._weekdaysParse) {\n this._weekdaysParse = [];\n this._minWeekdaysParse = [];\n this._shortWeekdaysParse = [];\n this._fullWeekdaysParse = [];\n }\n\n for (i = 0; i < 7; i++) {\n // make the regex if we don't have it already\n\n mom = createUTC([2000, 1]).day(i);\n if (strict && !this._fullWeekdaysParse[i]) {\n this._fullWeekdaysParse[i] = new RegExp(\n '^' + this.weekdays(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n this._shortWeekdaysParse[i] = new RegExp(\n '^' + this.weekdaysShort(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n this._minWeekdaysParse[i] = new RegExp(\n '^' + this.weekdaysMin(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n }\n if (!this._weekdaysParse[i]) {\n regex =\n '^' +\n this.weekdays(mom, '') +\n '|^' +\n this.weekdaysShort(mom, '') +\n '|^' +\n this.weekdaysMin(mom, '');\n this._weekdaysParse[i] = new RegExp(regex.replace('.', ''), 'i');\n }\n // test the regex\n if (\n strict &&\n format === 'dddd' &&\n this._fullWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'ddd' &&\n this._shortWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'dd' &&\n this._minWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (!strict && this._weekdaysParse[i].test(weekdayName)) {\n return i;\n }\n }\n }\n\n // MOMENTS\n\n function getSetDayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n var day = this._isUTC ? this._d.getUTCDay() : this._d.getDay();\n if (input != null) {\n input = parseWeekday(input, this.localeData());\n return this.add(input - day, 'd');\n } else {\n return day;\n }\n }\n\n function getSetLocaleDayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n var weekday = (this.day() + 7 - this.localeData()._week.dow) % 7;\n return input == null ? weekday : this.add(input - weekday, 'd');\n }\n\n function getSetISODayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n\n // behaves the same as moment#day except\n // as a getter, returns 7 instead of 0 (1-7 range instead of 0-6)\n // as a setter, sunday should belong to the previous week.\n\n if (input != null) {\n var weekday = parseIsoWeekday(input, this.localeData());\n return this.day(this.day() % 7 ? weekday : weekday - 7);\n } else {\n return this.day() || 7;\n }\n }\n\n function weekdaysRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysStrictRegex;\n } else {\n return this._weekdaysRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n this._weekdaysRegex = defaultWeekdaysRegex;\n }\n return this._weekdaysStrictRegex && isStrict\n ? this._weekdaysStrictRegex\n : this._weekdaysRegex;\n }\n }\n\n function weekdaysShortRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysShortStrictRegex;\n } else {\n return this._weekdaysShortRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysShortRegex')) {\n this._weekdaysShortRegex = defaultWeekdaysShortRegex;\n }\n return this._weekdaysShortStrictRegex && isStrict\n ? this._weekdaysShortStrictRegex\n : this._weekdaysShortRegex;\n }\n }\n\n function weekdaysMinRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysMinStrictRegex;\n } else {\n return this._weekdaysMinRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysMinRegex')) {\n this._weekdaysMinRegex = defaultWeekdaysMinRegex;\n }\n return this._weekdaysMinStrictRegex && isStrict\n ? this._weekdaysMinStrictRegex\n : this._weekdaysMinRegex;\n }\n }\n\n function computeWeekdaysParse() {\n function cmpLenRev(a, b) {\n return b.length - a.length;\n }\n\n var minPieces = [],\n shortPieces = [],\n longPieces = [],\n mixedPieces = [],\n i,\n mom,\n minp,\n shortp,\n longp;\n for (i = 0; i < 7; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, 1]).day(i);\n minp = regexEscape(this.weekdaysMin(mom, ''));\n shortp = regexEscape(this.weekdaysShort(mom, ''));\n longp = regexEscape(this.weekdays(mom, ''));\n minPieces.push(minp);\n shortPieces.push(shortp);\n longPieces.push(longp);\n mixedPieces.push(minp);\n mixedPieces.push(shortp);\n mixedPieces.push(longp);\n }\n // Sorting makes sure if one weekday (or abbr) is a prefix of another it\n // will match the longer piece.\n minPieces.sort(cmpLenRev);\n shortPieces.sort(cmpLenRev);\n longPieces.sort(cmpLenRev);\n mixedPieces.sort(cmpLenRev);\n\n this._weekdaysRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._weekdaysShortRegex = this._weekdaysRegex;\n this._weekdaysMinRegex = this._weekdaysRegex;\n\n this._weekdaysStrictRegex = new RegExp(\n '^(' + longPieces.join('|') + ')',\n 'i'\n );\n this._weekdaysShortStrictRegex = new RegExp(\n '^(' + shortPieces.join('|') + ')',\n 'i'\n );\n this._weekdaysMinStrictRegex = new RegExp(\n '^(' + minPieces.join('|') + ')',\n 'i'\n );\n }\n\n // FORMATTING\n\n function hFormat() {\n return this.hours() % 12 || 12;\n }\n\n function kFormat() {\n return this.hours() || 24;\n }\n\n addFormatToken('H', ['HH', 2], 0, 'hour');\n addFormatToken('h', ['hh', 2], 0, hFormat);\n addFormatToken('k', ['kk', 2], 0, kFormat);\n\n addFormatToken('hmm', 0, 0, function () {\n return '' + hFormat.apply(this) + zeroFill(this.minutes(), 2);\n });\n\n addFormatToken('hmmss', 0, 0, function () {\n return (\n '' +\n hFormat.apply(this) +\n zeroFill(this.minutes(), 2) +\n zeroFill(this.seconds(), 2)\n );\n });\n\n addFormatToken('Hmm', 0, 0, function () {\n return '' + this.hours() + zeroFill(this.minutes(), 2);\n });\n\n addFormatToken('Hmmss', 0, 0, function () {\n return (\n '' +\n this.hours() +\n zeroFill(this.minutes(), 2) +\n zeroFill(this.seconds(), 2)\n );\n });\n\n function meridiem(token, lowercase) {\n addFormatToken(token, 0, 0, function () {\n return this.localeData().meridiem(\n this.hours(),\n this.minutes(),\n lowercase\n );\n });\n }\n\n meridiem('a', true);\n meridiem('A', false);\n\n // ALIASES\n\n addUnitAlias('hour', 'h');\n\n // PRIORITY\n addUnitPriority('hour', 13);\n\n // PARSING\n\n function matchMeridiem(isStrict, locale) {\n return locale._meridiemParse;\n }\n\n addRegexToken('a', matchMeridiem);\n addRegexToken('A', matchMeridiem);\n addRegexToken('H', match1to2);\n addRegexToken('h', match1to2);\n addRegexToken('k', match1to2);\n addRegexToken('HH', match1to2, match2);\n addRegexToken('hh', match1to2, match2);\n addRegexToken('kk', match1to2, match2);\n\n addRegexToken('hmm', match3to4);\n addRegexToken('hmmss', match5to6);\n addRegexToken('Hmm', match3to4);\n addRegexToken('Hmmss', match5to6);\n\n addParseToken(['H', 'HH'], HOUR);\n addParseToken(['k', 'kk'], function (input, array, config) {\n var kInput = toInt(input);\n array[HOUR] = kInput === 24 ? 0 : kInput;\n });\n addParseToken(['a', 'A'], function (input, array, config) {\n config._isPm = config._locale.isPM(input);\n config._meridiem = input;\n });\n addParseToken(['h', 'hh'], function (input, array, config) {\n array[HOUR] = toInt(input);\n getParsingFlags(config).bigHour = true;\n });\n addParseToken('hmm', function (input, array, config) {\n var pos = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos));\n array[MINUTE] = toInt(input.substr(pos));\n getParsingFlags(config).bigHour = true;\n });\n addParseToken('hmmss', function (input, array, config) {\n var pos1 = input.length - 4,\n pos2 = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos1));\n array[MINUTE] = toInt(input.substr(pos1, 2));\n array[SECOND] = toInt(input.substr(pos2));\n getParsingFlags(config).bigHour = true;\n });\n addParseToken('Hmm', function (input, array, config) {\n var pos = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos));\n array[MINUTE] = toInt(input.substr(pos));\n });\n addParseToken('Hmmss', function (input, array, config) {\n var pos1 = input.length - 4,\n pos2 = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos1));\n array[MINUTE] = toInt(input.substr(pos1, 2));\n array[SECOND] = toInt(input.substr(pos2));\n });\n\n // LOCALES\n\n function localeIsPM(input) {\n // IE8 Quirks Mode & IE7 Standards Mode do not allow accessing strings like arrays\n // Using charAt should be more compatible.\n return (input + '').toLowerCase().charAt(0) === 'p';\n }\n\n var defaultLocaleMeridiemParse = /[ap]\\.?m?\\.?/i,\n // Setting the hour should keep the time, because the user explicitly\n // specified which hour they want. So trying to maintain the same hour (in\n // a new timezone) makes sense. Adding/subtracting hours does not follow\n // this rule.\n getSetHour = makeGetSet('Hours', true);\n\n function localeMeridiem(hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'pm' : 'PM';\n } else {\n return isLower ? 'am' : 'AM';\n }\n }\n\n var baseConfig = {\n calendar: defaultCalendar,\n longDateFormat: defaultLongDateFormat,\n invalidDate: defaultInvalidDate,\n ordinal: defaultOrdinal,\n dayOfMonthOrdinalParse: defaultDayOfMonthOrdinalParse,\n relativeTime: defaultRelativeTime,\n\n months: defaultLocaleMonths,\n monthsShort: defaultLocaleMonthsShort,\n\n week: defaultLocaleWeek,\n\n weekdays: defaultLocaleWeekdays,\n weekdaysMin: defaultLocaleWeekdaysMin,\n weekdaysShort: defaultLocaleWeekdaysShort,\n\n meridiemParse: defaultLocaleMeridiemParse,\n };\n\n // internal storage for locale config files\n var locales = {},\n localeFamilies = {},\n globalLocale;\n\n function commonPrefix(arr1, arr2) {\n var i,\n minl = Math.min(arr1.length, arr2.length);\n for (i = 0; i < minl; i += 1) {\n if (arr1[i] !== arr2[i]) {\n return i;\n }\n }\n return minl;\n }\n\n function normalizeLocale(key) {\n return key ? key.toLowerCase().replace('_', '-') : key;\n }\n\n // pick the locale from the array\n // try ['en-au', 'en-gb'] as 'en-au', 'en-gb', 'en', as in move through the list trying each\n // substring from most specific to least, but move to the next array item if it's a more specific variant than the current root\n function chooseLocale(names) {\n var i = 0,\n j,\n next,\n locale,\n split;\n\n while (i < names.length) {\n split = normalizeLocale(names[i]).split('-');\n j = split.length;\n next = normalizeLocale(names[i + 1]);\n next = next ? next.split('-') : null;\n while (j > 0) {\n locale = loadLocale(split.slice(0, j).join('-'));\n if (locale) {\n return locale;\n }\n if (\n next &&\n next.length >= j &&\n commonPrefix(split, next) >= j - 1\n ) {\n //the next array item is better than a shallower substring of this one\n break;\n }\n j--;\n }\n i++;\n }\n return globalLocale;\n }\n\n function loadLocale(name) {\n var oldLocale = null,\n aliasedRequire;\n // TODO: Find a better way to register and load all the locales in Node\n if (\n locales[name] === undefined &&\n typeof module !== 'undefined' &&\n module &&\n module.exports\n ) {\n try {\n oldLocale = globalLocale._abbr;\n aliasedRequire = require;\n aliasedRequire('./locale/' + name);\n getSetGlobalLocale(oldLocale);\n } catch (e) {\n // mark as not found to avoid repeating expensive file require call causing high CPU\n // when trying to find en-US, en_US, en-us for every format call\n locales[name] = null; // null means not found\n }\n }\n return locales[name];\n }\n\n // This function will load locale and then set the global locale. If\n // no arguments are passed in, it will simply return the current global\n // locale key.\n function getSetGlobalLocale(key, values) {\n var data;\n if (key) {\n if (isUndefined(values)) {\n data = getLocale(key);\n } else {\n data = defineLocale(key, values);\n }\n\n if (data) {\n // moment.duration._locale = moment._locale = data;\n globalLocale = data;\n } else {\n if (typeof console !== 'undefined' && console.warn) {\n //warn user if arguments are passed but the locale could not be set\n console.warn(\n 'Locale ' + key + ' not found. Did you forget to load it?'\n );\n }\n }\n }\n\n return globalLocale._abbr;\n }\n\n function defineLocale(name, config) {\n if (config !== null) {\n var locale,\n parentConfig = baseConfig;\n config.abbr = name;\n if (locales[name] != null) {\n deprecateSimple(\n 'defineLocaleOverride',\n 'use moment.updateLocale(localeName, config) to change ' +\n 'an existing locale. moment.defineLocale(localeName, ' +\n 'config) should only be used for creating a new locale ' +\n 'See http://momentjs.com/guides/#/warnings/define-locale/ for more info.'\n );\n parentConfig = locales[name]._config;\n } else if (config.parentLocale != null) {\n if (locales[config.parentLocale] != null) {\n parentConfig = locales[config.parentLocale]._config;\n } else {\n locale = loadLocale(config.parentLocale);\n if (locale != null) {\n parentConfig = locale._config;\n } else {\n if (!localeFamilies[config.parentLocale]) {\n localeFamilies[config.parentLocale] = [];\n }\n localeFamilies[config.parentLocale].push({\n name: name,\n config: config,\n });\n return null;\n }\n }\n }\n locales[name] = new Locale(mergeConfigs(parentConfig, config));\n\n if (localeFamilies[name]) {\n localeFamilies[name].forEach(function (x) {\n defineLocale(x.name, x.config);\n });\n }\n\n // backwards compat for now: also set the locale\n // make sure we set the locale AFTER all child locales have been\n // created, so we won't end up with the child locale set.\n getSetGlobalLocale(name);\n\n return locales[name];\n } else {\n // useful for testing\n delete locales[name];\n return null;\n }\n }\n\n function updateLocale(name, config) {\n if (config != null) {\n var locale,\n tmpLocale,\n parentConfig = baseConfig;\n\n if (locales[name] != null && locales[name].parentLocale != null) {\n // Update existing child locale in-place to avoid memory-leaks\n locales[name].set(mergeConfigs(locales[name]._config, config));\n } else {\n // MERGE\n tmpLocale = loadLocale(name);\n if (tmpLocale != null) {\n parentConfig = tmpLocale._config;\n }\n config = mergeConfigs(parentConfig, config);\n if (tmpLocale == null) {\n // updateLocale is called for creating a new locale\n // Set abbr so it will have a name (getters return\n // undefined otherwise).\n config.abbr = name;\n }\n locale = new Locale(config);\n locale.parentLocale = locales[name];\n locales[name] = locale;\n }\n\n // backwards compat for now: also set the locale\n getSetGlobalLocale(name);\n } else {\n // pass null for config to unupdate, useful for tests\n if (locales[name] != null) {\n if (locales[name].parentLocale != null) {\n locales[name] = locales[name].parentLocale;\n if (name === getSetGlobalLocale()) {\n getSetGlobalLocale(name);\n }\n } else if (locales[name] != null) {\n delete locales[name];\n }\n }\n }\n return locales[name];\n }\n\n // returns locale data\n function getLocale(key) {\n var locale;\n\n if (key && key._locale && key._locale._abbr) {\n key = key._locale._abbr;\n }\n\n if (!key) {\n return globalLocale;\n }\n\n if (!isArray(key)) {\n //short-circuit everything else\n locale = loadLocale(key);\n if (locale) {\n return locale;\n }\n key = [key];\n }\n\n return chooseLocale(key);\n }\n\n function listLocales() {\n return keys(locales);\n }\n\n function checkOverflow(m) {\n var overflow,\n a = m._a;\n\n if (a && getParsingFlags(m).overflow === -2) {\n overflow =\n a[MONTH] < 0 || a[MONTH] > 11\n ? MONTH\n : a[DATE] < 1 || a[DATE] > daysInMonth(a[YEAR], a[MONTH])\n ? DATE\n : a[HOUR] < 0 ||\n a[HOUR] > 24 ||\n (a[HOUR] === 24 &&\n (a[MINUTE] !== 0 ||\n a[SECOND] !== 0 ||\n a[MILLISECOND] !== 0))\n ? HOUR\n : a[MINUTE] < 0 || a[MINUTE] > 59\n ? MINUTE\n : a[SECOND] < 0 || a[SECOND] > 59\n ? SECOND\n : a[MILLISECOND] < 0 || a[MILLISECOND] > 999\n ? MILLISECOND\n : -1;\n\n if (\n getParsingFlags(m)._overflowDayOfYear &&\n (overflow < YEAR || overflow > DATE)\n ) {\n overflow = DATE;\n }\n if (getParsingFlags(m)._overflowWeeks && overflow === -1) {\n overflow = WEEK;\n }\n if (getParsingFlags(m)._overflowWeekday && overflow === -1) {\n overflow = WEEKDAY;\n }\n\n getParsingFlags(m).overflow = overflow;\n }\n\n return m;\n }\n\n // iso 8601 regex\n // 0000-00-00 0000-W00 or 0000-W00-0 + T + 00 or 00:00 or 00:00:00 or 00:00:00.000 + +00:00 or +0000 or +00)\n var extendedIsoRegex = /^\\s*((?:[+-]\\d{6}|\\d{4})-(?:\\d\\d-\\d\\d|W\\d\\d-\\d|W\\d\\d|\\d\\d\\d|\\d\\d))(?:(T| )(\\d\\d(?::\\d\\d(?::\\d\\d(?:[.,]\\d+)?)?)?)([+-]\\d\\d(?::?\\d\\d)?|\\s*Z)?)?$/,\n basicIsoRegex = /^\\s*((?:[+-]\\d{6}|\\d{4})(?:\\d\\d\\d\\d|W\\d\\d\\d|W\\d\\d|\\d\\d\\d|\\d\\d|))(?:(T| )(\\d\\d(?:\\d\\d(?:\\d\\d(?:[.,]\\d+)?)?)?)([+-]\\d\\d(?::?\\d\\d)?|\\s*Z)?)?$/,\n tzRegex = /Z|[+-]\\d\\d(?::?\\d\\d)?/,\n isoDates = [\n ['YYYYYY-MM-DD', /[+-]\\d{6}-\\d\\d-\\d\\d/],\n ['YYYY-MM-DD', /\\d{4}-\\d\\d-\\d\\d/],\n ['GGGG-[W]WW-E', /\\d{4}-W\\d\\d-\\d/],\n ['GGGG-[W]WW', /\\d{4}-W\\d\\d/, false],\n ['YYYY-DDD', /\\d{4}-\\d{3}/],\n ['YYYY-MM', /\\d{4}-\\d\\d/, false],\n ['YYYYYYMMDD', /[+-]\\d{10}/],\n ['YYYYMMDD', /\\d{8}/],\n ['GGGG[W]WWE', /\\d{4}W\\d{3}/],\n ['GGGG[W]WW', /\\d{4}W\\d{2}/, false],\n ['YYYYDDD', /\\d{7}/],\n ['YYYYMM', /\\d{6}/, false],\n ['YYYY', /\\d{4}/, false],\n ],\n // iso time formats and regexes\n isoTimes = [\n ['HH:mm:ss.SSSS', /\\d\\d:\\d\\d:\\d\\d\\.\\d+/],\n ['HH:mm:ss,SSSS', /\\d\\d:\\d\\d:\\d\\d,\\d+/],\n ['HH:mm:ss', /\\d\\d:\\d\\d:\\d\\d/],\n ['HH:mm', /\\d\\d:\\d\\d/],\n ['HHmmss.SSSS', /\\d\\d\\d\\d\\d\\d\\.\\d+/],\n ['HHmmss,SSSS', /\\d\\d\\d\\d\\d\\d,\\d+/],\n ['HHmmss', /\\d\\d\\d\\d\\d\\d/],\n ['HHmm', /\\d\\d\\d\\d/],\n ['HH', /\\d\\d/],\n ],\n aspNetJsonRegex = /^\\/?Date\\((-?\\d+)/i,\n // RFC 2822 regex: For details see https://tools.ietf.org/html/rfc2822#section-3.3\n rfc2822 = /^(?:(Mon|Tue|Wed|Thu|Fri|Sat|Sun),?\\s)?(\\d{1,2})\\s(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)\\s(\\d{2,4})\\s(\\d\\d):(\\d\\d)(?::(\\d\\d))?\\s(?:(UT|GMT|[ECMP][SD]T)|([Zz])|([+-]\\d{4}))$/,\n obsOffsets = {\n UT: 0,\n GMT: 0,\n EDT: -4 * 60,\n EST: -5 * 60,\n CDT: -5 * 60,\n CST: -6 * 60,\n MDT: -6 * 60,\n MST: -7 * 60,\n PDT: -7 * 60,\n PST: -8 * 60,\n };\n\n // date from iso format\n function configFromISO(config) {\n var i,\n l,\n string = config._i,\n match = extendedIsoRegex.exec(string) || basicIsoRegex.exec(string),\n allowTime,\n dateFormat,\n timeFormat,\n tzFormat;\n\n if (match) {\n getParsingFlags(config).iso = true;\n\n for (i = 0, l = isoDates.length; i < l; i++) {\n if (isoDates[i][1].exec(match[1])) {\n dateFormat = isoDates[i][0];\n allowTime = isoDates[i][2] !== false;\n break;\n }\n }\n if (dateFormat == null) {\n config._isValid = false;\n return;\n }\n if (match[3]) {\n for (i = 0, l = isoTimes.length; i < l; i++) {\n if (isoTimes[i][1].exec(match[3])) {\n // match[2] should be 'T' or space\n timeFormat = (match[2] || ' ') + isoTimes[i][0];\n break;\n }\n }\n if (timeFormat == null) {\n config._isValid = false;\n return;\n }\n }\n if (!allowTime && timeFormat != null) {\n config._isValid = false;\n return;\n }\n if (match[4]) {\n if (tzRegex.exec(match[4])) {\n tzFormat = 'Z';\n } else {\n config._isValid = false;\n return;\n }\n }\n config._f = dateFormat + (timeFormat || '') + (tzFormat || '');\n configFromStringAndFormat(config);\n } else {\n config._isValid = false;\n }\n }\n\n function extractFromRFC2822Strings(\n yearStr,\n monthStr,\n dayStr,\n hourStr,\n minuteStr,\n secondStr\n ) {\n var result = [\n untruncateYear(yearStr),\n defaultLocaleMonthsShort.indexOf(monthStr),\n parseInt(dayStr, 10),\n parseInt(hourStr, 10),\n parseInt(minuteStr, 10),\n ];\n\n if (secondStr) {\n result.push(parseInt(secondStr, 10));\n }\n\n return result;\n }\n\n function untruncateYear(yearStr) {\n var year = parseInt(yearStr, 10);\n if (year <= 49) {\n return 2000 + year;\n } else if (year <= 999) {\n return 1900 + year;\n }\n return year;\n }\n\n function preprocessRFC2822(s) {\n // Remove comments and folding whitespace and replace multiple-spaces with a single space\n return s\n .replace(/\\([^)]*\\)|[\\n\\t]/g, ' ')\n .replace(/(\\s\\s+)/g, ' ')\n .replace(/^\\s\\s*/, '')\n .replace(/\\s\\s*$/, '');\n }\n\n function checkWeekday(weekdayStr, parsedInput, config) {\n if (weekdayStr) {\n // TODO: Replace the vanilla JS Date object with an independent day-of-week check.\n var weekdayProvided = defaultLocaleWeekdaysShort.indexOf(weekdayStr),\n weekdayActual = new Date(\n parsedInput[0],\n parsedInput[1],\n parsedInput[2]\n ).getDay();\n if (weekdayProvided !== weekdayActual) {\n getParsingFlags(config).weekdayMismatch = true;\n config._isValid = false;\n return false;\n }\n }\n return true;\n }\n\n function calculateOffset(obsOffset, militaryOffset, numOffset) {\n if (obsOffset) {\n return obsOffsets[obsOffset];\n } else if (militaryOffset) {\n // the only allowed military tz is Z\n return 0;\n } else {\n var hm = parseInt(numOffset, 10),\n m = hm % 100,\n h = (hm - m) / 100;\n return h * 60 + m;\n }\n }\n\n // date and time from ref 2822 format\n function configFromRFC2822(config) {\n var match = rfc2822.exec(preprocessRFC2822(config._i)),\n parsedArray;\n if (match) {\n parsedArray = extractFromRFC2822Strings(\n match[4],\n match[3],\n match[2],\n match[5],\n match[6],\n match[7]\n );\n if (!checkWeekday(match[1], parsedArray, config)) {\n return;\n }\n\n config._a = parsedArray;\n config._tzm = calculateOffset(match[8], match[9], match[10]);\n\n config._d = createUTCDate.apply(null, config._a);\n config._d.setUTCMinutes(config._d.getUTCMinutes() - config._tzm);\n\n getParsingFlags(config).rfc2822 = true;\n } else {\n config._isValid = false;\n }\n }\n\n // date from 1) ASP.NET, 2) ISO, 3) RFC 2822 formats, or 4) optional fallback if parsing isn't strict\n function configFromString(config) {\n var matched = aspNetJsonRegex.exec(config._i);\n if (matched !== null) {\n config._d = new Date(+matched[1]);\n return;\n }\n\n configFromISO(config);\n if (config._isValid === false) {\n delete config._isValid;\n } else {\n return;\n }\n\n configFromRFC2822(config);\n if (config._isValid === false) {\n delete config._isValid;\n } else {\n return;\n }\n\n if (config._strict) {\n config._isValid = false;\n } else {\n // Final attempt, use Input Fallback\n hooks.createFromInputFallback(config);\n }\n }\n\n hooks.createFromInputFallback = deprecate(\n 'value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), ' +\n 'which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are ' +\n 'discouraged. Please refer to http://momentjs.com/guides/#/warnings/js-date/ for more info.',\n function (config) {\n config._d = new Date(config._i + (config._useUTC ? ' UTC' : ''));\n }\n );\n\n // Pick the first defined of two or three arguments.\n function defaults(a, b, c) {\n if (a != null) {\n return a;\n }\n if (b != null) {\n return b;\n }\n return c;\n }\n\n function currentDateArray(config) {\n // hooks is actually the exported moment object\n var nowValue = new Date(hooks.now());\n if (config._useUTC) {\n return [\n nowValue.getUTCFullYear(),\n nowValue.getUTCMonth(),\n nowValue.getUTCDate(),\n ];\n }\n return [nowValue.getFullYear(), nowValue.getMonth(), nowValue.getDate()];\n }\n\n // convert an array to a date.\n // the array should mirror the parameters below\n // note: all values past the year are optional and will default to the lowest possible value.\n // [year, month, day , hour, minute, second, millisecond]\n function configFromArray(config) {\n var i,\n date,\n input = [],\n currentDate,\n expectedWeekday,\n yearToUse;\n\n if (config._d) {\n return;\n }\n\n currentDate = currentDateArray(config);\n\n //compute day of the year from weeks and weekdays\n if (config._w && config._a[DATE] == null && config._a[MONTH] == null) {\n dayOfYearFromWeekInfo(config);\n }\n\n //if the day of the year is set, figure out what it is\n if (config._dayOfYear != null) {\n yearToUse = defaults(config._a[YEAR], currentDate[YEAR]);\n\n if (\n config._dayOfYear > daysInYear(yearToUse) ||\n config._dayOfYear === 0\n ) {\n getParsingFlags(config)._overflowDayOfYear = true;\n }\n\n date = createUTCDate(yearToUse, 0, config._dayOfYear);\n config._a[MONTH] = date.getUTCMonth();\n config._a[DATE] = date.getUTCDate();\n }\n\n // Default to current date.\n // * if no year, month, day of month are given, default to today\n // * if day of month is given, default month and year\n // * if month is given, default only year\n // * if year is given, don't default anything\n for (i = 0; i < 3 && config._a[i] == null; ++i) {\n config._a[i] = input[i] = currentDate[i];\n }\n\n // Zero out whatever was not defaulted, including time\n for (; i < 7; i++) {\n config._a[i] = input[i] =\n config._a[i] == null ? (i === 2 ? 1 : 0) : config._a[i];\n }\n\n // Check for 24:00:00.000\n if (\n config._a[HOUR] === 24 &&\n config._a[MINUTE] === 0 &&\n config._a[SECOND] === 0 &&\n config._a[MILLISECOND] === 0\n ) {\n config._nextDay = true;\n config._a[HOUR] = 0;\n }\n\n config._d = (config._useUTC ? createUTCDate : createDate).apply(\n null,\n input\n );\n expectedWeekday = config._useUTC\n ? config._d.getUTCDay()\n : config._d.getDay();\n\n // Apply timezone offset from input. The actual utcOffset can be changed\n // with parseZone.\n if (config._tzm != null) {\n config._d.setUTCMinutes(config._d.getUTCMinutes() - config._tzm);\n }\n\n if (config._nextDay) {\n config._a[HOUR] = 24;\n }\n\n // check for mismatching day of week\n if (\n config._w &&\n typeof config._w.d !== 'undefined' &&\n config._w.d !== expectedWeekday\n ) {\n getParsingFlags(config).weekdayMismatch = true;\n }\n }\n\n function dayOfYearFromWeekInfo(config) {\n var w, weekYear, week, weekday, dow, doy, temp, weekdayOverflow, curWeek;\n\n w = config._w;\n if (w.GG != null || w.W != null || w.E != null) {\n dow = 1;\n doy = 4;\n\n // TODO: We need to take the current isoWeekYear, but that depends on\n // how we interpret now (local, utc, fixed offset). So create\n // a now version of current config (take local/utc/offset flags, and\n // create now).\n weekYear = defaults(\n w.GG,\n config._a[YEAR],\n weekOfYear(createLocal(), 1, 4).year\n );\n week = defaults(w.W, 1);\n weekday = defaults(w.E, 1);\n if (weekday < 1 || weekday > 7) {\n weekdayOverflow = true;\n }\n } else {\n dow = config._locale._week.dow;\n doy = config._locale._week.doy;\n\n curWeek = weekOfYear(createLocal(), dow, doy);\n\n weekYear = defaults(w.gg, config._a[YEAR], curWeek.year);\n\n // Default to current week.\n week = defaults(w.w, curWeek.week);\n\n if (w.d != null) {\n // weekday -- low day numbers are considered next week\n weekday = w.d;\n if (weekday < 0 || weekday > 6) {\n weekdayOverflow = true;\n }\n } else if (w.e != null) {\n // local weekday -- counting starts from beginning of week\n weekday = w.e + dow;\n if (w.e < 0 || w.e > 6) {\n weekdayOverflow = true;\n }\n } else {\n // default to beginning of week\n weekday = dow;\n }\n }\n if (week < 1 || week > weeksInYear(weekYear, dow, doy)) {\n getParsingFlags(config)._overflowWeeks = true;\n } else if (weekdayOverflow != null) {\n getParsingFlags(config)._overflowWeekday = true;\n } else {\n temp = dayOfYearFromWeeks(weekYear, week, weekday, dow, doy);\n config._a[YEAR] = temp.year;\n config._dayOfYear = temp.dayOfYear;\n }\n }\n\n // constant that refers to the ISO standard\n hooks.ISO_8601 = function () {};\n\n // constant that refers to the RFC 2822 form\n hooks.RFC_2822 = function () {};\n\n // date from string and format string\n function configFromStringAndFormat(config) {\n // TODO: Move this to another part of the creation flow to prevent circular deps\n if (config._f === hooks.ISO_8601) {\n configFromISO(config);\n return;\n }\n if (config._f === hooks.RFC_2822) {\n configFromRFC2822(config);\n return;\n }\n config._a = [];\n getParsingFlags(config).empty = true;\n\n // This array is used to make a Date, either with `new Date` or `Date.UTC`\n var string = '' + config._i,\n i,\n parsedInput,\n tokens,\n token,\n skipped,\n stringLength = string.length,\n totalParsedInputLength = 0,\n era;\n\n tokens =\n expandFormat(config._f, config._locale).match(formattingTokens) || [];\n\n for (i = 0; i < tokens.length; i++) {\n token = tokens[i];\n parsedInput = (string.match(getParseRegexForToken(token, config)) ||\n [])[0];\n if (parsedInput) {\n skipped = string.substr(0, string.indexOf(parsedInput));\n if (skipped.length > 0) {\n getParsingFlags(config).unusedInput.push(skipped);\n }\n string = string.slice(\n string.indexOf(parsedInput) + parsedInput.length\n );\n totalParsedInputLength += parsedInput.length;\n }\n // don't parse if it's not a known token\n if (formatTokenFunctions[token]) {\n if (parsedInput) {\n getParsingFlags(config).empty = false;\n } else {\n getParsingFlags(config).unusedTokens.push(token);\n }\n addTimeToArrayFromToken(token, parsedInput, config);\n } else if (config._strict && !parsedInput) {\n getParsingFlags(config).unusedTokens.push(token);\n }\n }\n\n // add remaining unparsed input length to the string\n getParsingFlags(config).charsLeftOver =\n stringLength - totalParsedInputLength;\n if (string.length > 0) {\n getParsingFlags(config).unusedInput.push(string);\n }\n\n // clear _12h flag if hour is <= 12\n if (\n config._a[HOUR] <= 12 &&\n getParsingFlags(config).bigHour === true &&\n config._a[HOUR] > 0\n ) {\n getParsingFlags(config).bigHour = undefined;\n }\n\n getParsingFlags(config).parsedDateParts = config._a.slice(0);\n getParsingFlags(config).meridiem = config._meridiem;\n // handle meridiem\n config._a[HOUR] = meridiemFixWrap(\n config._locale,\n config._a[HOUR],\n config._meridiem\n );\n\n // handle era\n era = getParsingFlags(config).era;\n if (era !== null) {\n config._a[YEAR] = config._locale.erasConvertYear(era, config._a[YEAR]);\n }\n\n configFromArray(config);\n checkOverflow(config);\n }\n\n function meridiemFixWrap(locale, hour, meridiem) {\n var isPm;\n\n if (meridiem == null) {\n // nothing to do\n return hour;\n }\n if (locale.meridiemHour != null) {\n return locale.meridiemHour(hour, meridiem);\n } else if (locale.isPM != null) {\n // Fallback\n isPm = locale.isPM(meridiem);\n if (isPm && hour < 12) {\n hour += 12;\n }\n if (!isPm && hour === 12) {\n hour = 0;\n }\n return hour;\n } else {\n // this is not supposed to happen\n return hour;\n }\n }\n\n // date from string and array of format strings\n function configFromStringAndArray(config) {\n var tempConfig,\n bestMoment,\n scoreToBeat,\n i,\n currentScore,\n validFormatFound,\n bestFormatIsValid = false;\n\n if (config._f.length === 0) {\n getParsingFlags(config).invalidFormat = true;\n config._d = new Date(NaN);\n return;\n }\n\n for (i = 0; i < config._f.length; i++) {\n currentScore = 0;\n validFormatFound = false;\n tempConfig = copyConfig({}, config);\n if (config._useUTC != null) {\n tempConfig._useUTC = config._useUTC;\n }\n tempConfig._f = config._f[i];\n configFromStringAndFormat(tempConfig);\n\n if (isValid(tempConfig)) {\n validFormatFound = true;\n }\n\n // if there is any input that was not parsed add a penalty for that format\n currentScore += getParsingFlags(tempConfig).charsLeftOver;\n\n //or tokens\n currentScore += getParsingFlags(tempConfig).unusedTokens.length * 10;\n\n getParsingFlags(tempConfig).score = currentScore;\n\n if (!bestFormatIsValid) {\n if (\n scoreToBeat == null ||\n currentScore < scoreToBeat ||\n validFormatFound\n ) {\n scoreToBeat = currentScore;\n bestMoment = tempConfig;\n if (validFormatFound) {\n bestFormatIsValid = true;\n }\n }\n } else {\n if (currentScore < scoreToBeat) {\n scoreToBeat = currentScore;\n bestMoment = tempConfig;\n }\n }\n }\n\n extend(config, bestMoment || tempConfig);\n }\n\n function configFromObject(config) {\n if (config._d) {\n return;\n }\n\n var i = normalizeObjectUnits(config._i),\n dayOrDate = i.day === undefined ? i.date : i.day;\n config._a = map(\n [i.year, i.month, dayOrDate, i.hour, i.minute, i.second, i.millisecond],\n function (obj) {\n return obj && parseInt(obj, 10);\n }\n );\n\n configFromArray(config);\n }\n\n function createFromConfig(config) {\n var res = new Moment(checkOverflow(prepareConfig(config)));\n if (res._nextDay) {\n // Adding is smart enough around DST\n res.add(1, 'd');\n res._nextDay = undefined;\n }\n\n return res;\n }\n\n function prepareConfig(config) {\n var input = config._i,\n format = config._f;\n\n config._locale = config._locale || getLocale(config._l);\n\n if (input === null || (format === undefined && input === '')) {\n return createInvalid({ nullInput: true });\n }\n\n if (typeof input === 'string') {\n config._i = input = config._locale.preparse(input);\n }\n\n if (isMoment(input)) {\n return new Moment(checkOverflow(input));\n } else if (isDate(input)) {\n config._d = input;\n } else if (isArray(format)) {\n configFromStringAndArray(config);\n } else if (format) {\n configFromStringAndFormat(config);\n } else {\n configFromInput(config);\n }\n\n if (!isValid(config)) {\n config._d = null;\n }\n\n return config;\n }\n\n function configFromInput(config) {\n var input = config._i;\n if (isUndefined(input)) {\n config._d = new Date(hooks.now());\n } else if (isDate(input)) {\n config._d = new Date(input.valueOf());\n } else if (typeof input === 'string') {\n configFromString(config);\n } else if (isArray(input)) {\n config._a = map(input.slice(0), function (obj) {\n return parseInt(obj, 10);\n });\n configFromArray(config);\n } else if (isObject(input)) {\n configFromObject(config);\n } else if (isNumber(input)) {\n // from milliseconds\n config._d = new Date(input);\n } else {\n hooks.createFromInputFallback(config);\n }\n }\n\n function createLocalOrUTC(input, format, locale, strict, isUTC) {\n var c = {};\n\n if (format === true || format === false) {\n strict = format;\n format = undefined;\n }\n\n if (locale === true || locale === false) {\n strict = locale;\n locale = undefined;\n }\n\n if (\n (isObject(input) && isObjectEmpty(input)) ||\n (isArray(input) && input.length === 0)\n ) {\n input = undefined;\n }\n // object construction must be done this way.\n // https://github.com/moment/moment/issues/1423\n c._isAMomentObject = true;\n c._useUTC = c._isUTC = isUTC;\n c._l = locale;\n c._i = input;\n c._f = format;\n c._strict = strict;\n\n return createFromConfig(c);\n }\n\n function createLocal(input, format, locale, strict) {\n return createLocalOrUTC(input, format, locale, strict, false);\n }\n\n var prototypeMin = deprecate(\n 'moment().min is deprecated, use moment.max instead. http://momentjs.com/guides/#/warnings/min-max/',\n function () {\n var other = createLocal.apply(null, arguments);\n if (this.isValid() && other.isValid()) {\n return other < this ? this : other;\n } else {\n return createInvalid();\n }\n }\n ),\n prototypeMax = deprecate(\n 'moment().max is deprecated, use moment.min instead. http://momentjs.com/guides/#/warnings/min-max/',\n function () {\n var other = createLocal.apply(null, arguments);\n if (this.isValid() && other.isValid()) {\n return other > this ? this : other;\n } else {\n return createInvalid();\n }\n }\n );\n\n // Pick a moment m from moments so that m[fn](other) is true for all\n // other. This relies on the function fn to be transitive.\n //\n // moments should either be an array of moment objects or an array, whose\n // first element is an array of moment objects.\n function pickBy(fn, moments) {\n var res, i;\n if (moments.length === 1 && isArray(moments[0])) {\n moments = moments[0];\n }\n if (!moments.length) {\n return createLocal();\n }\n res = moments[0];\n for (i = 1; i < moments.length; ++i) {\n if (!moments[i].isValid() || moments[i][fn](res)) {\n res = moments[i];\n }\n }\n return res;\n }\n\n // TODO: Use [].sort instead?\n function min() {\n var args = [].slice.call(arguments, 0);\n\n return pickBy('isBefore', args);\n }\n\n function max() {\n var args = [].slice.call(arguments, 0);\n\n return pickBy('isAfter', args);\n }\n\n var now = function () {\n return Date.now ? Date.now() : +new Date();\n };\n\n var ordering = [\n 'year',\n 'quarter',\n 'month',\n 'week',\n 'day',\n 'hour',\n 'minute',\n 'second',\n 'millisecond',\n ];\n\n function isDurationValid(m) {\n var key,\n unitHasDecimal = false,\n i;\n for (key in m) {\n if (\n hasOwnProp(m, key) &&\n !(\n indexOf.call(ordering, key) !== -1 &&\n (m[key] == null || !isNaN(m[key]))\n )\n ) {\n return false;\n }\n }\n\n for (i = 0; i < ordering.length; ++i) {\n if (m[ordering[i]]) {\n if (unitHasDecimal) {\n return false; // only allow non-integers for smallest unit\n }\n if (parseFloat(m[ordering[i]]) !== toInt(m[ordering[i]])) {\n unitHasDecimal = true;\n }\n }\n }\n\n return true;\n }\n\n function isValid$1() {\n return this._isValid;\n }\n\n function createInvalid$1() {\n return createDuration(NaN);\n }\n\n function Duration(duration) {\n var normalizedInput = normalizeObjectUnits(duration),\n years = normalizedInput.year || 0,\n quarters = normalizedInput.quarter || 0,\n months = normalizedInput.month || 0,\n weeks = normalizedInput.week || normalizedInput.isoWeek || 0,\n days = normalizedInput.day || 0,\n hours = normalizedInput.hour || 0,\n minutes = normalizedInput.minute || 0,\n seconds = normalizedInput.second || 0,\n milliseconds = normalizedInput.millisecond || 0;\n\n this._isValid = isDurationValid(normalizedInput);\n\n // representation for dateAddRemove\n this._milliseconds =\n +milliseconds +\n seconds * 1e3 + // 1000\n minutes * 6e4 + // 1000 * 60\n hours * 1000 * 60 * 60; //using 1000 * 60 * 60 instead of 36e5 to avoid floating point rounding errors https://github.com/moment/moment/issues/2978\n // Because of dateAddRemove treats 24 hours as different from a\n // day when working around DST, we need to store them separately\n this._days = +days + weeks * 7;\n // It is impossible to translate months into days without knowing\n // which months you are are talking about, so we have to store\n // it separately.\n this._months = +months + quarters * 3 + years * 12;\n\n this._data = {};\n\n this._locale = getLocale();\n\n this._bubble();\n }\n\n function isDuration(obj) {\n return obj instanceof Duration;\n }\n\n function absRound(number) {\n if (number < 0) {\n return Math.round(-1 * number) * -1;\n } else {\n return Math.round(number);\n }\n }\n\n // compare two arrays, return the number of differences\n function compareArrays(array1, array2, dontConvert) {\n var len = Math.min(array1.length, array2.length),\n lengthDiff = Math.abs(array1.length - array2.length),\n diffs = 0,\n i;\n for (i = 0; i < len; i++) {\n if (\n (dontConvert && array1[i] !== array2[i]) ||\n (!dontConvert && toInt(array1[i]) !== toInt(array2[i]))\n ) {\n diffs++;\n }\n }\n return diffs + lengthDiff;\n }\n\n // FORMATTING\n\n function offset(token, separator) {\n addFormatToken(token, 0, 0, function () {\n var offset = this.utcOffset(),\n sign = '+';\n if (offset < 0) {\n offset = -offset;\n sign = '-';\n }\n return (\n sign +\n zeroFill(~~(offset / 60), 2) +\n separator +\n zeroFill(~~offset % 60, 2)\n );\n });\n }\n\n offset('Z', ':');\n offset('ZZ', '');\n\n // PARSING\n\n addRegexToken('Z', matchShortOffset);\n addRegexToken('ZZ', matchShortOffset);\n addParseToken(['Z', 'ZZ'], function (input, array, config) {\n config._useUTC = true;\n config._tzm = offsetFromString(matchShortOffset, input);\n });\n\n // HELPERS\n\n // timezone chunker\n // '+10:00' > ['10', '00']\n // '-1530' > ['-15', '30']\n var chunkOffset = /([\\+\\-]|\\d\\d)/gi;\n\n function offsetFromString(matcher, string) {\n var matches = (string || '').match(matcher),\n chunk,\n parts,\n minutes;\n\n if (matches === null) {\n return null;\n }\n\n chunk = matches[matches.length - 1] || [];\n parts = (chunk + '').match(chunkOffset) || ['-', 0, 0];\n minutes = +(parts[1] * 60) + toInt(parts[2]);\n\n return minutes === 0 ? 0 : parts[0] === '+' ? minutes : -minutes;\n }\n\n // Return a moment from input, that is local/utc/zone equivalent to model.\n function cloneWithOffset(input, model) {\n var res, diff;\n if (model._isUTC) {\n res = model.clone();\n diff =\n (isMoment(input) || isDate(input)\n ? input.valueOf()\n : createLocal(input).valueOf()) - res.valueOf();\n // Use low-level api, because this fn is low-level api.\n res._d.setTime(res._d.valueOf() + diff);\n hooks.updateOffset(res, false);\n return res;\n } else {\n return createLocal(input).local();\n }\n }\n\n function getDateOffset(m) {\n // On Firefox.24 Date#getTimezoneOffset returns a floating point.\n // https://github.com/moment/moment/pull/1871\n return -Math.round(m._d.getTimezoneOffset());\n }\n\n // HOOKS\n\n // This function will be called whenever a moment is mutated.\n // It is intended to keep the offset in sync with the timezone.\n hooks.updateOffset = function () {};\n\n // MOMENTS\n\n // keepLocalTime = true means only change the timezone, without\n // affecting the local hour. So 5:31:26 +0300 --[utcOffset(2, true)]-->\n // 5:31:26 +0200 It is possible that 5:31:26 doesn't exist with offset\n // +0200, so we adjust the time as needed, to be valid.\n //\n // Keeping the time actually adds/subtracts (one hour)\n // from the actual represented time. That is why we call updateOffset\n // a second time. In case it wants us to change the offset again\n // _changeInProgress == true case, then we have to adjust, because\n // there is no such time in the given timezone.\n function getSetOffset(input, keepLocalTime, keepMinutes) {\n var offset = this._offset || 0,\n localAdjust;\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n if (input != null) {\n if (typeof input === 'string') {\n input = offsetFromString(matchShortOffset, input);\n if (input === null) {\n return this;\n }\n } else if (Math.abs(input) < 16 && !keepMinutes) {\n input = input * 60;\n }\n if (!this._isUTC && keepLocalTime) {\n localAdjust = getDateOffset(this);\n }\n this._offset = input;\n this._isUTC = true;\n if (localAdjust != null) {\n this.add(localAdjust, 'm');\n }\n if (offset !== input) {\n if (!keepLocalTime || this._changeInProgress) {\n addSubtract(\n this,\n createDuration(input - offset, 'm'),\n 1,\n false\n );\n } else if (!this._changeInProgress) {\n this._changeInProgress = true;\n hooks.updateOffset(this, true);\n this._changeInProgress = null;\n }\n }\n return this;\n } else {\n return this._isUTC ? offset : getDateOffset(this);\n }\n }\n\n function getSetZone(input, keepLocalTime) {\n if (input != null) {\n if (typeof input !== 'string') {\n input = -input;\n }\n\n this.utcOffset(input, keepLocalTime);\n\n return this;\n } else {\n return -this.utcOffset();\n }\n }\n\n function setOffsetToUTC(keepLocalTime) {\n return this.utcOffset(0, keepLocalTime);\n }\n\n function setOffsetToLocal(keepLocalTime) {\n if (this._isUTC) {\n this.utcOffset(0, keepLocalTime);\n this._isUTC = false;\n\n if (keepLocalTime) {\n this.subtract(getDateOffset(this), 'm');\n }\n }\n return this;\n }\n\n function setOffsetToParsedOffset() {\n if (this._tzm != null) {\n this.utcOffset(this._tzm, false, true);\n } else if (typeof this._i === 'string') {\n var tZone = offsetFromString(matchOffset, this._i);\n if (tZone != null) {\n this.utcOffset(tZone);\n } else {\n this.utcOffset(0, true);\n }\n }\n return this;\n }\n\n function hasAlignedHourOffset(input) {\n if (!this.isValid()) {\n return false;\n }\n input = input ? createLocal(input).utcOffset() : 0;\n\n return (this.utcOffset() - input) % 60 === 0;\n }\n\n function isDaylightSavingTime() {\n return (\n this.utcOffset() > this.clone().month(0).utcOffset() ||\n this.utcOffset() > this.clone().month(5).utcOffset()\n );\n }\n\n function isDaylightSavingTimeShifted() {\n if (!isUndefined(this._isDSTShifted)) {\n return this._isDSTShifted;\n }\n\n var c = {},\n other;\n\n copyConfig(c, this);\n c = prepareConfig(c);\n\n if (c._a) {\n other = c._isUTC ? createUTC(c._a) : createLocal(c._a);\n this._isDSTShifted =\n this.isValid() && compareArrays(c._a, other.toArray()) > 0;\n } else {\n this._isDSTShifted = false;\n }\n\n return this._isDSTShifted;\n }\n\n function isLocal() {\n return this.isValid() ? !this._isUTC : false;\n }\n\n function isUtcOffset() {\n return this.isValid() ? this._isUTC : false;\n }\n\n function isUtc() {\n return this.isValid() ? this._isUTC && this._offset === 0 : false;\n }\n\n // ASP.NET json date format regex\n var aspNetRegex = /^(-|\\+)?(?:(\\d*)[. ])?(\\d+):(\\d+)(?::(\\d+)(\\.\\d*)?)?$/,\n // from http://docs.closure-library.googlecode.com/git/closure_goog_date_date.js.source.html\n // somewhat more in line with 4.4.3.2 2004 spec, but allows decimal anywhere\n // and further modified to allow for strings containing both week and day\n isoRegex = /^(-|\\+)?P(?:([-+]?[0-9,.]*)Y)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)W)?(?:([-+]?[0-9,.]*)D)?(?:T(?:([-+]?[0-9,.]*)H)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)S)?)?$/;\n\n function createDuration(input, key) {\n var duration = input,\n // matching against regexp is expensive, do it on demand\n match = null,\n sign,\n ret,\n diffRes;\n\n if (isDuration(input)) {\n duration = {\n ms: input._milliseconds,\n d: input._days,\n M: input._months,\n };\n } else if (isNumber(input) || !isNaN(+input)) {\n duration = {};\n if (key) {\n duration[key] = +input;\n } else {\n duration.milliseconds = +input;\n }\n } else if ((match = aspNetRegex.exec(input))) {\n sign = match[1] === '-' ? -1 : 1;\n duration = {\n y: 0,\n d: toInt(match[DATE]) * sign,\n h: toInt(match[HOUR]) * sign,\n m: toInt(match[MINUTE]) * sign,\n s: toInt(match[SECOND]) * sign,\n ms: toInt(absRound(match[MILLISECOND] * 1000)) * sign, // the millisecond decimal point is included in the match\n };\n } else if ((match = isoRegex.exec(input))) {\n sign = match[1] === '-' ? -1 : 1;\n duration = {\n y: parseIso(match[2], sign),\n M: parseIso(match[3], sign),\n w: parseIso(match[4], sign),\n d: parseIso(match[5], sign),\n h: parseIso(match[6], sign),\n m: parseIso(match[7], sign),\n s: parseIso(match[8], sign),\n };\n } else if (duration == null) {\n // checks for null or undefined\n duration = {};\n } else if (\n typeof duration === 'object' &&\n ('from' in duration || 'to' in duration)\n ) {\n diffRes = momentsDifference(\n createLocal(duration.from),\n createLocal(duration.to)\n );\n\n duration = {};\n duration.ms = diffRes.milliseconds;\n duration.M = diffRes.months;\n }\n\n ret = new Duration(duration);\n\n if (isDuration(input) && hasOwnProp(input, '_locale')) {\n ret._locale = input._locale;\n }\n\n if (isDuration(input) && hasOwnProp(input, '_isValid')) {\n ret._isValid = input._isValid;\n }\n\n return ret;\n }\n\n createDuration.fn = Duration.prototype;\n createDuration.invalid = createInvalid$1;\n\n function parseIso(inp, sign) {\n // We'd normally use ~~inp for this, but unfortunately it also\n // converts floats to ints.\n // inp may be undefined, so careful calling replace on it.\n var res = inp && parseFloat(inp.replace(',', '.'));\n // apply sign while we're at it\n return (isNaN(res) ? 0 : res) * sign;\n }\n\n function positiveMomentsDifference(base, other) {\n var res = {};\n\n res.months =\n other.month() - base.month() + (other.year() - base.year()) * 12;\n if (base.clone().add(res.months, 'M').isAfter(other)) {\n --res.months;\n }\n\n res.milliseconds = +other - +base.clone().add(res.months, 'M');\n\n return res;\n }\n\n function momentsDifference(base, other) {\n var res;\n if (!(base.isValid() && other.isValid())) {\n return { milliseconds: 0, months: 0 };\n }\n\n other = cloneWithOffset(other, base);\n if (base.isBefore(other)) {\n res = positiveMomentsDifference(base, other);\n } else {\n res = positiveMomentsDifference(other, base);\n res.milliseconds = -res.milliseconds;\n res.months = -res.months;\n }\n\n return res;\n }\n\n // TODO: remove 'name' arg after deprecation is removed\n function createAdder(direction, name) {\n return function (val, period) {\n var dur, tmp;\n //invert the arguments, but complain about it\n if (period !== null && !isNaN(+period)) {\n deprecateSimple(\n name,\n 'moment().' +\n name +\n '(period, number) is deprecated. Please use moment().' +\n name +\n '(number, period). ' +\n 'See http://momentjs.com/guides/#/warnings/add-inverted-param/ for more info.'\n );\n tmp = val;\n val = period;\n period = tmp;\n }\n\n dur = createDuration(val, period);\n addSubtract(this, dur, direction);\n return this;\n };\n }\n\n function addSubtract(mom, duration, isAdding, updateOffset) {\n var milliseconds = duration._milliseconds,\n days = absRound(duration._days),\n months = absRound(duration._months);\n\n if (!mom.isValid()) {\n // No op\n return;\n }\n\n updateOffset = updateOffset == null ? true : updateOffset;\n\n if (months) {\n setMonth(mom, get(mom, 'Month') + months * isAdding);\n }\n if (days) {\n set$1(mom, 'Date', get(mom, 'Date') + days * isAdding);\n }\n if (milliseconds) {\n mom._d.setTime(mom._d.valueOf() + milliseconds * isAdding);\n }\n if (updateOffset) {\n hooks.updateOffset(mom, days || months);\n }\n }\n\n var add = createAdder(1, 'add'),\n subtract = createAdder(-1, 'subtract');\n\n function isString(input) {\n return typeof input === 'string' || input instanceof String;\n }\n\n // type MomentInput = Moment | Date | string | number | (number | string)[] | MomentInputObject | void; // null | undefined\n function isMomentInput(input) {\n return (\n isMoment(input) ||\n isDate(input) ||\n isString(input) ||\n isNumber(input) ||\n isNumberOrStringArray(input) ||\n isMomentInputObject(input) ||\n input === null ||\n input === undefined\n );\n }\n\n function isMomentInputObject(input) {\n var objectTest = isObject(input) && !isObjectEmpty(input),\n propertyTest = false,\n properties = [\n 'years',\n 'year',\n 'y',\n 'months',\n 'month',\n 'M',\n 'days',\n 'day',\n 'd',\n 'dates',\n 'date',\n 'D',\n 'hours',\n 'hour',\n 'h',\n 'minutes',\n 'minute',\n 'm',\n 'seconds',\n 'second',\n 's',\n 'milliseconds',\n 'millisecond',\n 'ms',\n ],\n i,\n property;\n\n for (i = 0; i < properties.length; i += 1) {\n property = properties[i];\n propertyTest = propertyTest || hasOwnProp(input, property);\n }\n\n return objectTest && propertyTest;\n }\n\n function isNumberOrStringArray(input) {\n var arrayTest = isArray(input),\n dataTypeTest = false;\n if (arrayTest) {\n dataTypeTest =\n input.filter(function (item) {\n return !isNumber(item) && isString(input);\n }).length === 0;\n }\n return arrayTest && dataTypeTest;\n }\n\n function isCalendarSpec(input) {\n var objectTest = isObject(input) && !isObjectEmpty(input),\n propertyTest = false,\n properties = [\n 'sameDay',\n 'nextDay',\n 'lastDay',\n 'nextWeek',\n 'lastWeek',\n 'sameElse',\n ],\n i,\n property;\n\n for (i = 0; i < properties.length; i += 1) {\n property = properties[i];\n propertyTest = propertyTest || hasOwnProp(input, property);\n }\n\n return objectTest && propertyTest;\n }\n\n function getCalendarFormat(myMoment, now) {\n var diff = myMoment.diff(now, 'days', true);\n return diff < -6\n ? 'sameElse'\n : diff < -1\n ? 'lastWeek'\n : diff < 0\n ? 'lastDay'\n : diff < 1\n ? 'sameDay'\n : diff < 2\n ? 'nextDay'\n : diff < 7\n ? 'nextWeek'\n : 'sameElse';\n }\n\n function calendar$1(time, formats) {\n // Support for single parameter, formats only overload to the calendar function\n if (arguments.length === 1) {\n if (!arguments[0]) {\n time = undefined;\n formats = undefined;\n } else if (isMomentInput(arguments[0])) {\n time = arguments[0];\n formats = undefined;\n } else if (isCalendarSpec(arguments[0])) {\n formats = arguments[0];\n time = undefined;\n }\n }\n // We want to compare the start of today, vs this.\n // Getting start-of-today depends on whether we're local/utc/offset or not.\n var now = time || createLocal(),\n sod = cloneWithOffset(now, this).startOf('day'),\n format = hooks.calendarFormat(this, sod) || 'sameElse',\n output =\n formats &&\n (isFunction(formats[format])\n ? formats[format].call(this, now)\n : formats[format]);\n\n return this.format(\n output || this.localeData().calendar(format, this, createLocal(now))\n );\n }\n\n function clone() {\n return new Moment(this);\n }\n\n function isAfter(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input);\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() > localInput.valueOf();\n } else {\n return localInput.valueOf() < this.clone().startOf(units).valueOf();\n }\n }\n\n function isBefore(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input);\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() < localInput.valueOf();\n } else {\n return this.clone().endOf(units).valueOf() < localInput.valueOf();\n }\n }\n\n function isBetween(from, to, units, inclusivity) {\n var localFrom = isMoment(from) ? from : createLocal(from),\n localTo = isMoment(to) ? to : createLocal(to);\n if (!(this.isValid() && localFrom.isValid() && localTo.isValid())) {\n return false;\n }\n inclusivity = inclusivity || '()';\n return (\n (inclusivity[0] === '('\n ? this.isAfter(localFrom, units)\n : !this.isBefore(localFrom, units)) &&\n (inclusivity[1] === ')'\n ? this.isBefore(localTo, units)\n : !this.isAfter(localTo, units))\n );\n }\n\n function isSame(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input),\n inputMs;\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() === localInput.valueOf();\n } else {\n inputMs = localInput.valueOf();\n return (\n this.clone().startOf(units).valueOf() <= inputMs &&\n inputMs <= this.clone().endOf(units).valueOf()\n );\n }\n }\n\n function isSameOrAfter(input, units) {\n return this.isSame(input, units) || this.isAfter(input, units);\n }\n\n function isSameOrBefore(input, units) {\n return this.isSame(input, units) || this.isBefore(input, units);\n }\n\n function diff(input, units, asFloat) {\n var that, zoneDelta, output;\n\n if (!this.isValid()) {\n return NaN;\n }\n\n that = cloneWithOffset(input, this);\n\n if (!that.isValid()) {\n return NaN;\n }\n\n zoneDelta = (that.utcOffset() - this.utcOffset()) * 6e4;\n\n units = normalizeUnits(units);\n\n switch (units) {\n case 'year':\n output = monthDiff(this, that) / 12;\n break;\n case 'month':\n output = monthDiff(this, that);\n break;\n case 'quarter':\n output = monthDiff(this, that) / 3;\n break;\n case 'second':\n output = (this - that) / 1e3;\n break; // 1000\n case 'minute':\n output = (this - that) / 6e4;\n break; // 1000 * 60\n case 'hour':\n output = (this - that) / 36e5;\n break; // 1000 * 60 * 60\n case 'day':\n output = (this - that - zoneDelta) / 864e5;\n break; // 1000 * 60 * 60 * 24, negate dst\n case 'week':\n output = (this - that - zoneDelta) / 6048e5;\n break; // 1000 * 60 * 60 * 24 * 7, negate dst\n default:\n output = this - that;\n }\n\n return asFloat ? output : absFloor(output);\n }\n\n function monthDiff(a, b) {\n if (a.date() < b.date()) {\n // end-of-month calculations work correct when the start month has more\n // days than the end month.\n return -monthDiff(b, a);\n }\n // difference in months\n var wholeMonthDiff = (b.year() - a.year()) * 12 + (b.month() - a.month()),\n // b is in (anchor - 1 month, anchor + 1 month)\n anchor = a.clone().add(wholeMonthDiff, 'months'),\n anchor2,\n adjust;\n\n if (b - anchor < 0) {\n anchor2 = a.clone().add(wholeMonthDiff - 1, 'months');\n // linear across the month\n adjust = (b - anchor) / (anchor - anchor2);\n } else {\n anchor2 = a.clone().add(wholeMonthDiff + 1, 'months');\n // linear across the month\n adjust = (b - anchor) / (anchor2 - anchor);\n }\n\n //check for negative zero, return zero if negative zero\n return -(wholeMonthDiff + adjust) || 0;\n }\n\n hooks.defaultFormat = 'YYYY-MM-DDTHH:mm:ssZ';\n hooks.defaultFormatUtc = 'YYYY-MM-DDTHH:mm:ss[Z]';\n\n function toString() {\n return this.clone().locale('en').format('ddd MMM DD YYYY HH:mm:ss [GMT]ZZ');\n }\n\n function toISOString(keepOffset) {\n if (!this.isValid()) {\n return null;\n }\n var utc = keepOffset !== true,\n m = utc ? this.clone().utc() : this;\n if (m.year() < 0 || m.year() > 9999) {\n return formatMoment(\n m,\n utc\n ? 'YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]'\n : 'YYYYYY-MM-DD[T]HH:mm:ss.SSSZ'\n );\n }\n if (isFunction(Date.prototype.toISOString)) {\n // native implementation is ~50x faster, use it when we can\n if (utc) {\n return this.toDate().toISOString();\n } else {\n return new Date(this.valueOf() + this.utcOffset() * 60 * 1000)\n .toISOString()\n .replace('Z', formatMoment(m, 'Z'));\n }\n }\n return formatMoment(\n m,\n utc ? 'YYYY-MM-DD[T]HH:mm:ss.SSS[Z]' : 'YYYY-MM-DD[T]HH:mm:ss.SSSZ'\n );\n }\n\n /**\n * Return a human readable representation of a moment that can\n * also be evaluated to get a new moment which is the same\n *\n * @link https://nodejs.org/dist/latest/docs/api/util.html#util_custom_inspect_function_on_objects\n */\n function inspect() {\n if (!this.isValid()) {\n return 'moment.invalid(/* ' + this._i + ' */)';\n }\n var func = 'moment',\n zone = '',\n prefix,\n year,\n datetime,\n suffix;\n if (!this.isLocal()) {\n func = this.utcOffset() === 0 ? 'moment.utc' : 'moment.parseZone';\n zone = 'Z';\n }\n prefix = '[' + func + '(\"]';\n year = 0 <= this.year() && this.year() <= 9999 ? 'YYYY' : 'YYYYYY';\n datetime = '-MM-DD[T]HH:mm:ss.SSS';\n suffix = zone + '[\")]';\n\n return this.format(prefix + year + datetime + suffix);\n }\n\n function format(inputString) {\n if (!inputString) {\n inputString = this.isUtc()\n ? hooks.defaultFormatUtc\n : hooks.defaultFormat;\n }\n var output = formatMoment(this, inputString);\n return this.localeData().postformat(output);\n }\n\n function from(time, withoutSuffix) {\n if (\n this.isValid() &&\n ((isMoment(time) && time.isValid()) || createLocal(time).isValid())\n ) {\n return createDuration({ to: this, from: time })\n .locale(this.locale())\n .humanize(!withoutSuffix);\n } else {\n return this.localeData().invalidDate();\n }\n }\n\n function fromNow(withoutSuffix) {\n return this.from(createLocal(), withoutSuffix);\n }\n\n function to(time, withoutSuffix) {\n if (\n this.isValid() &&\n ((isMoment(time) && time.isValid()) || createLocal(time).isValid())\n ) {\n return createDuration({ from: this, to: time })\n .locale(this.locale())\n .humanize(!withoutSuffix);\n } else {\n return this.localeData().invalidDate();\n }\n }\n\n function toNow(withoutSuffix) {\n return this.to(createLocal(), withoutSuffix);\n }\n\n // If passed a locale key, it will set the locale for this\n // instance. Otherwise, it will return the locale configuration\n // variables for this instance.\n function locale(key) {\n var newLocaleData;\n\n if (key === undefined) {\n return this._locale._abbr;\n } else {\n newLocaleData = getLocale(key);\n if (newLocaleData != null) {\n this._locale = newLocaleData;\n }\n return this;\n }\n }\n\n var lang = deprecate(\n 'moment().lang() is deprecated. Instead, use moment().localeData() to get the language configuration. Use moment().locale() to change languages.',\n function (key) {\n if (key === undefined) {\n return this.localeData();\n } else {\n return this.locale(key);\n }\n }\n );\n\n function localeData() {\n return this._locale;\n }\n\n var MS_PER_SECOND = 1000,\n MS_PER_MINUTE = 60 * MS_PER_SECOND,\n MS_PER_HOUR = 60 * MS_PER_MINUTE,\n MS_PER_400_YEARS = (365 * 400 + 97) * 24 * MS_PER_HOUR;\n\n // actual modulo - handles negative numbers (for dates before 1970):\n function mod$1(dividend, divisor) {\n return ((dividend % divisor) + divisor) % divisor;\n }\n\n function localStartOfDate(y, m, d) {\n // the date constructor remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n return new Date(y + 400, m, d) - MS_PER_400_YEARS;\n } else {\n return new Date(y, m, d).valueOf();\n }\n }\n\n function utcStartOfDate(y, m, d) {\n // Date.UTC remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n return Date.UTC(y + 400, m, d) - MS_PER_400_YEARS;\n } else {\n return Date.UTC(y, m, d);\n }\n }\n\n function startOf(units) {\n var time, startOfDate;\n units = normalizeUnits(units);\n if (units === undefined || units === 'millisecond' || !this.isValid()) {\n return this;\n }\n\n startOfDate = this._isUTC ? utcStartOfDate : localStartOfDate;\n\n switch (units) {\n case 'year':\n time = startOfDate(this.year(), 0, 1);\n break;\n case 'quarter':\n time = startOfDate(\n this.year(),\n this.month() - (this.month() % 3),\n 1\n );\n break;\n case 'month':\n time = startOfDate(this.year(), this.month(), 1);\n break;\n case 'week':\n time = startOfDate(\n this.year(),\n this.month(),\n this.date() - this.weekday()\n );\n break;\n case 'isoWeek':\n time = startOfDate(\n this.year(),\n this.month(),\n this.date() - (this.isoWeekday() - 1)\n );\n break;\n case 'day':\n case 'date':\n time = startOfDate(this.year(), this.month(), this.date());\n break;\n case 'hour':\n time = this._d.valueOf();\n time -= mod$1(\n time + (this._isUTC ? 0 : this.utcOffset() * MS_PER_MINUTE),\n MS_PER_HOUR\n );\n break;\n case 'minute':\n time = this._d.valueOf();\n time -= mod$1(time, MS_PER_MINUTE);\n break;\n case 'second':\n time = this._d.valueOf();\n time -= mod$1(time, MS_PER_SECOND);\n break;\n }\n\n this._d.setTime(time);\n hooks.updateOffset(this, true);\n return this;\n }\n\n function endOf(units) {\n var time, startOfDate;\n units = normalizeUnits(units);\n if (units === undefined || units === 'millisecond' || !this.isValid()) {\n return this;\n }\n\n startOfDate = this._isUTC ? utcStartOfDate : localStartOfDate;\n\n switch (units) {\n case 'year':\n time = startOfDate(this.year() + 1, 0, 1) - 1;\n break;\n case 'quarter':\n time =\n startOfDate(\n this.year(),\n this.month() - (this.month() % 3) + 3,\n 1\n ) - 1;\n break;\n case 'month':\n time = startOfDate(this.year(), this.month() + 1, 1) - 1;\n break;\n case 'week':\n time =\n startOfDate(\n this.year(),\n this.month(),\n this.date() - this.weekday() + 7\n ) - 1;\n break;\n case 'isoWeek':\n time =\n startOfDate(\n this.year(),\n this.month(),\n this.date() - (this.isoWeekday() - 1) + 7\n ) - 1;\n break;\n case 'day':\n case 'date':\n time = startOfDate(this.year(), this.month(), this.date() + 1) - 1;\n break;\n case 'hour':\n time = this._d.valueOf();\n time +=\n MS_PER_HOUR -\n mod$1(\n time + (this._isUTC ? 0 : this.utcOffset() * MS_PER_MINUTE),\n MS_PER_HOUR\n ) -\n 1;\n break;\n case 'minute':\n time = this._d.valueOf();\n time += MS_PER_MINUTE - mod$1(time, MS_PER_MINUTE) - 1;\n break;\n case 'second':\n time = this._d.valueOf();\n time += MS_PER_SECOND - mod$1(time, MS_PER_SECOND) - 1;\n break;\n }\n\n this._d.setTime(time);\n hooks.updateOffset(this, true);\n return this;\n }\n\n function valueOf() {\n return this._d.valueOf() - (this._offset || 0) * 60000;\n }\n\n function unix() {\n return Math.floor(this.valueOf() / 1000);\n }\n\n function toDate() {\n return new Date(this.valueOf());\n }\n\n function toArray() {\n var m = this;\n return [\n m.year(),\n m.month(),\n m.date(),\n m.hour(),\n m.minute(),\n m.second(),\n m.millisecond(),\n ];\n }\n\n function toObject() {\n var m = this;\n return {\n years: m.year(),\n months: m.month(),\n date: m.date(),\n hours: m.hours(),\n minutes: m.minutes(),\n seconds: m.seconds(),\n milliseconds: m.milliseconds(),\n };\n }\n\n function toJSON() {\n // new Date(NaN).toJSON() === null\n return this.isValid() ? this.toISOString() : null;\n }\n\n function isValid$2() {\n return isValid(this);\n }\n\n function parsingFlags() {\n return extend({}, getParsingFlags(this));\n }\n\n function invalidAt() {\n return getParsingFlags(this).overflow;\n }\n\n function creationData() {\n return {\n input: this._i,\n format: this._f,\n locale: this._locale,\n isUTC: this._isUTC,\n strict: this._strict,\n };\n }\n\n addFormatToken('N', 0, 0, 'eraAbbr');\n addFormatToken('NN', 0, 0, 'eraAbbr');\n addFormatToken('NNN', 0, 0, 'eraAbbr');\n addFormatToken('NNNN', 0, 0, 'eraName');\n addFormatToken('NNNNN', 0, 0, 'eraNarrow');\n\n addFormatToken('y', ['y', 1], 'yo', 'eraYear');\n addFormatToken('y', ['yy', 2], 0, 'eraYear');\n addFormatToken('y', ['yyy', 3], 0, 'eraYear');\n addFormatToken('y', ['yyyy', 4], 0, 'eraYear');\n\n addRegexToken('N', matchEraAbbr);\n addRegexToken('NN', matchEraAbbr);\n addRegexToken('NNN', matchEraAbbr);\n addRegexToken('NNNN', matchEraName);\n addRegexToken('NNNNN', matchEraNarrow);\n\n addParseToken(['N', 'NN', 'NNN', 'NNNN', 'NNNNN'], function (\n input,\n array,\n config,\n token\n ) {\n var era = config._locale.erasParse(input, token, config._strict);\n if (era) {\n getParsingFlags(config).era = era;\n } else {\n getParsingFlags(config).invalidEra = input;\n }\n });\n\n addRegexToken('y', matchUnsigned);\n addRegexToken('yy', matchUnsigned);\n addRegexToken('yyy', matchUnsigned);\n addRegexToken('yyyy', matchUnsigned);\n addRegexToken('yo', matchEraYearOrdinal);\n\n addParseToken(['y', 'yy', 'yyy', 'yyyy'], YEAR);\n addParseToken(['yo'], function (input, array, config, token) {\n var match;\n if (config._locale._eraYearOrdinalRegex) {\n match = input.match(config._locale._eraYearOrdinalRegex);\n }\n\n if (config._locale.eraYearOrdinalParse) {\n array[YEAR] = config._locale.eraYearOrdinalParse(input, match);\n } else {\n array[YEAR] = parseInt(input, 10);\n }\n });\n\n function localeEras(m, format) {\n var i,\n l,\n date,\n eras = this._eras || getLocale('en')._eras;\n for (i = 0, l = eras.length; i < l; ++i) {\n switch (typeof eras[i].since) {\n case 'string':\n // truncate time\n date = hooks(eras[i].since).startOf('day');\n eras[i].since = date.valueOf();\n break;\n }\n\n switch (typeof eras[i].until) {\n case 'undefined':\n eras[i].until = +Infinity;\n break;\n case 'string':\n // truncate time\n date = hooks(eras[i].until).startOf('day').valueOf();\n eras[i].until = date.valueOf();\n break;\n }\n }\n return eras;\n }\n\n function localeErasParse(eraName, format, strict) {\n var i,\n l,\n eras = this.eras(),\n name,\n abbr,\n narrow;\n eraName = eraName.toUpperCase();\n\n for (i = 0, l = eras.length; i < l; ++i) {\n name = eras[i].name.toUpperCase();\n abbr = eras[i].abbr.toUpperCase();\n narrow = eras[i].narrow.toUpperCase();\n\n if (strict) {\n switch (format) {\n case 'N':\n case 'NN':\n case 'NNN':\n if (abbr === eraName) {\n return eras[i];\n }\n break;\n\n case 'NNNN':\n if (name === eraName) {\n return eras[i];\n }\n break;\n\n case 'NNNNN':\n if (narrow === eraName) {\n return eras[i];\n }\n break;\n }\n } else if ([name, abbr, narrow].indexOf(eraName) >= 0) {\n return eras[i];\n }\n }\n }\n\n function localeErasConvertYear(era, year) {\n var dir = era.since <= era.until ? +1 : -1;\n if (year === undefined) {\n return hooks(era.since).year();\n } else {\n return hooks(era.since).year() + (year - era.offset) * dir;\n }\n }\n\n function getEraName() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].name;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].name;\n }\n }\n\n return '';\n }\n\n function getEraNarrow() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].narrow;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].narrow;\n }\n }\n\n return '';\n }\n\n function getEraAbbr() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].abbr;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].abbr;\n }\n }\n\n return '';\n }\n\n function getEraYear() {\n var i,\n l,\n dir,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n dir = eras[i].since <= eras[i].until ? +1 : -1;\n\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (\n (eras[i].since <= val && val <= eras[i].until) ||\n (eras[i].until <= val && val <= eras[i].since)\n ) {\n return (\n (this.year() - hooks(eras[i].since).year()) * dir +\n eras[i].offset\n );\n }\n }\n\n return this.year();\n }\n\n function erasNameRegex(isStrict) {\n if (!hasOwnProp(this, '_erasNameRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasNameRegex : this._erasRegex;\n }\n\n function erasAbbrRegex(isStrict) {\n if (!hasOwnProp(this, '_erasAbbrRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasAbbrRegex : this._erasRegex;\n }\n\n function erasNarrowRegex(isStrict) {\n if (!hasOwnProp(this, '_erasNarrowRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasNarrowRegex : this._erasRegex;\n }\n\n function matchEraAbbr(isStrict, locale) {\n return locale.erasAbbrRegex(isStrict);\n }\n\n function matchEraName(isStrict, locale) {\n return locale.erasNameRegex(isStrict);\n }\n\n function matchEraNarrow(isStrict, locale) {\n return locale.erasNarrowRegex(isStrict);\n }\n\n function matchEraYearOrdinal(isStrict, locale) {\n return locale._eraYearOrdinalRegex || matchUnsigned;\n }\n\n function computeErasParse() {\n var abbrPieces = [],\n namePieces = [],\n narrowPieces = [],\n mixedPieces = [],\n i,\n l,\n eras = this.eras();\n\n for (i = 0, l = eras.length; i < l; ++i) {\n namePieces.push(regexEscape(eras[i].name));\n abbrPieces.push(regexEscape(eras[i].abbr));\n narrowPieces.push(regexEscape(eras[i].narrow));\n\n mixedPieces.push(regexEscape(eras[i].name));\n mixedPieces.push(regexEscape(eras[i].abbr));\n mixedPieces.push(regexEscape(eras[i].narrow));\n }\n\n this._erasRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._erasNameRegex = new RegExp('^(' + namePieces.join('|') + ')', 'i');\n this._erasAbbrRegex = new RegExp('^(' + abbrPieces.join('|') + ')', 'i');\n this._erasNarrowRegex = new RegExp(\n '^(' + narrowPieces.join('|') + ')',\n 'i'\n );\n }\n\n // FORMATTING\n\n addFormatToken(0, ['gg', 2], 0, function () {\n return this.weekYear() % 100;\n });\n\n addFormatToken(0, ['GG', 2], 0, function () {\n return this.isoWeekYear() % 100;\n });\n\n function addWeekYearFormatToken(token, getter) {\n addFormatToken(0, [token, token.length], 0, getter);\n }\n\n addWeekYearFormatToken('gggg', 'weekYear');\n addWeekYearFormatToken('ggggg', 'weekYear');\n addWeekYearFormatToken('GGGG', 'isoWeekYear');\n addWeekYearFormatToken('GGGGG', 'isoWeekYear');\n\n // ALIASES\n\n addUnitAlias('weekYear', 'gg');\n addUnitAlias('isoWeekYear', 'GG');\n\n // PRIORITY\n\n addUnitPriority('weekYear', 1);\n addUnitPriority('isoWeekYear', 1);\n\n // PARSING\n\n addRegexToken('G', matchSigned);\n addRegexToken('g', matchSigned);\n addRegexToken('GG', match1to2, match2);\n addRegexToken('gg', match1to2, match2);\n addRegexToken('GGGG', match1to4, match4);\n addRegexToken('gggg', match1to4, match4);\n addRegexToken('GGGGG', match1to6, match6);\n addRegexToken('ggggg', match1to6, match6);\n\n addWeekParseToken(['gggg', 'ggggg', 'GGGG', 'GGGGG'], function (\n input,\n week,\n config,\n token\n ) {\n week[token.substr(0, 2)] = toInt(input);\n });\n\n addWeekParseToken(['gg', 'GG'], function (input, week, config, token) {\n week[token] = hooks.parseTwoDigitYear(input);\n });\n\n // MOMENTS\n\n function getSetWeekYear(input) {\n return getSetWeekYearHelper.call(\n this,\n input,\n this.week(),\n this.weekday(),\n this.localeData()._week.dow,\n this.localeData()._week.doy\n );\n }\n\n function getSetISOWeekYear(input) {\n return getSetWeekYearHelper.call(\n this,\n input,\n this.isoWeek(),\n this.isoWeekday(),\n 1,\n 4\n );\n }\n\n function getISOWeeksInYear() {\n return weeksInYear(this.year(), 1, 4);\n }\n\n function getISOWeeksInISOWeekYear() {\n return weeksInYear(this.isoWeekYear(), 1, 4);\n }\n\n function getWeeksInYear() {\n var weekInfo = this.localeData()._week;\n return weeksInYear(this.year(), weekInfo.dow, weekInfo.doy);\n }\n\n function getWeeksInWeekYear() {\n var weekInfo = this.localeData()._week;\n return weeksInYear(this.weekYear(), weekInfo.dow, weekInfo.doy);\n }\n\n function getSetWeekYearHelper(input, week, weekday, dow, doy) {\n var weeksTarget;\n if (input == null) {\n return weekOfYear(this, dow, doy).year;\n } else {\n weeksTarget = weeksInYear(input, dow, doy);\n if (week > weeksTarget) {\n week = weeksTarget;\n }\n return setWeekAll.call(this, input, week, weekday, dow, doy);\n }\n }\n\n function setWeekAll(weekYear, week, weekday, dow, doy) {\n var dayOfYearData = dayOfYearFromWeeks(weekYear, week, weekday, dow, doy),\n date = createUTCDate(dayOfYearData.year, 0, dayOfYearData.dayOfYear);\n\n this.year(date.getUTCFullYear());\n this.month(date.getUTCMonth());\n this.date(date.getUTCDate());\n return this;\n }\n\n // FORMATTING\n\n addFormatToken('Q', 0, 'Qo', 'quarter');\n\n // ALIASES\n\n addUnitAlias('quarter', 'Q');\n\n // PRIORITY\n\n addUnitPriority('quarter', 7);\n\n // PARSING\n\n addRegexToken('Q', match1);\n addParseToken('Q', function (input, array) {\n array[MONTH] = (toInt(input) - 1) * 3;\n });\n\n // MOMENTS\n\n function getSetQuarter(input) {\n return input == null\n ? Math.ceil((this.month() + 1) / 3)\n : this.month((input - 1) * 3 + (this.month() % 3));\n }\n\n // FORMATTING\n\n addFormatToken('D', ['DD', 2], 'Do', 'date');\n\n // ALIASES\n\n addUnitAlias('date', 'D');\n\n // PRIORITY\n addUnitPriority('date', 9);\n\n // PARSING\n\n addRegexToken('D', match1to2);\n addRegexToken('DD', match1to2, match2);\n addRegexToken('Do', function (isStrict, locale) {\n // TODO: Remove \"ordinalParse\" fallback in next major release.\n return isStrict\n ? locale._dayOfMonthOrdinalParse || locale._ordinalParse\n : locale._dayOfMonthOrdinalParseLenient;\n });\n\n addParseToken(['D', 'DD'], DATE);\n addParseToken('Do', function (input, array) {\n array[DATE] = toInt(input.match(match1to2)[0]);\n });\n\n // MOMENTS\n\n var getSetDayOfMonth = makeGetSet('Date', true);\n\n // FORMATTING\n\n addFormatToken('DDD', ['DDDD', 3], 'DDDo', 'dayOfYear');\n\n // ALIASES\n\n addUnitAlias('dayOfYear', 'DDD');\n\n // PRIORITY\n addUnitPriority('dayOfYear', 4);\n\n // PARSING\n\n addRegexToken('DDD', match1to3);\n addRegexToken('DDDD', match3);\n addParseToken(['DDD', 'DDDD'], function (input, array, config) {\n config._dayOfYear = toInt(input);\n });\n\n // HELPERS\n\n // MOMENTS\n\n function getSetDayOfYear(input) {\n var dayOfYear =\n Math.round(\n (this.clone().startOf('day') - this.clone().startOf('year')) / 864e5\n ) + 1;\n return input == null ? dayOfYear : this.add(input - dayOfYear, 'd');\n }\n\n // FORMATTING\n\n addFormatToken('m', ['mm', 2], 0, 'minute');\n\n // ALIASES\n\n addUnitAlias('minute', 'm');\n\n // PRIORITY\n\n addUnitPriority('minute', 14);\n\n // PARSING\n\n addRegexToken('m', match1to2);\n addRegexToken('mm', match1to2, match2);\n addParseToken(['m', 'mm'], MINUTE);\n\n // MOMENTS\n\n var getSetMinute = makeGetSet('Minutes', false);\n\n // FORMATTING\n\n addFormatToken('s', ['ss', 2], 0, 'second');\n\n // ALIASES\n\n addUnitAlias('second', 's');\n\n // PRIORITY\n\n addUnitPriority('second', 15);\n\n // PARSING\n\n addRegexToken('s', match1to2);\n addRegexToken('ss', match1to2, match2);\n addParseToken(['s', 'ss'], SECOND);\n\n // MOMENTS\n\n var getSetSecond = makeGetSet('Seconds', false);\n\n // FORMATTING\n\n addFormatToken('S', 0, 0, function () {\n return ~~(this.millisecond() / 100);\n });\n\n addFormatToken(0, ['SS', 2], 0, function () {\n return ~~(this.millisecond() / 10);\n });\n\n addFormatToken(0, ['SSS', 3], 0, 'millisecond');\n addFormatToken(0, ['SSSS', 4], 0, function () {\n return this.millisecond() * 10;\n });\n addFormatToken(0, ['SSSSS', 5], 0, function () {\n return this.millisecond() * 100;\n });\n addFormatToken(0, ['SSSSSS', 6], 0, function () {\n return this.millisecond() * 1000;\n });\n addFormatToken(0, ['SSSSSSS', 7], 0, function () {\n return this.millisecond() * 10000;\n });\n addFormatToken(0, ['SSSSSSSS', 8], 0, function () {\n return this.millisecond() * 100000;\n });\n addFormatToken(0, ['SSSSSSSSS', 9], 0, function () {\n return this.millisecond() * 1000000;\n });\n\n // ALIASES\n\n addUnitAlias('millisecond', 'ms');\n\n // PRIORITY\n\n addUnitPriority('millisecond', 16);\n\n // PARSING\n\n addRegexToken('S', match1to3, match1);\n addRegexToken('SS', match1to3, match2);\n addRegexToken('SSS', match1to3, match3);\n\n var token, getSetMillisecond;\n for (token = 'SSSS'; token.length <= 9; token += 'S') {\n addRegexToken(token, matchUnsigned);\n }\n\n function parseMs(input, array) {\n array[MILLISECOND] = toInt(('0.' + input) * 1000);\n }\n\n for (token = 'S'; token.length <= 9; token += 'S') {\n addParseToken(token, parseMs);\n }\n\n getSetMillisecond = makeGetSet('Milliseconds', false);\n\n // FORMATTING\n\n addFormatToken('z', 0, 0, 'zoneAbbr');\n addFormatToken('zz', 0, 0, 'zoneName');\n\n // MOMENTS\n\n function getZoneAbbr() {\n return this._isUTC ? 'UTC' : '';\n }\n\n function getZoneName() {\n return this._isUTC ? 'Coordinated Universal Time' : '';\n }\n\n var proto = Moment.prototype;\n\n proto.add = add;\n proto.calendar = calendar$1;\n proto.clone = clone;\n proto.diff = diff;\n proto.endOf = endOf;\n proto.format = format;\n proto.from = from;\n proto.fromNow = fromNow;\n proto.to = to;\n proto.toNow = toNow;\n proto.get = stringGet;\n proto.invalidAt = invalidAt;\n proto.isAfter = isAfter;\n proto.isBefore = isBefore;\n proto.isBetween = isBetween;\n proto.isSame = isSame;\n proto.isSameOrAfter = isSameOrAfter;\n proto.isSameOrBefore = isSameOrBefore;\n proto.isValid = isValid$2;\n proto.lang = lang;\n proto.locale = locale;\n proto.localeData = localeData;\n proto.max = prototypeMax;\n proto.min = prototypeMin;\n proto.parsingFlags = parsingFlags;\n proto.set = stringSet;\n proto.startOf = startOf;\n proto.subtract = subtract;\n proto.toArray = toArray;\n proto.toObject = toObject;\n proto.toDate = toDate;\n proto.toISOString = toISOString;\n proto.inspect = inspect;\n if (typeof Symbol !== 'undefined' && Symbol.for != null) {\n proto[Symbol.for('nodejs.util.inspect.custom')] = function () {\n return 'Moment<' + this.format() + '>';\n };\n }\n proto.toJSON = toJSON;\n proto.toString = toString;\n proto.unix = unix;\n proto.valueOf = valueOf;\n proto.creationData = creationData;\n proto.eraName = getEraName;\n proto.eraNarrow = getEraNarrow;\n proto.eraAbbr = getEraAbbr;\n proto.eraYear = getEraYear;\n proto.year = getSetYear;\n proto.isLeapYear = getIsLeapYear;\n proto.weekYear = getSetWeekYear;\n proto.isoWeekYear = getSetISOWeekYear;\n proto.quarter = proto.quarters = getSetQuarter;\n proto.month = getSetMonth;\n proto.daysInMonth = getDaysInMonth;\n proto.week = proto.weeks = getSetWeek;\n proto.isoWeek = proto.isoWeeks = getSetISOWeek;\n proto.weeksInYear = getWeeksInYear;\n proto.weeksInWeekYear = getWeeksInWeekYear;\n proto.isoWeeksInYear = getISOWeeksInYear;\n proto.isoWeeksInISOWeekYear = getISOWeeksInISOWeekYear;\n proto.date = getSetDayOfMonth;\n proto.day = proto.days = getSetDayOfWeek;\n proto.weekday = getSetLocaleDayOfWeek;\n proto.isoWeekday = getSetISODayOfWeek;\n proto.dayOfYear = getSetDayOfYear;\n proto.hour = proto.hours = getSetHour;\n proto.minute = proto.minutes = getSetMinute;\n proto.second = proto.seconds = getSetSecond;\n proto.millisecond = proto.milliseconds = getSetMillisecond;\n proto.utcOffset = getSetOffset;\n proto.utc = setOffsetToUTC;\n proto.local = setOffsetToLocal;\n proto.parseZone = setOffsetToParsedOffset;\n proto.hasAlignedHourOffset = hasAlignedHourOffset;\n proto.isDST = isDaylightSavingTime;\n proto.isLocal = isLocal;\n proto.isUtcOffset = isUtcOffset;\n proto.isUtc = isUtc;\n proto.isUTC = isUtc;\n proto.zoneAbbr = getZoneAbbr;\n proto.zoneName = getZoneName;\n proto.dates = deprecate(\n 'dates accessor is deprecated. Use date instead.',\n getSetDayOfMonth\n );\n proto.months = deprecate(\n 'months accessor is deprecated. Use month instead',\n getSetMonth\n );\n proto.years = deprecate(\n 'years accessor is deprecated. Use year instead',\n getSetYear\n );\n proto.zone = deprecate(\n 'moment().zone is deprecated, use moment().utcOffset instead. http://momentjs.com/guides/#/warnings/zone/',\n getSetZone\n );\n proto.isDSTShifted = deprecate(\n 'isDSTShifted is deprecated. See http://momentjs.com/guides/#/warnings/dst-shifted/ for more information',\n isDaylightSavingTimeShifted\n );\n\n function createUnix(input) {\n return createLocal(input * 1000);\n }\n\n function createInZone() {\n return createLocal.apply(null, arguments).parseZone();\n }\n\n function preParsePostFormat(string) {\n return string;\n }\n\n var proto$1 = Locale.prototype;\n\n proto$1.calendar = calendar;\n proto$1.longDateFormat = longDateFormat;\n proto$1.invalidDate = invalidDate;\n proto$1.ordinal = ordinal;\n proto$1.preparse = preParsePostFormat;\n proto$1.postformat = preParsePostFormat;\n proto$1.relativeTime = relativeTime;\n proto$1.pastFuture = pastFuture;\n proto$1.set = set;\n proto$1.eras = localeEras;\n proto$1.erasParse = localeErasParse;\n proto$1.erasConvertYear = localeErasConvertYear;\n proto$1.erasAbbrRegex = erasAbbrRegex;\n proto$1.erasNameRegex = erasNameRegex;\n proto$1.erasNarrowRegex = erasNarrowRegex;\n\n proto$1.months = localeMonths;\n proto$1.monthsShort = localeMonthsShort;\n proto$1.monthsParse = localeMonthsParse;\n proto$1.monthsRegex = monthsRegex;\n proto$1.monthsShortRegex = monthsShortRegex;\n proto$1.week = localeWeek;\n proto$1.firstDayOfYear = localeFirstDayOfYear;\n proto$1.firstDayOfWeek = localeFirstDayOfWeek;\n\n proto$1.weekdays = localeWeekdays;\n proto$1.weekdaysMin = localeWeekdaysMin;\n proto$1.weekdaysShort = localeWeekdaysShort;\n proto$1.weekdaysParse = localeWeekdaysParse;\n\n proto$1.weekdaysRegex = weekdaysRegex;\n proto$1.weekdaysShortRegex = weekdaysShortRegex;\n proto$1.weekdaysMinRegex = weekdaysMinRegex;\n\n proto$1.isPM = localeIsPM;\n proto$1.meridiem = localeMeridiem;\n\n function get$1(format, index, field, setter) {\n var locale = getLocale(),\n utc = createUTC().set(setter, index);\n return locale[field](utc, format);\n }\n\n function listMonthsImpl(format, index, field) {\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n\n if (index != null) {\n return get$1(format, index, field, 'month');\n }\n\n var i,\n out = [];\n for (i = 0; i < 12; i++) {\n out[i] = get$1(format, i, field, 'month');\n }\n return out;\n }\n\n // ()\n // (5)\n // (fmt, 5)\n // (fmt)\n // (true)\n // (true, 5)\n // (true, fmt, 5)\n // (true, fmt)\n function listWeekdaysImpl(localeSorted, format, index, field) {\n if (typeof localeSorted === 'boolean') {\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n } else {\n format = localeSorted;\n index = format;\n localeSorted = false;\n\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n }\n\n var locale = getLocale(),\n shift = localeSorted ? locale._week.dow : 0,\n i,\n out = [];\n\n if (index != null) {\n return get$1(format, (index + shift) % 7, field, 'day');\n }\n\n for (i = 0; i < 7; i++) {\n out[i] = get$1(format, (i + shift) % 7, field, 'day');\n }\n return out;\n }\n\n function listMonths(format, index) {\n return listMonthsImpl(format, index, 'months');\n }\n\n function listMonthsShort(format, index) {\n return listMonthsImpl(format, index, 'monthsShort');\n }\n\n function listWeekdays(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdays');\n }\n\n function listWeekdaysShort(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdaysShort');\n }\n\n function listWeekdaysMin(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdaysMin');\n }\n\n getSetGlobalLocale('en', {\n eras: [\n {\n since: '0001-01-01',\n until: +Infinity,\n offset: 1,\n name: 'Anno Domini',\n narrow: 'AD',\n abbr: 'AD',\n },\n {\n since: '0000-12-31',\n until: -Infinity,\n offset: 1,\n name: 'Before Christ',\n narrow: 'BC',\n abbr: 'BC',\n },\n ],\n dayOfMonthOrdinalParse: /\\d{1,2}(th|st|nd|rd)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n toInt((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n });\n\n // Side effect imports\n\n hooks.lang = deprecate(\n 'moment.lang is deprecated. Use moment.locale instead.',\n getSetGlobalLocale\n );\n hooks.langData = deprecate(\n 'moment.langData is deprecated. Use moment.localeData instead.',\n getLocale\n );\n\n var mathAbs = Math.abs;\n\n function abs() {\n var data = this._data;\n\n this._milliseconds = mathAbs(this._milliseconds);\n this._days = mathAbs(this._days);\n this._months = mathAbs(this._months);\n\n data.milliseconds = mathAbs(data.milliseconds);\n data.seconds = mathAbs(data.seconds);\n data.minutes = mathAbs(data.minutes);\n data.hours = mathAbs(data.hours);\n data.months = mathAbs(data.months);\n data.years = mathAbs(data.years);\n\n return this;\n }\n\n function addSubtract$1(duration, input, value, direction) {\n var other = createDuration(input, value);\n\n duration._milliseconds += direction * other._milliseconds;\n duration._days += direction * other._days;\n duration._months += direction * other._months;\n\n return duration._bubble();\n }\n\n // supports only 2.0-style add(1, 's') or add(duration)\n function add$1(input, value) {\n return addSubtract$1(this, input, value, 1);\n }\n\n // supports only 2.0-style subtract(1, 's') or subtract(duration)\n function subtract$1(input, value) {\n return addSubtract$1(this, input, value, -1);\n }\n\n function absCeil(number) {\n if (number < 0) {\n return Math.floor(number);\n } else {\n return Math.ceil(number);\n }\n }\n\n function bubble() {\n var milliseconds = this._milliseconds,\n days = this._days,\n months = this._months,\n data = this._data,\n seconds,\n minutes,\n hours,\n years,\n monthsFromDays;\n\n // if we have a mix of positive and negative values, bubble down first\n // check: https://github.com/moment/moment/issues/2166\n if (\n !(\n (milliseconds >= 0 && days >= 0 && months >= 0) ||\n (milliseconds <= 0 && days <= 0 && months <= 0)\n )\n ) {\n milliseconds += absCeil(monthsToDays(months) + days) * 864e5;\n days = 0;\n months = 0;\n }\n\n // The following code bubbles up values, see the tests for\n // examples of what that means.\n data.milliseconds = milliseconds % 1000;\n\n seconds = absFloor(milliseconds / 1000);\n data.seconds = seconds % 60;\n\n minutes = absFloor(seconds / 60);\n data.minutes = minutes % 60;\n\n hours = absFloor(minutes / 60);\n data.hours = hours % 24;\n\n days += absFloor(hours / 24);\n\n // convert days to months\n monthsFromDays = absFloor(daysToMonths(days));\n months += monthsFromDays;\n days -= absCeil(monthsToDays(monthsFromDays));\n\n // 12 months -> 1 year\n years = absFloor(months / 12);\n months %= 12;\n\n data.days = days;\n data.months = months;\n data.years = years;\n\n return this;\n }\n\n function daysToMonths(days) {\n // 400 years have 146097 days (taking into account leap year rules)\n // 400 years have 12 months === 4800\n return (days * 4800) / 146097;\n }\n\n function monthsToDays(months) {\n // the reverse of daysToMonths\n return (months * 146097) / 4800;\n }\n\n function as(units) {\n if (!this.isValid()) {\n return NaN;\n }\n var days,\n months,\n milliseconds = this._milliseconds;\n\n units = normalizeUnits(units);\n\n if (units === 'month' || units === 'quarter' || units === 'year') {\n days = this._days + milliseconds / 864e5;\n months = this._months + daysToMonths(days);\n switch (units) {\n case 'month':\n return months;\n case 'quarter':\n return months / 3;\n case 'year':\n return months / 12;\n }\n } else {\n // handle milliseconds separately because of floating point math errors (issue #1867)\n days = this._days + Math.round(monthsToDays(this._months));\n switch (units) {\n case 'week':\n return days / 7 + milliseconds / 6048e5;\n case 'day':\n return days + milliseconds / 864e5;\n case 'hour':\n return days * 24 + milliseconds / 36e5;\n case 'minute':\n return days * 1440 + milliseconds / 6e4;\n case 'second':\n return days * 86400 + milliseconds / 1000;\n // Math.floor prevents floating point math errors here\n case 'millisecond':\n return Math.floor(days * 864e5) + milliseconds;\n default:\n throw new Error('Unknown unit ' + units);\n }\n }\n }\n\n // TODO: Use this.as('ms')?\n function valueOf$1() {\n if (!this.isValid()) {\n return NaN;\n }\n return (\n this._milliseconds +\n this._days * 864e5 +\n (this._months % 12) * 2592e6 +\n toInt(this._months / 12) * 31536e6\n );\n }\n\n function makeAs(alias) {\n return function () {\n return this.as(alias);\n };\n }\n\n var asMilliseconds = makeAs('ms'),\n asSeconds = makeAs('s'),\n asMinutes = makeAs('m'),\n asHours = makeAs('h'),\n asDays = makeAs('d'),\n asWeeks = makeAs('w'),\n asMonths = makeAs('M'),\n asQuarters = makeAs('Q'),\n asYears = makeAs('y');\n\n function clone$1() {\n return createDuration(this);\n }\n\n function get$2(units) {\n units = normalizeUnits(units);\n return this.isValid() ? this[units + 's']() : NaN;\n }\n\n function makeGetter(name) {\n return function () {\n return this.isValid() ? this._data[name] : NaN;\n };\n }\n\n var milliseconds = makeGetter('milliseconds'),\n seconds = makeGetter('seconds'),\n minutes = makeGetter('minutes'),\n hours = makeGetter('hours'),\n days = makeGetter('days'),\n months = makeGetter('months'),\n years = makeGetter('years');\n\n function weeks() {\n return absFloor(this.days() / 7);\n }\n\n var round = Math.round,\n thresholds = {\n ss: 44, // a few seconds to seconds\n s: 45, // seconds to minute\n m: 45, // minutes to hour\n h: 22, // hours to day\n d: 26, // days to month/week\n w: null, // weeks to month\n M: 11, // months to year\n };\n\n // helper function for moment.fn.from, moment.fn.fromNow, and moment.duration.fn.humanize\n function substituteTimeAgo(string, number, withoutSuffix, isFuture, locale) {\n return locale.relativeTime(number || 1, !!withoutSuffix, string, isFuture);\n }\n\n function relativeTime$1(posNegDuration, withoutSuffix, thresholds, locale) {\n var duration = createDuration(posNegDuration).abs(),\n seconds = round(duration.as('s')),\n minutes = round(duration.as('m')),\n hours = round(duration.as('h')),\n days = round(duration.as('d')),\n months = round(duration.as('M')),\n weeks = round(duration.as('w')),\n years = round(duration.as('y')),\n a =\n (seconds <= thresholds.ss && ['s', seconds]) ||\n (seconds < thresholds.s && ['ss', seconds]) ||\n (minutes <= 1 && ['m']) ||\n (minutes < thresholds.m && ['mm', minutes]) ||\n (hours <= 1 && ['h']) ||\n (hours < thresholds.h && ['hh', hours]) ||\n (days <= 1 && ['d']) ||\n (days < thresholds.d && ['dd', days]);\n\n if (thresholds.w != null) {\n a =\n a ||\n (weeks <= 1 && ['w']) ||\n (weeks < thresholds.w && ['ww', weeks]);\n }\n a = a ||\n (months <= 1 && ['M']) ||\n (months < thresholds.M && ['MM', months]) ||\n (years <= 1 && ['y']) || ['yy', years];\n\n a[2] = withoutSuffix;\n a[3] = +posNegDuration > 0;\n a[4] = locale;\n return substituteTimeAgo.apply(null, a);\n }\n\n // This function allows you to set the rounding function for relative time strings\n function getSetRelativeTimeRounding(roundingFunction) {\n if (roundingFunction === undefined) {\n return round;\n }\n if (typeof roundingFunction === 'function') {\n round = roundingFunction;\n return true;\n }\n return false;\n }\n\n // This function allows you to set a threshold for relative time strings\n function getSetRelativeTimeThreshold(threshold, limit) {\n if (thresholds[threshold] === undefined) {\n return false;\n }\n if (limit === undefined) {\n return thresholds[threshold];\n }\n thresholds[threshold] = limit;\n if (threshold === 's') {\n thresholds.ss = limit - 1;\n }\n return true;\n }\n\n function humanize(argWithSuffix, argThresholds) {\n if (!this.isValid()) {\n return this.localeData().invalidDate();\n }\n\n var withSuffix = false,\n th = thresholds,\n locale,\n output;\n\n if (typeof argWithSuffix === 'object') {\n argThresholds = argWithSuffix;\n argWithSuffix = false;\n }\n if (typeof argWithSuffix === 'boolean') {\n withSuffix = argWithSuffix;\n }\n if (typeof argThresholds === 'object') {\n th = Object.assign({}, thresholds, argThresholds);\n if (argThresholds.s != null && argThresholds.ss == null) {\n th.ss = argThresholds.s - 1;\n }\n }\n\n locale = this.localeData();\n output = relativeTime$1(this, !withSuffix, th, locale);\n\n if (withSuffix) {\n output = locale.pastFuture(+this, output);\n }\n\n return locale.postformat(output);\n }\n\n var abs$1 = Math.abs;\n\n function sign(x) {\n return (x > 0) - (x < 0) || +x;\n }\n\n function toISOString$1() {\n // for ISO strings we do not use the normal bubbling rules:\n // * milliseconds bubble up until they become hours\n // * days do not bubble at all\n // * months bubble up until they become years\n // This is because there is no context-free conversion between hours and days\n // (think of clock changes)\n // and also not between days and months (28-31 days per month)\n if (!this.isValid()) {\n return this.localeData().invalidDate();\n }\n\n var seconds = abs$1(this._milliseconds) / 1000,\n days = abs$1(this._days),\n months = abs$1(this._months),\n minutes,\n hours,\n years,\n s,\n total = this.asSeconds(),\n totalSign,\n ymSign,\n daysSign,\n hmsSign;\n\n if (!total) {\n // this is the same as C#'s (Noda) and python (isodate)...\n // but not other JS (goog.date)\n return 'P0D';\n }\n\n // 3600 seconds -> 60 minutes -> 1 hour\n minutes = absFloor(seconds / 60);\n hours = absFloor(minutes / 60);\n seconds %= 60;\n minutes %= 60;\n\n // 12 months -> 1 year\n years = absFloor(months / 12);\n months %= 12;\n\n // inspired by https://github.com/dordille/moment-isoduration/blob/master/moment.isoduration.js\n s = seconds ? seconds.toFixed(3).replace(/\\.?0+$/, '') : '';\n\n totalSign = total < 0 ? '-' : '';\n ymSign = sign(this._months) !== sign(total) ? '-' : '';\n daysSign = sign(this._days) !== sign(total) ? '-' : '';\n hmsSign = sign(this._milliseconds) !== sign(total) ? '-' : '';\n\n return (\n totalSign +\n 'P' +\n (years ? ymSign + years + 'Y' : '') +\n (months ? ymSign + months + 'M' : '') +\n (days ? daysSign + days + 'D' : '') +\n (hours || minutes || seconds ? 'T' : '') +\n (hours ? hmsSign + hours + 'H' : '') +\n (minutes ? hmsSign + minutes + 'M' : '') +\n (seconds ? hmsSign + s + 'S' : '')\n );\n }\n\n var proto$2 = Duration.prototype;\n\n proto$2.isValid = isValid$1;\n proto$2.abs = abs;\n proto$2.add = add$1;\n proto$2.subtract = subtract$1;\n proto$2.as = as;\n proto$2.asMilliseconds = asMilliseconds;\n proto$2.asSeconds = asSeconds;\n proto$2.asMinutes = asMinutes;\n proto$2.asHours = asHours;\n proto$2.asDays = asDays;\n proto$2.asWeeks = asWeeks;\n proto$2.asMonths = asMonths;\n proto$2.asQuarters = asQuarters;\n proto$2.asYears = asYears;\n proto$2.valueOf = valueOf$1;\n proto$2._bubble = bubble;\n proto$2.clone = clone$1;\n proto$2.get = get$2;\n proto$2.milliseconds = milliseconds;\n proto$2.seconds = seconds;\n proto$2.minutes = minutes;\n proto$2.hours = hours;\n proto$2.days = days;\n proto$2.weeks = weeks;\n proto$2.months = months;\n proto$2.years = years;\n proto$2.humanize = humanize;\n proto$2.toISOString = toISOString$1;\n proto$2.toString = toISOString$1;\n proto$2.toJSON = toISOString$1;\n proto$2.locale = locale;\n proto$2.localeData = localeData;\n\n proto$2.toIsoString = deprecate(\n 'toIsoString() is deprecated. Please use toISOString() instead (notice the capitals)',\n toISOString$1\n );\n proto$2.lang = lang;\n\n // FORMATTING\n\n addFormatToken('X', 0, 0, 'unix');\n addFormatToken('x', 0, 0, 'valueOf');\n\n // PARSING\n\n addRegexToken('x', matchSigned);\n addRegexToken('X', matchTimestamp);\n addParseToken('X', function (input, array, config) {\n config._d = new Date(parseFloat(input) * 1000);\n });\n addParseToken('x', function (input, array, config) {\n config._d = new Date(toInt(input));\n });\n\n //! moment.js\n\n hooks.version = '2.29.1';\n\n setHookCallback(createLocal);\n\n hooks.fn = proto;\n hooks.min = min;\n hooks.max = max;\n hooks.now = now;\n hooks.utc = createUTC;\n hooks.unix = createUnix;\n hooks.months = listMonths;\n hooks.isDate = isDate;\n hooks.locale = getSetGlobalLocale;\n hooks.invalid = createInvalid;\n hooks.duration = createDuration;\n hooks.isMoment = isMoment;\n hooks.weekdays = listWeekdays;\n hooks.parseZone = createInZone;\n hooks.localeData = getLocale;\n hooks.isDuration = isDuration;\n hooks.monthsShort = listMonthsShort;\n hooks.weekdaysMin = listWeekdaysMin;\n hooks.defineLocale = defineLocale;\n hooks.updateLocale = updateLocale;\n hooks.locales = listLocales;\n hooks.weekdaysShort = listWeekdaysShort;\n hooks.normalizeUnits = normalizeUnits;\n hooks.relativeTimeRounding = getSetRelativeTimeRounding;\n hooks.relativeTimeThreshold = getSetRelativeTimeThreshold;\n hooks.calendarFormat = getCalendarFormat;\n hooks.prototype = proto;\n\n // currently HTML5 input type only supports 24-hour formats\n hooks.HTML5_FMT = {\n DATETIME_LOCAL: 'YYYY-MM-DDTHH:mm', // \n DATETIME_LOCAL_SECONDS: 'YYYY-MM-DDTHH:mm:ss', // \n DATETIME_LOCAL_MS: 'YYYY-MM-DDTHH:mm:ss.SSS', // \n DATE: 'YYYY-MM-DD', // \n TIME: 'HH:mm', // \n TIME_SECONDS: 'HH:mm:ss', // \n TIME_MS: 'HH:mm:ss.SSS', // \n WEEK: 'GGGG-[W]WW', // \n MONTH: 'YYYY-MM', // \n };\n\n return hooks;\n\n})));\n","import { Subject } from './Subject';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n if (subscription && !subscription.closed) {\n subscriber.next(this._value);\n }\n return subscription;\n }\n getValue() {\n if (this.hasError) {\n throw this.thrownError;\n }\n else if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return this._value;\n }\n }\n next(value) {\n super.next(this._value = value);\n }\n}\n","import { Subscriber } from './Subscriber';\nexport class InnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n this.index = 0;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this.index++, this);\n }\n _error(error) {\n this.parent.notifyError(error, this);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\n","import { empty } from './observable/empty';\nimport { of } from './observable/of';\nimport { throwError } from './observable/throwError';\nexport var NotificationKind;\n(function (NotificationKind) {\n NotificationKind[\"NEXT\"] = \"N\";\n NotificationKind[\"ERROR\"] = \"E\";\n NotificationKind[\"COMPLETE\"] = \"C\";\n})(NotificationKind || (NotificationKind = {}));\nexport class Notification {\n constructor(kind, value, error) {\n this.kind = kind;\n this.value = value;\n this.error = error;\n this.hasValue = kind === 'N';\n }\n observe(observer) {\n switch (this.kind) {\n case 'N':\n return observer.next && observer.next(this.value);\n case 'E':\n return observer.error && observer.error(this.error);\n case 'C':\n return observer.complete && observer.complete();\n }\n }\n do(next, error, complete) {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return next && next(this.value);\n case 'E':\n return error && error(this.error);\n case 'C':\n return complete && complete();\n }\n }\n accept(nextOrObserver, error, complete) {\n if (nextOrObserver && typeof nextOrObserver.next === 'function') {\n return this.observe(nextOrObserver);\n }\n else {\n return this.do(nextOrObserver, error, complete);\n }\n }\n toObservable() {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return of(this.value);\n case 'E':\n return throwError(this.error);\n case 'C':\n return empty();\n }\n throw new Error('unexpected notification kind value');\n }\n static createNext(value) {\n if (typeof value !== 'undefined') {\n return new Notification('N', value);\n }\n return Notification.undefinedValueNotification;\n }\n static createError(err) {\n return new Notification('E', undefined, err);\n }\n static createComplete() {\n return Notification.completeNotification;\n }\n}\nNotification.completeNotification = new Notification('C');\nNotification.undefinedValueNotification = new Notification('N', undefined);\n","import { canReportError } from './util/canReportError';\nimport { toSubscriber } from './util/toSubscriber';\nimport { observable as Symbol_observable } from './symbol/observable';\nimport { pipeFromArray } from './util/pipe';\nimport { config } from './config';\nexport class Observable {\n constructor(subscribe) {\n this._isScalar = false;\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n lift(operator) {\n const observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n }\n subscribe(observerOrNext, error, complete) {\n const { operator } = this;\n const sink = toSubscriber(observerOrNext, error, complete);\n if (operator) {\n sink.add(operator.call(sink, this.source));\n }\n else {\n sink.add(this.source || (config.useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?\n this._subscribe(sink) :\n this._trySubscribe(sink));\n }\n if (config.useDeprecatedSynchronousErrorHandling) {\n if (sink.syncErrorThrowable) {\n sink.syncErrorThrowable = false;\n if (sink.syncErrorThrown) {\n throw sink.syncErrorValue;\n }\n }\n }\n return sink;\n }\n _trySubscribe(sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n sink.syncErrorThrown = true;\n sink.syncErrorValue = err;\n }\n if (canReportError(sink)) {\n sink.error(err);\n }\n else {\n console.warn(err);\n }\n }\n }\n forEach(next, promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let subscription;\n subscription = this.subscribe((value) => {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n if (subscription) {\n subscription.unsubscribe();\n }\n }\n }, reject, resolve);\n });\n }\n _subscribe(subscriber) {\n const { source } = this;\n return source && source.subscribe(subscriber);\n }\n [Symbol_observable]() {\n return this;\n }\n pipe(...operations) {\n if (operations.length === 0) {\n return this;\n }\n return pipeFromArray(operations)(this);\n }\n toPromise(promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let value;\n this.subscribe((x) => value = x, (err) => reject(err), () => resolve(value));\n });\n }\n}\nObservable.create = (subscribe) => {\n return new Observable(subscribe);\n};\nfunction getPromiseCtor(promiseCtor) {\n if (!promiseCtor) {\n promiseCtor = config.Promise || Promise;\n }\n if (!promiseCtor) {\n throw new Error('no Promise impl found');\n }\n return promiseCtor;\n}\n","import { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport const empty = {\n closed: true,\n next(value) { },\n error(err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n },\n complete() { }\n};\n","import { Subscriber } from './Subscriber';\nexport class OuterSubscriber extends Subscriber {\n notifyNext(outerValue, innerValue, outerIndex, innerIndex, innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error, innerSub) {\n this.destination.error(error);\n }\n notifyComplete(innerSub) {\n this.destination.complete();\n }\n}\n","import { Subject } from './Subject';\nimport { queue } from './scheduler/queue';\nimport { Subscription } from './Subscription';\nimport { ObserveOnSubscriber } from './operators/observeOn';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nexport class ReplaySubject extends Subject {\n constructor(bufferSize = Number.POSITIVE_INFINITY, windowTime = Number.POSITIVE_INFINITY, scheduler) {\n super();\n this.scheduler = scheduler;\n this._events = [];\n this._infiniteTimeWindow = false;\n this._bufferSize = bufferSize < 1 ? 1 : bufferSize;\n this._windowTime = windowTime < 1 ? 1 : windowTime;\n if (windowTime === Number.POSITIVE_INFINITY) {\n this._infiniteTimeWindow = true;\n this.next = this.nextInfiniteTimeWindow;\n }\n else {\n this.next = this.nextTimeWindow;\n }\n }\n nextInfiniteTimeWindow(value) {\n if (!this.isStopped) {\n const _events = this._events;\n _events.push(value);\n if (_events.length > this._bufferSize) {\n _events.shift();\n }\n }\n super.next(value);\n }\n nextTimeWindow(value) {\n if (!this.isStopped) {\n this._events.push(new ReplayEvent(this._getNow(), value));\n this._trimBufferThenGetEvents();\n }\n super.next(value);\n }\n _subscribe(subscriber) {\n const _infiniteTimeWindow = this._infiniteTimeWindow;\n const _events = _infiniteTimeWindow ? this._events : this._trimBufferThenGetEvents();\n const scheduler = this.scheduler;\n const len = _events.length;\n let subscription;\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.isStopped || this.hasError) {\n subscription = Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n subscription = new SubjectSubscription(this, subscriber);\n }\n if (scheduler) {\n subscriber.add(subscriber = new ObserveOnSubscriber(subscriber, scheduler));\n }\n if (_infiniteTimeWindow) {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i]);\n }\n }\n else {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i].value);\n }\n }\n if (this.hasError) {\n subscriber.error(this.thrownError);\n }\n else if (this.isStopped) {\n subscriber.complete();\n }\n return subscription;\n }\n _getNow() {\n return (this.scheduler || queue).now();\n }\n _trimBufferThenGetEvents() {\n const now = this._getNow();\n const _bufferSize = this._bufferSize;\n const _windowTime = this._windowTime;\n const _events = this._events;\n const eventsCount = _events.length;\n let spliceCount = 0;\n while (spliceCount < eventsCount) {\n if ((now - _events[spliceCount].time) < _windowTime) {\n break;\n }\n spliceCount++;\n }\n if (eventsCount > _bufferSize) {\n spliceCount = Math.max(spliceCount, eventsCount - _bufferSize);\n }\n if (spliceCount > 0) {\n _events.splice(0, spliceCount);\n }\n return _events;\n }\n}\nclass ReplayEvent {\n constructor(time, value) {\n this.time = time;\n this.value = value;\n }\n}\n","export class Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n this.SchedulerAction = SchedulerAction;\n this.now = now;\n }\n schedule(work, delay = 0, state) {\n return new this.SchedulerAction(this, work).schedule(state, delay);\n }\n}\nScheduler.now = () => Date.now();\n","import { Observable } from './Observable';\nimport { Subscriber } from './Subscriber';\nimport { Subscription } from './Subscription';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nexport class SubjectSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n this.destination = destination;\n }\n}\nexport class Subject extends Observable {\n constructor() {\n super();\n this.observers = [];\n this.closed = false;\n this.isStopped = false;\n this.hasError = false;\n this.thrownError = null;\n }\n [rxSubscriberSymbol]() {\n return new SubjectSubscriber(this);\n }\n lift(operator) {\n const subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n }\n next(value) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n if (!this.isStopped) {\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].next(value);\n }\n }\n }\n error(err) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.hasError = true;\n this.thrownError = err;\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].error(err);\n }\n this.observers.length = 0;\n }\n complete() {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].complete();\n }\n this.observers.length = 0;\n }\n unsubscribe() {\n this.isStopped = true;\n this.closed = true;\n this.observers = null;\n }\n _trySubscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return super._trySubscribe(subscriber);\n }\n }\n _subscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.hasError) {\n subscriber.error(this.thrownError);\n return Subscription.EMPTY;\n }\n else if (this.isStopped) {\n subscriber.complete();\n return Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n return new SubjectSubscription(this, subscriber);\n }\n }\n asObservable() {\n const observable = new Observable();\n observable.source = this;\n return observable;\n }\n}\nSubject.create = (destination, source) => {\n return new AnonymousSubject(destination, source);\n};\nexport class AnonymousSubject extends Subject {\n constructor(destination, source) {\n super();\n this.destination = destination;\n this.source = source;\n }\n next(value) {\n const { destination } = this;\n if (destination && destination.next) {\n destination.next(value);\n }\n }\n error(err) {\n const { destination } = this;\n if (destination && destination.error) {\n this.destination.error(err);\n }\n }\n complete() {\n const { destination } = this;\n if (destination && destination.complete) {\n this.destination.complete();\n }\n }\n _subscribe(subscriber) {\n const { source } = this;\n if (source) {\n return this.source.subscribe(subscriber);\n }\n else {\n return Subscription.EMPTY;\n }\n }\n}\n","import { Subscription } from './Subscription';\nexport class SubjectSubscription extends Subscription {\n constructor(subject, subscriber) {\n super();\n this.subject = subject;\n this.subscriber = subscriber;\n this.closed = false;\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.closed = true;\n const subject = this.subject;\n const observers = subject.observers;\n this.subject = null;\n if (!observers || observers.length === 0 || subject.isStopped || subject.closed) {\n return;\n }\n const subscriberIndex = observers.indexOf(this.subscriber);\n if (subscriberIndex !== -1) {\n observers.splice(subscriberIndex, 1);\n }\n }\n}\n","import { isFunction } from './util/isFunction';\nimport { empty as emptyObserver } from './Observer';\nimport { Subscription } from './Subscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nimport { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport class Subscriber extends Subscription {\n constructor(destinationOrNext, error, complete) {\n super();\n this.syncErrorValue = null;\n this.syncErrorThrown = false;\n this.syncErrorThrowable = false;\n this.isStopped = false;\n switch (arguments.length) {\n case 0:\n this.destination = emptyObserver;\n break;\n case 1:\n if (!destinationOrNext) {\n this.destination = emptyObserver;\n break;\n }\n if (typeof destinationOrNext === 'object') {\n if (destinationOrNext instanceof Subscriber) {\n this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;\n this.destination = destinationOrNext;\n destinationOrNext.add(this);\n }\n else {\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext);\n }\n break;\n }\n default:\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext, error, complete);\n break;\n }\n }\n [rxSubscriberSymbol]() { return this; }\n static create(next, error, complete) {\n const subscriber = new Subscriber(next, error, complete);\n subscriber.syncErrorThrowable = false;\n return subscriber;\n }\n next(value) {\n if (!this.isStopped) {\n this._next(value);\n }\n }\n error(err) {\n if (!this.isStopped) {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (!this.isStopped) {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.isStopped = true;\n super.unsubscribe();\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.destination.complete();\n this.unsubscribe();\n }\n _unsubscribeAndRecycle() {\n const { _parentOrParents } = this;\n this._parentOrParents = null;\n this.unsubscribe();\n this.closed = false;\n this.isStopped = false;\n this._parentOrParents = _parentOrParents;\n return this;\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(_parentSubscriber, observerOrNext, error, complete) {\n super();\n this._parentSubscriber = _parentSubscriber;\n let next;\n let context = this;\n if (isFunction(observerOrNext)) {\n next = observerOrNext;\n }\n else if (observerOrNext) {\n next = observerOrNext.next;\n error = observerOrNext.error;\n complete = observerOrNext.complete;\n if (observerOrNext !== emptyObserver) {\n context = Object.create(observerOrNext);\n if (isFunction(context.unsubscribe)) {\n this.add(context.unsubscribe.bind(context));\n }\n context.unsubscribe = this.unsubscribe.bind(this);\n }\n }\n this._context = context;\n this._next = next;\n this._error = error;\n this._complete = complete;\n }\n next(value) {\n if (!this.isStopped && this._next) {\n const { _parentSubscriber } = this;\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._next, value);\n }\n else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {\n this.unsubscribe();\n }\n }\n }\n error(err) {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n const { useDeprecatedSynchronousErrorHandling } = config;\n if (this._error) {\n if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._error, err);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, this._error, err);\n this.unsubscribe();\n }\n }\n else if (!_parentSubscriber.syncErrorThrowable) {\n this.unsubscribe();\n if (useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n hostReportError(err);\n }\n else {\n if (useDeprecatedSynchronousErrorHandling) {\n _parentSubscriber.syncErrorValue = err;\n _parentSubscriber.syncErrorThrown = true;\n }\n else {\n hostReportError(err);\n }\n this.unsubscribe();\n }\n }\n }\n complete() {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n if (this._complete) {\n const wrappedComplete = () => this._complete.call(this._context);\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(wrappedComplete);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, wrappedComplete);\n this.unsubscribe();\n }\n }\n else {\n this.unsubscribe();\n }\n }\n }\n __tryOrUnsub(fn, value) {\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n this.unsubscribe();\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n }\n }\n __tryOrSetError(parent, fn, value) {\n if (!config.useDeprecatedSynchronousErrorHandling) {\n throw new Error('bad call');\n }\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n parent.syncErrorValue = err;\n parent.syncErrorThrown = true;\n return true;\n }\n else {\n hostReportError(err);\n return true;\n }\n }\n return false;\n }\n _unsubscribe() {\n const { _parentSubscriber } = this;\n this._context = null;\n this._parentSubscriber = null;\n _parentSubscriber.unsubscribe();\n }\n}\n","import { isArray } from './util/isArray';\nimport { isObject } from './util/isObject';\nimport { isFunction } from './util/isFunction';\nimport { UnsubscriptionError } from './util/UnsubscriptionError';\nexport class Subscription {\n constructor(unsubscribe) {\n this.closed = false;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (unsubscribe) {\n this._ctorUnsubscribe = true;\n this._unsubscribe = unsubscribe;\n }\n }\n unsubscribe() {\n let errors;\n if (this.closed) {\n return;\n }\n let { _parentOrParents, _ctorUnsubscribe, _unsubscribe, _subscriptions } = this;\n this.closed = true;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (_parentOrParents instanceof Subscription) {\n _parentOrParents.remove(this);\n }\n else if (_parentOrParents !== null) {\n for (let index = 0; index < _parentOrParents.length; ++index) {\n const parent = _parentOrParents[index];\n parent.remove(this);\n }\n }\n if (isFunction(_unsubscribe)) {\n if (_ctorUnsubscribe) {\n this._unsubscribe = undefined;\n }\n try {\n _unsubscribe.call(this);\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError ? flattenUnsubscriptionErrors(e.errors) : [e];\n }\n }\n if (isArray(_subscriptions)) {\n let index = -1;\n let len = _subscriptions.length;\n while (++index < len) {\n const sub = _subscriptions[index];\n if (isObject(sub)) {\n try {\n sub.unsubscribe();\n }\n catch (e) {\n errors = errors || [];\n if (e instanceof UnsubscriptionError) {\n errors = errors.concat(flattenUnsubscriptionErrors(e.errors));\n }\n else {\n errors.push(e);\n }\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError(errors);\n }\n }\n add(teardown) {\n let subscription = teardown;\n if (!teardown) {\n return Subscription.EMPTY;\n }\n switch (typeof teardown) {\n case 'function':\n subscription = new Subscription(teardown);\n case 'object':\n if (subscription === this || subscription.closed || typeof subscription.unsubscribe !== 'function') {\n return subscription;\n }\n else if (this.closed) {\n subscription.unsubscribe();\n return subscription;\n }\n else if (!(subscription instanceof Subscription)) {\n const tmp = subscription;\n subscription = new Subscription();\n subscription._subscriptions = [tmp];\n }\n break;\n default: {\n throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');\n }\n }\n let { _parentOrParents } = subscription;\n if (_parentOrParents === null) {\n subscription._parentOrParents = this;\n }\n else if (_parentOrParents instanceof Subscription) {\n if (_parentOrParents === this) {\n return subscription;\n }\n subscription._parentOrParents = [_parentOrParents, this];\n }\n else if (_parentOrParents.indexOf(this) === -1) {\n _parentOrParents.push(this);\n }\n else {\n return subscription;\n }\n const subscriptions = this._subscriptions;\n if (subscriptions === null) {\n this._subscriptions = [subscription];\n }\n else {\n subscriptions.push(subscription);\n }\n return subscription;\n }\n remove(subscription) {\n const subscriptions = this._subscriptions;\n if (subscriptions) {\n const subscriptionIndex = subscriptions.indexOf(subscription);\n if (subscriptionIndex !== -1) {\n subscriptions.splice(subscriptionIndex, 1);\n }\n }\n }\n}\nSubscription.EMPTY = (function (empty) {\n empty.closed = true;\n return empty;\n}(new Subscription()));\nfunction flattenUnsubscriptionErrors(errors) {\n return errors.reduce((errs, err) => errs.concat((err instanceof UnsubscriptionError) ? err.errors : err), []);\n}\n","let _enable_super_gross_mode_that_will_cause_bad_things = false;\nexport const config = {\n Promise: undefined,\n set useDeprecatedSynchronousErrorHandling(value) {\n if (value) {\n const error = new Error();\n console.warn('DEPRECATED! RxJS was set to use deprecated synchronous error handling behavior by code at: \\n' + error.stack);\n }\n else if (_enable_super_gross_mode_that_will_cause_bad_things) {\n console.log('RxJS: Back to a better error behavior. Thank you. <3');\n }\n _enable_super_gross_mode_that_will_cause_bad_things = value;\n },\n get useDeprecatedSynchronousErrorHandling() {\n return _enable_super_gross_mode_that_will_cause_bad_things;\n },\n};\n","import { Subscriber } from './Subscriber';\nimport { Observable } from './Observable';\nimport { subscribeTo } from './util/subscribeTo';\nexport class SimpleInnerSubscriber extends Subscriber {\n constructor(parent) {\n super();\n this.parent = parent;\n }\n _next(value) {\n this.parent.notifyNext(value);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete();\n this.unsubscribe();\n }\n}\nexport class ComplexInnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\nexport class SimpleOuterSubscriber extends Subscriber {\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyError(err) {\n this.destination.error(err);\n }\n notifyComplete() {\n this.destination.complete();\n }\n}\nexport class ComplexOuterSubscriber extends Subscriber {\n notifyNext(_outerValue, innerValue, _outerIndex, _innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error) {\n this.destination.error(error);\n }\n notifyComplete(_innerSub) {\n this.destination.complete();\n }\n}\nexport function innerSubscribe(result, innerSubscriber) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n let subscription;\n try {\n subscription = subscribeTo(result)(innerSubscriber);\n }\n catch (error) {\n innerSubscriber.error(error);\n }\n return subscription;\n}\n","import { SubjectSubscriber } from '../Subject';\nimport { Observable } from '../Observable';\nimport { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nimport { refCount as higherOrderRefCount } from '../operators/refCount';\nexport class ConnectableObservable extends Observable {\n constructor(source, subjectFactory) {\n super();\n this.source = source;\n this.subjectFactory = subjectFactory;\n this._refCount = 0;\n this._isComplete = false;\n }\n _subscribe(subscriber) {\n return this.getSubject().subscribe(subscriber);\n }\n getSubject() {\n const subject = this._subject;\n if (!subject || subject.isStopped) {\n this._subject = this.subjectFactory();\n }\n return this._subject;\n }\n connect() {\n let connection = this._connection;\n if (!connection) {\n this._isComplete = false;\n connection = this._connection = new Subscription();\n connection.add(this.source\n .subscribe(new ConnectableSubscriber(this.getSubject(), this)));\n if (connection.closed) {\n this._connection = null;\n connection = Subscription.EMPTY;\n }\n }\n return connection;\n }\n refCount() {\n return higherOrderRefCount()(this);\n }\n}\nexport const connectableObservableDescriptor = (() => {\n const connectableProto = ConnectableObservable.prototype;\n return {\n operator: { value: null },\n _refCount: { value: 0, writable: true },\n _subject: { value: null, writable: true },\n _connection: { value: null, writable: true },\n _subscribe: { value: connectableProto._subscribe },\n _isComplete: { value: connectableProto._isComplete, writable: true },\n getSubject: { value: connectableProto.getSubject },\n connect: { value: connectableProto.connect },\n refCount: { value: connectableProto.refCount }\n };\n})();\nclass ConnectableSubscriber extends SubjectSubscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _error(err) {\n this._unsubscribe();\n super._error(err);\n }\n _complete() {\n this.connectable._isComplete = true;\n this._unsubscribe();\n super._complete();\n }\n _unsubscribe() {\n const connectable = this.connectable;\n if (connectable) {\n this.connectable = null;\n const connection = connectable._connection;\n connectable._refCount = 0;\n connectable._subject = null;\n connectable._connection = null;\n if (connection) {\n connection.unsubscribe();\n }\n }\n }\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { isArray } from '../util/isArray';\nimport { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nimport { fromArray } from './fromArray';\nconst NONE = {};\nexport function combineLatest(...observables) {\n let resultSelector = undefined;\n let scheduler = undefined;\n if (isScheduler(observables[observables.length - 1])) {\n scheduler = observables.pop();\n }\n if (typeof observables[observables.length - 1] === 'function') {\n resultSelector = observables.pop();\n }\n if (observables.length === 1 && isArray(observables[0])) {\n observables = observables[0];\n }\n return fromArray(observables, scheduler).lift(new CombineLatestOperator(resultSelector));\n}\nexport class CombineLatestOperator {\n constructor(resultSelector) {\n this.resultSelector = resultSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new CombineLatestSubscriber(subscriber, this.resultSelector));\n }\n}\nexport class CombineLatestSubscriber extends OuterSubscriber {\n constructor(destination, resultSelector) {\n super(destination);\n this.resultSelector = resultSelector;\n this.active = 0;\n this.values = [];\n this.observables = [];\n }\n _next(observable) {\n this.values.push(NONE);\n this.observables.push(observable);\n }\n _complete() {\n const observables = this.observables;\n const len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n this.active = len;\n this.toRespond = len;\n for (let i = 0; i < len; i++) {\n const observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n }\n notifyComplete(unused) {\n if ((this.active -= 1) === 0) {\n this.destination.complete();\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n const values = this.values;\n const oldVal = values[outerIndex];\n const toRespond = !this.toRespond\n ? 0\n : oldVal === NONE ? --this.toRespond : this.toRespond;\n values[outerIndex] = innerValue;\n if (toRespond === 0) {\n if (this.resultSelector) {\n this._tryResultSelector(values);\n }\n else {\n this.destination.next(values.slice());\n }\n }\n }\n _tryResultSelector(values) {\n let result;\n try {\n result = this.resultSelector.apply(this, values);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { of } from './of';\nimport { concatAll } from '../operators/concatAll';\nexport function concat(...observables) {\n return concatAll()(of(...observables));\n}\n","import { Observable } from '../Observable';\nimport { from } from './from';\nimport { empty } from './empty';\nexport function defer(observableFactory) {\n return new Observable(subscriber => {\n let input;\n try {\n input = observableFactory();\n }\n catch (err) {\n subscriber.error(err);\n return undefined;\n }\n const source = input ? from(input) : empty();\n return source.subscribe(subscriber);\n });\n}\n","import { Observable } from '../Observable';\nexport const EMPTY = new Observable(subscriber => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable(subscriber => scheduler.schedule(() => subscriber.complete()));\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { map } from '../operators/map';\nimport { isObject } from '../util/isObject';\nimport { from } from './from';\nexport function forkJoin(...sources) {\n if (sources.length === 1) {\n const first = sources[0];\n if (isArray(first)) {\n return forkJoinInternal(first, null);\n }\n if (isObject(first) && Object.getPrototypeOf(first) === Object.prototype) {\n const keys = Object.keys(first);\n return forkJoinInternal(keys.map(key => first[key]), keys);\n }\n }\n if (typeof sources[sources.length - 1] === 'function') {\n const resultSelector = sources.pop();\n sources = (sources.length === 1 && isArray(sources[0])) ? sources[0] : sources;\n return forkJoinInternal(sources, null).pipe(map((args) => resultSelector(...args)));\n }\n return forkJoinInternal(sources, null);\n}\nfunction forkJoinInternal(sources, keys) {\n return new Observable(subscriber => {\n const len = sources.length;\n if (len === 0) {\n subscriber.complete();\n return;\n }\n const values = new Array(len);\n let completed = 0;\n let emitted = 0;\n for (let i = 0; i < len; i++) {\n const source = from(sources[i]);\n let hasValue = false;\n subscriber.add(source.subscribe({\n next: value => {\n if (!hasValue) {\n hasValue = true;\n emitted++;\n }\n values[i] = value;\n },\n error: err => subscriber.error(err),\n complete: () => {\n completed++;\n if (completed === len || !hasValue) {\n if (emitted === len) {\n subscriber.next(keys ?\n keys.reduce((result, key, i) => (result[key] = values[i], result), {}) :\n values);\n }\n subscriber.complete();\n }\n }\n }));\n }\n });\n}\n","import { Observable } from '../Observable';\nimport { subscribeTo } from '../util/subscribeTo';\nimport { scheduled } from '../scheduled/scheduled';\nexport function from(input, scheduler) {\n if (!scheduler) {\n if (input instanceof Observable) {\n return input;\n }\n return new Observable(subscribeTo(input));\n }\n else {\n return scheduled(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { subscribeToArray } from '../util/subscribeToArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function fromArray(input, scheduler) {\n if (!scheduler) {\n return new Observable(subscribeToArray(input));\n }\n else {\n return scheduleArray(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { isFunction } from '../util/isFunction';\nimport { map } from '../operators/map';\nconst toString = (() => Object.prototype.toString)();\nexport function fromEvent(target, eventName, options, resultSelector) {\n if (isFunction(options)) {\n resultSelector = options;\n options = undefined;\n }\n if (resultSelector) {\n return fromEvent(target, eventName, options).pipe(map(args => isArray(args) ? resultSelector(...args) : resultSelector(args)));\n }\n return new Observable(subscriber => {\n function handler(e) {\n if (arguments.length > 1) {\n subscriber.next(Array.prototype.slice.call(arguments));\n }\n else {\n subscriber.next(e);\n }\n }\n setupSubscription(target, eventName, handler, subscriber, options);\n });\n}\nfunction setupSubscription(sourceObj, eventName, handler, subscriber, options) {\n let unsubscribe;\n if (isEventTarget(sourceObj)) {\n const source = sourceObj;\n sourceObj.addEventListener(eventName, handler, options);\n unsubscribe = () => source.removeEventListener(eventName, handler, options);\n }\n else if (isJQueryStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.on(eventName, handler);\n unsubscribe = () => source.off(eventName, handler);\n }\n else if (isNodeStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.addListener(eventName, handler);\n unsubscribe = () => source.removeListener(eventName, handler);\n }\n else if (sourceObj && sourceObj.length) {\n for (let i = 0, len = sourceObj.length; i < len; i++) {\n setupSubscription(sourceObj[i], eventName, handler, subscriber, options);\n }\n }\n else {\n throw new TypeError('Invalid event target');\n }\n subscriber.add(unsubscribe);\n}\nfunction isNodeStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.addListener === 'function' && typeof sourceObj.removeListener === 'function';\n}\nfunction isJQueryStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.on === 'function' && typeof sourceObj.off === 'function';\n}\nfunction isEventTarget(sourceObj) {\n return sourceObj && typeof sourceObj.addEventListener === 'function' && typeof sourceObj.removeEventListener === 'function';\n}\n","import { Observable } from '../Observable';\nimport { async } from '../scheduler/async';\nimport { isNumeric } from '../util/isNumeric';\nexport function interval(period = 0, scheduler = async) {\n if (!isNumeric(period) || period < 0) {\n period = 0;\n }\n if (!scheduler || typeof scheduler.schedule !== 'function') {\n scheduler = async;\n }\n return new Observable(subscriber => {\n subscriber.add(scheduler.schedule(dispatch, period, { subscriber, counter: 0, period }));\n return subscriber;\n });\n}\nfunction dispatch(state) {\n const { subscriber, counter, period } = state;\n subscriber.next(counter);\n this.schedule({ subscriber, counter: counter + 1, period }, period);\n}\n","import { Observable } from '../Observable';\nimport { isScheduler } from '../util/isScheduler';\nimport { mergeAll } from '../operators/mergeAll';\nimport { fromArray } from './fromArray';\nexport function merge(...observables) {\n let concurrent = Number.POSITIVE_INFINITY;\n let scheduler = null;\n let last = observables[observables.length - 1];\n if (isScheduler(last)) {\n scheduler = observables.pop();\n if (observables.length > 1 && typeof observables[observables.length - 1] === 'number') {\n concurrent = observables.pop();\n }\n }\n else if (typeof last === 'number') {\n concurrent = observables.pop();\n }\n if (scheduler === null && observables.length === 1 && observables[0] instanceof Observable) {\n return observables[0];\n }\n return mergeAll(concurrent)(fromArray(observables, scheduler));\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { fromArray } from './fromArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function of(...args) {\n let scheduler = args[args.length - 1];\n if (isScheduler(scheduler)) {\n args.pop();\n return scheduleArray(args, scheduler);\n }\n else {\n return fromArray(args);\n }\n}\n","import { Observable } from '../Observable';\nexport function throwError(error, scheduler) {\n if (!scheduler) {\n return new Observable(subscriber => subscriber.error(error));\n }\n else {\n return new Observable(subscriber => scheduler.schedule(dispatch, 0, { error, subscriber }));\n }\n}\nfunction dispatch({ error, subscriber }) {\n subscriber.error(error);\n}\n","import { Observable } from '../Observable';\nimport { async } from '../scheduler/async';\nimport { isNumeric } from '../util/isNumeric';\nimport { isScheduler } from '../util/isScheduler';\nexport function timer(dueTime = 0, periodOrScheduler, scheduler) {\n let period = -1;\n if (isNumeric(periodOrScheduler)) {\n period = Number(periodOrScheduler) < 1 && 1 || Number(periodOrScheduler);\n }\n else if (isScheduler(periodOrScheduler)) {\n scheduler = periodOrScheduler;\n }\n if (!isScheduler(scheduler)) {\n scheduler = async;\n }\n return new Observable(subscriber => {\n const due = isNumeric(dueTime)\n ? dueTime\n : (+dueTime - scheduler.now());\n return scheduler.schedule(dispatch, due, {\n index: 0, period, subscriber\n });\n });\n}\nfunction dispatch(state) {\n const { index, period, subscriber } = state;\n subscriber.next(index);\n if (subscriber.closed) {\n return;\n }\n else if (period === -1) {\n return subscriber.complete();\n }\n state.index = index + 1;\n this.schedule(state, period);\n}\n","import { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport function audit(durationSelector) {\n return function auditOperatorFunction(source) {\n return source.lift(new AuditOperator(durationSelector));\n };\n}\nclass AuditOperator {\n constructor(durationSelector) {\n this.durationSelector = durationSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new AuditSubscriber(subscriber, this.durationSelector));\n }\n}\nclass AuditSubscriber extends SimpleOuterSubscriber {\n constructor(destination, durationSelector) {\n super(destination);\n this.durationSelector = durationSelector;\n this.hasValue = false;\n }\n _next(value) {\n this.value = value;\n this.hasValue = true;\n if (!this.throttled) {\n let duration;\n try {\n const { durationSelector } = this;\n duration = durationSelector(value);\n }\n catch (err) {\n return this.destination.error(err);\n }\n const innerSubscription = innerSubscribe(duration, new SimpleInnerSubscriber(this));\n if (!innerSubscription || innerSubscription.closed) {\n this.clearThrottle();\n }\n else {\n this.add(this.throttled = innerSubscription);\n }\n }\n }\n clearThrottle() {\n const { value, hasValue, throttled } = this;\n if (throttled) {\n this.remove(throttled);\n this.throttled = undefined;\n throttled.unsubscribe();\n }\n if (hasValue) {\n this.value = undefined;\n this.hasValue = false;\n this.destination.next(value);\n }\n }\n notifyNext() {\n this.clearThrottle();\n }\n notifyComplete() {\n this.clearThrottle();\n }\n}\n","import { async } from '../scheduler/async';\nimport { audit } from './audit';\nimport { timer } from '../observable/timer';\nexport function auditTime(duration, scheduler = async) {\n return audit(() => timer(duration, scheduler));\n}\n","import { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function catchError(selector) {\n return function catchErrorOperatorFunction(source) {\n const operator = new CatchOperator(selector);\n const caught = source.lift(operator);\n return (operator.caught = caught);\n };\n}\nclass CatchOperator {\n constructor(selector) {\n this.selector = selector;\n }\n call(subscriber, source) {\n return source.subscribe(new CatchSubscriber(subscriber, this.selector, this.caught));\n }\n}\nclass CatchSubscriber extends SimpleOuterSubscriber {\n constructor(destination, selector, caught) {\n super(destination);\n this.selector = selector;\n this.caught = caught;\n }\n error(err) {\n if (!this.isStopped) {\n let result;\n try {\n result = this.selector(err, this.caught);\n }\n catch (err2) {\n super.error(err2);\n return;\n }\n this._unsubscribeAndRecycle();\n const innerSubscriber = new SimpleInnerSubscriber(this);\n this.add(innerSubscriber);\n const innerSubscription = innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n this.add(innerSubscription);\n }\n }\n }\n}\n","import { mergeAll } from './mergeAll';\nexport function concatAll() {\n return mergeAll(1);\n}\n","import { mergeMap } from './mergeMap';\nexport function concatMap(project, resultSelector) {\n return mergeMap(project, resultSelector, 1);\n}\n","import { Subscriber } from '../Subscriber';\nimport { async } from '../scheduler/async';\nexport function debounceTime(dueTime, scheduler = async) {\n return (source) => source.lift(new DebounceTimeOperator(dueTime, scheduler));\n}\nclass DebounceTimeOperator {\n constructor(dueTime, scheduler) {\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DebounceTimeSubscriber(subscriber, this.dueTime, this.scheduler));\n }\n}\nclass DebounceTimeSubscriber extends Subscriber {\n constructor(destination, dueTime, scheduler) {\n super(destination);\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n this.debouncedSubscription = null;\n this.lastValue = null;\n this.hasValue = false;\n }\n _next(value) {\n this.clearDebounce();\n this.lastValue = value;\n this.hasValue = true;\n this.add(this.debouncedSubscription = this.scheduler.schedule(dispatchNext, this.dueTime, this));\n }\n _complete() {\n this.debouncedNext();\n this.destination.complete();\n }\n debouncedNext() {\n this.clearDebounce();\n if (this.hasValue) {\n const { lastValue } = this;\n this.lastValue = null;\n this.hasValue = false;\n this.destination.next(lastValue);\n }\n }\n clearDebounce() {\n const debouncedSubscription = this.debouncedSubscription;\n if (debouncedSubscription !== null) {\n this.remove(debouncedSubscription);\n debouncedSubscription.unsubscribe();\n this.debouncedSubscription = null;\n }\n }\n}\nfunction dispatchNext(subscriber) {\n subscriber.debouncedNext();\n}\n","import { Subscriber } from '../Subscriber';\nexport function defaultIfEmpty(defaultValue = null) {\n return (source) => source.lift(new DefaultIfEmptyOperator(defaultValue));\n}\nclass DefaultIfEmptyOperator {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n call(subscriber, source) {\n return source.subscribe(new DefaultIfEmptySubscriber(subscriber, this.defaultValue));\n }\n}\nclass DefaultIfEmptySubscriber extends Subscriber {\n constructor(destination, defaultValue) {\n super(destination);\n this.defaultValue = defaultValue;\n this.isEmpty = true;\n }\n _next(value) {\n this.isEmpty = false;\n this.destination.next(value);\n }\n _complete() {\n if (this.isEmpty) {\n this.destination.next(this.defaultValue);\n }\n this.destination.complete();\n }\n}\n","import { async } from '../scheduler/async';\nimport { isDate } from '../util/isDate';\nimport { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function delay(delay, scheduler = async) {\n const absoluteDelay = isDate(delay);\n const delayFor = absoluteDelay ? (+delay - scheduler.now()) : Math.abs(delay);\n return (source) => source.lift(new DelayOperator(delayFor, scheduler));\n}\nclass DelayOperator {\n constructor(delay, scheduler) {\n this.delay = delay;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DelaySubscriber(subscriber, this.delay, this.scheduler));\n }\n}\nclass DelaySubscriber extends Subscriber {\n constructor(destination, delay, scheduler) {\n super(destination);\n this.delay = delay;\n this.scheduler = scheduler;\n this.queue = [];\n this.active = false;\n this.errored = false;\n }\n static dispatch(state) {\n const source = state.source;\n const queue = source.queue;\n const scheduler = state.scheduler;\n const destination = state.destination;\n while (queue.length > 0 && (queue[0].time - scheduler.now()) <= 0) {\n queue.shift().notification.observe(destination);\n }\n if (queue.length > 0) {\n const delay = Math.max(0, queue[0].time - scheduler.now());\n this.schedule(state, delay);\n }\n else {\n this.unsubscribe();\n source.active = false;\n }\n }\n _schedule(scheduler) {\n this.active = true;\n const destination = this.destination;\n destination.add(scheduler.schedule(DelaySubscriber.dispatch, this.delay, {\n source: this, destination: this.destination, scheduler: scheduler\n }));\n }\n scheduleNotification(notification) {\n if (this.errored === true) {\n return;\n }\n const scheduler = this.scheduler;\n const message = new DelayMessage(scheduler.now() + this.delay, notification);\n this.queue.push(message);\n if (this.active === false) {\n this._schedule(scheduler);\n }\n }\n _next(value) {\n this.scheduleNotification(Notification.createNext(value));\n }\n _error(err) {\n this.errored = true;\n this.queue = [];\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.scheduleNotification(Notification.createComplete());\n this.unsubscribe();\n }\n}\nclass DelayMessage {\n constructor(time, notification) {\n this.time = time;\n this.notification = notification;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function dematerialize() {\n return function dematerializeOperatorFunction(source) {\n return source.lift(new DeMaterializeOperator());\n };\n}\nclass DeMaterializeOperator {\n call(subscriber, source) {\n return source.subscribe(new DeMaterializeSubscriber(subscriber));\n }\n}\nclass DeMaterializeSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n }\n _next(value) {\n value.observe(this.destination);\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function distinctUntilChanged(compare, keySelector) {\n return (source) => source.lift(new DistinctUntilChangedOperator(compare, keySelector));\n}\nclass DistinctUntilChangedOperator {\n constructor(compare, keySelector) {\n this.compare = compare;\n this.keySelector = keySelector;\n }\n call(subscriber, source) {\n return source.subscribe(new DistinctUntilChangedSubscriber(subscriber, this.compare, this.keySelector));\n }\n}\nclass DistinctUntilChangedSubscriber extends Subscriber {\n constructor(destination, compare, keySelector) {\n super(destination);\n this.keySelector = keySelector;\n this.hasKey = false;\n if (typeof compare === 'function') {\n this.compare = compare;\n }\n }\n compare(x, y) {\n return x === y;\n }\n _next(value) {\n let key;\n try {\n const { keySelector } = this;\n key = keySelector ? keySelector(value) : value;\n }\n catch (err) {\n return this.destination.error(err);\n }\n let result = false;\n if (this.hasKey) {\n try {\n const { compare } = this;\n result = compare(this.key, key);\n }\n catch (err) {\n return this.destination.error(err);\n }\n }\n else {\n this.hasKey = true;\n }\n if (!result) {\n this.key = key;\n this.destination.next(value);\n }\n }\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function exhaustMap(project, resultSelector) {\n if (resultSelector) {\n return (source) => source.pipe(exhaustMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii)))));\n }\n return (source) => source.lift(new ExhaustMapOperator(project));\n}\nclass ExhaustMapOperator {\n constructor(project) {\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new ExhaustMapSubscriber(subscriber, this.project));\n }\n}\nclass ExhaustMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project) {\n super(destination);\n this.project = project;\n this.hasSubscription = false;\n this.hasCompleted = false;\n this.index = 0;\n }\n _next(value) {\n if (!this.hasSubscription) {\n this.tryNext(value);\n }\n }\n tryNext(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.hasSubscription = true;\n this._innerSub(result);\n }\n _innerSub(result) {\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n const innerSubscription = innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n }\n _complete() {\n this.hasCompleted = true;\n if (!this.hasSubscription) {\n this.destination.complete();\n }\n this.unsubscribe();\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyError(err) {\n this.destination.error(err);\n }\n notifyComplete() {\n this.hasSubscription = false;\n if (this.hasCompleted) {\n this.destination.complete();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function filter(predicate, thisArg) {\n return function filterOperatorFunction(source) {\n return source.lift(new FilterOperator(predicate, thisArg));\n };\n}\nclass FilterOperator {\n constructor(predicate, thisArg) {\n this.predicate = predicate;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new FilterSubscriber(subscriber, this.predicate, this.thisArg));\n }\n}\nclass FilterSubscriber extends Subscriber {\n constructor(destination, predicate, thisArg) {\n super(destination);\n this.predicate = predicate;\n this.thisArg = thisArg;\n this.count = 0;\n }\n _next(value) {\n let result;\n try {\n result = this.predicate.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (result) {\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nexport function finalize(callback) {\n return (source) => source.lift(new FinallyOperator(callback));\n}\nclass FinallyOperator {\n constructor(callback) {\n this.callback = callback;\n }\n call(subscriber, source) {\n return source.subscribe(new FinallySubscriber(subscriber, this.callback));\n }\n}\nclass FinallySubscriber extends Subscriber {\n constructor(destination, callback) {\n super(destination);\n this.add(new Subscription(callback));\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nimport { Observable } from '../Observable';\nimport { Subject } from '../Subject';\nexport function groupBy(keySelector, elementSelector, durationSelector, subjectSelector) {\n return (source) => source.lift(new GroupByOperator(keySelector, elementSelector, durationSelector, subjectSelector));\n}\nclass GroupByOperator {\n constructor(keySelector, elementSelector, durationSelector, subjectSelector) {\n this.keySelector = keySelector;\n this.elementSelector = elementSelector;\n this.durationSelector = durationSelector;\n this.subjectSelector = subjectSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new GroupBySubscriber(subscriber, this.keySelector, this.elementSelector, this.durationSelector, this.subjectSelector));\n }\n}\nclass GroupBySubscriber extends Subscriber {\n constructor(destination, keySelector, elementSelector, durationSelector, subjectSelector) {\n super(destination);\n this.keySelector = keySelector;\n this.elementSelector = elementSelector;\n this.durationSelector = durationSelector;\n this.subjectSelector = subjectSelector;\n this.groups = null;\n this.attemptedToUnsubscribe = false;\n this.count = 0;\n }\n _next(value) {\n let key;\n try {\n key = this.keySelector(value);\n }\n catch (err) {\n this.error(err);\n return;\n }\n this._group(value, key);\n }\n _group(value, key) {\n let groups = this.groups;\n if (!groups) {\n groups = this.groups = new Map();\n }\n let group = groups.get(key);\n let element;\n if (this.elementSelector) {\n try {\n element = this.elementSelector(value);\n }\n catch (err) {\n this.error(err);\n }\n }\n else {\n element = value;\n }\n if (!group) {\n group = (this.subjectSelector ? this.subjectSelector() : new Subject());\n groups.set(key, group);\n const groupedObservable = new GroupedObservable(key, group, this);\n this.destination.next(groupedObservable);\n if (this.durationSelector) {\n let duration;\n try {\n duration = this.durationSelector(new GroupedObservable(key, group));\n }\n catch (err) {\n this.error(err);\n return;\n }\n this.add(duration.subscribe(new GroupDurationSubscriber(key, group, this)));\n }\n }\n if (!group.closed) {\n group.next(element);\n }\n }\n _error(err) {\n const groups = this.groups;\n if (groups) {\n groups.forEach((group, key) => {\n group.error(err);\n });\n groups.clear();\n }\n this.destination.error(err);\n }\n _complete() {\n const groups = this.groups;\n if (groups) {\n groups.forEach((group, key) => {\n group.complete();\n });\n groups.clear();\n }\n this.destination.complete();\n }\n removeGroup(key) {\n this.groups.delete(key);\n }\n unsubscribe() {\n if (!this.closed) {\n this.attemptedToUnsubscribe = true;\n if (this.count === 0) {\n super.unsubscribe();\n }\n }\n }\n}\nclass GroupDurationSubscriber extends Subscriber {\n constructor(key, group, parent) {\n super(group);\n this.key = key;\n this.group = group;\n this.parent = parent;\n }\n _next(value) {\n this.complete();\n }\n _unsubscribe() {\n const { parent, key } = this;\n this.key = this.parent = null;\n if (parent) {\n parent.removeGroup(key);\n }\n }\n}\nexport class GroupedObservable extends Observable {\n constructor(key, groupSubject, refCountSubscription) {\n super();\n this.key = key;\n this.groupSubject = groupSubject;\n this.refCountSubscription = refCountSubscription;\n }\n _subscribe(subscriber) {\n const subscription = new Subscription();\n const { refCountSubscription, groupSubject } = this;\n if (refCountSubscription && !refCountSubscription.closed) {\n subscription.add(new InnerRefCountSubscription(refCountSubscription));\n }\n subscription.add(groupSubject.subscribe(subscriber));\n return subscription;\n }\n}\nclass InnerRefCountSubscription extends Subscription {\n constructor(parent) {\n super();\n this.parent = parent;\n parent.count++;\n }\n unsubscribe() {\n const parent = this.parent;\n if (!parent.closed && !this.closed) {\n super.unsubscribe();\n parent.count -= 1;\n if (parent.count === 0 && parent.attemptedToUnsubscribe) {\n parent.unsubscribe();\n }\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function ignoreElements() {\n return function ignoreElementsOperatorFunction(source) {\n return source.lift(new IgnoreElementsOperator());\n };\n}\nclass IgnoreElementsOperator {\n call(subscriber, source) {\n return source.subscribe(new IgnoreElementsSubscriber(subscriber));\n }\n}\nclass IgnoreElementsSubscriber extends Subscriber {\n _next(unused) {\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { takeLast } from './takeLast';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { identity } from '../util/identity';\nexport function last(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, takeLast(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { Subscriber } from '../Subscriber';\nexport function map(project, thisArg) {\n return function mapOperation(source) {\n if (typeof project !== 'function') {\n throw new TypeError('argument is not a function. Are you looking for `mapTo()`?');\n }\n return source.lift(new MapOperator(project, thisArg));\n };\n}\nexport class MapOperator {\n constructor(project, thisArg) {\n this.project = project;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new MapSubscriber(subscriber, this.project, this.thisArg));\n }\n}\nclass MapSubscriber extends Subscriber {\n constructor(destination, project, thisArg) {\n super(destination);\n this.project = project;\n this.count = 0;\n this.thisArg = thisArg || this;\n }\n _next(value) {\n let result;\n try {\n result = this.project.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function materialize() {\n return function materializeOperatorFunction(source) {\n return source.lift(new MaterializeOperator());\n };\n}\nclass MaterializeOperator {\n call(subscriber, source) {\n return source.subscribe(new MaterializeSubscriber(subscriber));\n }\n}\nclass MaterializeSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n }\n _next(value) {\n this.destination.next(Notification.createNext(value));\n }\n _error(err) {\n const destination = this.destination;\n destination.next(Notification.createError(err));\n destination.complete();\n }\n _complete() {\n const destination = this.destination;\n destination.next(Notification.createComplete());\n destination.complete();\n }\n}\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Number.POSITIVE_INFINITY) {\n return mergeMap(identity, concurrent);\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function mergeMap(project, resultSelector, concurrent = Number.POSITIVE_INFINITY) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(mergeMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii))), concurrent));\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return (source) => source.lift(new MergeMapOperator(project, concurrent));\n}\nexport class MergeMapOperator {\n constructor(project, concurrent = Number.POSITIVE_INFINITY) {\n this.project = project;\n this.concurrent = concurrent;\n }\n call(observer, source) {\n return source.subscribe(new MergeMapSubscriber(observer, this.project, this.concurrent));\n }\n}\nexport class MergeMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project, concurrent = Number.POSITIVE_INFINITY) {\n super(destination);\n this.project = project;\n this.concurrent = concurrent;\n this.hasCompleted = false;\n this.buffer = [];\n this.active = 0;\n this.index = 0;\n }\n _next(value) {\n if (this.active < this.concurrent) {\n this._tryNext(value);\n }\n else {\n this.buffer.push(value);\n }\n }\n _tryNext(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.active++;\n this._innerSub(result);\n }\n _innerSub(ish) {\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n const innerSubscription = innerSubscribe(ish, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n }\n _complete() {\n this.hasCompleted = true;\n if (this.active === 0 && this.buffer.length === 0) {\n this.destination.complete();\n }\n this.unsubscribe();\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyComplete() {\n const buffer = this.buffer;\n this.active--;\n if (buffer.length > 0) {\n this._next(buffer.shift());\n }\n else if (this.active === 0 && this.hasCompleted) {\n this.destination.complete();\n }\n }\n}\nexport const flatMap = mergeMap;\n","import { connectableObservableDescriptor } from '../observable/ConnectableObservable';\nexport function multicast(subjectOrSubjectFactory, selector) {\n return function multicastOperatorFunction(source) {\n let subjectFactory;\n if (typeof subjectOrSubjectFactory === 'function') {\n subjectFactory = subjectOrSubjectFactory;\n }\n else {\n subjectFactory = function subjectFactory() {\n return subjectOrSubjectFactory;\n };\n }\n if (typeof selector === 'function') {\n return source.lift(new MulticastOperator(subjectFactory, selector));\n }\n const connectable = Object.create(source, connectableObservableDescriptor);\n connectable.source = source;\n connectable.subjectFactory = subjectFactory;\n return connectable;\n };\n}\nexport class MulticastOperator {\n constructor(subjectFactory, selector) {\n this.subjectFactory = subjectFactory;\n this.selector = selector;\n }\n call(subscriber, source) {\n const { selector } = this;\n const subject = this.subjectFactory();\n const subscription = selector(subject).subscribe(subscriber);\n subscription.add(source.subscribe(subject));\n return subscription;\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function observeOn(scheduler, delay = 0) {\n return function observeOnOperatorFunction(source) {\n return source.lift(new ObserveOnOperator(scheduler, delay));\n };\n}\nexport class ObserveOnOperator {\n constructor(scheduler, delay = 0) {\n this.scheduler = scheduler;\n this.delay = delay;\n }\n call(subscriber, source) {\n return source.subscribe(new ObserveOnSubscriber(subscriber, this.scheduler, this.delay));\n }\n}\nexport class ObserveOnSubscriber extends Subscriber {\n constructor(destination, scheduler, delay = 0) {\n super(destination);\n this.scheduler = scheduler;\n this.delay = delay;\n }\n static dispatch(arg) {\n const { notification, destination } = arg;\n notification.observe(destination);\n this.unsubscribe();\n }\n scheduleMessage(notification) {\n const destination = this.destination;\n destination.add(this.scheduler.schedule(ObserveOnSubscriber.dispatch, this.delay, new ObserveOnMessage(notification, this.destination)));\n }\n _next(value) {\n this.scheduleMessage(Notification.createNext(value));\n }\n _error(err) {\n this.scheduleMessage(Notification.createError(err));\n this.unsubscribe();\n }\n _complete() {\n this.scheduleMessage(Notification.createComplete());\n this.unsubscribe();\n }\n}\nexport class ObserveOnMessage {\n constructor(notification, destination) {\n this.notification = notification;\n this.destination = destination;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function pairwise() {\n return (source) => source.lift(new PairwiseOperator());\n}\nclass PairwiseOperator {\n call(subscriber, source) {\n return source.subscribe(new PairwiseSubscriber(subscriber));\n }\n}\nclass PairwiseSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n this.hasPrev = false;\n }\n _next(value) {\n let pair;\n if (this.hasPrev) {\n pair = [this.prev, value];\n }\n else {\n this.hasPrev = true;\n }\n this.prev = value;\n if (pair) {\n this.destination.next(pair);\n }\n }\n}\n","import { not } from '../util/not';\nimport { filter } from './filter';\nexport function partition(predicate, thisArg) {\n return (source) => [\n filter(predicate, thisArg)(source),\n filter(not(predicate, thisArg))(source)\n ];\n}\n","import { map } from './map';\nexport function pluck(...properties) {\n const length = properties.length;\n if (length === 0) {\n throw new Error('list of properties cannot be empty.');\n }\n return (source) => map(plucker(properties, length))(source);\n}\nfunction plucker(props, length) {\n const mapper = (x) => {\n let currentProp = x;\n for (let i = 0; i < length; i++) {\n const p = currentProp != null ? currentProp[props[i]] : undefined;\n if (p !== void 0) {\n currentProp = p;\n }\n else {\n return undefined;\n }\n }\n return currentProp;\n };\n return mapper;\n}\n","import { Subscriber } from '../Subscriber';\nexport function refCount() {\n return function refCountOperatorFunction(source) {\n return source.lift(new RefCountOperator(source));\n };\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function scan(accumulator, seed) {\n let hasSeed = false;\n if (arguments.length >= 2) {\n hasSeed = true;\n }\n return function scanOperatorFunction(source) {\n return source.lift(new ScanOperator(accumulator, seed, hasSeed));\n };\n}\nclass ScanOperator {\n constructor(accumulator, seed, hasSeed = false) {\n this.accumulator = accumulator;\n this.seed = seed;\n this.hasSeed = hasSeed;\n }\n call(subscriber, source) {\n return source.subscribe(new ScanSubscriber(subscriber, this.accumulator, this.seed, this.hasSeed));\n }\n}\nclass ScanSubscriber extends Subscriber {\n constructor(destination, accumulator, _seed, hasSeed) {\n super(destination);\n this.accumulator = accumulator;\n this._seed = _seed;\n this.hasSeed = hasSeed;\n this.index = 0;\n }\n get seed() {\n return this._seed;\n }\n set seed(value) {\n this.hasSeed = true;\n this._seed = value;\n }\n _next(value) {\n if (!this.hasSeed) {\n this.seed = value;\n this.destination.next(value);\n }\n else {\n return this._tryNext(value);\n }\n }\n _tryNext(value) {\n const index = this.index++;\n let result;\n try {\n result = this.accumulator(this.seed, value, index);\n }\n catch (err) {\n this.destination.error(err);\n }\n this.seed = result;\n this.destination.next(result);\n }\n}\n","import { multicast } from './multicast';\nimport { refCount } from './refCount';\nimport { Subject } from '../Subject';\nfunction shareSubjectFactory() {\n return new Subject();\n}\nexport function share() {\n return (source) => refCount()(multicast(shareSubjectFactory)(source));\n}\n","import { ReplaySubject } from '../ReplaySubject';\nexport function shareReplay(configOrBufferSize, windowTime, scheduler) {\n let config;\n if (configOrBufferSize && typeof configOrBufferSize === 'object') {\n config = configOrBufferSize;\n }\n else {\n config = {\n bufferSize: configOrBufferSize,\n windowTime,\n refCount: false,\n scheduler,\n };\n }\n return (source) => source.lift(shareReplayOperator(config));\n}\nfunction shareReplayOperator({ bufferSize = Number.POSITIVE_INFINITY, windowTime = Number.POSITIVE_INFINITY, refCount: useRefCount, scheduler, }) {\n let subject;\n let refCount = 0;\n let subscription;\n let hasError = false;\n let isComplete = false;\n return function shareReplayOperation(source) {\n refCount++;\n let innerSub;\n if (!subject || hasError) {\n hasError = false;\n subject = new ReplaySubject(bufferSize, windowTime, scheduler);\n innerSub = subject.subscribe(this);\n subscription = source.subscribe({\n next(value) {\n subject.next(value);\n },\n error(err) {\n hasError = true;\n subject.error(err);\n },\n complete() {\n isComplete = true;\n subscription = undefined;\n subject.complete();\n },\n });\n if (isComplete) {\n subscription = undefined;\n }\n }\n else {\n innerSub = subject.subscribe(this);\n }\n this.add(() => {\n refCount--;\n innerSub.unsubscribe();\n innerSub = undefined;\n if (subscription && !isComplete && useRefCount && refCount === 0) {\n subscription.unsubscribe();\n subscription = undefined;\n subject = undefined;\n }\n });\n };\n}\n","import { Subscriber } from '../Subscriber';\nexport function skip(count) {\n return (source) => source.lift(new SkipOperator(count));\n}\nclass SkipOperator {\n constructor(total) {\n this.total = total;\n }\n call(subscriber, source) {\n return source.subscribe(new SkipSubscriber(subscriber, this.total));\n }\n}\nclass SkipSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.count = 0;\n }\n _next(x) {\n if (++this.count > this.total) {\n this.destination.next(x);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function skipWhile(predicate) {\n return (source) => source.lift(new SkipWhileOperator(predicate));\n}\nclass SkipWhileOperator {\n constructor(predicate) {\n this.predicate = predicate;\n }\n call(subscriber, source) {\n return source.subscribe(new SkipWhileSubscriber(subscriber, this.predicate));\n }\n}\nclass SkipWhileSubscriber extends Subscriber {\n constructor(destination, predicate) {\n super(destination);\n this.predicate = predicate;\n this.skipping = true;\n this.index = 0;\n }\n _next(value) {\n const destination = this.destination;\n if (this.skipping) {\n this.tryCallPredicate(value);\n }\n if (!this.skipping) {\n destination.next(value);\n }\n }\n tryCallPredicate(value) {\n try {\n const result = this.predicate(value, this.index++);\n this.skipping = Boolean(result);\n }\n catch (err) {\n this.destination.error(err);\n }\n }\n}\n","import { concat } from '../observable/concat';\nimport { isScheduler } from '../util/isScheduler';\nexport function startWith(...array) {\n const scheduler = array[array.length - 1];\n if (isScheduler(scheduler)) {\n array.pop();\n return (source) => concat(array, source, scheduler);\n }\n else {\n return (source) => concat(array, source);\n }\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function switchMap(project, resultSelector) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(switchMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii)))));\n }\n return (source) => source.lift(new SwitchMapOperator(project));\n}\nclass SwitchMapOperator {\n constructor(project) {\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new SwitchMapSubscriber(subscriber, this.project));\n }\n}\nclass SwitchMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project) {\n super(destination);\n this.project = project;\n this.index = 0;\n }\n _next(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (error) {\n this.destination.error(error);\n return;\n }\n this._innerSub(result);\n }\n _innerSub(result) {\n const innerSubscription = this.innerSubscription;\n if (innerSubscription) {\n innerSubscription.unsubscribe();\n }\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n this.innerSubscription = innerSubscribe(result, innerSubscriber);\n if (this.innerSubscription !== innerSubscriber) {\n destination.add(this.innerSubscription);\n }\n }\n _complete() {\n const { innerSubscription } = this;\n if (!innerSubscription || innerSubscription.closed) {\n super._complete();\n }\n this.unsubscribe();\n }\n _unsubscribe() {\n this.innerSubscription = undefined;\n }\n notifyComplete() {\n this.innerSubscription = undefined;\n if (this.isStopped) {\n super._complete();\n }\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function take(count) {\n return (source) => {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeOperator(count));\n }\n };\n}\nclass TakeOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeSubscriber(subscriber, this.total));\n }\n}\nclass TakeSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.count = 0;\n }\n _next(value) {\n const total = this.total;\n const count = ++this.count;\n if (count <= total) {\n this.destination.next(value);\n if (count === total) {\n this.destination.complete();\n this.unsubscribe();\n }\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function takeLast(count) {\n return function takeLastOperatorFunction(source) {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeLastOperator(count));\n }\n };\n}\nclass TakeLastOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeLastSubscriber(subscriber, this.total));\n }\n}\nclass TakeLastSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.ring = new Array();\n this.count = 0;\n }\n _next(value) {\n const ring = this.ring;\n const total = this.total;\n const count = this.count++;\n if (ring.length < total) {\n ring.push(value);\n }\n else {\n const index = count % total;\n ring[index] = value;\n }\n }\n _complete() {\n const destination = this.destination;\n let count = this.count;\n if (count > 0) {\n const total = this.count >= this.total ? this.total : this.count;\n const ring = this.ring;\n for (let i = 0; i < total; i++) {\n const idx = (count++) % total;\n destination.next(ring[idx]);\n }\n }\n destination.complete();\n }\n}\n","import { innerSubscribe, SimpleInnerSubscriber, SimpleOuterSubscriber } from '../innerSubscribe';\nexport function takeUntil(notifier) {\n return (source) => source.lift(new TakeUntilOperator(notifier));\n}\nclass TakeUntilOperator {\n constructor(notifier) {\n this.notifier = notifier;\n }\n call(subscriber, source) {\n const takeUntilSubscriber = new TakeUntilSubscriber(subscriber);\n const notifierSubscription = innerSubscribe(this.notifier, new SimpleInnerSubscriber(takeUntilSubscriber));\n if (notifierSubscription && !takeUntilSubscriber.seenValue) {\n takeUntilSubscriber.add(notifierSubscription);\n return source.subscribe(takeUntilSubscriber);\n }\n return takeUntilSubscriber;\n }\n}\nclass TakeUntilSubscriber extends SimpleOuterSubscriber {\n constructor(destination) {\n super(destination);\n this.seenValue = false;\n }\n notifyNext() {\n this.seenValue = true;\n this.complete();\n }\n notifyComplete() {\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function takeWhile(predicate, inclusive = false) {\n return (source) => source.lift(new TakeWhileOperator(predicate, inclusive));\n}\nclass TakeWhileOperator {\n constructor(predicate, inclusive) {\n this.predicate = predicate;\n this.inclusive = inclusive;\n }\n call(subscriber, source) {\n return source.subscribe(new TakeWhileSubscriber(subscriber, this.predicate, this.inclusive));\n }\n}\nclass TakeWhileSubscriber extends Subscriber {\n constructor(destination, predicate, inclusive) {\n super(destination);\n this.predicate = predicate;\n this.inclusive = inclusive;\n this.index = 0;\n }\n _next(value) {\n const destination = this.destination;\n let result;\n try {\n result = this.predicate(value, this.index++);\n }\n catch (err) {\n destination.error(err);\n return;\n }\n this.nextOrComplete(value, result);\n }\n nextOrComplete(value, predicateResult) {\n const destination = this.destination;\n if (Boolean(predicateResult)) {\n destination.next(value);\n }\n else {\n if (this.inclusive) {\n destination.next(value);\n }\n destination.complete();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { noop } from '../util/noop';\nimport { isFunction } from '../util/isFunction';\nexport function tap(nextOrObserver, error, complete) {\n return function tapOperatorFunction(source) {\n return source.lift(new DoOperator(nextOrObserver, error, complete));\n };\n}\nclass DoOperator {\n constructor(nextOrObserver, error, complete) {\n this.nextOrObserver = nextOrObserver;\n this.error = error;\n this.complete = complete;\n }\n call(subscriber, source) {\n return source.subscribe(new TapSubscriber(subscriber, this.nextOrObserver, this.error, this.complete));\n }\n}\nclass TapSubscriber extends Subscriber {\n constructor(destination, observerOrNext, error, complete) {\n super(destination);\n this._tapNext = noop;\n this._tapError = noop;\n this._tapComplete = noop;\n this._tapError = error || noop;\n this._tapComplete = complete || noop;\n if (isFunction(observerOrNext)) {\n this._context = this;\n this._tapNext = observerOrNext;\n }\n else if (observerOrNext) {\n this._context = observerOrNext;\n this._tapNext = observerOrNext.next || noop;\n this._tapError = observerOrNext.error || noop;\n this._tapComplete = observerOrNext.complete || noop;\n }\n }\n _next(value) {\n try {\n this._tapNext.call(this._context, value);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(value);\n }\n _error(err) {\n try {\n this._tapError.call(this._context, err);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.error(err);\n }\n _complete() {\n try {\n this._tapComplete.call(this._context);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n return this.destination.complete();\n }\n}\n","import { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport const defaultThrottleConfig = {\n leading: true,\n trailing: false\n};\nexport function throttle(durationSelector, config = defaultThrottleConfig) {\n return (source) => source.lift(new ThrottleOperator(durationSelector, !!config.leading, !!config.trailing));\n}\nclass ThrottleOperator {\n constructor(durationSelector, leading, trailing) {\n this.durationSelector = durationSelector;\n this.leading = leading;\n this.trailing = trailing;\n }\n call(subscriber, source) {\n return source.subscribe(new ThrottleSubscriber(subscriber, this.durationSelector, this.leading, this.trailing));\n }\n}\nclass ThrottleSubscriber extends SimpleOuterSubscriber {\n constructor(destination, durationSelector, _leading, _trailing) {\n super(destination);\n this.destination = destination;\n this.durationSelector = durationSelector;\n this._leading = _leading;\n this._trailing = _trailing;\n this._hasValue = false;\n }\n _next(value) {\n this._hasValue = true;\n this._sendValue = value;\n if (!this._throttled) {\n if (this._leading) {\n this.send();\n }\n else {\n this.throttle(value);\n }\n }\n }\n send() {\n const { _hasValue, _sendValue } = this;\n if (_hasValue) {\n this.destination.next(_sendValue);\n this.throttle(_sendValue);\n }\n this._hasValue = false;\n this._sendValue = undefined;\n }\n throttle(value) {\n const duration = this.tryDurationSelector(value);\n if (!!duration) {\n this.add(this._throttled = innerSubscribe(duration, new SimpleInnerSubscriber(this)));\n }\n }\n tryDurationSelector(value) {\n try {\n return this.durationSelector(value);\n }\n catch (err) {\n this.destination.error(err);\n return null;\n }\n }\n throttlingDone() {\n const { _throttled, _trailing } = this;\n if (_throttled) {\n _throttled.unsubscribe();\n }\n this._throttled = undefined;\n if (_trailing) {\n this.send();\n }\n }\n notifyNext() {\n this.throttlingDone();\n }\n notifyComplete() {\n this.throttlingDone();\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { async } from '../scheduler/async';\nimport { defaultThrottleConfig } from './throttle';\nexport function throttleTime(duration, scheduler = async, config = defaultThrottleConfig) {\n return (source) => source.lift(new ThrottleTimeOperator(duration, scheduler, config.leading, config.trailing));\n}\nclass ThrottleTimeOperator {\n constructor(duration, scheduler, leading, trailing) {\n this.duration = duration;\n this.scheduler = scheduler;\n this.leading = leading;\n this.trailing = trailing;\n }\n call(subscriber, source) {\n return source.subscribe(new ThrottleTimeSubscriber(subscriber, this.duration, this.scheduler, this.leading, this.trailing));\n }\n}\nclass ThrottleTimeSubscriber extends Subscriber {\n constructor(destination, duration, scheduler, leading, trailing) {\n super(destination);\n this.duration = duration;\n this.scheduler = scheduler;\n this.leading = leading;\n this.trailing = trailing;\n this._hasTrailingValue = false;\n this._trailingValue = null;\n }\n _next(value) {\n if (this.throttled) {\n if (this.trailing) {\n this._trailingValue = value;\n this._hasTrailingValue = true;\n }\n }\n else {\n this.add(this.throttled = this.scheduler.schedule(dispatchNext, this.duration, { subscriber: this }));\n if (this.leading) {\n this.destination.next(value);\n }\n else if (this.trailing) {\n this._trailingValue = value;\n this._hasTrailingValue = true;\n }\n }\n }\n _complete() {\n if (this._hasTrailingValue) {\n this.destination.next(this._trailingValue);\n this.destination.complete();\n }\n else {\n this.destination.complete();\n }\n }\n clearThrottle() {\n const throttled = this.throttled;\n if (throttled) {\n if (this.trailing && this._hasTrailingValue) {\n this.destination.next(this._trailingValue);\n this._trailingValue = null;\n this._hasTrailingValue = false;\n }\n throttled.unsubscribe();\n this.remove(throttled);\n this.throttled = null;\n }\n }\n}\nfunction dispatchNext(arg) {\n const { subscriber } = arg;\n subscriber.clearThrottle();\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { Subscriber } from '../Subscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return (source) => {\n return source.lift(new ThrowIfEmptyOperator(errorFactory));\n };\n}\nclass ThrowIfEmptyOperator {\n constructor(errorFactory) {\n this.errorFactory = errorFactory;\n }\n call(subscriber, source) {\n return source.subscribe(new ThrowIfEmptySubscriber(subscriber, this.errorFactory));\n }\n}\nclass ThrowIfEmptySubscriber extends Subscriber {\n constructor(destination, errorFactory) {\n super(destination);\n this.errorFactory = errorFactory;\n this.hasValue = false;\n }\n _next(value) {\n this.hasValue = true;\n this.destination.next(value);\n }\n _complete() {\n if (!this.hasValue) {\n let err;\n try {\n err = this.errorFactory();\n }\n catch (e) {\n err = e;\n }\n this.destination.error(err);\n }\n else {\n return this.destination.complete();\n }\n }\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","import { async } from '../scheduler/async';\nimport { TimeoutError } from '../util/TimeoutError';\nimport { timeoutWith } from './timeoutWith';\nimport { throwError } from '../observable/throwError';\nexport function timeout(due, scheduler = async) {\n return timeoutWith(due, throwError(new TimeoutError()), scheduler);\n}\n","import { async } from '../scheduler/async';\nimport { isDate } from '../util/isDate';\nimport { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport function timeoutWith(due, withObservable, scheduler = async) {\n return (source) => {\n let absoluteTimeout = isDate(due);\n let waitFor = absoluteTimeout ? (+due - scheduler.now()) : Math.abs(due);\n return source.lift(new TimeoutWithOperator(waitFor, absoluteTimeout, withObservable, scheduler));\n };\n}\nclass TimeoutWithOperator {\n constructor(waitFor, absoluteTimeout, withObservable, scheduler) {\n this.waitFor = waitFor;\n this.absoluteTimeout = absoluteTimeout;\n this.withObservable = withObservable;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new TimeoutWithSubscriber(subscriber, this.absoluteTimeout, this.waitFor, this.withObservable, this.scheduler));\n }\n}\nclass TimeoutWithSubscriber extends SimpleOuterSubscriber {\n constructor(destination, absoluteTimeout, waitFor, withObservable, scheduler) {\n super(destination);\n this.absoluteTimeout = absoluteTimeout;\n this.waitFor = waitFor;\n this.withObservable = withObservable;\n this.scheduler = scheduler;\n this.scheduleTimeout();\n }\n static dispatchTimeout(subscriber) {\n const { withObservable } = subscriber;\n subscriber._unsubscribeAndRecycle();\n subscriber.add(innerSubscribe(withObservable, new SimpleInnerSubscriber(subscriber)));\n }\n scheduleTimeout() {\n const { action } = this;\n if (action) {\n this.action = action.schedule(this, this.waitFor);\n }\n else {\n this.add(this.action = this.scheduler.schedule(TimeoutWithSubscriber.dispatchTimeout, this.waitFor, this));\n }\n }\n _next(value) {\n if (!this.absoluteTimeout) {\n this.scheduleTimeout();\n }\n super._next(value);\n }\n _unsubscribe() {\n this.action = undefined;\n this.scheduler = null;\n this.withObservable = null;\n }\n}\n","import { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nexport function withLatestFrom(...args) {\n return (source) => {\n let project;\n if (typeof args[args.length - 1] === 'function') {\n project = args.pop();\n }\n const observables = args;\n return source.lift(new WithLatestFromOperator(observables, project));\n };\n}\nclass WithLatestFromOperator {\n constructor(observables, project) {\n this.observables = observables;\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new WithLatestFromSubscriber(subscriber, this.observables, this.project));\n }\n}\nclass WithLatestFromSubscriber extends OuterSubscriber {\n constructor(destination, observables, project) {\n super(destination);\n this.observables = observables;\n this.project = project;\n this.toRespond = [];\n const len = observables.length;\n this.values = new Array(len);\n for (let i = 0; i < len; i++) {\n this.toRespond.push(i);\n }\n for (let i = 0; i < len; i++) {\n let observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n this.values[outerIndex] = innerValue;\n const toRespond = this.toRespond;\n if (toRespond.length > 0) {\n const found = toRespond.indexOf(outerIndex);\n if (found !== -1) {\n toRespond.splice(found, 1);\n }\n }\n }\n notifyComplete() {\n }\n _next(value) {\n if (this.toRespond.length === 0) {\n const args = [value, ...this.values];\n if (this.project) {\n this._tryProject(args);\n }\n else {\n this.destination.next(args);\n }\n }\n }\n _tryProject(args) {\n let result;\n try {\n result = this.project.apply(this, args);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function scheduleArray(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n let i = 0;\n sub.add(scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n return;\n }\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n sub.add(this.schedule());\n }\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function scheduleIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable(subscriber => {\n const sub = new Subscription();\n let iterator;\n sub.add(() => {\n if (iterator && typeof iterator.return === 'function') {\n iterator.return();\n }\n });\n sub.add(scheduler.schedule(() => {\n iterator = input[Symbol_iterator]();\n sub.add(scheduler.schedule(function () {\n if (subscriber.closed) {\n return;\n }\n let value;\n let done;\n try {\n const result = iterator.next();\n value = result.value;\n done = result.done;\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n this.schedule();\n }\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport function scheduleObservable(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => {\n const observable = input[Symbol_observable]();\n sub.add(observable.subscribe({\n next(value) { sub.add(scheduler.schedule(() => subscriber.next(value))); },\n error(err) { sub.add(scheduler.schedule(() => subscriber.error(err))); },\n complete() { sub.add(scheduler.schedule(() => subscriber.complete())); },\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function schedulePromise(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => input.then(value => {\n sub.add(scheduler.schedule(() => {\n subscriber.next(value);\n sub.add(scheduler.schedule(() => subscriber.complete()));\n }));\n }, err => {\n sub.add(scheduler.schedule(() => subscriber.error(err)));\n })));\n return sub;\n });\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n else if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n else if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n else if (isIterable(input) || typeof input === 'string') {\n return scheduleIterable(input, scheduler);\n }\n }\n throw new TypeError((input !== null && typeof input || input) + ' is not observable');\n}\n","import { Subscription } from '../Subscription';\nexport class Action extends Subscription {\n constructor(scheduler, work) {\n super();\n }\n schedule(state, delay = 0) {\n return this;\n }\n}\n","import { AsyncAction } from './AsyncAction';\nexport class AnimationFrameAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler.scheduled || (scheduler.scheduled = requestAnimationFrame(() => scheduler.flush(null)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n if (scheduler.actions.length === 0) {\n cancelAnimationFrame(id);\n scheduler.scheduled = undefined;\n }\n return undefined;\n }\n}\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AnimationFrameScheduler extends AsyncScheduler {\n flush(action) {\n this.active = true;\n this.scheduled = undefined;\n const { actions } = this;\n let error;\n let index = -1;\n let count = actions.length;\n action = action || actions.shift();\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (++index < count && (action = actions.shift()));\n this.active = false;\n if (error) {\n while (++index < count && (action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { Immediate } from '../util/Immediate';\nimport { AsyncAction } from './AsyncAction';\nexport class AsapAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler.scheduled || (scheduler.scheduled = Immediate.setImmediate(scheduler.flush.bind(scheduler, null)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n if (scheduler.actions.length === 0) {\n Immediate.clearImmediate(id);\n scheduler.scheduled = undefined;\n }\n return undefined;\n }\n}\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AsapScheduler extends AsyncScheduler {\n flush(action) {\n this.active = true;\n this.scheduled = undefined;\n const { actions } = this;\n let error;\n let index = -1;\n let count = actions.length;\n action = action || actions.shift();\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (++index < count && (action = actions.shift()));\n this.active = false;\n if (error) {\n while (++index < count && (action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { Action } from './Action';\nexport class AsyncAction extends Action {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n this.pending = false;\n }\n schedule(state, delay = 0) {\n if (this.closed) {\n return this;\n }\n this.state = state;\n const id = this.id;\n const scheduler = this.scheduler;\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, delay);\n }\n this.pending = true;\n this.delay = delay;\n this.id = this.id || this.requestAsyncId(scheduler, this.id, delay);\n return this;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n return setInterval(scheduler.flush.bind(scheduler, this), delay);\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && this.delay === delay && this.pending === false) {\n return id;\n }\n clearInterval(id);\n return undefined;\n }\n execute(state, delay) {\n if (this.closed) {\n return new Error('executing a cancelled action');\n }\n this.pending = false;\n const error = this._execute(state, delay);\n if (error) {\n return error;\n }\n else if (this.pending === false && this.id != null) {\n this.id = this.recycleAsyncId(this.scheduler, this.id, null);\n }\n }\n _execute(state, delay) {\n let errored = false;\n let errorValue = undefined;\n try {\n this.work(state);\n }\n catch (e) {\n errored = true;\n errorValue = !!e && e || new Error(e);\n }\n if (errored) {\n this.unsubscribe();\n return errorValue;\n }\n }\n _unsubscribe() {\n const id = this.id;\n const scheduler = this.scheduler;\n const actions = scheduler.actions;\n const index = actions.indexOf(this);\n this.work = null;\n this.state = null;\n this.pending = false;\n this.scheduler = null;\n if (index !== -1) {\n actions.splice(index, 1);\n }\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, null);\n }\n this.delay = null;\n }\n}\n","import { Scheduler } from '../Scheduler';\nexport class AsyncScheduler extends Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n super(SchedulerAction, () => {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.now();\n }\n else {\n return now();\n }\n });\n this.actions = [];\n this.active = false;\n this.scheduled = undefined;\n }\n schedule(work, delay = 0, state) {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.schedule(work, delay, state);\n }\n else {\n return super.schedule(work, delay, state);\n }\n }\n flush(action) {\n const { actions } = this;\n if (this.active) {\n actions.push(action);\n return;\n }\n let error;\n this.active = true;\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (action = actions.shift());\n this.active = false;\n if (error) {\n while (action = actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { AsyncAction } from './AsyncAction';\nexport class QueueAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n schedule(state, delay = 0) {\n if (delay > 0) {\n return super.schedule(state, delay);\n }\n this.delay = delay;\n this.state = state;\n this.scheduler.flush(this);\n return this;\n }\n execute(state, delay) {\n return (delay > 0 || this.closed) ?\n super.execute(state, delay) :\n this._execute(state, delay);\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n return scheduler.flush(this);\n }\n}\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class QueueScheduler extends AsyncScheduler {\n}\n","import { AnimationFrameAction } from './AnimationFrameAction';\nimport { AnimationFrameScheduler } from './AnimationFrameScheduler';\nexport const animationFrameScheduler = new AnimationFrameScheduler(AnimationFrameAction);\nexport const animationFrame = animationFrameScheduler;\n","import { AsapAction } from './AsapAction';\nimport { AsapScheduler } from './AsapScheduler';\nexport const asapScheduler = new AsapScheduler(AsapAction);\nexport const asap = asapScheduler;\n","import { AsyncAction } from './AsyncAction';\nimport { AsyncScheduler } from './AsyncScheduler';\nexport const asyncScheduler = new AsyncScheduler(AsyncAction);\nexport const async = asyncScheduler;\n","import { QueueAction } from './QueueAction';\nimport { QueueScheduler } from './QueueScheduler';\nexport const queueScheduler = new QueueScheduler(QueueAction);\nexport const queue = queueScheduler;\n","export function getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexport const iterator = getSymbolIterator();\nexport const $$iterator = iterator;\n","export const observable = (() => typeof Symbol === 'function' && Symbol.observable || '@@observable')();\n","export const rxSubscriber = (() => typeof Symbol === 'function'\n ? Symbol('rxSubscriber')\n : '@@rxSubscriber_' + Math.random())();\nexport const $$rxSubscriber = rxSubscriber;\n","const ArgumentOutOfRangeErrorImpl = (() => {\n function ArgumentOutOfRangeErrorImpl() {\n Error.call(this);\n this.message = 'argument out of range';\n this.name = 'ArgumentOutOfRangeError';\n return this;\n }\n ArgumentOutOfRangeErrorImpl.prototype = Object.create(Error.prototype);\n return ArgumentOutOfRangeErrorImpl;\n})();\nexport const ArgumentOutOfRangeError = ArgumentOutOfRangeErrorImpl;\n","const EmptyErrorImpl = (() => {\n function EmptyErrorImpl() {\n Error.call(this);\n this.message = 'no elements in sequence';\n this.name = 'EmptyError';\n return this;\n }\n EmptyErrorImpl.prototype = Object.create(Error.prototype);\n return EmptyErrorImpl;\n})();\nexport const EmptyError = EmptyErrorImpl;\n","let nextHandle = 1;\nconst RESOLVED = (() => Promise.resolve())();\nconst activeHandles = {};\nfunction findAndClearHandle(handle) {\n if (handle in activeHandles) {\n delete activeHandles[handle];\n return true;\n }\n return false;\n}\nexport const Immediate = {\n setImmediate(cb) {\n const handle = nextHandle++;\n activeHandles[handle] = true;\n RESOLVED.then(() => findAndClearHandle(handle) && cb());\n return handle;\n },\n clearImmediate(handle) {\n findAndClearHandle(handle);\n },\n};\nexport const TestTools = {\n pending() {\n return Object.keys(activeHandles).length;\n }\n};\n","const ObjectUnsubscribedErrorImpl = (() => {\n function ObjectUnsubscribedErrorImpl() {\n Error.call(this);\n this.message = 'object unsubscribed';\n this.name = 'ObjectUnsubscribedError';\n return this;\n }\n ObjectUnsubscribedErrorImpl.prototype = Object.create(Error.prototype);\n return ObjectUnsubscribedErrorImpl;\n})();\nexport const ObjectUnsubscribedError = ObjectUnsubscribedErrorImpl;\n","const TimeoutErrorImpl = (() => {\n function TimeoutErrorImpl() {\n Error.call(this);\n this.message = 'Timeout has occurred';\n this.name = 'TimeoutError';\n return this;\n }\n TimeoutErrorImpl.prototype = Object.create(Error.prototype);\n return TimeoutErrorImpl;\n})();\nexport const TimeoutError = TimeoutErrorImpl;\n","const UnsubscriptionErrorImpl = (() => {\n function UnsubscriptionErrorImpl(errors) {\n Error.call(this);\n this.message = errors ?\n `${errors.length} errors occurred during unsubscription:\n${errors.map((err, i) => `${i + 1}) ${err.toString()}`).join('\\n ')}` : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n return this;\n }\n UnsubscriptionErrorImpl.prototype = Object.create(Error.prototype);\n return UnsubscriptionErrorImpl;\n})();\nexport const UnsubscriptionError = UnsubscriptionErrorImpl;\n","import { Subscriber } from '../Subscriber';\nexport function canReportError(observer) {\n while (observer) {\n const { closed, destination, isStopped } = observer;\n if (closed || isStopped) {\n return false;\n }\n else if (destination && destination instanceof Subscriber) {\n observer = destination;\n }\n else {\n observer = null;\n }\n }\n return true;\n}\n","export function hostReportError(err) {\n setTimeout(() => { throw err; }, 0);\n}\n","export function identity(x) {\n return x;\n}\n","export const isArray = (() => Array.isArray || ((x) => x && typeof x.length === 'number'))();\n","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","export function isDate(value) {\n return value instanceof Date && !isNaN(+value);\n}\n","export function isFunction(x) {\n return typeof x === 'function';\n}\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport function isInteropObservable(input) {\n return input && typeof input[Symbol_observable] === 'function';\n}\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function isIterable(input) {\n return input && typeof input[Symbol_iterator] === 'function';\n}\n","import { isArray } from './isArray';\nexport function isNumeric(val) {\n return !isArray(val) && (val - parseFloat(val) + 1) >= 0;\n}\n","export function isObject(x) {\n return x !== null && typeof x === 'object';\n}\n","import { Observable } from '../Observable';\nexport function isObservable(obj) {\n return !!obj && (obj instanceof Observable || (typeof obj.lift === 'function' && typeof obj.subscribe === 'function'));\n}\n","export function isPromise(value) {\n return !!value && typeof value.subscribe !== 'function' && typeof value.then === 'function';\n}\n","export function isScheduler(value) {\n return value && typeof value.schedule === 'function';\n}\n","export function noop() { }\n","export function not(pred, thisArg) {\n function notPred() {\n return !(notPred.pred.apply(notPred.thisArg, arguments));\n }\n notPred.pred = pred;\n notPred.thisArg = thisArg;\n return notPred;\n}\n","import { identity } from './identity';\nexport function pipe(...fns) {\n return pipeFromArray(fns);\n}\nexport function pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce((prev, fn) => fn(prev), input);\n };\n}\n","import { subscribeToArray } from './subscribeToArray';\nimport { subscribeToPromise } from './subscribeToPromise';\nimport { subscribeToIterable } from './subscribeToIterable';\nimport { subscribeToObservable } from './subscribeToObservable';\nimport { isArrayLike } from './isArrayLike';\nimport { isPromise } from './isPromise';\nimport { isObject } from './isObject';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeTo = (result) => {\n if (!!result && typeof result[Symbol_observable] === 'function') {\n return subscribeToObservable(result);\n }\n else if (isArrayLike(result)) {\n return subscribeToArray(result);\n }\n else if (isPromise(result)) {\n return subscribeToPromise(result);\n }\n else if (!!result && typeof result[Symbol_iterator] === 'function') {\n return subscribeToIterable(result);\n }\n else {\n const value = isObject(result) ? 'an invalid object' : `'${result}'`;\n const msg = `You provided ${value} where a stream was expected.`\n + ' You can provide an Observable, Promise, Array, or Iterable.';\n throw new TypeError(msg);\n }\n};\n","export const subscribeToArray = (array) => (subscriber) => {\n for (let i = 0, len = array.length; i < len && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n};\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport const subscribeToIterable = (iterable) => (subscriber) => {\n const iterator = iterable[Symbol_iterator]();\n do {\n let item;\n try {\n item = iterator.next();\n }\n catch (err) {\n subscriber.error(err);\n return subscriber;\n }\n if (item.done) {\n subscriber.complete();\n break;\n }\n subscriber.next(item.value);\n if (subscriber.closed) {\n break;\n }\n } while (true);\n if (typeof iterator.return === 'function') {\n subscriber.add(() => {\n if (iterator.return) {\n iterator.return();\n }\n });\n }\n return subscriber;\n};\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeToObservable = (obj) => (subscriber) => {\n const obs = obj[Symbol_observable]();\n if (typeof obs.subscribe !== 'function') {\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n }\n else {\n return obs.subscribe(subscriber);\n }\n};\n","import { hostReportError } from './hostReportError';\nexport const subscribeToPromise = (promise) => (subscriber) => {\n promise.then((value) => {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, (err) => subscriber.error(err))\n .then(null, hostReportError);\n return subscriber;\n};\n","import { InnerSubscriber } from '../InnerSubscriber';\nimport { subscribeTo } from './subscribeTo';\nimport { Observable } from '../Observable';\nexport function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, innerSubscriber = new InnerSubscriber(outerSubscriber, outerValue, outerIndex)) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n return subscribeTo(result)(innerSubscriber);\n}\n","import { Subscriber } from '../Subscriber';\nimport { rxSubscriber as rxSubscriberSymbol } from '../symbol/rxSubscriber';\nimport { empty as emptyObserver } from '../Observer';\nexport function toSubscriber(nextOrObserver, error, complete) {\n if (nextOrObserver) {\n if (nextOrObserver instanceof Subscriber) {\n return nextOrObserver;\n }\n if (nextOrObserver[rxSubscriberSymbol]) {\n return nextOrObserver[rxSubscriberSymbol]();\n }\n }\n if (!nextOrObserver && !error && !complete) {\n return new Subscriber(emptyObserver);\n }\n return new Subscriber(nextOrObserver, error, complete);\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\n/**\n * Returns `true` if action has the same type as action creator.\n * Defines Type Guard that lets TypeScript know `payload` type inside blocks\n * where `isType` returned `true`.\n *\n * @example\n *\n * const somethingHappened =\n * actionCreator<{foo: string}>('SOMETHING_HAPPENED');\n *\n * if (isType(action, somethingHappened)) {\n * // action.payload has type {foo: string}\n * }\n */\nfunction isType(action, actionCreator) {\n return action.type === actionCreator.type;\n}\nexports.isType = isType;\n/**\n * Creates Action Creator factory with optional prefix for action types.\n * @param prefix Prefix to be prepended to action types as `/`.\n * @param defaultIsError Function that detects whether action is error given the\n * payload. Default is `payload => payload instanceof Error`.\n */\nfunction actionCreatorFactory(prefix, defaultIsError) {\n if (defaultIsError === void 0) { defaultIsError = function (p) { return p instanceof Error; }; }\n var actionTypes = {};\n var base = prefix ? prefix + \"/\" : '';\n function actionCreator(type, commonMeta, isError) {\n if (isError === void 0) { isError = defaultIsError; }\n var fullType = base + type;\n if (process.env.NODE_ENV !== 'production') {\n if (actionTypes[fullType])\n throw new Error(\"Duplicate action type: \" + fullType);\n actionTypes[fullType] = true;\n }\n return Object.assign(function (payload, meta) {\n var action = {\n type: fullType,\n payload: payload,\n };\n if (commonMeta || meta) {\n action.meta = Object.assign({}, commonMeta, meta);\n }\n if (isError && (typeof isError === 'boolean' || isError(payload))) {\n action.error = true;\n }\n return action;\n }, {\n type: fullType,\n toString: function () { return fullType; },\n match: function (action) {\n return action.type === fullType;\n },\n });\n }\n function asyncActionCreators(type, commonMeta) {\n return {\n type: base + type,\n started: actionCreator(type + \"_STARTED\", commonMeta, false),\n done: actionCreator(type + \"_DONE\", commonMeta, false),\n failed: actionCreator(type + \"_FAILED\", commonMeta, true),\n };\n }\n return Object.assign(actionCreator, { async: asyncActionCreators });\n}\nexports.actionCreatorFactory = actionCreatorFactory;\nexports.default = actionCreatorFactory;\n","/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n extendStatics = Object.setPrototypeOf ||\r\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n if (typeof b !== \"function\" && b !== null)\r\n throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n extendStatics(d, b);\r\n function __() { this.constructor = d; }\r\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n __assign = Object.assign || function __assign(t) {\r\n for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n s = arguments[i];\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n }\r\n return t;\r\n }\r\n return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n var t = {};\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n t[p] = s[p];\r\n if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n t[p[i]] = s[p[i]];\r\n }\r\n return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n return new (P || (P = Promise))(function (resolve, reject) {\r\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n function verb(n) { return function (v) { return step([n, v]); }; }\r\n function step(op) {\r\n if (f) throw new TypeError(\"Generator is already executing.\");\r\n while (_) try {\r\n if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n if (y = 0, t) op = [op[0] & 2, t.value];\r\n switch (op[0]) {\r\n case 0: case 1: t = op; break;\r\n case 4: _.label++; return { value: op[1], done: false };\r\n case 5: _.label++; y = op[1]; op = [0]; continue;\r\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n default:\r\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n if (t[2]) _.ops.pop();\r\n _.trys.pop(); continue;\r\n }\r\n op = body.call(thisArg, _);\r\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });\r\n}) : (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n if (m) return m.call(o);\r\n if (o && typeof o.length === \"number\") return {\r\n next: function () {\r\n if (o && i >= o.length) o = void 0;\r\n return { value: o && o[i++], done: !o };\r\n }\r\n };\r\n throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n if (!m) return o;\r\n var i = m.call(o), r, ar = [], e;\r\n try {\r\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n }\r\n catch (error) { e = { error: error }; }\r\n finally {\r\n try {\r\n if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n }\r\n finally { if (e) throw e.error; }\r\n }\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n for (var ar = [], i = 0; i < arguments.length; i++)\r\n ar = ar.concat(__read(arguments[i]));\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n r[k] = a[j];\r\n return r;\r\n}\r\n\r\nexport function __spreadArray(to, from, pack) {\r\n if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\r\n if (ar || !(i in from)) {\r\n if (!ar) ar = Array.prototype.slice.call(from, 0, i);\r\n ar[i] = from[i];\r\n }\r\n }\r\n return to.concat(ar || Array.prototype.slice.call(from));\r\n}\r\n\r\nexport function __await(v) {\r\n return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n function fulfill(value) { resume(\"next\", value); }\r\n function reject(value) { resume(\"throw\", value); }\r\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n var i, p;\r\n return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var m = o[Symbol.asyncIterator], i;\r\n return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n o[\"default\"] = v;\r\n};\r\n\r\nexport function __importStar(mod) {\r\n if (mod && mod.__esModule) return mod;\r\n var result = {};\r\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\r\n __setModuleDefault(result, mod);\r\n return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, state, kind, f) {\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a getter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot read private member from an object whose class did not declare it\");\r\n return kind === \"m\" ? f : kind === \"a\" ? f.call(receiver) : f ? f.value : state.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, state, value, kind, f) {\r\n if (kind === \"m\") throw new TypeError(\"Private method is not writable\");\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a setter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot write private member to an object whose class did not declare it\");\r\n return (kind === \"a\" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;\r\n}\r\n","/**\n * @license Angular v13.1.3\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the [AnimationBuilder.build](api/animations/AnimationBuilder#build)() method\n * to create a programmatic animation. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n}\n/**\n * A factory object returned from the\n * [AnimationBuilder.build](api/animations/AnimationBuilder#build)()\n * method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Specifies automatic styling.\n *\n * @publicApi\n */\nconst AUTO_STYLE = '*';\n/**\n * Creates a named animation trigger, containing a list of [`state()`](api/animations/state)\n * and `transition()` entries to be evaluated when the expression\n * bound to the trigger changes.\n *\n * @param name An identifying string.\n * @param definitions An animation definition object, containing an array of\n * [`state()`](api/animations/state) and `transition()` declarations.\n *\n * @return An object that encapsulates the trigger data.\n *\n * @usageNotes\n * Define an animation trigger in the `animations` section of `@Component` metadata.\n * In the template, reference the trigger by name and bind it to a trigger expression that\n * evaluates to a defined animation state, using the following format:\n *\n * `[@triggerName]=\"expression\"`\n *\n * Animation trigger bindings convert all values to strings, and then match the\n * previous and current values against any linked transitions.\n * Booleans can be specified as `1` or `true` and `0` or `false`.\n *\n * ### Usage Example\n *\n * The following example creates an animation trigger reference based on the provided\n * name value.\n * The provided animation value is expected to be an array consisting of state and\n * transition declarations.\n *\n * ```typescript\n * @Component({\n * selector: \"my-component\",\n * templateUrl: \"my-component-tpl.html\",\n * animations: [\n * trigger(\"myAnimationTrigger\", [\n * state(...),\n * state(...),\n * transition(...),\n * transition(...)\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"something\";\n * }\n * ```\n *\n * The template associated with this component makes use of the defined trigger\n * by binding to an element within its template code.\n *\n * ```html\n * \n *
...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n *
\n * \n *
\n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: 7 /* Trigger */, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" }),\n * style({ background: \"red\" })\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: 4 /* Animate */, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: 3 /* Group */, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: 2 /* Sequence */, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation [`state`](api/animations/state), within an animation\n *`sequence`, or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow an element to animate from\n * a height of 0 up to its full height:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: 6 /* Style */, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: 0 /* State */, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: 5 /* Keyframes */, steps };\n}\n/**\n * Declares an animation transition which is played when a certain specified condition is met.\n *\n * @param stateChangeExpr A string with a specific format or a function that specifies when the\n * animation transition should occur (see [State Change Expression](#state-change-expression)).\n *\n * @param steps One or more animation objects that represent the animation's instructions.\n *\n * @param options An options object that can be used to specify a delay for the animation or provide\n * custom parameters for it.\n *\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n *\n * ### State Change Expression\n *\n * The State Change Expression instructs Angular when to run the transition's animations, it can\n *either be\n * - a string with a specific syntax\n * - or a function that compares the previous and current state (value of the expression bound to\n * the element's trigger) and returns `true` if the transition should occur or `false` otherwise\n *\n * The string format can be:\n * - `fromState => toState`, which indicates that the transition's animations should occur then the\n * expression bound to the trigger's element goes from `fromState` to `toState`\n *\n * _Example:_\n * ```typescript\n * transition('open => closed', animate('.5s ease-out', style({ height: 0 }) ))\n * ```\n *\n * - `fromState <=> toState`, which indicates that the transition's animations should occur then\n * the expression bound to the trigger's element goes from `fromState` to `toState` or vice versa\n *\n * _Example:_\n * ```typescript\n * transition('enabled <=> disabled', animate('1s cubic-bezier(0.8,0.3,0,1)'))\n * ```\n *\n * - `:enter`/`:leave`, which indicates that the transition's animations should occur when the\n * element enters or exists the DOM\n *\n * _Example:_\n * ```typescript\n * transition(':enter', [\n * style({ opacity: 0 }),\n * animate('500ms', style({ opacity: 1 }))\n * ])\n * ```\n *\n * - `:increment`/`:decrement`, which indicates that the transition's animations should occur when\n * the numerical expression bound to the trigger's element has increased in value or decreased\n *\n * _Example:_\n * ```typescript\n * transition(':increment', query('@counter', animateChild()))\n * ```\n *\n * - a sequence of any of the above divided by commas, which indicates that transition's animations\n * should occur whenever one of the state change expressions matches\n *\n * _Example:_\n * ```typescript\n * transition(':increment, * => enabled, :enter', animate('1s ease', keyframes([\n * style({ transform: 'scale(1)', offset: 0}),\n * style({ transform: 'scale(1.1)', offset: 0.7}),\n * style({ transform: 'scale(1)', offset: 1})\n * ]))),\n * ```\n *\n * Also note that in such context:\n * - `void` can be used to indicate the absence of the element\n * - asterisks can be used as wildcards that match any state\n * - (as a consequence of the above, `void => *` is equivalent to `:enter` and `* => void` is\n * equivalent to `:leave`)\n * - `true` and `false` also match expression values of `1` and `0` respectively (but do not match\n * _truthy_ and _falsy_ values)\n *\n *
\n *\n * Be careful about entering end leaving elements as their transitions present a common\n * pitfall for developers.\n *\n * Note that when an element with a trigger enters the DOM its `:enter` transition always\n * gets executed, but its `:leave` transition will not be executed if the element is removed\n * alongside its parent (as it will be removed \"without warning\" before its transition has\n * a chance to be executed, the only way that such transition can occur is if the element\n * is exiting the DOM on its own).\n *\n *\n *
\n *\n * ### Animating to a Final State\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no `style` data, that step is automatically considered the final animation arc,\n * for the element to reach the final state, in such case Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n *\n * ### Usage Examples\n *\n * - Transition animations applied based on\n * the trigger's expression value\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\"on => off, open => closed\", animate(500)),\n * transition(\"* <=> error\", query('.indicator', animateChild()))\n * ])\n * ```\n *\n * - Transition animations applied based on custom logic dependent\n * on the trigger's expression value and provided parameters\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\n * (fromState, toState, _element, params) =>\n * ['firststep', 'laststep'].includes(fromState.toLowerCase())\n * && toState === params?.['target'],\n * animate('1s')\n * )\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: 1 /* Transition */, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: 8 /* Reference */, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: 9 /* AnimateChild */, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: 10 /* AnimateRef */, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements (not\n * all elements can be queried via these tokens, see\n * [Entering and Leaving Elements](#entering-and-leaving-elements))\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n *\n * ### Multiple Tokens\n *\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Entering and Leaving Elements\n *\n * Not all elements can be queried via the `:enter` and `:leave` tokens, the only ones\n * that can are those that Angular assumes can enter/leave based on their own logic\n * (if their insertion/removal is simply a consequence of that of their parent they\n * should be queried via a different token in their parent's `:enter`/`:leave` transitions).\n *\n * The only elements Angular assumes can enter/leave on their own logic (thus the only\n * ones that can be queried via the `:enter` and `:leave` tokens) are:\n * - Those inserted dynamically (via `ViewContainerRef`)\n * - Those that have a structural directive (which, under the hood, are a subset of the above ones)\n *\n *
\n *\n * Note that elements will be successfully queried via `:enter`/`:leave` even if their\n * insertion/removal is not done manually via `ViewContainerRef`or caused by their structural\n * directive (e.g. they enter/exit alongside their parent).\n *\n *
\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n *
\n *
Title
\n *
\n * Blah blah blah\n *
\n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: 11 /* Query */, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * \n * \n *
\n *
\n * {{ item }}\n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: 12 /* Stagger */, timings, animation };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction scheduleMicroTask(cb) {\n Promise.resolve(null).then(cb);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see `animate()`\n * @see `AnimationPlayer`\n * @see `GroupPlayer`\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this._position = 0;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n scheduleMicroTask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this._started = false;\n }\n setPosition(position) {\n this._position = this.totalTime ? position * this.totalTime : 1;\n }\n getPosition() {\n return this.totalTime ? this._position / this.totalTime : 1;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see `AnimationPlayer`\n * @see `{@link animations/group group()}`\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n scheduleMicroTask(() => this._onFinish());\n }\n else {\n this.players.forEach(player => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach(player => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach(player => player.play());\n }\n pause() {\n this.players.forEach(player => player.pause());\n }\n restart() {\n this.players.forEach(player => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach(player => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach(player => player.destroy());\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach(player => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach(player => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n const longestPlayer = this.players.reduce((longestSoFar, player) => {\n const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;\n return newPlayerIsLongest ? player : longestSoFar;\n }, null);\n return longestPlayer != null ? longestPlayer.getPosition() : 0;\n }\n beforeDestroy() {\n this.players.forEach(player => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ɵPRE_STYLE = '!';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, ɵPRE_STYLE };\n","/**\n * @license Angular v13.1.3\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { ɵAnimationGroupPlayer, NoopAnimationPlayer, AUTO_STYLE, ɵPRE_STYLE, sequence, style } from '@angular/animations';\nimport * as i0 from '@angular/core';\nimport { Injectable } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction isBrowser() {\n return (typeof window !== 'undefined' && typeof window.document !== 'undefined');\n}\nfunction isNode() {\n // Checking only for `process` isn't enough to identify whether or not we're in a Node\n // environment, because Webpack by default will polyfill the `process`. While we can discern\n // that Webpack polyfilled it by looking at `process.browser`, it's very Webpack-specific and\n // might not be future-proof. Instead we look at the stringified version of `process` which\n // is `[object process]` in Node and `[object Object]` when polyfilled.\n return typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n}\nfunction optimizeGroupPlayer(players) {\n switch (players.length) {\n case 0:\n return new NoopAnimationPlayer();\n case 1:\n return players[0];\n default:\n return new ɵAnimationGroupPlayer(players);\n }\n}\nfunction normalizeKeyframes(driver, normalizer, element, keyframes, preStyles = {}, postStyles = {}) {\n const errors = [];\n const normalizedKeyframes = [];\n let previousOffset = -1;\n let previousKeyframe = null;\n keyframes.forEach(kf => {\n const offset = kf['offset'];\n const isSameOffset = offset == previousOffset;\n const normalizedKeyframe = (isSameOffset && previousKeyframe) || {};\n Object.keys(kf).forEach(prop => {\n let normalizedProp = prop;\n let normalizedValue = kf[prop];\n if (prop !== 'offset') {\n normalizedProp = normalizer.normalizePropertyName(normalizedProp, errors);\n switch (normalizedValue) {\n case ɵPRE_STYLE:\n normalizedValue = preStyles[prop];\n break;\n case AUTO_STYLE:\n normalizedValue = postStyles[prop];\n break;\n default:\n normalizedValue =\n normalizer.normalizeStyleValue(prop, normalizedProp, normalizedValue, errors);\n break;\n }\n }\n normalizedKeyframe[normalizedProp] = normalizedValue;\n });\n if (!isSameOffset) {\n normalizedKeyframes.push(normalizedKeyframe);\n }\n previousKeyframe = normalizedKeyframe;\n previousOffset = offset;\n });\n if (errors.length) {\n const LINE_START = '\\n - ';\n throw new Error(`Unable to animate due to the following errors:${LINE_START}${errors.join(LINE_START)}`);\n }\n return normalizedKeyframes;\n}\nfunction listenOnPlayer(player, eventName, event, callback) {\n switch (eventName) {\n case 'start':\n player.onStart(() => callback(event && copyAnimationEvent(event, 'start', player)));\n break;\n case 'done':\n player.onDone(() => callback(event && copyAnimationEvent(event, 'done', player)));\n break;\n case 'destroy':\n player.onDestroy(() => callback(event && copyAnimationEvent(event, 'destroy', player)));\n break;\n }\n}\nfunction copyAnimationEvent(e, phaseName, player) {\n const totalTime = player.totalTime;\n const disabled = player.disabled ? true : false;\n const event = makeAnimationEvent(e.element, e.triggerName, e.fromState, e.toState, phaseName || e.phaseName, totalTime == undefined ? e.totalTime : totalTime, disabled);\n const data = e['_data'];\n if (data != null) {\n event['_data'] = data;\n }\n return event;\n}\nfunction makeAnimationEvent(element, triggerName, fromState, toState, phaseName = '', totalTime = 0, disabled) {\n return { element, triggerName, fromState, toState, phaseName, totalTime, disabled: !!disabled };\n}\nfunction getOrSetAsInMap(map, key, defaultValue) {\n let value;\n if (map instanceof Map) {\n value = map.get(key);\n if (!value) {\n map.set(key, value = defaultValue);\n }\n }\n else {\n value = map[key];\n if (!value) {\n value = map[key] = defaultValue;\n }\n }\n return value;\n}\nfunction parseTimelineCommand(command) {\n const separatorPos = command.indexOf(':');\n const id = command.substring(1, separatorPos);\n const action = command.substr(separatorPos + 1);\n return [id, action];\n}\nlet _contains = (elm1, elm2) => false;\nlet _query = (element, selector, multi) => {\n return [];\n};\n// Define utility methods for browsers and platform-server(domino) where Element\n// and utility methods exist.\nconst _isNode = isNode();\nif (_isNode || typeof Element !== 'undefined') {\n if (!isBrowser()) {\n _contains = (elm1, elm2) => elm1.contains(elm2);\n }\n else {\n _contains = (elm1, elm2) => {\n while (elm2 && elm2 !== document.documentElement) {\n if (elm2 === elm1) {\n return true;\n }\n elm2 = elm2.parentNode || elm2.host; // consider host to support shadow DOM\n }\n return false;\n };\n }\n _query = (element, selector, multi) => {\n if (multi) {\n return Array.from(element.querySelectorAll(selector));\n }\n const elem = element.querySelector(selector);\n return elem ? [elem] : [];\n };\n}\nfunction containsVendorPrefix(prop) {\n // Webkit is the only real popular vendor prefix nowadays\n // cc: http://shouldiprefix.com/\n return prop.substring(1, 6) == 'ebkit'; // webkit or Webkit\n}\nlet _CACHED_BODY = null;\nlet _IS_WEBKIT = false;\nfunction validateStyleProperty(prop) {\n if (!_CACHED_BODY) {\n _CACHED_BODY = getBodyNode() || {};\n _IS_WEBKIT = _CACHED_BODY.style ? ('WebkitAppearance' in _CACHED_BODY.style) : false;\n }\n let result = true;\n if (_CACHED_BODY.style && !containsVendorPrefix(prop)) {\n result = prop in _CACHED_BODY.style;\n if (!result && _IS_WEBKIT) {\n const camelProp = 'Webkit' + prop.charAt(0).toUpperCase() + prop.substr(1);\n result = camelProp in _CACHED_BODY.style;\n }\n }\n return result;\n}\nfunction getBodyNode() {\n if (typeof document != 'undefined') {\n return document.body;\n }\n return null;\n}\nconst containsElement = _contains;\nconst invokeQuery = _query;\nfunction hypenatePropsObject(object) {\n const newObj = {};\n Object.keys(object).forEach(prop => {\n const newProp = prop.replace(/([a-z])([A-Z])/g, '$1-$2');\n newObj[newProp] = object[prop];\n });\n return newObj;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NoopAnimationDriver {\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(_element, _selector) {\n // This method is deprecated and no longer in use so we return false.\n return false;\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return defaultValue || '';\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n return new NoopAnimationPlayer(duration, delay);\n }\n}\nNoopAnimationDriver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NoopAnimationDriver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNoopAnimationDriver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NoopAnimationDriver });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NoopAnimationDriver, decorators: [{\n type: Injectable\n }] });\n/**\n * @publicApi\n */\nclass AnimationDriver {\n}\nAnimationDriver.NOOP = ( /* @__PURE__ */new NoopAnimationDriver());\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_SECOND$1 = 1000;\nconst SUBSTITUTION_EXPR_START = '{{';\nconst SUBSTITUTION_EXPR_END = '}}';\nconst ENTER_CLASSNAME = 'ng-enter';\nconst LEAVE_CLASSNAME = 'ng-leave';\nconst NG_TRIGGER_CLASSNAME = 'ng-trigger';\nconst NG_TRIGGER_SELECTOR = '.ng-trigger';\nconst NG_ANIMATING_CLASSNAME = 'ng-animating';\nconst NG_ANIMATING_SELECTOR = '.ng-animating';\nfunction resolveTimingValue(value) {\n if (typeof value == 'number')\n return value;\n const matches = value.match(/^(-?[\\.\\d]+)(m?s)/);\n if (!matches || matches.length < 2)\n return 0;\n return _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n}\nfunction _convertTimeValueToMS(value, unit) {\n switch (unit) {\n case 's':\n return value * ONE_SECOND$1;\n default: // ms or something else\n return value;\n }\n}\nfunction resolveTiming(timings, errors, allowNegativeValues) {\n return timings.hasOwnProperty('duration') ?\n timings :\n parseTimeExpression(timings, errors, allowNegativeValues);\n}\nfunction parseTimeExpression(exp, errors, allowNegativeValues) {\n const regex = /^(-?[\\.\\d]+)(m?s)(?:\\s+(-?[\\.\\d]+)(m?s))?(?:\\s+([-a-z]+(?:\\(.+?\\))?))?$/i;\n let duration;\n let delay = 0;\n let easing = '';\n if (typeof exp === 'string') {\n const matches = exp.match(regex);\n if (matches === null) {\n errors.push(`The provided timing value \"${exp}\" is invalid.`);\n return { duration: 0, delay: 0, easing: '' };\n }\n duration = _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n const delayMatch = matches[3];\n if (delayMatch != null) {\n delay = _convertTimeValueToMS(parseFloat(delayMatch), matches[4]);\n }\n const easingVal = matches[5];\n if (easingVal) {\n easing = easingVal;\n }\n }\n else {\n duration = exp;\n }\n if (!allowNegativeValues) {\n let containsErrors = false;\n let startIndex = errors.length;\n if (duration < 0) {\n errors.push(`Duration values below 0 are not allowed for this animation step.`);\n containsErrors = true;\n }\n if (delay < 0) {\n errors.push(`Delay values below 0 are not allowed for this animation step.`);\n containsErrors = true;\n }\n if (containsErrors) {\n errors.splice(startIndex, 0, `The provided timing value \"${exp}\" is invalid.`);\n }\n }\n return { duration, delay, easing };\n}\nfunction copyObj(obj, destination = {}) {\n Object.keys(obj).forEach(prop => {\n destination[prop] = obj[prop];\n });\n return destination;\n}\nfunction normalizeStyles(styles) {\n const normalizedStyles = {};\n if (Array.isArray(styles)) {\n styles.forEach(data => copyStyles(data, false, normalizedStyles));\n }\n else {\n copyStyles(styles, false, normalizedStyles);\n }\n return normalizedStyles;\n}\nfunction copyStyles(styles, readPrototype, destination = {}) {\n if (readPrototype) {\n // we make use of a for-in loop so that the\n // prototypically inherited properties are\n // revealed from the backFill map\n for (let prop in styles) {\n destination[prop] = styles[prop];\n }\n }\n else {\n copyObj(styles, destination);\n }\n return destination;\n}\nfunction getStyleAttributeString(element, key, value) {\n // Return the key-value pair string to be added to the style attribute for the\n // given CSS style key.\n if (value) {\n return key + ':' + value + ';';\n }\n else {\n return '';\n }\n}\nfunction writeStyleAttribute(element) {\n // Read the style property of the element and manually reflect it to the\n // style attribute. This is needed because Domino on platform-server doesn't\n // understand the full set of allowed CSS properties and doesn't reflect some\n // of them automatically.\n let styleAttrValue = '';\n for (let i = 0; i < element.style.length; i++) {\n const key = element.style.item(i);\n styleAttrValue += getStyleAttributeString(element, key, element.style.getPropertyValue(key));\n }\n for (const key in element.style) {\n // Skip internal Domino properties that don't need to be reflected.\n if (!element.style.hasOwnProperty(key) || key.startsWith('_')) {\n continue;\n }\n const dashKey = camelCaseToDashCase(key);\n styleAttrValue += getStyleAttributeString(element, dashKey, element.style[key]);\n }\n element.setAttribute('style', styleAttrValue);\n}\nfunction setStyles(element, styles, formerStyles) {\n if (element['style']) {\n Object.keys(styles).forEach(prop => {\n const camelProp = dashCaseToCamelCase(prop);\n if (formerStyles && !formerStyles.hasOwnProperty(prop)) {\n formerStyles[prop] = element.style[camelProp];\n }\n element.style[camelProp] = styles[prop];\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction eraseStyles(element, styles) {\n if (element['style']) {\n Object.keys(styles).forEach(prop => {\n const camelProp = dashCaseToCamelCase(prop);\n element.style[camelProp] = '';\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction normalizeAnimationEntry(steps) {\n if (Array.isArray(steps)) {\n if (steps.length == 1)\n return steps[0];\n return sequence(steps);\n }\n return steps;\n}\nfunction validateStyleParams(value, options, errors) {\n const params = options.params || {};\n const matches = extractStyleParams(value);\n if (matches.length) {\n matches.forEach(varName => {\n if (!params.hasOwnProperty(varName)) {\n errors.push(`Unable to resolve the local animation param ${varName} in the given list of values`);\n }\n });\n }\n}\nconst PARAM_REGEX = new RegExp(`${SUBSTITUTION_EXPR_START}\\\\s*(.+?)\\\\s*${SUBSTITUTION_EXPR_END}`, 'g');\nfunction extractStyleParams(value) {\n let params = [];\n if (typeof value === 'string') {\n let match;\n while (match = PARAM_REGEX.exec(value)) {\n params.push(match[1]);\n }\n PARAM_REGEX.lastIndex = 0;\n }\n return params;\n}\nfunction interpolateParams(value, params, errors) {\n const original = value.toString();\n const str = original.replace(PARAM_REGEX, (_, varName) => {\n let localVal = params[varName];\n // this means that the value was never overridden by the data passed in by the user\n if (!params.hasOwnProperty(varName)) {\n errors.push(`Please provide a value for the animation param ${varName}`);\n localVal = '';\n }\n return localVal.toString();\n });\n // we do this to assert that numeric values stay as they are\n return str == original ? value : str;\n}\nfunction iteratorToArray(iterator) {\n const arr = [];\n let item = iterator.next();\n while (!item.done) {\n arr.push(item.value);\n item = iterator.next();\n }\n return arr;\n}\nconst DASH_CASE_REGEXP = /-+([a-z0-9])/g;\nfunction dashCaseToCamelCase(input) {\n return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase());\n}\nfunction camelCaseToDashCase(input) {\n return input.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase();\n}\nfunction allowPreviousPlayerStylesMerge(duration, delay) {\n return duration === 0 || delay === 0;\n}\nfunction balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles) {\n const previousStyleProps = Object.keys(previousStyles);\n if (previousStyleProps.length && keyframes.length) {\n let startingKeyframe = keyframes[0];\n let missingStyleProps = [];\n previousStyleProps.forEach(prop => {\n if (!startingKeyframe.hasOwnProperty(prop)) {\n missingStyleProps.push(prop);\n }\n startingKeyframe[prop] = previousStyles[prop];\n });\n if (missingStyleProps.length) {\n // tslint:disable-next-line\n for (var i = 1; i < keyframes.length; i++) {\n let kf = keyframes[i];\n missingStyleProps.forEach(function (prop) {\n kf[prop] = computeStyle(element, prop);\n });\n }\n }\n }\n return keyframes;\n}\nfunction visitDslNode(visitor, node, context) {\n switch (node.type) {\n case 7 /* Trigger */:\n return visitor.visitTrigger(node, context);\n case 0 /* State */:\n return visitor.visitState(node, context);\n case 1 /* Transition */:\n return visitor.visitTransition(node, context);\n case 2 /* Sequence */:\n return visitor.visitSequence(node, context);\n case 3 /* Group */:\n return visitor.visitGroup(node, context);\n case 4 /* Animate */:\n return visitor.visitAnimate(node, context);\n case 5 /* Keyframes */:\n return visitor.visitKeyframes(node, context);\n case 6 /* Style */:\n return visitor.visitStyle(node, context);\n case 8 /* Reference */:\n return visitor.visitReference(node, context);\n case 9 /* AnimateChild */:\n return visitor.visitAnimateChild(node, context);\n case 10 /* AnimateRef */:\n return visitor.visitAnimateRef(node, context);\n case 11 /* Query */:\n return visitor.visitQuery(node, context);\n case 12 /* Stagger */:\n return visitor.visitStagger(node, context);\n default:\n throw new Error(`Unable to resolve animation metadata node #${node.type}`);\n }\n}\nfunction computeStyle(element, prop) {\n return window.getComputedStyle(element)[prop];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ANY_STATE = '*';\nfunction parseTransitionExpr(transitionValue, errors) {\n const expressions = [];\n if (typeof transitionValue == 'string') {\n transitionValue.split(/\\s*,\\s*/).forEach(str => parseInnerTransitionStr(str, expressions, errors));\n }\n else {\n expressions.push(transitionValue);\n }\n return expressions;\n}\nfunction parseInnerTransitionStr(eventStr, expressions, errors) {\n if (eventStr[0] == ':') {\n const result = parseAnimationAlias(eventStr, errors);\n if (typeof result == 'function') {\n expressions.push(result);\n return;\n }\n eventStr = result;\n }\n const match = eventStr.match(/^(\\*|[-\\w]+)\\s*()\\s*(\\*|[-\\w]+)$/);\n if (match == null || match.length < 4) {\n errors.push(`The provided transition expression \"${eventStr}\" is not supported`);\n return expressions;\n }\n const fromState = match[1];\n const separator = match[2];\n const toState = match[3];\n expressions.push(makeLambdaFromStates(fromState, toState));\n const isFullAnyStateExpr = fromState == ANY_STATE && toState == ANY_STATE;\n if (separator[0] == '<' && !isFullAnyStateExpr) {\n expressions.push(makeLambdaFromStates(toState, fromState));\n }\n}\nfunction parseAnimationAlias(alias, errors) {\n switch (alias) {\n case ':enter':\n return 'void => *';\n case ':leave':\n return '* => void';\n case ':increment':\n return (fromState, toState) => parseFloat(toState) > parseFloat(fromState);\n case ':decrement':\n return (fromState, toState) => parseFloat(toState) < parseFloat(fromState);\n default:\n errors.push(`The transition alias value \"${alias}\" is not supported`);\n return '* => *';\n }\n}\n// DO NOT REFACTOR ... keep the follow set instantiations\n// with the values intact (closure compiler for some reason\n// removes follow-up lines that add the values outside of\n// the constructor...\nconst TRUE_BOOLEAN_VALUES = new Set(['true', '1']);\nconst FALSE_BOOLEAN_VALUES = new Set(['false', '0']);\nfunction makeLambdaFromStates(lhs, rhs) {\n const LHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(lhs) || FALSE_BOOLEAN_VALUES.has(lhs);\n const RHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(rhs) || FALSE_BOOLEAN_VALUES.has(rhs);\n return (fromState, toState) => {\n let lhsMatch = lhs == ANY_STATE || lhs == fromState;\n let rhsMatch = rhs == ANY_STATE || rhs == toState;\n if (!lhsMatch && LHS_MATCH_BOOLEAN && typeof fromState === 'boolean') {\n lhsMatch = fromState ? TRUE_BOOLEAN_VALUES.has(lhs) : FALSE_BOOLEAN_VALUES.has(lhs);\n }\n if (!rhsMatch && RHS_MATCH_BOOLEAN && typeof toState === 'boolean') {\n rhsMatch = toState ? TRUE_BOOLEAN_VALUES.has(rhs) : FALSE_BOOLEAN_VALUES.has(rhs);\n }\n return lhsMatch && rhsMatch;\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst SELF_TOKEN = ':self';\nconst SELF_TOKEN_REGEX = new RegExp(`\\s*${SELF_TOKEN}\\s*,?`, 'g');\n/*\n * [Validation]\n * The visitor code below will traverse the animation AST generated by the animation verb functions\n * (the output is a tree of objects) and attempt to perform a series of validations on the data. The\n * following corner-cases will be validated:\n *\n * 1. Overlap of animations\n * Given that a CSS property cannot be animated in more than one place at the same time, it's\n * important that this behavior is detected and validated. The way in which this occurs is that\n * each time a style property is examined, a string-map containing the property will be updated with\n * the start and end times for when the property is used within an animation step.\n *\n * If there are two or more parallel animations that are currently running (these are invoked by the\n * group()) on the same element then the validator will throw an error. Since the start/end timing\n * values are collected for each property then if the current animation step is animating the same\n * property and its timing values fall anywhere into the window of time that the property is\n * currently being animated within then this is what causes an error.\n *\n * 2. Timing values\n * The validator will validate to see if a timing value of `duration delay easing` or\n * `durationNumber` is valid or not.\n *\n * (note that upon validation the code below will replace the timing data with an object containing\n * {duration,delay,easing}.\n *\n * 3. Offset Validation\n * Each of the style() calls are allowed to have an offset value when placed inside of keyframes().\n * Offsets within keyframes() are considered valid when:\n *\n * - No offsets are used at all\n * - Each style() entry contains an offset value\n * - Each offset is between 0 and 1\n * - Each offset is greater to or equal than the previous one\n *\n * Otherwise an error will be thrown.\n */\nfunction buildAnimationAst(driver, metadata, errors) {\n return new AnimationAstBuilderVisitor(driver).build(metadata, errors);\n}\nconst ROOT_SELECTOR = '';\nclass AnimationAstBuilderVisitor {\n constructor(_driver) {\n this._driver = _driver;\n }\n build(metadata, errors) {\n const context = new AnimationAstBuilderContext(errors);\n this._resetContextStyleTimingState(context);\n return visitDslNode(this, normalizeAnimationEntry(metadata), context);\n }\n _resetContextStyleTimingState(context) {\n context.currentQuerySelector = ROOT_SELECTOR;\n context.collectedStyles = {};\n context.collectedStyles[ROOT_SELECTOR] = {};\n context.currentTime = 0;\n }\n visitTrigger(metadata, context) {\n let queryCount = context.queryCount = 0;\n let depCount = context.depCount = 0;\n const states = [];\n const transitions = [];\n if (metadata.name.charAt(0) == '@') {\n context.errors.push('animation triggers cannot be prefixed with an `@` sign (e.g. trigger(\\'@foo\\', [...]))');\n }\n metadata.definitions.forEach(def => {\n this._resetContextStyleTimingState(context);\n if (def.type == 0 /* State */) {\n const stateDef = def;\n const name = stateDef.name;\n name.toString().split(/\\s*,\\s*/).forEach(n => {\n stateDef.name = n;\n states.push(this.visitState(stateDef, context));\n });\n stateDef.name = name;\n }\n else if (def.type == 1 /* Transition */) {\n const transition = this.visitTransition(def, context);\n queryCount += transition.queryCount;\n depCount += transition.depCount;\n transitions.push(transition);\n }\n else {\n context.errors.push('only state() and transition() definitions can sit inside of a trigger()');\n }\n });\n return {\n type: 7 /* Trigger */,\n name: metadata.name,\n states,\n transitions,\n queryCount,\n depCount,\n options: null\n };\n }\n visitState(metadata, context) {\n const styleAst = this.visitStyle(metadata.styles, context);\n const astParams = (metadata.options && metadata.options.params) || null;\n if (styleAst.containsDynamicStyles) {\n const missingSubs = new Set();\n const params = astParams || {};\n styleAst.styles.forEach(value => {\n if (isObject(value)) {\n const stylesObj = value;\n Object.keys(stylesObj).forEach(prop => {\n extractStyleParams(stylesObj[prop]).forEach(sub => {\n if (!params.hasOwnProperty(sub)) {\n missingSubs.add(sub);\n }\n });\n });\n }\n });\n if (missingSubs.size) {\n const missingSubsArr = iteratorToArray(missingSubs.values());\n context.errors.push(`state(\"${metadata\n .name}\", ...) must define default values for all the following style substitutions: ${missingSubsArr.join(', ')}`);\n }\n }\n return {\n type: 0 /* State */,\n name: metadata.name,\n style: styleAst,\n options: astParams ? { params: astParams } : null\n };\n }\n visitTransition(metadata, context) {\n context.queryCount = 0;\n context.depCount = 0;\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n const matchers = parseTransitionExpr(metadata.expr, context.errors);\n return {\n type: 1 /* Transition */,\n matchers,\n animation,\n queryCount: context.queryCount,\n depCount: context.depCount,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitSequence(metadata, context) {\n return {\n type: 2 /* Sequence */,\n steps: metadata.steps.map(s => visitDslNode(this, s, context)),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitGroup(metadata, context) {\n const currentTime = context.currentTime;\n let furthestTime = 0;\n const steps = metadata.steps.map(step => {\n context.currentTime = currentTime;\n const innerAst = visitDslNode(this, step, context);\n furthestTime = Math.max(furthestTime, context.currentTime);\n return innerAst;\n });\n context.currentTime = furthestTime;\n return {\n type: 3 /* Group */,\n steps,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimate(metadata, context) {\n const timingAst = constructTimingAst(metadata.timings, context.errors);\n context.currentAnimateTimings = timingAst;\n let styleAst;\n let styleMetadata = metadata.styles ? metadata.styles : style({});\n if (styleMetadata.type == 5 /* Keyframes */) {\n styleAst = this.visitKeyframes(styleMetadata, context);\n }\n else {\n let styleMetadata = metadata.styles;\n let isEmpty = false;\n if (!styleMetadata) {\n isEmpty = true;\n const newStyleData = {};\n if (timingAst.easing) {\n newStyleData['easing'] = timingAst.easing;\n }\n styleMetadata = style(newStyleData);\n }\n context.currentTime += timingAst.duration + timingAst.delay;\n const _styleAst = this.visitStyle(styleMetadata, context);\n _styleAst.isEmptyStep = isEmpty;\n styleAst = _styleAst;\n }\n context.currentAnimateTimings = null;\n return {\n type: 4 /* Animate */,\n timings: timingAst,\n style: styleAst,\n options: null\n };\n }\n visitStyle(metadata, context) {\n const ast = this._makeStyleAst(metadata, context);\n this._validateStyleAst(ast, context);\n return ast;\n }\n _makeStyleAst(metadata, context) {\n const styles = [];\n if (Array.isArray(metadata.styles)) {\n metadata.styles.forEach(styleTuple => {\n if (typeof styleTuple == 'string') {\n if (styleTuple == AUTO_STYLE) {\n styles.push(styleTuple);\n }\n else {\n context.errors.push(`The provided style string value ${styleTuple} is not allowed.`);\n }\n }\n else {\n styles.push(styleTuple);\n }\n });\n }\n else {\n styles.push(metadata.styles);\n }\n let containsDynamicStyles = false;\n let collectedEasing = null;\n styles.forEach(styleData => {\n if (isObject(styleData)) {\n const styleMap = styleData;\n const easing = styleMap['easing'];\n if (easing) {\n collectedEasing = easing;\n delete styleMap['easing'];\n }\n if (!containsDynamicStyles) {\n for (let prop in styleMap) {\n const value = styleMap[prop];\n if (value.toString().indexOf(SUBSTITUTION_EXPR_START) >= 0) {\n containsDynamicStyles = true;\n break;\n }\n }\n }\n }\n });\n return {\n type: 6 /* Style */,\n styles,\n easing: collectedEasing,\n offset: metadata.offset,\n containsDynamicStyles,\n options: null\n };\n }\n _validateStyleAst(ast, context) {\n const timings = context.currentAnimateTimings;\n let endTime = context.currentTime;\n let startTime = context.currentTime;\n if (timings && startTime > 0) {\n startTime -= timings.duration + timings.delay;\n }\n ast.styles.forEach(tuple => {\n if (typeof tuple == 'string')\n return;\n Object.keys(tuple).forEach(prop => {\n if (!this._driver.validateStyleProperty(prop)) {\n context.errors.push(`The provided animation property \"${prop}\" is not a supported CSS property for animations`);\n return;\n }\n const collectedStyles = context.collectedStyles[context.currentQuerySelector];\n const collectedEntry = collectedStyles[prop];\n let updateCollectedStyle = true;\n if (collectedEntry) {\n if (startTime != endTime && startTime >= collectedEntry.startTime &&\n endTime <= collectedEntry.endTime) {\n context.errors.push(`The CSS property \"${prop}\" that exists between the times of \"${collectedEntry.startTime}ms\" and \"${collectedEntry\n .endTime}ms\" is also being animated in a parallel animation between the times of \"${startTime}ms\" and \"${endTime}ms\"`);\n updateCollectedStyle = false;\n }\n // we always choose the smaller start time value since we\n // want to have a record of the entire animation window where\n // the style property is being animated in between\n startTime = collectedEntry.startTime;\n }\n if (updateCollectedStyle) {\n collectedStyles[prop] = { startTime, endTime };\n }\n if (context.options) {\n validateStyleParams(tuple[prop], context.options, context.errors);\n }\n });\n });\n }\n visitKeyframes(metadata, context) {\n const ast = { type: 5 /* Keyframes */, styles: [], options: null };\n if (!context.currentAnimateTimings) {\n context.errors.push(`keyframes() must be placed inside of a call to animate()`);\n return ast;\n }\n const MAX_KEYFRAME_OFFSET = 1;\n let totalKeyframesWithOffsets = 0;\n const offsets = [];\n let offsetsOutOfOrder = false;\n let keyframesOutOfRange = false;\n let previousOffset = 0;\n const keyframes = metadata.steps.map(styles => {\n const style = this._makeStyleAst(styles, context);\n let offsetVal = style.offset != null ? style.offset : consumeOffset(style.styles);\n let offset = 0;\n if (offsetVal != null) {\n totalKeyframesWithOffsets++;\n offset = style.offset = offsetVal;\n }\n keyframesOutOfRange = keyframesOutOfRange || offset < 0 || offset > 1;\n offsetsOutOfOrder = offsetsOutOfOrder || offset < previousOffset;\n previousOffset = offset;\n offsets.push(offset);\n return style;\n });\n if (keyframesOutOfRange) {\n context.errors.push(`Please ensure that all keyframe offsets are between 0 and 1`);\n }\n if (offsetsOutOfOrder) {\n context.errors.push(`Please ensure that all keyframe offsets are in order`);\n }\n const length = metadata.steps.length;\n let generatedOffset = 0;\n if (totalKeyframesWithOffsets > 0 && totalKeyframesWithOffsets < length) {\n context.errors.push(`Not all style() steps within the declared keyframes() contain offsets`);\n }\n else if (totalKeyframesWithOffsets == 0) {\n generatedOffset = MAX_KEYFRAME_OFFSET / (length - 1);\n }\n const limit = length - 1;\n const currentTime = context.currentTime;\n const currentAnimateTimings = context.currentAnimateTimings;\n const animateDuration = currentAnimateTimings.duration;\n keyframes.forEach((kf, i) => {\n const offset = generatedOffset > 0 ? (i == limit ? 1 : (generatedOffset * i)) : offsets[i];\n const durationUpToThisFrame = offset * animateDuration;\n context.currentTime = currentTime + currentAnimateTimings.delay + durationUpToThisFrame;\n currentAnimateTimings.duration = durationUpToThisFrame;\n this._validateStyleAst(kf, context);\n kf.offset = offset;\n ast.styles.push(kf);\n });\n return ast;\n }\n visitReference(metadata, context) {\n return {\n type: 8 /* Reference */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateChild(metadata, context) {\n context.depCount++;\n return {\n type: 9 /* AnimateChild */,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateRef(metadata, context) {\n return {\n type: 10 /* AnimateRef */,\n animation: this.visitReference(metadata.animation, context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitQuery(metadata, context) {\n const parentSelector = context.currentQuerySelector;\n const options = (metadata.options || {});\n context.queryCount++;\n context.currentQuery = metadata;\n const [selector, includeSelf] = normalizeSelector(metadata.selector);\n context.currentQuerySelector =\n parentSelector.length ? (parentSelector + ' ' + selector) : selector;\n getOrSetAsInMap(context.collectedStyles, context.currentQuerySelector, {});\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n context.currentQuery = null;\n context.currentQuerySelector = parentSelector;\n return {\n type: 11 /* Query */,\n selector,\n limit: options.limit || 0,\n optional: !!options.optional,\n includeSelf,\n animation,\n originalSelector: metadata.selector,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitStagger(metadata, context) {\n if (!context.currentQuery) {\n context.errors.push(`stagger() can only be used inside of query()`);\n }\n const timings = metadata.timings === 'full' ?\n { duration: 0, delay: 0, easing: 'full' } :\n resolveTiming(metadata.timings, context.errors, true);\n return {\n type: 12 /* Stagger */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n timings,\n options: null\n };\n }\n}\nfunction normalizeSelector(selector) {\n const hasAmpersand = selector.split(/\\s*,\\s*/).find(token => token == SELF_TOKEN) ? true : false;\n if (hasAmpersand) {\n selector = selector.replace(SELF_TOKEN_REGEX, '');\n }\n // Note: the :enter and :leave aren't normalized here since those\n // selectors are filled in at runtime during timeline building\n selector = selector.replace(/@\\*/g, NG_TRIGGER_SELECTOR)\n .replace(/@\\w+/g, match => NG_TRIGGER_SELECTOR + '-' + match.substr(1))\n .replace(/:animating/g, NG_ANIMATING_SELECTOR);\n return [selector, hasAmpersand];\n}\nfunction normalizeParams(obj) {\n return obj ? copyObj(obj) : null;\n}\nclass AnimationAstBuilderContext {\n constructor(errors) {\n this.errors = errors;\n this.queryCount = 0;\n this.depCount = 0;\n this.currentTransition = null;\n this.currentQuery = null;\n this.currentQuerySelector = null;\n this.currentAnimateTimings = null;\n this.currentTime = 0;\n this.collectedStyles = {};\n this.options = null;\n }\n}\nfunction consumeOffset(styles) {\n if (typeof styles == 'string')\n return null;\n let offset = null;\n if (Array.isArray(styles)) {\n styles.forEach(styleTuple => {\n if (isObject(styleTuple) && styleTuple.hasOwnProperty('offset')) {\n const obj = styleTuple;\n offset = parseFloat(obj['offset']);\n delete obj['offset'];\n }\n });\n }\n else if (isObject(styles) && styles.hasOwnProperty('offset')) {\n const obj = styles;\n offset = parseFloat(obj['offset']);\n delete obj['offset'];\n }\n return offset;\n}\nfunction isObject(value) {\n return !Array.isArray(value) && typeof value == 'object';\n}\nfunction constructTimingAst(value, errors) {\n let timings = null;\n if (value.hasOwnProperty('duration')) {\n timings = value;\n }\n else if (typeof value == 'number') {\n const duration = resolveTiming(value, errors).duration;\n return makeTimingAst(duration, 0, '');\n }\n const strValue = value;\n const isDynamic = strValue.split(/\\s+/).some(v => v.charAt(0) == '{' && v.charAt(1) == '{');\n if (isDynamic) {\n const ast = makeTimingAst(0, 0, '');\n ast.dynamic = true;\n ast.strValue = strValue;\n return ast;\n }\n timings = timings || resolveTiming(strValue, errors);\n return makeTimingAst(timings.duration, timings.delay, timings.easing);\n}\nfunction normalizeAnimationOptions(options) {\n if (options) {\n options = copyObj(options);\n if (options['params']) {\n options['params'] = normalizeParams(options['params']);\n }\n }\n else {\n options = {};\n }\n return options;\n}\nfunction makeTimingAst(duration, delay, easing) {\n return { duration, delay, easing };\n}\n\nfunction createTimelineInstruction(element, keyframes, preStyleProps, postStyleProps, duration, delay, easing = null, subTimeline = false) {\n return {\n type: 1 /* TimelineAnimation */,\n element,\n keyframes,\n preStyleProps,\n postStyleProps,\n duration,\n delay,\n totalTime: duration + delay,\n easing,\n subTimeline\n };\n}\n\nclass ElementInstructionMap {\n constructor() {\n this._map = new Map();\n }\n get(element) {\n return this._map.get(element) || [];\n }\n append(element, instructions) {\n let existingInstructions = this._map.get(element);\n if (!existingInstructions) {\n this._map.set(element, existingInstructions = []);\n }\n existingInstructions.push(...instructions);\n }\n has(element) {\n return this._map.has(element);\n }\n clear() {\n this._map.clear();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_FRAME_IN_MILLISECONDS = 1;\nconst ENTER_TOKEN = ':enter';\nconst ENTER_TOKEN_REGEX = new RegExp(ENTER_TOKEN, 'g');\nconst LEAVE_TOKEN = ':leave';\nconst LEAVE_TOKEN_REGEX = new RegExp(LEAVE_TOKEN, 'g');\n/*\n * The code within this file aims to generate web-animations-compatible keyframes from Angular's\n * animation DSL code.\n *\n * The code below will be converted from:\n *\n * ```\n * sequence([\n * style({ opacity: 0 }),\n * animate(1000, style({ opacity: 0 }))\n * ])\n * ```\n *\n * To:\n * ```\n * keyframes = [{ opacity: 0, offset: 0 }, { opacity: 1, offset: 1 }]\n * duration = 1000\n * delay = 0\n * easing = ''\n * ```\n *\n * For this operation to cover the combination of animation verbs (style, animate, group, etc...) a\n * combination of prototypical inheritance, AST traversal and merge-sort-like algorithms are used.\n *\n * [AST Traversal]\n * Each of the animation verbs, when executed, will return an string-map object representing what\n * type of action it is (style, animate, group, etc...) and the data associated with it. This means\n * that when functional composition mix of these functions is evaluated (like in the example above)\n * then it will end up producing a tree of objects representing the animation itself.\n *\n * When this animation object tree is processed by the visitor code below it will visit each of the\n * verb statements within the visitor. And during each visit it will build the context of the\n * animation keyframes by interacting with the `TimelineBuilder`.\n *\n * [TimelineBuilder]\n * This class is responsible for tracking the styles and building a series of keyframe objects for a\n * timeline between a start and end time. The builder starts off with an initial timeline and each\n * time the AST comes across a `group()`, `keyframes()` or a combination of the two within a\n * `sequence()` then it will generate a sub timeline for each step as well as a new one after\n * they are complete.\n *\n * As the AST is traversed, the timing state on each of the timelines will be incremented. If a sub\n * timeline was created (based on one of the cases above) then the parent timeline will attempt to\n * merge the styles used within the sub timelines into itself (only with group() this will happen).\n * This happens with a merge operation (much like how the merge works in mergeSort) and it will only\n * copy the most recently used styles from the sub timelines into the parent timeline. This ensures\n * that if the styles are used later on in another phase of the animation then they will be the most\n * up-to-date values.\n *\n * [How Missing Styles Are Updated]\n * Each timeline has a `backFill` property which is responsible for filling in new styles into\n * already processed keyframes if a new style shows up later within the animation sequence.\n *\n * ```\n * sequence([\n * style({ width: 0 }),\n * animate(1000, style({ width: 100 })),\n * animate(1000, style({ width: 200 })),\n * animate(1000, style({ width: 300 }))\n * animate(1000, style({ width: 400, height: 400 })) // notice how `height` doesn't exist anywhere\n * else\n * ])\n * ```\n *\n * What is happening here is that the `height` value is added later in the sequence, but is missing\n * from all previous animation steps. Therefore when a keyframe is created it would also be missing\n * from all previous keyframes up until where it is first used. For the timeline keyframe generation\n * to properly fill in the style it will place the previous value (the value from the parent\n * timeline) or a default value of `*` into the backFill object. Given that each of the keyframe\n * styles is an object that prototypically inherits from the backFill object, this means that if a\n * value is added into the backFill then it will automatically propagate any missing values to all\n * keyframes. Therefore the missing `height` value will be properly filled into the already\n * processed keyframes.\n *\n * When a sub-timeline is created it will have its own backFill property. This is done so that\n * styles present within the sub-timeline do not accidentally seep into the previous/future timeline\n * keyframes\n *\n * (For prototypically-inherited contents to be detected a `for(i in obj)` loop must be used.)\n *\n * [Validation]\n * The code in this file is not responsible for validation. That functionality happens with within\n * the `AnimationValidatorVisitor` code.\n */\nfunction buildAnimationTimelines(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles = {}, finalStyles = {}, options, subInstructions, errors = []) {\n return new AnimationTimelineBuilderVisitor().buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors);\n}\nclass AnimationTimelineBuilderVisitor {\n buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors = []) {\n subInstructions = subInstructions || new ElementInstructionMap();\n const context = new AnimationTimelineContext(driver, rootElement, subInstructions, enterClassName, leaveClassName, errors, []);\n context.options = options;\n context.currentTimeline.setStyles([startingStyles], null, context.errors, options);\n visitDslNode(this, ast, context);\n // this checks to see if an actual animation happened\n const timelines = context.timelines.filter(timeline => timeline.containsAnimation());\n if (Object.keys(finalStyles).length) {\n // note: we just want to apply the final styles for the rootElement, so we do not\n // just apply the styles to the last timeline but the last timeline which\n // element is the root one (basically `*`-styles are replaced with the actual\n // state style values only for the root element)\n let lastRootTimeline;\n for (let i = timelines.length - 1; i >= 0; i--) {\n const timeline = timelines[i];\n if (timeline.element === rootElement) {\n lastRootTimeline = timeline;\n break;\n }\n }\n if (lastRootTimeline && !lastRootTimeline.allowOnlyTimelineStyles()) {\n lastRootTimeline.setStyles([finalStyles], null, context.errors, options);\n }\n }\n return timelines.length ? timelines.map(timeline => timeline.buildKeyframes()) :\n [createTimelineInstruction(rootElement, [], [], [], 0, 0, '', false)];\n }\n visitTrigger(ast, context) {\n // these values are not visited in this AST\n }\n visitState(ast, context) {\n // these values are not visited in this AST\n }\n visitTransition(ast, context) {\n // these values are not visited in this AST\n }\n visitAnimateChild(ast, context) {\n const elementInstructions = context.subInstructions.get(context.element);\n if (elementInstructions) {\n const innerContext = context.createSubContext(ast.options);\n const startTime = context.currentTimeline.currentTime;\n const endTime = this._visitSubInstructions(elementInstructions, innerContext, innerContext.options);\n if (startTime != endTime) {\n // we do this on the upper context because we created a sub context for\n // the sub child animations\n context.transformIntoNewTimeline(endTime);\n }\n }\n context.previousNode = ast;\n }\n visitAnimateRef(ast, context) {\n const innerContext = context.createSubContext(ast.options);\n innerContext.transformIntoNewTimeline();\n this.visitReference(ast.animation, innerContext);\n context.transformIntoNewTimeline(innerContext.currentTimeline.currentTime);\n context.previousNode = ast;\n }\n _visitSubInstructions(instructions, context, options) {\n const startTime = context.currentTimeline.currentTime;\n let furthestTime = startTime;\n // this is a special-case for when a user wants to skip a sub\n // animation from being fired entirely.\n const duration = options.duration != null ? resolveTimingValue(options.duration) : null;\n const delay = options.delay != null ? resolveTimingValue(options.delay) : null;\n if (duration !== 0) {\n instructions.forEach(instruction => {\n const instructionTimings = context.appendInstructionToTimeline(instruction, duration, delay);\n furthestTime =\n Math.max(furthestTime, instructionTimings.duration + instructionTimings.delay);\n });\n }\n return furthestTime;\n }\n visitReference(ast, context) {\n context.updateOptions(ast.options, true);\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n }\n visitSequence(ast, context) {\n const subContextCount = context.subContextCount;\n let ctx = context;\n const options = ast.options;\n if (options && (options.params || options.delay)) {\n ctx = context.createSubContext(options);\n ctx.transformIntoNewTimeline();\n if (options.delay != null) {\n if (ctx.previousNode.type == 6 /* Style */) {\n ctx.currentTimeline.snapshotCurrentStyles();\n ctx.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n const delay = resolveTimingValue(options.delay);\n ctx.delayNextStep(delay);\n }\n }\n if (ast.steps.length) {\n ast.steps.forEach(s => visitDslNode(this, s, ctx));\n // this is here just in case the inner steps only contain or end with a style() call\n ctx.currentTimeline.applyStylesToKeyframe();\n // this means that some animation function within the sequence\n // ended up creating a sub timeline (which means the current\n // timeline cannot overlap with the contents of the sequence)\n if (ctx.subContextCount > subContextCount) {\n ctx.transformIntoNewTimeline();\n }\n }\n context.previousNode = ast;\n }\n visitGroup(ast, context) {\n const innerTimelines = [];\n let furthestTime = context.currentTimeline.currentTime;\n const delay = ast.options && ast.options.delay ? resolveTimingValue(ast.options.delay) : 0;\n ast.steps.forEach(s => {\n const innerContext = context.createSubContext(ast.options);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n visitDslNode(this, s, innerContext);\n furthestTime = Math.max(furthestTime, innerContext.currentTimeline.currentTime);\n innerTimelines.push(innerContext.currentTimeline);\n });\n // this operation is run after the AST loop because otherwise\n // if the parent timeline's collected styles were updated then\n // it would pass in invalid data into the new-to-be forked items\n innerTimelines.forEach(timeline => context.currentTimeline.mergeTimelineCollectedStyles(timeline));\n context.transformIntoNewTimeline(furthestTime);\n context.previousNode = ast;\n }\n _visitTiming(ast, context) {\n if (ast.dynamic) {\n const strValue = ast.strValue;\n const timingValue = context.params ? interpolateParams(strValue, context.params, context.errors) : strValue;\n return resolveTiming(timingValue, context.errors);\n }\n else {\n return { duration: ast.duration, delay: ast.delay, easing: ast.easing };\n }\n }\n visitAnimate(ast, context) {\n const timings = context.currentAnimateTimings = this._visitTiming(ast.timings, context);\n const timeline = context.currentTimeline;\n if (timings.delay) {\n context.incrementTime(timings.delay);\n timeline.snapshotCurrentStyles();\n }\n const style = ast.style;\n if (style.type == 5 /* Keyframes */) {\n this.visitKeyframes(style, context);\n }\n else {\n context.incrementTime(timings.duration);\n this.visitStyle(style, context);\n timeline.applyStylesToKeyframe();\n }\n context.currentAnimateTimings = null;\n context.previousNode = ast;\n }\n visitStyle(ast, context) {\n const timeline = context.currentTimeline;\n const timings = context.currentAnimateTimings;\n // this is a special case for when a style() call\n // directly follows an animate() call (but not inside of an animate() call)\n if (!timings && timeline.getCurrentStyleProperties().length) {\n timeline.forwardFrame();\n }\n const easing = (timings && timings.easing) || ast.easing;\n if (ast.isEmptyStep) {\n timeline.applyEmptyStep(easing);\n }\n else {\n timeline.setStyles(ast.styles, easing, context.errors, context.options);\n }\n context.previousNode = ast;\n }\n visitKeyframes(ast, context) {\n const currentAnimateTimings = context.currentAnimateTimings;\n const startTime = (context.currentTimeline).duration;\n const duration = currentAnimateTimings.duration;\n const innerContext = context.createSubContext();\n const innerTimeline = innerContext.currentTimeline;\n innerTimeline.easing = currentAnimateTimings.easing;\n ast.styles.forEach(step => {\n const offset = step.offset || 0;\n innerTimeline.forwardTime(offset * duration);\n innerTimeline.setStyles(step.styles, step.easing, context.errors, context.options);\n innerTimeline.applyStylesToKeyframe();\n });\n // this will ensure that the parent timeline gets all the styles from\n // the child even if the new timeline below is not used\n context.currentTimeline.mergeTimelineCollectedStyles(innerTimeline);\n // we do this because the window between this timeline and the sub timeline\n // should ensure that the styles within are exactly the same as they were before\n context.transformIntoNewTimeline(startTime + duration);\n context.previousNode = ast;\n }\n visitQuery(ast, context) {\n // in the event that the first step before this is a style step we need\n // to ensure the styles are applied before the children are animated\n const startTime = context.currentTimeline.currentTime;\n const options = (ast.options || {});\n const delay = options.delay ? resolveTimingValue(options.delay) : 0;\n if (delay &&\n (context.previousNode.type === 6 /* Style */ ||\n (startTime == 0 && context.currentTimeline.getCurrentStyleProperties().length))) {\n context.currentTimeline.snapshotCurrentStyles();\n context.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n let furthestTime = startTime;\n const elms = context.invokeQuery(ast.selector, ast.originalSelector, ast.limit, ast.includeSelf, options.optional ? true : false, context.errors);\n context.currentQueryTotal = elms.length;\n let sameElementTimeline = null;\n elms.forEach((element, i) => {\n context.currentQueryIndex = i;\n const innerContext = context.createSubContext(ast.options, element);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n if (element === context.element) {\n sameElementTimeline = innerContext.currentTimeline;\n }\n visitDslNode(this, ast.animation, innerContext);\n // this is here just incase the inner steps only contain or end\n // with a style() call (which is here to signal that this is a preparatory\n // call to style an element before it is animated again)\n innerContext.currentTimeline.applyStylesToKeyframe();\n const endTime = innerContext.currentTimeline.currentTime;\n furthestTime = Math.max(furthestTime, endTime);\n });\n context.currentQueryIndex = 0;\n context.currentQueryTotal = 0;\n context.transformIntoNewTimeline(furthestTime);\n if (sameElementTimeline) {\n context.currentTimeline.mergeTimelineCollectedStyles(sameElementTimeline);\n context.currentTimeline.snapshotCurrentStyles();\n }\n context.previousNode = ast;\n }\n visitStagger(ast, context) {\n const parentContext = context.parentContext;\n const tl = context.currentTimeline;\n const timings = ast.timings;\n const duration = Math.abs(timings.duration);\n const maxTime = duration * (context.currentQueryTotal - 1);\n let delay = duration * context.currentQueryIndex;\n let staggerTransformer = timings.duration < 0 ? 'reverse' : timings.easing;\n switch (staggerTransformer) {\n case 'reverse':\n delay = maxTime - delay;\n break;\n case 'full':\n delay = parentContext.currentStaggerTime;\n break;\n }\n const timeline = context.currentTimeline;\n if (delay) {\n timeline.delayNextStep(delay);\n }\n const startingTime = timeline.currentTime;\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n // time = duration + delay\n // the reason why this computation is so complex is because\n // the inner timeline may either have a delay value or a stretched\n // keyframe depending on if a subtimeline is not used or is used.\n parentContext.currentStaggerTime =\n (tl.currentTime - startingTime) + (tl.startTime - parentContext.currentTimeline.startTime);\n }\n}\nconst DEFAULT_NOOP_PREVIOUS_NODE = {};\nclass AnimationTimelineContext {\n constructor(_driver, element, subInstructions, _enterClassName, _leaveClassName, errors, timelines, initialTimeline) {\n this._driver = _driver;\n this.element = element;\n this.subInstructions = subInstructions;\n this._enterClassName = _enterClassName;\n this._leaveClassName = _leaveClassName;\n this.errors = errors;\n this.timelines = timelines;\n this.parentContext = null;\n this.currentAnimateTimings = null;\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.subContextCount = 0;\n this.options = {};\n this.currentQueryIndex = 0;\n this.currentQueryTotal = 0;\n this.currentStaggerTime = 0;\n this.currentTimeline = initialTimeline || new TimelineBuilder(this._driver, element, 0);\n timelines.push(this.currentTimeline);\n }\n get params() {\n return this.options.params;\n }\n updateOptions(options, skipIfExists) {\n if (!options)\n return;\n const newOptions = options;\n let optionsToUpdate = this.options;\n // NOTE: this will get patched up when other animation methods support duration overrides\n if (newOptions.duration != null) {\n optionsToUpdate.duration = resolveTimingValue(newOptions.duration);\n }\n if (newOptions.delay != null) {\n optionsToUpdate.delay = resolveTimingValue(newOptions.delay);\n }\n const newParams = newOptions.params;\n if (newParams) {\n let paramsToUpdate = optionsToUpdate.params;\n if (!paramsToUpdate) {\n paramsToUpdate = this.options.params = {};\n }\n Object.keys(newParams).forEach(name => {\n if (!skipIfExists || !paramsToUpdate.hasOwnProperty(name)) {\n paramsToUpdate[name] = interpolateParams(newParams[name], paramsToUpdate, this.errors);\n }\n });\n }\n }\n _copyOptions() {\n const options = {};\n if (this.options) {\n const oldParams = this.options.params;\n if (oldParams) {\n const params = options['params'] = {};\n Object.keys(oldParams).forEach(name => {\n params[name] = oldParams[name];\n });\n }\n }\n return options;\n }\n createSubContext(options = null, element, newTime) {\n const target = element || this.element;\n const context = new AnimationTimelineContext(this._driver, target, this.subInstructions, this._enterClassName, this._leaveClassName, this.errors, this.timelines, this.currentTimeline.fork(target, newTime || 0));\n context.previousNode = this.previousNode;\n context.currentAnimateTimings = this.currentAnimateTimings;\n context.options = this._copyOptions();\n context.updateOptions(options);\n context.currentQueryIndex = this.currentQueryIndex;\n context.currentQueryTotal = this.currentQueryTotal;\n context.parentContext = this;\n this.subContextCount++;\n return context;\n }\n transformIntoNewTimeline(newTime) {\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.currentTimeline = this.currentTimeline.fork(this.element, newTime);\n this.timelines.push(this.currentTimeline);\n return this.currentTimeline;\n }\n appendInstructionToTimeline(instruction, duration, delay) {\n const updatedTimings = {\n duration: duration != null ? duration : instruction.duration,\n delay: this.currentTimeline.currentTime + (delay != null ? delay : 0) + instruction.delay,\n easing: ''\n };\n const builder = new SubTimelineBuilder(this._driver, instruction.element, instruction.keyframes, instruction.preStyleProps, instruction.postStyleProps, updatedTimings, instruction.stretchStartingKeyframe);\n this.timelines.push(builder);\n return updatedTimings;\n }\n incrementTime(time) {\n this.currentTimeline.forwardTime(this.currentTimeline.duration + time);\n }\n delayNextStep(delay) {\n // negative delays are not yet supported\n if (delay > 0) {\n this.currentTimeline.delayNextStep(delay);\n }\n }\n invokeQuery(selector, originalSelector, limit, includeSelf, optional, errors) {\n let results = [];\n if (includeSelf) {\n results.push(this.element);\n }\n if (selector.length > 0) { // only if :self is used then the selector can be empty\n selector = selector.replace(ENTER_TOKEN_REGEX, '.' + this._enterClassName);\n selector = selector.replace(LEAVE_TOKEN_REGEX, '.' + this._leaveClassName);\n const multi = limit != 1;\n let elements = this._driver.query(this.element, selector, multi);\n if (limit !== 0) {\n elements = limit < 0 ? elements.slice(elements.length + limit, elements.length) :\n elements.slice(0, limit);\n }\n results.push(...elements);\n }\n if (!optional && results.length == 0) {\n errors.push(`\\`query(\"${originalSelector}\")\\` returned zero elements. (Use \\`query(\"${originalSelector}\", { optional: true })\\` if you wish to allow this.)`);\n }\n return results;\n }\n}\nclass TimelineBuilder {\n constructor(_driver, element, startTime, _elementTimelineStylesLookup) {\n this._driver = _driver;\n this.element = element;\n this.startTime = startTime;\n this._elementTimelineStylesLookup = _elementTimelineStylesLookup;\n this.duration = 0;\n this._previousKeyframe = {};\n this._currentKeyframe = {};\n this._keyframes = new Map();\n this._styleSummary = {};\n this._pendingStyles = {};\n this._backFill = {};\n this._currentEmptyStepKeyframe = null;\n if (!this._elementTimelineStylesLookup) {\n this._elementTimelineStylesLookup = new Map();\n }\n this._localTimelineStyles = Object.create(this._backFill, {});\n this._globalTimelineStyles = this._elementTimelineStylesLookup.get(element);\n if (!this._globalTimelineStyles) {\n this._globalTimelineStyles = this._localTimelineStyles;\n this._elementTimelineStylesLookup.set(element, this._localTimelineStyles);\n }\n this._loadKeyframe();\n }\n containsAnimation() {\n switch (this._keyframes.size) {\n case 0:\n return false;\n case 1:\n return this.getCurrentStyleProperties().length > 0;\n default:\n return true;\n }\n }\n getCurrentStyleProperties() {\n return Object.keys(this._currentKeyframe);\n }\n get currentTime() {\n return this.startTime + this.duration;\n }\n delayNextStep(delay) {\n // in the event that a style() step is placed right before a stagger()\n // and that style() step is the very first style() value in the animation\n // then we need to make a copy of the keyframe [0, copy, 1] so that the delay\n // properly applies the style() values to work with the stagger...\n const hasPreStyleStep = this._keyframes.size == 1 && Object.keys(this._pendingStyles).length;\n if (this.duration || hasPreStyleStep) {\n this.forwardTime(this.currentTime + delay);\n if (hasPreStyleStep) {\n this.snapshotCurrentStyles();\n }\n }\n else {\n this.startTime += delay;\n }\n }\n fork(element, currentTime) {\n this.applyStylesToKeyframe();\n return new TimelineBuilder(this._driver, element, currentTime || this.currentTime, this._elementTimelineStylesLookup);\n }\n _loadKeyframe() {\n if (this._currentKeyframe) {\n this._previousKeyframe = this._currentKeyframe;\n }\n this._currentKeyframe = this._keyframes.get(this.duration);\n if (!this._currentKeyframe) {\n this._currentKeyframe = Object.create(this._backFill, {});\n this._keyframes.set(this.duration, this._currentKeyframe);\n }\n }\n forwardFrame() {\n this.duration += ONE_FRAME_IN_MILLISECONDS;\n this._loadKeyframe();\n }\n forwardTime(time) {\n this.applyStylesToKeyframe();\n this.duration = time;\n this._loadKeyframe();\n }\n _updateStyle(prop, value) {\n this._localTimelineStyles[prop] = value;\n this._globalTimelineStyles[prop] = value;\n this._styleSummary[prop] = { time: this.currentTime, value };\n }\n allowOnlyTimelineStyles() {\n return this._currentEmptyStepKeyframe !== this._currentKeyframe;\n }\n applyEmptyStep(easing) {\n if (easing) {\n this._previousKeyframe['easing'] = easing;\n }\n // special case for animate(duration):\n // all missing styles are filled with a `*` value then\n // if any destination styles are filled in later on the same\n // keyframe then they will override the overridden styles\n // We use `_globalTimelineStyles` here because there may be\n // styles in previous keyframes that are not present in this timeline\n Object.keys(this._globalTimelineStyles).forEach(prop => {\n this._backFill[prop] = this._globalTimelineStyles[prop] || AUTO_STYLE;\n this._currentKeyframe[prop] = AUTO_STYLE;\n });\n this._currentEmptyStepKeyframe = this._currentKeyframe;\n }\n setStyles(input, easing, errors, options) {\n if (easing) {\n this._previousKeyframe['easing'] = easing;\n }\n const params = (options && options.params) || {};\n const styles = flattenStyles(input, this._globalTimelineStyles);\n Object.keys(styles).forEach(prop => {\n const val = interpolateParams(styles[prop], params, errors);\n this._pendingStyles[prop] = val;\n if (!this._localTimelineStyles.hasOwnProperty(prop)) {\n this._backFill[prop] = this._globalTimelineStyles.hasOwnProperty(prop) ?\n this._globalTimelineStyles[prop] :\n AUTO_STYLE;\n }\n this._updateStyle(prop, val);\n });\n }\n applyStylesToKeyframe() {\n const styles = this._pendingStyles;\n const props = Object.keys(styles);\n if (props.length == 0)\n return;\n this._pendingStyles = {};\n props.forEach(prop => {\n const val = styles[prop];\n this._currentKeyframe[prop] = val;\n });\n Object.keys(this._localTimelineStyles).forEach(prop => {\n if (!this._currentKeyframe.hasOwnProperty(prop)) {\n this._currentKeyframe[prop] = this._localTimelineStyles[prop];\n }\n });\n }\n snapshotCurrentStyles() {\n Object.keys(this._localTimelineStyles).forEach(prop => {\n const val = this._localTimelineStyles[prop];\n this._pendingStyles[prop] = val;\n this._updateStyle(prop, val);\n });\n }\n getFinalKeyframe() {\n return this._keyframes.get(this.duration);\n }\n get properties() {\n const properties = [];\n for (let prop in this._currentKeyframe) {\n properties.push(prop);\n }\n return properties;\n }\n mergeTimelineCollectedStyles(timeline) {\n Object.keys(timeline._styleSummary).forEach(prop => {\n const details0 = this._styleSummary[prop];\n const details1 = timeline._styleSummary[prop];\n if (!details0 || details1.time > details0.time) {\n this._updateStyle(prop, details1.value);\n }\n });\n }\n buildKeyframes() {\n this.applyStylesToKeyframe();\n const preStyleProps = new Set();\n const postStyleProps = new Set();\n const isEmpty = this._keyframes.size === 1 && this.duration === 0;\n let finalKeyframes = [];\n this._keyframes.forEach((keyframe, time) => {\n const finalKeyframe = copyStyles(keyframe, true);\n Object.keys(finalKeyframe).forEach(prop => {\n const value = finalKeyframe[prop];\n if (value == ɵPRE_STYLE) {\n preStyleProps.add(prop);\n }\n else if (value == AUTO_STYLE) {\n postStyleProps.add(prop);\n }\n });\n if (!isEmpty) {\n finalKeyframe['offset'] = time / this.duration;\n }\n finalKeyframes.push(finalKeyframe);\n });\n const preProps = preStyleProps.size ? iteratorToArray(preStyleProps.values()) : [];\n const postProps = postStyleProps.size ? iteratorToArray(postStyleProps.values()) : [];\n // special case for a 0-second animation (which is designed just to place styles onscreen)\n if (isEmpty) {\n const kf0 = finalKeyframes[0];\n const kf1 = copyObj(kf0);\n kf0['offset'] = 0;\n kf1['offset'] = 1;\n finalKeyframes = [kf0, kf1];\n }\n return createTimelineInstruction(this.element, finalKeyframes, preProps, postProps, this.duration, this.startTime, this.easing, false);\n }\n}\nclass SubTimelineBuilder extends TimelineBuilder {\n constructor(driver, element, keyframes, preStyleProps, postStyleProps, timings, _stretchStartingKeyframe = false) {\n super(driver, element, timings.delay);\n this.keyframes = keyframes;\n this.preStyleProps = preStyleProps;\n this.postStyleProps = postStyleProps;\n this._stretchStartingKeyframe = _stretchStartingKeyframe;\n this.timings = { duration: timings.duration, delay: timings.delay, easing: timings.easing };\n }\n containsAnimation() {\n return this.keyframes.length > 1;\n }\n buildKeyframes() {\n let keyframes = this.keyframes;\n let { delay, duration, easing } = this.timings;\n if (this._stretchStartingKeyframe && delay) {\n const newKeyframes = [];\n const totalTime = duration + delay;\n const startingGap = delay / totalTime;\n // the original starting keyframe now starts once the delay is done\n const newFirstKeyframe = copyStyles(keyframes[0], false);\n newFirstKeyframe['offset'] = 0;\n newKeyframes.push(newFirstKeyframe);\n const oldFirstKeyframe = copyStyles(keyframes[0], false);\n oldFirstKeyframe['offset'] = roundOffset(startingGap);\n newKeyframes.push(oldFirstKeyframe);\n /*\n When the keyframe is stretched then it means that the delay before the animation\n starts is gone. Instead the first keyframe is placed at the start of the animation\n and it is then copied to where it starts when the original delay is over. This basically\n means nothing animates during that delay, but the styles are still rendered. For this\n to work the original offset values that exist in the original keyframes must be \"warped\"\n so that they can take the new keyframe + delay into account.\n \n delay=1000, duration=1000, keyframes = 0 .5 1\n \n turns into\n \n delay=0, duration=2000, keyframes = 0 .33 .66 1\n */\n // offsets between 1 ... n -1 are all warped by the keyframe stretch\n const limit = keyframes.length - 1;\n for (let i = 1; i <= limit; i++) {\n let kf = copyStyles(keyframes[i], false);\n const oldOffset = kf['offset'];\n const timeAtKeyframe = delay + oldOffset * duration;\n kf['offset'] = roundOffset(timeAtKeyframe / totalTime);\n newKeyframes.push(kf);\n }\n // the new starting keyframe should be added at the start\n duration = totalTime;\n delay = 0;\n easing = '';\n keyframes = newKeyframes;\n }\n return createTimelineInstruction(this.element, keyframes, this.preStyleProps, this.postStyleProps, duration, delay, easing, true);\n }\n}\nfunction roundOffset(offset, decimalPoints = 3) {\n const mult = Math.pow(10, decimalPoints - 1);\n return Math.round(offset * mult) / mult;\n}\nfunction flattenStyles(input, allStyles) {\n const styles = {};\n let allProperties;\n input.forEach(token => {\n if (token === '*') {\n allProperties = allProperties || Object.keys(allStyles);\n allProperties.forEach(prop => {\n styles[prop] = AUTO_STYLE;\n });\n }\n else {\n copyStyles(token, false, styles);\n }\n });\n return styles;\n}\n\nclass Animation {\n constructor(_driver, input) {\n this._driver = _driver;\n const errors = [];\n const ast = buildAnimationAst(_driver, input, errors);\n if (errors.length) {\n const errorMessage = `animation validation failed:\\n${errors.join('\\n')}`;\n throw new Error(errorMessage);\n }\n this._animationAst = ast;\n }\n buildTimelines(element, startingStyles, destinationStyles, options, subInstructions) {\n const start = Array.isArray(startingStyles) ? normalizeStyles(startingStyles) :\n startingStyles;\n const dest = Array.isArray(destinationStyles) ? normalizeStyles(destinationStyles) :\n destinationStyles;\n const errors = [];\n subInstructions = subInstructions || new ElementInstructionMap();\n const result = buildAnimationTimelines(this._driver, element, this._animationAst, ENTER_CLASSNAME, LEAVE_CLASSNAME, start, dest, options, subInstructions, errors);\n if (errors.length) {\n const errorMessage = `animation building failed:\\n${errors.join('\\n')}`;\n throw new Error(errorMessage);\n }\n return result;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass AnimationStyleNormalizer {\n}\n/**\n * @publicApi\n */\nclass NoopAnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return propertyName;\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n return value;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass WebAnimationsStyleNormalizer extends AnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return dashCaseToCamelCase(propertyName);\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n let unit = '';\n const strVal = value.toString().trim();\n if (DIMENSIONAL_PROP_MAP[normalizedProperty] && value !== 0 && value !== '0') {\n if (typeof value === 'number') {\n unit = 'px';\n }\n else {\n const valAndSuffixMatch = value.match(/^[+-]?[\\d\\.]+([a-z]*)$/);\n if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) {\n errors.push(`Please provide a CSS unit value for ${userProvidedProperty}:${value}`);\n }\n }\n }\n return strVal + unit;\n }\n}\nconst DIMENSIONAL_PROP_MAP = (() => makeBooleanMap('width,height,minWidth,minHeight,maxWidth,maxHeight,left,top,bottom,right,fontSize,outlineWidth,outlineOffset,paddingTop,paddingLeft,paddingBottom,paddingRight,marginTop,marginLeft,marginBottom,marginRight,borderRadius,borderWidth,borderTopWidth,borderLeftWidth,borderRightWidth,borderBottomWidth,textIndent,perspective'\n .split(',')))();\nfunction makeBooleanMap(keys) {\n const map = {};\n keys.forEach(key => map[key] = true);\n return map;\n}\n\nfunction createTransitionInstruction(element, triggerName, fromState, toState, isRemovalTransition, fromStyles, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors) {\n return {\n type: 0 /* TransitionAnimation */,\n element,\n triggerName,\n isRemovalTransition,\n fromState,\n fromStyles,\n toState,\n toStyles,\n timelines,\n queriedElements,\n preStyleProps,\n postStyleProps,\n totalTime,\n errors\n };\n}\n\nconst EMPTY_OBJECT = {};\nclass AnimationTransitionFactory {\n constructor(_triggerName, ast, _stateStyles) {\n this._triggerName = _triggerName;\n this.ast = ast;\n this._stateStyles = _stateStyles;\n }\n match(currentState, nextState, element, params) {\n return oneOrMoreTransitionsMatch(this.ast.matchers, currentState, nextState, element, params);\n }\n buildStyles(stateName, params, errors) {\n const backupStateStyler = this._stateStyles['*'];\n const stateStyler = this._stateStyles[stateName];\n const backupStyles = backupStateStyler ? backupStateStyler.buildStyles(params, errors) : {};\n return stateStyler ? stateStyler.buildStyles(params, errors) : backupStyles;\n }\n build(driver, element, currentState, nextState, enterClassName, leaveClassName, currentOptions, nextOptions, subInstructions, skipAstBuild) {\n const errors = [];\n const transitionAnimationParams = this.ast.options && this.ast.options.params || EMPTY_OBJECT;\n const currentAnimationParams = currentOptions && currentOptions.params || EMPTY_OBJECT;\n const currentStateStyles = this.buildStyles(currentState, currentAnimationParams, errors);\n const nextAnimationParams = nextOptions && nextOptions.params || EMPTY_OBJECT;\n const nextStateStyles = this.buildStyles(nextState, nextAnimationParams, errors);\n const queriedElements = new Set();\n const preStyleMap = new Map();\n const postStyleMap = new Map();\n const isRemoval = nextState === 'void';\n const animationOptions = { params: Object.assign(Object.assign({}, transitionAnimationParams), nextAnimationParams) };\n const timelines = skipAstBuild ?\n [] :\n buildAnimationTimelines(driver, element, this.ast.animation, enterClassName, leaveClassName, currentStateStyles, nextStateStyles, animationOptions, subInstructions, errors);\n let totalTime = 0;\n timelines.forEach(tl => {\n totalTime = Math.max(tl.duration + tl.delay, totalTime);\n });\n if (errors.length) {\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, [], [], preStyleMap, postStyleMap, totalTime, errors);\n }\n timelines.forEach(tl => {\n const elm = tl.element;\n const preProps = getOrSetAsInMap(preStyleMap, elm, {});\n tl.preStyleProps.forEach(prop => preProps[prop] = true);\n const postProps = getOrSetAsInMap(postStyleMap, elm, {});\n tl.postStyleProps.forEach(prop => postProps[prop] = true);\n if (elm !== element) {\n queriedElements.add(elm);\n }\n });\n const queriedElementsList = iteratorToArray(queriedElements.values());\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, timelines, queriedElementsList, preStyleMap, postStyleMap, totalTime);\n }\n}\nfunction oneOrMoreTransitionsMatch(matchFns, currentState, nextState, element, params) {\n return matchFns.some(fn => fn(currentState, nextState, element, params));\n}\nclass AnimationStateStyles {\n constructor(styles, defaultParams, normalizer) {\n this.styles = styles;\n this.defaultParams = defaultParams;\n this.normalizer = normalizer;\n }\n buildStyles(params, errors) {\n const finalStyles = {};\n const combinedParams = copyObj(this.defaultParams);\n Object.keys(params).forEach(key => {\n const value = params[key];\n if (value != null) {\n combinedParams[key] = value;\n }\n });\n this.styles.styles.forEach(value => {\n if (typeof value !== 'string') {\n const styleObj = value;\n Object.keys(styleObj).forEach(prop => {\n let val = styleObj[prop];\n if (val.length > 1) {\n val = interpolateParams(val, combinedParams, errors);\n }\n const normalizedProp = this.normalizer.normalizePropertyName(prop, errors);\n val = this.normalizer.normalizeStyleValue(prop, normalizedProp, val, errors);\n finalStyles[normalizedProp] = val;\n });\n }\n });\n return finalStyles;\n }\n}\n\nfunction buildTrigger(name, ast, normalizer) {\n return new AnimationTrigger(name, ast, normalizer);\n}\nclass AnimationTrigger {\n constructor(name, ast, _normalizer) {\n this.name = name;\n this.ast = ast;\n this._normalizer = _normalizer;\n this.transitionFactories = [];\n this.states = {};\n ast.states.forEach(ast => {\n const defaultParams = (ast.options && ast.options.params) || {};\n this.states[ast.name] = new AnimationStateStyles(ast.style, defaultParams, _normalizer);\n });\n balanceProperties(this.states, 'true', '1');\n balanceProperties(this.states, 'false', '0');\n ast.transitions.forEach(ast => {\n this.transitionFactories.push(new AnimationTransitionFactory(name, ast, this.states));\n });\n this.fallbackTransition = createFallbackTransition(name, this.states, this._normalizer);\n }\n get containsQueries() {\n return this.ast.queryCount > 0;\n }\n matchTransition(currentState, nextState, element, params) {\n const entry = this.transitionFactories.find(f => f.match(currentState, nextState, element, params));\n return entry || null;\n }\n matchStyles(currentState, params, errors) {\n return this.fallbackTransition.buildStyles(currentState, params, errors);\n }\n}\nfunction createFallbackTransition(triggerName, states, normalizer) {\n const matchers = [(fromState, toState) => true];\n const animation = { type: 2 /* Sequence */, steps: [], options: null };\n const transition = {\n type: 1 /* Transition */,\n animation,\n matchers,\n options: null,\n queryCount: 0,\n depCount: 0\n };\n return new AnimationTransitionFactory(triggerName, transition, states);\n}\nfunction balanceProperties(obj, key1, key2) {\n if (obj.hasOwnProperty(key1)) {\n if (!obj.hasOwnProperty(key2)) {\n obj[key2] = obj[key1];\n }\n }\n else if (obj.hasOwnProperty(key2)) {\n obj[key1] = obj[key2];\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst EMPTY_INSTRUCTION_MAP = new ElementInstructionMap();\nclass TimelineAnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._animations = {};\n this._playersById = {};\n this.players = [];\n }\n register(id, metadata) {\n const errors = [];\n const ast = buildAnimationAst(this._driver, metadata, errors);\n if (errors.length) {\n throw new Error(`Unable to build the animation due to the following errors: ${errors.join('\\n')}`);\n }\n else {\n this._animations[id] = ast;\n }\n }\n _buildPlayer(i, preStyles, postStyles) {\n const element = i.element;\n const keyframes = normalizeKeyframes(this._driver, this._normalizer, element, i.keyframes, preStyles, postStyles);\n return this._driver.animate(element, keyframes, i.duration, i.delay, i.easing, [], true);\n }\n create(id, element, options = {}) {\n const errors = [];\n const ast = this._animations[id];\n let instructions;\n const autoStylesMap = new Map();\n if (ast) {\n instructions = buildAnimationTimelines(this._driver, element, ast, ENTER_CLASSNAME, LEAVE_CLASSNAME, {}, {}, options, EMPTY_INSTRUCTION_MAP, errors);\n instructions.forEach(inst => {\n const styles = getOrSetAsInMap(autoStylesMap, inst.element, {});\n inst.postStyleProps.forEach(prop => styles[prop] = null);\n });\n }\n else {\n errors.push('The requested animation doesn\\'t exist or has already been destroyed');\n instructions = [];\n }\n if (errors.length) {\n throw new Error(`Unable to create the animation due to the following errors: ${errors.join('\\n')}`);\n }\n autoStylesMap.forEach((styles, element) => {\n Object.keys(styles).forEach(prop => {\n styles[prop] = this._driver.computeStyle(element, prop, AUTO_STYLE);\n });\n });\n const players = instructions.map(i => {\n const styles = autoStylesMap.get(i.element);\n return this._buildPlayer(i, {}, styles);\n });\n const player = optimizeGroupPlayer(players);\n this._playersById[id] = player;\n player.onDestroy(() => this.destroy(id));\n this.players.push(player);\n return player;\n }\n destroy(id) {\n const player = this._getPlayer(id);\n player.destroy();\n delete this._playersById[id];\n const index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n }\n _getPlayer(id) {\n const player = this._playersById[id];\n if (!player) {\n throw new Error(`Unable to find the timeline player referenced by ${id}`);\n }\n return player;\n }\n listen(id, element, eventName, callback) {\n // triggerName, fromState, toState are all ignored for timeline animations\n const baseEvent = makeAnimationEvent(element, '', '', '');\n listenOnPlayer(this._getPlayer(id), eventName, baseEvent, callback);\n return () => { };\n }\n command(id, element, command, args) {\n if (command == 'register') {\n this.register(id, args[0]);\n return;\n }\n if (command == 'create') {\n const options = (args[0] || {});\n this.create(id, element, options);\n return;\n }\n const player = this._getPlayer(id);\n switch (command) {\n case 'play':\n player.play();\n break;\n case 'pause':\n player.pause();\n break;\n case 'reset':\n player.reset();\n break;\n case 'restart':\n player.restart();\n break;\n case 'finish':\n player.finish();\n break;\n case 'init':\n player.init();\n break;\n case 'setPosition':\n player.setPosition(parseFloat(args[0]));\n break;\n case 'destroy':\n this.destroy(id);\n break;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst QUEUED_CLASSNAME = 'ng-animate-queued';\nconst QUEUED_SELECTOR = '.ng-animate-queued';\nconst DISABLED_CLASSNAME = 'ng-animate-disabled';\nconst DISABLED_SELECTOR = '.ng-animate-disabled';\nconst STAR_CLASSNAME = 'ng-star-inserted';\nconst STAR_SELECTOR = '.ng-star-inserted';\nconst EMPTY_PLAYER_ARRAY = [];\nconst NULL_REMOVAL_STATE = {\n namespaceId: '',\n setForRemoval: false,\n setForMove: false,\n hasAnimation: false,\n removedBeforeQueried: false\n};\nconst NULL_REMOVED_QUERIED_STATE = {\n namespaceId: '',\n setForMove: false,\n setForRemoval: false,\n hasAnimation: false,\n removedBeforeQueried: true\n};\nconst REMOVAL_FLAG = '__ng_removed';\nclass StateValue {\n constructor(input, namespaceId = '') {\n this.namespaceId = namespaceId;\n const isObj = input && input.hasOwnProperty('value');\n const value = isObj ? input['value'] : input;\n this.value = normalizeTriggerValue(value);\n if (isObj) {\n const options = copyObj(input);\n delete options['value'];\n this.options = options;\n }\n else {\n this.options = {};\n }\n if (!this.options.params) {\n this.options.params = {};\n }\n }\n get params() {\n return this.options.params;\n }\n absorbOptions(options) {\n const newParams = options.params;\n if (newParams) {\n const oldParams = this.options.params;\n Object.keys(newParams).forEach(prop => {\n if (oldParams[prop] == null) {\n oldParams[prop] = newParams[prop];\n }\n });\n }\n }\n}\nconst VOID_VALUE = 'void';\nconst DEFAULT_STATE_VALUE = new StateValue(VOID_VALUE);\nclass AnimationTransitionNamespace {\n constructor(id, hostElement, _engine) {\n this.id = id;\n this.hostElement = hostElement;\n this._engine = _engine;\n this.players = [];\n this._triggers = {};\n this._queue = [];\n this._elementListeners = new Map();\n this._hostClassName = 'ng-tns-' + id;\n addClass(hostElement, this._hostClassName);\n }\n listen(element, name, phase, callback) {\n if (!this._triggers.hasOwnProperty(name)) {\n throw new Error(`Unable to listen on the animation trigger event \"${phase}\" because the animation trigger \"${name}\" doesn\\'t exist!`);\n }\n if (phase == null || phase.length == 0) {\n throw new Error(`Unable to listen on the animation trigger \"${name}\" because the provided event is undefined!`);\n }\n if (!isTriggerEventValid(phase)) {\n throw new Error(`The provided animation trigger event \"${phase}\" for the animation trigger \"${name}\" is not supported!`);\n }\n const listeners = getOrSetAsInMap(this._elementListeners, element, []);\n const data = { name, phase, callback };\n listeners.push(data);\n const triggersWithStates = getOrSetAsInMap(this._engine.statesByElement, element, {});\n if (!triggersWithStates.hasOwnProperty(name)) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + name);\n triggersWithStates[name] = DEFAULT_STATE_VALUE;\n }\n return () => {\n // the event listener is removed AFTER the flush has occurred such\n // that leave animations callbacks can fire (otherwise if the node\n // is removed in between then the listeners would be deregistered)\n this._engine.afterFlush(() => {\n const index = listeners.indexOf(data);\n if (index >= 0) {\n listeners.splice(index, 1);\n }\n if (!this._triggers[name]) {\n delete triggersWithStates[name];\n }\n });\n };\n }\n register(name, ast) {\n if (this._triggers[name]) {\n // throw\n return false;\n }\n else {\n this._triggers[name] = ast;\n return true;\n }\n }\n _getTrigger(name) {\n const trigger = this._triggers[name];\n if (!trigger) {\n throw new Error(`The provided animation trigger \"${name}\" has not been registered!`);\n }\n return trigger;\n }\n trigger(element, triggerName, value, defaultToFallback = true) {\n const trigger = this._getTrigger(triggerName);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n let triggersWithStates = this._engine.statesByElement.get(element);\n if (!triggersWithStates) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + triggerName);\n this._engine.statesByElement.set(element, triggersWithStates = {});\n }\n let fromState = triggersWithStates[triggerName];\n const toState = new StateValue(value, this.id);\n const isObj = value && value.hasOwnProperty('value');\n if (!isObj && fromState) {\n toState.absorbOptions(fromState.options);\n }\n triggersWithStates[triggerName] = toState;\n if (!fromState) {\n fromState = DEFAULT_STATE_VALUE;\n }\n const isRemoval = toState.value === VOID_VALUE;\n // normally this isn't reached by here, however, if an object expression\n // is passed in then it may be a new object each time. Comparing the value\n // is important since that will stay the same despite there being a new object.\n // The removal arc here is special cased because the same element is triggered\n // twice in the event that it contains animations on the outer/inner portions\n // of the host container\n if (!isRemoval && fromState.value === toState.value) {\n // this means that despite the value not changing, some inner params\n // have changed which means that the animation final styles need to be applied\n if (!objEquals(fromState.params, toState.params)) {\n const errors = [];\n const fromStyles = trigger.matchStyles(fromState.value, fromState.params, errors);\n const toStyles = trigger.matchStyles(toState.value, toState.params, errors);\n if (errors.length) {\n this._engine.reportError(errors);\n }\n else {\n this._engine.afterFlush(() => {\n eraseStyles(element, fromStyles);\n setStyles(element, toStyles);\n });\n }\n }\n return;\n }\n const playersOnElement = getOrSetAsInMap(this._engine.playersByElement, element, []);\n playersOnElement.forEach(player => {\n // only remove the player if it is queued on the EXACT same trigger/namespace\n // we only also deal with queued players here because if the animation has\n // started then we want to keep the player alive until the flush happens\n // (which is where the previousPlayers are passed into the new player)\n if (player.namespaceId == this.id && player.triggerName == triggerName && player.queued) {\n player.destroy();\n }\n });\n let transition = trigger.matchTransition(fromState.value, toState.value, element, toState.params);\n let isFallbackTransition = false;\n if (!transition) {\n if (!defaultToFallback)\n return;\n transition = trigger.fallbackTransition;\n isFallbackTransition = true;\n }\n this._engine.totalQueuedPlayers++;\n this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition });\n if (!isFallbackTransition) {\n addClass(element, QUEUED_CLASSNAME);\n player.onStart(() => {\n removeClass(element, QUEUED_CLASSNAME);\n });\n }\n player.onDone(() => {\n let index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n const players = this._engine.playersByElement.get(element);\n if (players) {\n let index = players.indexOf(player);\n if (index >= 0) {\n players.splice(index, 1);\n }\n }\n });\n this.players.push(player);\n playersOnElement.push(player);\n return player;\n }\n deregister(name) {\n delete this._triggers[name];\n this._engine.statesByElement.forEach((stateMap, element) => {\n delete stateMap[name];\n });\n this._elementListeners.forEach((listeners, element) => {\n this._elementListeners.set(element, listeners.filter(entry => {\n return entry.name != name;\n }));\n });\n }\n clearElementCache(element) {\n this._engine.statesByElement.delete(element);\n this._elementListeners.delete(element);\n const elementPlayers = this._engine.playersByElement.get(element);\n if (elementPlayers) {\n elementPlayers.forEach(player => player.destroy());\n this._engine.playersByElement.delete(element);\n }\n }\n _signalRemovalForInnerTriggers(rootElement, context) {\n const elements = this._engine.driver.query(rootElement, NG_TRIGGER_SELECTOR, true);\n // emulate a leave animation for all inner nodes within this node.\n // If there are no animations found for any of the nodes then clear the cache\n // for the element.\n elements.forEach(elm => {\n // this means that an inner remove() operation has already kicked off\n // the animation on this element...\n if (elm[REMOVAL_FLAG])\n return;\n const namespaces = this._engine.fetchNamespacesByElement(elm);\n if (namespaces.size) {\n namespaces.forEach(ns => ns.triggerLeaveAnimation(elm, context, false, true));\n }\n else {\n this.clearElementCache(elm);\n }\n });\n // If the child elements were removed along with the parent, their animations might not\n // have completed. Clear all the elements from the cache so we don't end up with a memory leak.\n this._engine.afterFlushAnimationsDone(() => elements.forEach(elm => this.clearElementCache(elm)));\n }\n triggerLeaveAnimation(element, context, destroyAfterComplete, defaultToFallback) {\n const triggerStates = this._engine.statesByElement.get(element);\n const previousTriggersValues = new Map();\n if (triggerStates) {\n const players = [];\n Object.keys(triggerStates).forEach(triggerName => {\n previousTriggersValues.set(triggerName, triggerStates[triggerName].value);\n // this check is here in the event that an element is removed\n // twice (both on the host level and the component level)\n if (this._triggers[triggerName]) {\n const player = this.trigger(element, triggerName, VOID_VALUE, defaultToFallback);\n if (player) {\n players.push(player);\n }\n }\n });\n if (players.length) {\n this._engine.markElementAsRemoved(this.id, element, true, context, previousTriggersValues);\n if (destroyAfterComplete) {\n optimizeGroupPlayer(players).onDone(() => this._engine.processLeaveNode(element));\n }\n return true;\n }\n }\n return false;\n }\n prepareLeaveAnimationListeners(element) {\n const listeners = this._elementListeners.get(element);\n const elementStates = this._engine.statesByElement.get(element);\n // if this statement fails then it means that the element was picked up\n // by an earlier flush (or there are no listeners at all to track the leave).\n if (listeners && elementStates) {\n const visitedTriggers = new Set();\n listeners.forEach(listener => {\n const triggerName = listener.name;\n if (visitedTriggers.has(triggerName))\n return;\n visitedTriggers.add(triggerName);\n const trigger = this._triggers[triggerName];\n const transition = trigger.fallbackTransition;\n const fromState = elementStates[triggerName] || DEFAULT_STATE_VALUE;\n const toState = new StateValue(VOID_VALUE);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n this._engine.totalQueuedPlayers++;\n this._queue.push({\n element,\n triggerName,\n transition,\n fromState,\n toState,\n player,\n isFallbackTransition: true\n });\n });\n }\n }\n removeNode(element, context) {\n const engine = this._engine;\n if (element.childElementCount) {\n this._signalRemovalForInnerTriggers(element, context);\n }\n // this means that a * => VOID animation was detected and kicked off\n if (this.triggerLeaveAnimation(element, context, true))\n return;\n // find the player that is animating and make sure that the\n // removal is delayed until that player has completed\n let containsPotentialParentTransition = false;\n if (engine.totalAnimations) {\n const currentPlayers = engine.players.length ? engine.playersByQueriedElement.get(element) : [];\n // when this `if statement` does not continue forward it means that\n // a previous animation query has selected the current element and\n // is animating it. In this situation want to continue forwards and\n // allow the element to be queued up for animation later.\n if (currentPlayers && currentPlayers.length) {\n containsPotentialParentTransition = true;\n }\n else {\n let parent = element;\n while (parent = parent.parentNode) {\n const triggers = engine.statesByElement.get(parent);\n if (triggers) {\n containsPotentialParentTransition = true;\n break;\n }\n }\n }\n }\n // at this stage we know that the element will either get removed\n // during flush or will be picked up by a parent query. Either way\n // we need to fire the listeners for this element when it DOES get\n // removed (once the query parent animation is done or after flush)\n this.prepareLeaveAnimationListeners(element);\n // whether or not a parent has an animation we need to delay the deferral of the leave\n // operation until we have more information (which we do after flush() has been called)\n if (containsPotentialParentTransition) {\n engine.markElementAsRemoved(this.id, element, false, context);\n }\n else {\n const removalFlag = element[REMOVAL_FLAG];\n if (!removalFlag || removalFlag === NULL_REMOVAL_STATE) {\n // we do this after the flush has occurred such\n // that the callbacks can be fired\n engine.afterFlush(() => this.clearElementCache(element));\n engine.destroyInnerAnimations(element);\n engine._onRemovalComplete(element, context);\n }\n }\n }\n insertNode(element, parent) {\n addClass(element, this._hostClassName);\n }\n drainQueuedTransitions(microtaskId) {\n const instructions = [];\n this._queue.forEach(entry => {\n const player = entry.player;\n if (player.destroyed)\n return;\n const element = entry.element;\n const listeners = this._elementListeners.get(element);\n if (listeners) {\n listeners.forEach((listener) => {\n if (listener.name == entry.triggerName) {\n const baseEvent = makeAnimationEvent(element, entry.triggerName, entry.fromState.value, entry.toState.value);\n baseEvent['_data'] = microtaskId;\n listenOnPlayer(entry.player, listener.phase, baseEvent, listener.callback);\n }\n });\n }\n if (player.markedForDestroy) {\n this._engine.afterFlush(() => {\n // now we can destroy the element properly since the event listeners have\n // been bound to the player\n player.destroy();\n });\n }\n else {\n instructions.push(entry);\n }\n });\n this._queue = [];\n return instructions.sort((a, b) => {\n // if depCount == 0 them move to front\n // otherwise if a contains b then move back\n const d0 = a.transition.ast.depCount;\n const d1 = b.transition.ast.depCount;\n if (d0 == 0 || d1 == 0) {\n return d0 - d1;\n }\n return this._engine.driver.containsElement(a.element, b.element) ? 1 : -1;\n });\n }\n destroy(context) {\n this.players.forEach(p => p.destroy());\n this._signalRemovalForInnerTriggers(this.hostElement, context);\n }\n elementContainsData(element) {\n let containsData = false;\n if (this._elementListeners.has(element))\n containsData = true;\n containsData =\n (this._queue.find(entry => entry.element === element) ? true : false) || containsData;\n return containsData;\n }\n}\nclass TransitionAnimationEngine {\n constructor(bodyNode, driver, _normalizer) {\n this.bodyNode = bodyNode;\n this.driver = driver;\n this._normalizer = _normalizer;\n this.players = [];\n this.newHostElements = new Map();\n this.playersByElement = new Map();\n this.playersByQueriedElement = new Map();\n this.statesByElement = new Map();\n this.disabledNodes = new Set();\n this.totalAnimations = 0;\n this.totalQueuedPlayers = 0;\n this._namespaceLookup = {};\n this._namespaceList = [];\n this._flushFns = [];\n this._whenQuietFns = [];\n this.namespacesByHostElement = new Map();\n this.collectedEnterElements = [];\n this.collectedLeaveElements = [];\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n }\n /** @internal */\n _onRemovalComplete(element, context) {\n this.onRemovalComplete(element, context);\n }\n get queuedPlayers() {\n const players = [];\n this._namespaceList.forEach(ns => {\n ns.players.forEach(player => {\n if (player.queued) {\n players.push(player);\n }\n });\n });\n return players;\n }\n createNamespace(namespaceId, hostElement) {\n const ns = new AnimationTransitionNamespace(namespaceId, hostElement, this);\n if (this.bodyNode && this.driver.containsElement(this.bodyNode, hostElement)) {\n this._balanceNamespaceList(ns, hostElement);\n }\n else {\n // defer this later until flush during when the host element has\n // been inserted so that we know exactly where to place it in\n // the namespace list\n this.newHostElements.set(hostElement, ns);\n // given that this host element is a part of the animation code, it\n // may or may not be inserted by a parent node that is of an\n // animation renderer type. If this happens then we can still have\n // access to this item when we query for :enter nodes. If the parent\n // is a renderer then the set data-structure will normalize the entry\n this.collectEnterElement(hostElement);\n }\n return this._namespaceLookup[namespaceId] = ns;\n }\n _balanceNamespaceList(ns, hostElement) {\n const limit = this._namespaceList.length - 1;\n if (limit >= 0) {\n let found = false;\n for (let i = limit; i >= 0; i--) {\n const nextNamespace = this._namespaceList[i];\n if (this.driver.containsElement(nextNamespace.hostElement, hostElement)) {\n this._namespaceList.splice(i + 1, 0, ns);\n found = true;\n break;\n }\n }\n if (!found) {\n this._namespaceList.splice(0, 0, ns);\n }\n }\n else {\n this._namespaceList.push(ns);\n }\n this.namespacesByHostElement.set(hostElement, ns);\n return ns;\n }\n register(namespaceId, hostElement) {\n let ns = this._namespaceLookup[namespaceId];\n if (!ns) {\n ns = this.createNamespace(namespaceId, hostElement);\n }\n return ns;\n }\n registerTrigger(namespaceId, name, trigger) {\n let ns = this._namespaceLookup[namespaceId];\n if (ns && ns.register(name, trigger)) {\n this.totalAnimations++;\n }\n }\n destroy(namespaceId, context) {\n if (!namespaceId)\n return;\n const ns = this._fetchNamespace(namespaceId);\n this.afterFlush(() => {\n this.namespacesByHostElement.delete(ns.hostElement);\n delete this._namespaceLookup[namespaceId];\n const index = this._namespaceList.indexOf(ns);\n if (index >= 0) {\n this._namespaceList.splice(index, 1);\n }\n });\n this.afterFlushAnimationsDone(() => ns.destroy(context));\n }\n _fetchNamespace(id) {\n return this._namespaceLookup[id];\n }\n fetchNamespacesByElement(element) {\n // normally there should only be one namespace per element, however\n // if @triggers are placed on both the component element and then\n // its host element (within the component code) then there will be\n // two namespaces returned. We use a set here to simply deduplicate\n // the namespaces in case (for the reason described above) there are multiple triggers\n const namespaces = new Set();\n const elementStates = this.statesByElement.get(element);\n if (elementStates) {\n const keys = Object.keys(elementStates);\n for (let i = 0; i < keys.length; i++) {\n const nsId = elementStates[keys[i]].namespaceId;\n if (nsId) {\n const ns = this._fetchNamespace(nsId);\n if (ns) {\n namespaces.add(ns);\n }\n }\n }\n }\n return namespaces;\n }\n trigger(namespaceId, element, name, value) {\n if (isElementNode(element)) {\n const ns = this._fetchNamespace(namespaceId);\n if (ns) {\n ns.trigger(element, name, value);\n return true;\n }\n }\n return false;\n }\n insertNode(namespaceId, element, parent, insertBefore) {\n if (!isElementNode(element))\n return;\n // special case for when an element is removed and reinserted (move operation)\n // when this occurs we do not want to use the element for deletion later\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n details.setForRemoval = false;\n details.setForMove = true;\n const index = this.collectedLeaveElements.indexOf(element);\n if (index >= 0) {\n this.collectedLeaveElements.splice(index, 1);\n }\n }\n // in the event that the namespaceId is blank then the caller\n // code does not contain any animation code in it, but it is\n // just being called so that the node is marked as being inserted\n if (namespaceId) {\n const ns = this._fetchNamespace(namespaceId);\n // This if-statement is a workaround for router issue #21947.\n // The router sometimes hits a race condition where while a route\n // is being instantiated a new navigation arrives, triggering leave\n // animation of DOM that has not been fully initialized, until this\n // is resolved, we need to handle the scenario when DOM is not in a\n // consistent state during the animation.\n if (ns) {\n ns.insertNode(element, parent);\n }\n }\n // only *directives and host elements are inserted before\n if (insertBefore) {\n this.collectEnterElement(element);\n }\n }\n collectEnterElement(element) {\n this.collectedEnterElements.push(element);\n }\n markElementAsDisabled(element, value) {\n if (value) {\n if (!this.disabledNodes.has(element)) {\n this.disabledNodes.add(element);\n addClass(element, DISABLED_CLASSNAME);\n }\n }\n else if (this.disabledNodes.has(element)) {\n this.disabledNodes.delete(element);\n removeClass(element, DISABLED_CLASSNAME);\n }\n }\n removeNode(namespaceId, element, isHostElement, context) {\n if (isElementNode(element)) {\n const ns = namespaceId ? this._fetchNamespace(namespaceId) : null;\n if (ns) {\n ns.removeNode(element, context);\n }\n else {\n this.markElementAsRemoved(namespaceId, element, false, context);\n }\n if (isHostElement) {\n const hostNS = this.namespacesByHostElement.get(element);\n if (hostNS && hostNS.id !== namespaceId) {\n hostNS.removeNode(element, context);\n }\n }\n }\n else {\n this._onRemovalComplete(element, context);\n }\n }\n markElementAsRemoved(namespaceId, element, hasAnimation, context, previousTriggersValues) {\n this.collectedLeaveElements.push(element);\n element[REMOVAL_FLAG] = {\n namespaceId,\n setForRemoval: context,\n hasAnimation,\n removedBeforeQueried: false,\n previousTriggersValues\n };\n }\n listen(namespaceId, element, name, phase, callback) {\n if (isElementNode(element)) {\n return this._fetchNamespace(namespaceId).listen(element, name, phase, callback);\n }\n return () => { };\n }\n _buildInstruction(entry, subTimelines, enterClassName, leaveClassName, skipBuildAst) {\n return entry.transition.build(this.driver, entry.element, entry.fromState.value, entry.toState.value, enterClassName, leaveClassName, entry.fromState.options, entry.toState.options, subTimelines, skipBuildAst);\n }\n destroyInnerAnimations(containerElement) {\n let elements = this.driver.query(containerElement, NG_TRIGGER_SELECTOR, true);\n elements.forEach(element => this.destroyActiveAnimationsForElement(element));\n if (this.playersByQueriedElement.size == 0)\n return;\n elements = this.driver.query(containerElement, NG_ANIMATING_SELECTOR, true);\n elements.forEach(element => this.finishActiveQueriedAnimationOnElement(element));\n }\n destroyActiveAnimationsForElement(element) {\n const players = this.playersByElement.get(element);\n if (players) {\n players.forEach(player => {\n // special case for when an element is set for destruction, but hasn't started.\n // in this situation we want to delay the destruction until the flush occurs\n // so that any event listeners attached to the player are triggered.\n if (player.queued) {\n player.markedForDestroy = true;\n }\n else {\n player.destroy();\n }\n });\n }\n }\n finishActiveQueriedAnimationOnElement(element) {\n const players = this.playersByQueriedElement.get(element);\n if (players) {\n players.forEach(player => player.finish());\n }\n }\n whenRenderingDone() {\n return new Promise(resolve => {\n if (this.players.length) {\n return optimizeGroupPlayer(this.players).onDone(() => resolve());\n }\n else {\n resolve();\n }\n });\n }\n processLeaveNode(element) {\n var _a;\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n // this will prevent it from removing it twice\n element[REMOVAL_FLAG] = NULL_REMOVAL_STATE;\n if (details.namespaceId) {\n this.destroyInnerAnimations(element);\n const ns = this._fetchNamespace(details.namespaceId);\n if (ns) {\n ns.clearElementCache(element);\n }\n }\n this._onRemovalComplete(element, details.setForRemoval);\n }\n if ((_a = element.classList) === null || _a === void 0 ? void 0 : _a.contains(DISABLED_CLASSNAME)) {\n this.markElementAsDisabled(element, false);\n }\n this.driver.query(element, DISABLED_SELECTOR, true).forEach(node => {\n this.markElementAsDisabled(node, false);\n });\n }\n flush(microtaskId = -1) {\n let players = [];\n if (this.newHostElements.size) {\n this.newHostElements.forEach((ns, element) => this._balanceNamespaceList(ns, element));\n this.newHostElements.clear();\n }\n if (this.totalAnimations && this.collectedEnterElements.length) {\n for (let i = 0; i < this.collectedEnterElements.length; i++) {\n const elm = this.collectedEnterElements[i];\n addClass(elm, STAR_CLASSNAME);\n }\n }\n if (this._namespaceList.length &&\n (this.totalQueuedPlayers || this.collectedLeaveElements.length)) {\n const cleanupFns = [];\n try {\n players = this._flushAnimations(cleanupFns, microtaskId);\n }\n finally {\n for (let i = 0; i < cleanupFns.length; i++) {\n cleanupFns[i]();\n }\n }\n }\n else {\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n this.processLeaveNode(element);\n }\n }\n this.totalQueuedPlayers = 0;\n this.collectedEnterElements.length = 0;\n this.collectedLeaveElements.length = 0;\n this._flushFns.forEach(fn => fn());\n this._flushFns = [];\n if (this._whenQuietFns.length) {\n // we move these over to a variable so that\n // if any new callbacks are registered in another\n // flush they do not populate the existing set\n const quietFns = this._whenQuietFns;\n this._whenQuietFns = [];\n if (players.length) {\n optimizeGroupPlayer(players).onDone(() => {\n quietFns.forEach(fn => fn());\n });\n }\n else {\n quietFns.forEach(fn => fn());\n }\n }\n }\n reportError(errors) {\n throw new Error(`Unable to process animations due to the following failed trigger transitions\\n ${errors.join('\\n')}`);\n }\n _flushAnimations(cleanupFns, microtaskId) {\n const subTimelines = new ElementInstructionMap();\n const skippedPlayers = [];\n const skippedPlayersMap = new Map();\n const queuedInstructions = [];\n const queriedElements = new Map();\n const allPreStyleElements = new Map();\n const allPostStyleElements = new Map();\n const disabledElementsSet = new Set();\n this.disabledNodes.forEach(node => {\n disabledElementsSet.add(node);\n const nodesThatAreDisabled = this.driver.query(node, QUEUED_SELECTOR, true);\n for (let i = 0; i < nodesThatAreDisabled.length; i++) {\n disabledElementsSet.add(nodesThatAreDisabled[i]);\n }\n });\n const bodyNode = this.bodyNode;\n const allTriggerElements = Array.from(this.statesByElement.keys());\n const enterNodeMap = buildRootMap(allTriggerElements, this.collectedEnterElements);\n // this must occur before the instructions are built below such that\n // the :enter queries match the elements (since the timeline queries\n // are fired during instruction building).\n const enterNodeMapIds = new Map();\n let i = 0;\n enterNodeMap.forEach((nodes, root) => {\n const className = ENTER_CLASSNAME + i++;\n enterNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n const allLeaveNodes = [];\n const mergedLeaveNodes = new Set();\n const leaveNodesWithoutAnimations = new Set();\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n allLeaveNodes.push(element);\n mergedLeaveNodes.add(element);\n if (details.hasAnimation) {\n this.driver.query(element, STAR_SELECTOR, true).forEach(elm => mergedLeaveNodes.add(elm));\n }\n else {\n leaveNodesWithoutAnimations.add(element);\n }\n }\n }\n const leaveNodeMapIds = new Map();\n const leaveNodeMap = buildRootMap(allTriggerElements, Array.from(mergedLeaveNodes));\n leaveNodeMap.forEach((nodes, root) => {\n const className = LEAVE_CLASSNAME + i++;\n leaveNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n cleanupFns.push(() => {\n enterNodeMap.forEach((nodes, root) => {\n const className = enterNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n leaveNodeMap.forEach((nodes, root) => {\n const className = leaveNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n allLeaveNodes.forEach(element => {\n this.processLeaveNode(element);\n });\n });\n const allPlayers = [];\n const erroneousTransitions = [];\n for (let i = this._namespaceList.length - 1; i >= 0; i--) {\n const ns = this._namespaceList[i];\n ns.drainQueuedTransitions(microtaskId).forEach(entry => {\n const player = entry.player;\n const element = entry.element;\n allPlayers.push(player);\n if (this.collectedEnterElements.length) {\n const details = element[REMOVAL_FLAG];\n // animations for move operations (elements being removed and reinserted,\n // e.g. when the order of an *ngFor list changes) are currently not supported\n if (details && details.setForMove) {\n if (details.previousTriggersValues &&\n details.previousTriggersValues.has(entry.triggerName)) {\n const previousValue = details.previousTriggersValues.get(entry.triggerName);\n // we need to restore the previous trigger value since the element has\n // only been moved and hasn't actually left the DOM\n const triggersWithStates = this.statesByElement.get(entry.element);\n if (triggersWithStates && triggersWithStates[entry.triggerName]) {\n triggersWithStates[entry.triggerName].value = previousValue;\n }\n }\n player.destroy();\n return;\n }\n }\n const nodeIsOrphaned = !bodyNode || !this.driver.containsElement(bodyNode, element);\n const leaveClassName = leaveNodeMapIds.get(element);\n const enterClassName = enterNodeMapIds.get(element);\n const instruction = this._buildInstruction(entry, subTimelines, enterClassName, leaveClassName, nodeIsOrphaned);\n if (instruction.errors && instruction.errors.length) {\n erroneousTransitions.push(instruction);\n return;\n }\n // even though the element may not be in the DOM, it may still\n // be added at a later point (due to the mechanics of content\n // projection and/or dynamic component insertion) therefore it's\n // important to still style the element.\n if (nodeIsOrphaned) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // if an unmatched transition is queued and ready to go\n // then it SHOULD NOT render an animation and cancel the\n // previously running animations.\n if (entry.isFallbackTransition) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // this means that if a parent animation uses this animation as a sub-trigger\n // then it will instruct the timeline builder not to add a player delay, but\n // instead stretch the first keyframe gap until the animation starts. This is\n // important in order to prevent extra initialization styles from being\n // required by the user for the animation.\n const timelines = [];\n instruction.timelines.forEach(tl => {\n tl.stretchStartingKeyframe = true;\n if (!this.disabledNodes.has(tl.element)) {\n timelines.push(tl);\n }\n });\n instruction.timelines = timelines;\n subTimelines.append(element, instruction.timelines);\n const tuple = { instruction, player, element };\n queuedInstructions.push(tuple);\n instruction.queriedElements.forEach(element => getOrSetAsInMap(queriedElements, element, []).push(player));\n instruction.preStyleProps.forEach((stringMap, element) => {\n const props = Object.keys(stringMap);\n if (props.length) {\n let setVal = allPreStyleElements.get(element);\n if (!setVal) {\n allPreStyleElements.set(element, setVal = new Set());\n }\n props.forEach(prop => setVal.add(prop));\n }\n });\n instruction.postStyleProps.forEach((stringMap, element) => {\n const props = Object.keys(stringMap);\n let setVal = allPostStyleElements.get(element);\n if (!setVal) {\n allPostStyleElements.set(element, setVal = new Set());\n }\n props.forEach(prop => setVal.add(prop));\n });\n });\n }\n if (erroneousTransitions.length) {\n const errors = [];\n erroneousTransitions.forEach(instruction => {\n errors.push(`@${instruction.triggerName} has failed due to:\\n`);\n instruction.errors.forEach(error => errors.push(`- ${error}\\n`));\n });\n allPlayers.forEach(player => player.destroy());\n this.reportError(errors);\n }\n const allPreviousPlayersMap = new Map();\n // this map tells us which element in the DOM tree is contained by\n // which animation. Further down this map will get populated once\n // the players are built and in doing so we can use it to efficiently\n // figure out if a sub player is skipped due to a parent player having priority.\n const animationElementMap = new Map();\n queuedInstructions.forEach(entry => {\n const element = entry.element;\n if (subTimelines.has(element)) {\n animationElementMap.set(element, element);\n this._beforeAnimationBuild(entry.player.namespaceId, entry.instruction, allPreviousPlayersMap);\n }\n });\n skippedPlayers.forEach(player => {\n const element = player.element;\n const previousPlayers = this._getPreviousPlayers(element, false, player.namespaceId, player.triggerName, null);\n previousPlayers.forEach(prevPlayer => {\n getOrSetAsInMap(allPreviousPlayersMap, element, []).push(prevPlayer);\n prevPlayer.destroy();\n });\n });\n // this is a special case for nodes that will be removed either by\n // having their own leave animations or by being queried in a container\n // that will be removed once a parent animation is complete. The idea\n // here is that * styles must be identical to ! styles because of\n // backwards compatibility (* is also filled in by default in many places).\n // Otherwise * styles will return an empty value or \"auto\" since the element\n // passed to getComputedStyle will not be visible (since * === destination)\n const replaceNodes = allLeaveNodes.filter(node => {\n return replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements);\n });\n // POST STAGE: fill the * styles\n const postStylesMap = new Map();\n const allLeaveQueriedNodes = cloakAndComputeStyles(postStylesMap, this.driver, leaveNodesWithoutAnimations, allPostStyleElements, AUTO_STYLE);\n allLeaveQueriedNodes.forEach(node => {\n if (replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements)) {\n replaceNodes.push(node);\n }\n });\n // PRE STAGE: fill the ! styles\n const preStylesMap = new Map();\n enterNodeMap.forEach((nodes, root) => {\n cloakAndComputeStyles(preStylesMap, this.driver, new Set(nodes), allPreStyleElements, ɵPRE_STYLE);\n });\n replaceNodes.forEach(node => {\n const post = postStylesMap.get(node);\n const pre = preStylesMap.get(node);\n postStylesMap.set(node, Object.assign(Object.assign({}, post), pre));\n });\n const rootPlayers = [];\n const subPlayers = [];\n const NO_PARENT_ANIMATION_ELEMENT_DETECTED = {};\n queuedInstructions.forEach(entry => {\n const { element, player, instruction } = entry;\n // this means that it was never consumed by a parent animation which\n // means that it is independent and therefore should be set for animation\n if (subTimelines.has(element)) {\n if (disabledElementsSet.has(element)) {\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n player.disabled = true;\n player.overrideTotalTime(instruction.totalTime);\n skippedPlayers.push(player);\n return;\n }\n // this will flow up the DOM and query the map to figure out\n // if a parent animation has priority over it. In the situation\n // that a parent is detected then it will cancel the loop. If\n // nothing is detected, or it takes a few hops to find a parent,\n // then it will fill in the missing nodes and signal them as having\n // a detected parent (or a NO_PARENT value via a special constant).\n let parentWithAnimation = NO_PARENT_ANIMATION_ELEMENT_DETECTED;\n if (animationElementMap.size > 1) {\n let elm = element;\n const parentsToAdd = [];\n while (elm = elm.parentNode) {\n const detectedParent = animationElementMap.get(elm);\n if (detectedParent) {\n parentWithAnimation = detectedParent;\n break;\n }\n parentsToAdd.push(elm);\n }\n parentsToAdd.forEach(parent => animationElementMap.set(parent, parentWithAnimation));\n }\n const innerPlayer = this._buildAnimation(player.namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap);\n player.setRealPlayer(innerPlayer);\n if (parentWithAnimation === NO_PARENT_ANIMATION_ELEMENT_DETECTED) {\n rootPlayers.push(player);\n }\n else {\n const parentPlayers = this.playersByElement.get(parentWithAnimation);\n if (parentPlayers && parentPlayers.length) {\n player.parentPlayer = optimizeGroupPlayer(parentPlayers);\n }\n skippedPlayers.push(player);\n }\n }\n else {\n eraseStyles(element, instruction.fromStyles);\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n // there still might be a ancestor player animating this\n // element therefore we will still add it as a sub player\n // even if its animation may be disabled\n subPlayers.push(player);\n if (disabledElementsSet.has(element)) {\n skippedPlayers.push(player);\n }\n }\n });\n // find all of the sub players' corresponding inner animation players\n subPlayers.forEach(player => {\n // even if no players are found for a sub animation it\n // will still complete itself after the next tick since it's Noop\n const playersForElement = skippedPlayersMap.get(player.element);\n if (playersForElement && playersForElement.length) {\n const innerPlayer = optimizeGroupPlayer(playersForElement);\n player.setRealPlayer(innerPlayer);\n }\n });\n // the reason why we don't actually play the animation is\n // because all that a skipped player is designed to do is to\n // fire the start/done transition callback events\n skippedPlayers.forEach(player => {\n if (player.parentPlayer) {\n player.syncPlayerEvents(player.parentPlayer);\n }\n else {\n player.destroy();\n }\n });\n // run through all of the queued removals and see if they\n // were picked up by a query. If not then perform the removal\n // operation right away unless a parent animation is ongoing.\n for (let i = 0; i < allLeaveNodes.length; i++) {\n const element = allLeaveNodes[i];\n const details = element[REMOVAL_FLAG];\n removeClass(element, LEAVE_CLASSNAME);\n // this means the element has a removal animation that is being\n // taken care of and therefore the inner elements will hang around\n // until that animation is over (or the parent queried animation)\n if (details && details.hasAnimation)\n continue;\n let players = [];\n // if this element is queried or if it contains queried children\n // then we want for the element not to be removed from the page\n // until the queried animations have finished\n if (queriedElements.size) {\n let queriedPlayerResults = queriedElements.get(element);\n if (queriedPlayerResults && queriedPlayerResults.length) {\n players.push(...queriedPlayerResults);\n }\n let queriedInnerElements = this.driver.query(element, NG_ANIMATING_SELECTOR, true);\n for (let j = 0; j < queriedInnerElements.length; j++) {\n let queriedPlayers = queriedElements.get(queriedInnerElements[j]);\n if (queriedPlayers && queriedPlayers.length) {\n players.push(...queriedPlayers);\n }\n }\n }\n const activePlayers = players.filter(p => !p.destroyed);\n if (activePlayers.length) {\n removeNodesAfterAnimationDone(this, element, activePlayers);\n }\n else {\n this.processLeaveNode(element);\n }\n }\n // this is required so the cleanup method doesn't remove them\n allLeaveNodes.length = 0;\n rootPlayers.forEach(player => {\n this.players.push(player);\n player.onDone(() => {\n player.destroy();\n const index = this.players.indexOf(player);\n this.players.splice(index, 1);\n });\n player.play();\n });\n return rootPlayers;\n }\n elementContainsData(namespaceId, element) {\n let containsData = false;\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval)\n containsData = true;\n if (this.playersByElement.has(element))\n containsData = true;\n if (this.playersByQueriedElement.has(element))\n containsData = true;\n if (this.statesByElement.has(element))\n containsData = true;\n return this._fetchNamespace(namespaceId).elementContainsData(element) || containsData;\n }\n afterFlush(callback) {\n this._flushFns.push(callback);\n }\n afterFlushAnimationsDone(callback) {\n this._whenQuietFns.push(callback);\n }\n _getPreviousPlayers(element, isQueriedElement, namespaceId, triggerName, toStateValue) {\n let players = [];\n if (isQueriedElement) {\n const queriedElementPlayers = this.playersByQueriedElement.get(element);\n if (queriedElementPlayers) {\n players = queriedElementPlayers;\n }\n }\n else {\n const elementPlayers = this.playersByElement.get(element);\n if (elementPlayers) {\n const isRemovalAnimation = !toStateValue || toStateValue == VOID_VALUE;\n elementPlayers.forEach(player => {\n if (player.queued)\n return;\n if (!isRemovalAnimation && player.triggerName != triggerName)\n return;\n players.push(player);\n });\n }\n }\n if (namespaceId || triggerName) {\n players = players.filter(player => {\n if (namespaceId && namespaceId != player.namespaceId)\n return false;\n if (triggerName && triggerName != player.triggerName)\n return false;\n return true;\n });\n }\n return players;\n }\n _beforeAnimationBuild(namespaceId, instruction, allPreviousPlayersMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // when a removal animation occurs, ALL previous players are collected\n // and destroyed (even if they are outside of the current namespace)\n const targetNameSpaceId = instruction.isRemovalTransition ? undefined : namespaceId;\n const targetTriggerName = instruction.isRemovalTransition ? undefined : triggerName;\n for (const timelineInstruction of instruction.timelines) {\n const element = timelineInstruction.element;\n const isQueriedElement = element !== rootElement;\n const players = getOrSetAsInMap(allPreviousPlayersMap, element, []);\n const previousPlayers = this._getPreviousPlayers(element, isQueriedElement, targetNameSpaceId, targetTriggerName, instruction.toState);\n previousPlayers.forEach(player => {\n const realPlayer = player.getRealPlayer();\n if (realPlayer.beforeDestroy) {\n realPlayer.beforeDestroy();\n }\n player.destroy();\n players.push(player);\n });\n }\n // this needs to be done so that the PRE/POST styles can be\n // computed properly without interfering with the previous animation\n eraseStyles(rootElement, instruction.fromStyles);\n }\n _buildAnimation(namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // we first run this so that the previous animation player\n // data can be passed into the successive animation players\n const allQueriedPlayers = [];\n const allConsumedElements = new Set();\n const allSubElements = new Set();\n const allNewPlayers = instruction.timelines.map(timelineInstruction => {\n const element = timelineInstruction.element;\n allConsumedElements.add(element);\n // FIXME (matsko): make sure to-be-removed animations are removed properly\n const details = element[REMOVAL_FLAG];\n if (details && details.removedBeforeQueried)\n return new NoopAnimationPlayer(timelineInstruction.duration, timelineInstruction.delay);\n const isQueriedElement = element !== rootElement;\n const previousPlayers = flattenGroupPlayers((allPreviousPlayersMap.get(element) || EMPTY_PLAYER_ARRAY)\n .map(p => p.getRealPlayer()))\n .filter(p => {\n // the `element` is not apart of the AnimationPlayer definition, but\n // Mock/WebAnimations\n // use the element within their implementation. This will be added in Angular5 to\n // AnimationPlayer\n const pp = p;\n return pp.element ? pp.element === element : false;\n });\n const preStyles = preStylesMap.get(element);\n const postStyles = postStylesMap.get(element);\n const keyframes = normalizeKeyframes(this.driver, this._normalizer, element, timelineInstruction.keyframes, preStyles, postStyles);\n const player = this._buildPlayer(timelineInstruction, keyframes, previousPlayers);\n // this means that this particular player belongs to a sub trigger. It is\n // important that we match this player up with the corresponding (@trigger.listener)\n if (timelineInstruction.subTimeline && skippedPlayersMap) {\n allSubElements.add(element);\n }\n if (isQueriedElement) {\n const wrappedPlayer = new TransitionAnimationPlayer(namespaceId, triggerName, element);\n wrappedPlayer.setRealPlayer(player);\n allQueriedPlayers.push(wrappedPlayer);\n }\n return player;\n });\n allQueriedPlayers.forEach(player => {\n getOrSetAsInMap(this.playersByQueriedElement, player.element, []).push(player);\n player.onDone(() => deleteOrUnsetInMap(this.playersByQueriedElement, player.element, player));\n });\n allConsumedElements.forEach(element => addClass(element, NG_ANIMATING_CLASSNAME));\n const player = optimizeGroupPlayer(allNewPlayers);\n player.onDestroy(() => {\n allConsumedElements.forEach(element => removeClass(element, NG_ANIMATING_CLASSNAME));\n setStyles(rootElement, instruction.toStyles);\n });\n // this basically makes all of the callbacks for sub element animations\n // be dependent on the upper players for when they finish\n allSubElements.forEach(element => {\n getOrSetAsInMap(skippedPlayersMap, element, []).push(player);\n });\n return player;\n }\n _buildPlayer(instruction, keyframes, previousPlayers) {\n if (keyframes.length > 0) {\n return this.driver.animate(instruction.element, keyframes, instruction.duration, instruction.delay, instruction.easing, previousPlayers);\n }\n // special case for when an empty transition|definition is provided\n // ... there is no point in rendering an empty animation\n return new NoopAnimationPlayer(instruction.duration, instruction.delay);\n }\n}\nclass TransitionAnimationPlayer {\n constructor(namespaceId, triggerName, element) {\n this.namespaceId = namespaceId;\n this.triggerName = triggerName;\n this.element = element;\n this._player = new NoopAnimationPlayer();\n this._containsRealPlayer = false;\n this._queuedCallbacks = {};\n this.destroyed = false;\n this.markedForDestroy = false;\n this.disabled = false;\n this.queued = true;\n this.totalTime = 0;\n }\n setRealPlayer(player) {\n if (this._containsRealPlayer)\n return;\n this._player = player;\n Object.keys(this._queuedCallbacks).forEach(phase => {\n this._queuedCallbacks[phase].forEach(callback => listenOnPlayer(player, phase, undefined, callback));\n });\n this._queuedCallbacks = {};\n this._containsRealPlayer = true;\n this.overrideTotalTime(player.totalTime);\n this.queued = false;\n }\n getRealPlayer() {\n return this._player;\n }\n overrideTotalTime(totalTime) {\n this.totalTime = totalTime;\n }\n syncPlayerEvents(player) {\n const p = this._player;\n if (p.triggerCallback) {\n player.onStart(() => p.triggerCallback('start'));\n }\n player.onDone(() => this.finish());\n player.onDestroy(() => this.destroy());\n }\n _queueEvent(name, callback) {\n getOrSetAsInMap(this._queuedCallbacks, name, []).push(callback);\n }\n onDone(fn) {\n if (this.queued) {\n this._queueEvent('done', fn);\n }\n this._player.onDone(fn);\n }\n onStart(fn) {\n if (this.queued) {\n this._queueEvent('start', fn);\n }\n this._player.onStart(fn);\n }\n onDestroy(fn) {\n if (this.queued) {\n this._queueEvent('destroy', fn);\n }\n this._player.onDestroy(fn);\n }\n init() {\n this._player.init();\n }\n hasStarted() {\n return this.queued ? false : this._player.hasStarted();\n }\n play() {\n !this.queued && this._player.play();\n }\n pause() {\n !this.queued && this._player.pause();\n }\n restart() {\n !this.queued && this._player.restart();\n }\n finish() {\n this._player.finish();\n }\n destroy() {\n this.destroyed = true;\n this._player.destroy();\n }\n reset() {\n !this.queued && this._player.reset();\n }\n setPosition(p) {\n if (!this.queued) {\n this._player.setPosition(p);\n }\n }\n getPosition() {\n return this.queued ? 0 : this._player.getPosition();\n }\n /** @internal */\n triggerCallback(phaseName) {\n const p = this._player;\n if (p.triggerCallback) {\n p.triggerCallback(phaseName);\n }\n }\n}\nfunction deleteOrUnsetInMap(map, key, value) {\n let currentValues;\n if (map instanceof Map) {\n currentValues = map.get(key);\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n map.delete(key);\n }\n }\n }\n else {\n currentValues = map[key];\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n delete map[key];\n }\n }\n }\n return currentValues;\n}\nfunction normalizeTriggerValue(value) {\n // we use `!= null` here because it's the most simple\n // way to test against a \"falsy\" value without mixing\n // in empty strings or a zero value. DO NOT OPTIMIZE.\n return value != null ? value : null;\n}\nfunction isElementNode(node) {\n return node && node['nodeType'] === 1;\n}\nfunction isTriggerEventValid(eventName) {\n return eventName == 'start' || eventName == 'done';\n}\nfunction cloakElement(element, value) {\n const oldValue = element.style.display;\n element.style.display = value != null ? value : 'none';\n return oldValue;\n}\nfunction cloakAndComputeStyles(valuesMap, driver, elements, elementPropsMap, defaultStyle) {\n const cloakVals = [];\n elements.forEach(element => cloakVals.push(cloakElement(element)));\n const failedElements = [];\n elementPropsMap.forEach((props, element) => {\n const styles = {};\n props.forEach(prop => {\n const value = styles[prop] = driver.computeStyle(element, prop, defaultStyle);\n // there is no easy way to detect this because a sub element could be removed\n // by a parent animation element being detached.\n if (!value || value.length == 0) {\n element[REMOVAL_FLAG] = NULL_REMOVED_QUERIED_STATE;\n failedElements.push(element);\n }\n });\n valuesMap.set(element, styles);\n });\n // we use a index variable here since Set.forEach(a, i) does not return\n // an index value for the closure (but instead just the value)\n let i = 0;\n elements.forEach(element => cloakElement(element, cloakVals[i++]));\n return failedElements;\n}\n/*\nSince the Angular renderer code will return a collection of inserted\nnodes in all areas of a DOM tree, it's up to this algorithm to figure\nout which nodes are roots for each animation @trigger.\n\nBy placing each inserted node into a Set and traversing upwards, it\nis possible to find the @trigger elements and well any direct *star\ninsertion nodes, if a @trigger root is found then the enter element\nis placed into the Map[@trigger] spot.\n */\nfunction buildRootMap(roots, nodes) {\n const rootMap = new Map();\n roots.forEach(root => rootMap.set(root, []));\n if (nodes.length == 0)\n return rootMap;\n const NULL_NODE = 1;\n const nodeSet = new Set(nodes);\n const localRootMap = new Map();\n function getRoot(node) {\n if (!node)\n return NULL_NODE;\n let root = localRootMap.get(node);\n if (root)\n return root;\n const parent = node.parentNode;\n if (rootMap.has(parent)) { // ngIf inside @trigger\n root = parent;\n }\n else if (nodeSet.has(parent)) { // ngIf inside ngIf\n root = NULL_NODE;\n }\n else { // recurse upwards\n root = getRoot(parent);\n }\n localRootMap.set(node, root);\n return root;\n }\n nodes.forEach(node => {\n const root = getRoot(node);\n if (root !== NULL_NODE) {\n rootMap.get(root).push(node);\n }\n });\n return rootMap;\n}\nfunction addClass(element, className) {\n var _a;\n (_a = element.classList) === null || _a === void 0 ? void 0 : _a.add(className);\n}\nfunction removeClass(element, className) {\n var _a;\n (_a = element.classList) === null || _a === void 0 ? void 0 : _a.remove(className);\n}\nfunction removeNodesAfterAnimationDone(engine, element, players) {\n optimizeGroupPlayer(players).onDone(() => engine.processLeaveNode(element));\n}\nfunction flattenGroupPlayers(players) {\n const finalPlayers = [];\n _flattenGroupPlayersRecur(players, finalPlayers);\n return finalPlayers;\n}\nfunction _flattenGroupPlayersRecur(players, finalPlayers) {\n for (let i = 0; i < players.length; i++) {\n const player = players[i];\n if (player instanceof ɵAnimationGroupPlayer) {\n _flattenGroupPlayersRecur(player.players, finalPlayers);\n }\n else {\n finalPlayers.push(player);\n }\n }\n}\nfunction objEquals(a, b) {\n const k1 = Object.keys(a);\n const k2 = Object.keys(b);\n if (k1.length != k2.length)\n return false;\n for (let i = 0; i < k1.length; i++) {\n const prop = k1[i];\n if (!b.hasOwnProperty(prop) || a[prop] !== b[prop])\n return false;\n }\n return true;\n}\nfunction replacePostStylesAsPre(element, allPreStyleElements, allPostStyleElements) {\n const postEntry = allPostStyleElements.get(element);\n if (!postEntry)\n return false;\n let preEntry = allPreStyleElements.get(element);\n if (preEntry) {\n postEntry.forEach(data => preEntry.add(data));\n }\n else {\n allPreStyleElements.set(element, postEntry);\n }\n allPostStyleElements.delete(element);\n return true;\n}\n\nclass AnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._triggerCache = {};\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n this._transitionEngine = new TransitionAnimationEngine(bodyNode, _driver, _normalizer);\n this._timelineEngine = new TimelineAnimationEngine(bodyNode, _driver, _normalizer);\n this._transitionEngine.onRemovalComplete = (element, context) => this.onRemovalComplete(element, context);\n }\n registerTrigger(componentId, namespaceId, hostElement, name, metadata) {\n const cacheKey = componentId + '-' + name;\n let trigger = this._triggerCache[cacheKey];\n if (!trigger) {\n const errors = [];\n const ast = buildAnimationAst(this._driver, metadata, errors);\n if (errors.length) {\n throw new Error(`The animation trigger \"${name}\" has failed to build due to the following errors:\\n - ${errors.join('\\n - ')}`);\n }\n trigger = buildTrigger(name, ast, this._normalizer);\n this._triggerCache[cacheKey] = trigger;\n }\n this._transitionEngine.registerTrigger(namespaceId, name, trigger);\n }\n register(namespaceId, hostElement) {\n this._transitionEngine.register(namespaceId, hostElement);\n }\n destroy(namespaceId, context) {\n this._transitionEngine.destroy(namespaceId, context);\n }\n onInsert(namespaceId, element, parent, insertBefore) {\n this._transitionEngine.insertNode(namespaceId, element, parent, insertBefore);\n }\n onRemove(namespaceId, element, context, isHostElement) {\n this._transitionEngine.removeNode(namespaceId, element, isHostElement || false, context);\n }\n disableAnimations(element, disable) {\n this._transitionEngine.markElementAsDisabled(element, disable);\n }\n process(namespaceId, element, property, value) {\n if (property.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(property);\n const args = value;\n this._timelineEngine.command(id, element, action, args);\n }\n else {\n this._transitionEngine.trigger(namespaceId, element, property, value);\n }\n }\n listen(namespaceId, element, eventName, eventPhase, callback) {\n // @@listen\n if (eventName.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(eventName);\n return this._timelineEngine.listen(id, element, action, callback);\n }\n return this._transitionEngine.listen(namespaceId, element, eventName, eventPhase, callback);\n }\n flush(microtaskId = -1) {\n this._transitionEngine.flush(microtaskId);\n }\n get players() {\n return this._transitionEngine.players\n .concat(this._timelineEngine.players);\n }\n whenRenderingDone() {\n return this._transitionEngine.whenRenderingDone();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an instance of `SpecialCasedStyles` if and when any special (non animateable) styles are\n * detected.\n *\n * In CSS there exist properties that cannot be animated within a keyframe animation\n * (whether it be via CSS keyframes or web-animations) and the animation implementation\n * will ignore them. This function is designed to detect those special cased styles and\n * return a container that will be executed at the start and end of the animation.\n *\n * @returns an instance of `SpecialCasedStyles` if any special styles are detected otherwise `null`\n */\nfunction packageNonAnimatableStyles(element, styles) {\n let startStyles = null;\n let endStyles = null;\n if (Array.isArray(styles) && styles.length) {\n startStyles = filterNonAnimatableStyles(styles[0]);\n if (styles.length > 1) {\n endStyles = filterNonAnimatableStyles(styles[styles.length - 1]);\n }\n }\n else if (styles) {\n startStyles = filterNonAnimatableStyles(styles);\n }\n return (startStyles || endStyles) ? new SpecialCasedStyles(element, startStyles, endStyles) :\n null;\n}\n/**\n * Designed to be executed during a keyframe-based animation to apply any special-cased styles.\n *\n * When started (when the `start()` method is run) then the provided `startStyles`\n * will be applied. When finished (when the `finish()` method is called) the\n * `endStyles` will be applied as well any any starting styles. Finally when\n * `destroy()` is called then all styles will be removed.\n */\nclass SpecialCasedStyles {\n constructor(_element, _startStyles, _endStyles) {\n this._element = _element;\n this._startStyles = _startStyles;\n this._endStyles = _endStyles;\n this._state = 0 /* Pending */;\n let initialStyles = SpecialCasedStyles.initialStylesByElement.get(_element);\n if (!initialStyles) {\n SpecialCasedStyles.initialStylesByElement.set(_element, initialStyles = {});\n }\n this._initialStyles = initialStyles;\n }\n start() {\n if (this._state < 1 /* Started */) {\n if (this._startStyles) {\n setStyles(this._element, this._startStyles, this._initialStyles);\n }\n this._state = 1 /* Started */;\n }\n }\n finish() {\n this.start();\n if (this._state < 2 /* Finished */) {\n setStyles(this._element, this._initialStyles);\n if (this._endStyles) {\n setStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n this._state = 1 /* Started */;\n }\n }\n destroy() {\n this.finish();\n if (this._state < 3 /* Destroyed */) {\n SpecialCasedStyles.initialStylesByElement.delete(this._element);\n if (this._startStyles) {\n eraseStyles(this._element, this._startStyles);\n this._endStyles = null;\n }\n if (this._endStyles) {\n eraseStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n setStyles(this._element, this._initialStyles);\n this._state = 3 /* Destroyed */;\n }\n }\n}\nSpecialCasedStyles.initialStylesByElement = ( /* @__PURE__ */new WeakMap());\nfunction filterNonAnimatableStyles(styles) {\n let result = null;\n const props = Object.keys(styles);\n for (let i = 0; i < props.length; i++) {\n const prop = props[i];\n if (isNonAnimatableStyle(prop)) {\n result = result || {};\n result[prop] = styles[prop];\n }\n }\n return result;\n}\nfunction isNonAnimatableStyle(prop) {\n return prop === 'display' || prop === 'position';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ELAPSED_TIME_MAX_DECIMAL_PLACES = 3;\nconst ANIMATION_PROP = 'animation';\nconst ANIMATIONEND_EVENT = 'animationend';\nconst ONE_SECOND = 1000;\nclass ElementAnimationStyleHandler {\n constructor(_element, _name, _duration, _delay, _easing, _fillMode, _onDoneFn) {\n this._element = _element;\n this._name = _name;\n this._duration = _duration;\n this._delay = _delay;\n this._easing = _easing;\n this._fillMode = _fillMode;\n this._onDoneFn = _onDoneFn;\n this._finished = false;\n this._destroyed = false;\n this._startTime = 0;\n this._position = 0;\n this._eventFn = (e) => this._handleCallback(e);\n }\n apply() {\n applyKeyframeAnimation(this._element, `${this._duration}ms ${this._easing} ${this._delay}ms 1 normal ${this._fillMode} ${this._name}`);\n addRemoveAnimationEvent(this._element, this._eventFn, false);\n this._startTime = Date.now();\n }\n pause() {\n playPauseAnimation(this._element, this._name, 'paused');\n }\n resume() {\n playPauseAnimation(this._element, this._name, 'running');\n }\n setPosition(position) {\n const index = findIndexForAnimation(this._element, this._name);\n this._position = position * this._duration;\n setAnimationStyle(this._element, 'Delay', `-${this._position}ms`, index);\n }\n getPosition() {\n return this._position;\n }\n _handleCallback(event) {\n const timestamp = event._ngTestManualTimestamp || Date.now();\n const elapsedTime = parseFloat(event.elapsedTime.toFixed(ELAPSED_TIME_MAX_DECIMAL_PLACES)) * ONE_SECOND;\n if (event.animationName == this._name &&\n Math.max(timestamp - this._startTime, 0) >= this._delay && elapsedTime >= this._duration) {\n this.finish();\n }\n }\n finish() {\n if (this._finished)\n return;\n this._finished = true;\n this._onDoneFn();\n addRemoveAnimationEvent(this._element, this._eventFn, true);\n }\n destroy() {\n if (this._destroyed)\n return;\n this._destroyed = true;\n this.finish();\n removeKeyframeAnimation(this._element, this._name);\n }\n}\nfunction playPauseAnimation(element, name, status) {\n const index = findIndexForAnimation(element, name);\n setAnimationStyle(element, 'PlayState', status, index);\n}\nfunction applyKeyframeAnimation(element, value) {\n const anim = getAnimationStyle(element, '').trim();\n let index = 0;\n if (anim.length) {\n index = countChars(anim, ',') + 1;\n value = `${anim}, ${value}`;\n }\n setAnimationStyle(element, '', value);\n return index;\n}\nfunction removeKeyframeAnimation(element, name) {\n const anim = getAnimationStyle(element, '');\n const tokens = anim.split(',');\n const index = findMatchingTokenIndex(tokens, name);\n if (index >= 0) {\n tokens.splice(index, 1);\n const newValue = tokens.join(',');\n setAnimationStyle(element, '', newValue);\n }\n}\nfunction findIndexForAnimation(element, value) {\n const anim = getAnimationStyle(element, '');\n if (anim.indexOf(',') > 0) {\n const tokens = anim.split(',');\n return findMatchingTokenIndex(tokens, value);\n }\n return findMatchingTokenIndex([anim], value);\n}\nfunction findMatchingTokenIndex(tokens, searchToken) {\n for (let i = 0; i < tokens.length; i++) {\n if (tokens[i].indexOf(searchToken) >= 0) {\n return i;\n }\n }\n return -1;\n}\nfunction addRemoveAnimationEvent(element, fn, doRemove) {\n doRemove ? element.removeEventListener(ANIMATIONEND_EVENT, fn) :\n element.addEventListener(ANIMATIONEND_EVENT, fn);\n}\nfunction setAnimationStyle(element, name, value, index) {\n const prop = ANIMATION_PROP + name;\n if (index != null) {\n const oldValue = element.style[prop];\n if (oldValue.length) {\n const tokens = oldValue.split(',');\n tokens[index] = value;\n value = tokens.join(',');\n }\n }\n element.style[prop] = value;\n}\nfunction getAnimationStyle(element, name) {\n return element.style[ANIMATION_PROP + name] || '';\n}\nfunction countChars(value, char) {\n let count = 0;\n for (let i = 0; i < value.length; i++) {\n const c = value.charAt(i);\n if (c === char)\n count++;\n }\n return count;\n}\n\nconst DEFAULT_FILL_MODE = 'forwards';\nconst DEFAULT_EASING = 'linear';\nclass CssKeyframesPlayer {\n constructor(element, keyframes, animationName, _duration, _delay, easing, _finalStyles, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.animationName = animationName;\n this._duration = _duration;\n this._delay = _delay;\n this._finalStyles = _finalStyles;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this.currentSnapshot = {};\n this._state = 0;\n this.easing = easing || DEFAULT_EASING;\n this.totalTime = _duration + _delay;\n this._buildStyler();\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n destroy() {\n this.init();\n if (this._state >= 4 /* DESTROYED */)\n return;\n this._state = 4 /* DESTROYED */;\n this._styler.destroy();\n this._flushStartFns();\n this._flushDoneFns();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n _flushDoneFns() {\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n _flushStartFns() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n finish() {\n this.init();\n if (this._state >= 3 /* FINISHED */)\n return;\n this._state = 3 /* FINISHED */;\n this._styler.finish();\n this._flushStartFns();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._flushDoneFns();\n }\n setPosition(value) {\n this._styler.setPosition(value);\n }\n getPosition() {\n return this._styler.getPosition();\n }\n hasStarted() {\n return this._state >= 2 /* STARTED */;\n }\n init() {\n if (this._state >= 1 /* INITIALIZED */)\n return;\n this._state = 1 /* INITIALIZED */;\n const elm = this.element;\n this._styler.apply();\n if (this._delay) {\n this._styler.pause();\n }\n }\n play() {\n this.init();\n if (!this.hasStarted()) {\n this._flushStartFns();\n this._state = 2 /* STARTED */;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this._styler.resume();\n }\n pause() {\n this.init();\n this._styler.pause();\n }\n restart() {\n this.reset();\n this.play();\n }\n reset() {\n this._state = 0 /* RESET */;\n this._styler.destroy();\n this._buildStyler();\n this._styler.apply();\n }\n _buildStyler() {\n this._styler = new ElementAnimationStyleHandler(this.element, this.animationName, this._duration, this._delay, this.easing, DEFAULT_FILL_MODE, () => this.finish());\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n beforeDestroy() {\n this.init();\n const styles = {};\n if (this.hasStarted()) {\n const finished = this._state >= 3 /* FINISHED */;\n Object.keys(this._finalStyles).forEach(prop => {\n if (prop != 'offset') {\n styles[prop] = finished ? this._finalStyles[prop] : computeStyle(this.element, prop);\n }\n });\n }\n this.currentSnapshot = styles;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass DirectStylePlayer extends NoopAnimationPlayer {\n constructor(element, styles) {\n super();\n this.element = element;\n this._startingStyles = {};\n this.__initialized = false;\n this._styles = hypenatePropsObject(styles);\n }\n init() {\n if (this.__initialized || !this._startingStyles)\n return;\n this.__initialized = true;\n Object.keys(this._styles).forEach(prop => {\n this._startingStyles[prop] = this.element.style[prop];\n });\n super.init();\n }\n play() {\n if (!this._startingStyles)\n return;\n this.init();\n Object.keys(this._styles)\n .forEach(prop => this.element.style.setProperty(prop, this._styles[prop]));\n super.play();\n }\n destroy() {\n if (!this._startingStyles)\n return;\n Object.keys(this._startingStyles).forEach(prop => {\n const value = this._startingStyles[prop];\n if (value) {\n this.element.style.setProperty(prop, value);\n }\n else {\n this.element.style.removeProperty(prop);\n }\n });\n this._startingStyles = null;\n super.destroy();\n }\n}\n\nconst KEYFRAMES_NAME_PREFIX = 'gen_css_kf_';\nconst TAB_SPACE = ' ';\nclass CssKeyframesDriver {\n constructor() {\n this._count = 0;\n }\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(_element, _selector) {\n // This method is deprecated and no longer in use so we return false.\n return false;\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n buildKeyframeElement(element, name, keyframes) {\n keyframes = keyframes.map(kf => hypenatePropsObject(kf));\n let keyframeStr = `@keyframes ${name} {\\n`;\n let tab = '';\n keyframes.forEach(kf => {\n tab = TAB_SPACE;\n const offset = parseFloat(kf['offset']);\n keyframeStr += `${tab}${offset * 100}% {\\n`;\n tab += TAB_SPACE;\n Object.keys(kf).forEach(prop => {\n const value = kf[prop];\n switch (prop) {\n case 'offset':\n return;\n case 'easing':\n if (value) {\n keyframeStr += `${tab}animation-timing-function: ${value};\\n`;\n }\n return;\n default:\n keyframeStr += `${tab}${prop}: ${value};\\n`;\n return;\n }\n });\n keyframeStr += `${tab}}\\n`;\n });\n keyframeStr += `}\\n`;\n const kfElm = document.createElement('style');\n kfElm.textContent = keyframeStr;\n return kfElm;\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && scrubberAccessRequested) {\n notifyFaultyScrubber();\n }\n const previousCssKeyframePlayers = previousPlayers.filter(player => player instanceof CssKeyframesPlayer);\n const previousStyles = {};\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousCssKeyframePlayers.forEach(player => {\n let styles = player.currentSnapshot;\n Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);\n });\n }\n keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);\n const finalStyles = flattenKeyframesIntoStyles(keyframes);\n // if there is no animation then there is no point in applying\n // styles and waiting for an event to get fired. This causes lag.\n // It's better to just directly apply the styles to the element\n // via the direct styling animation player.\n if (duration == 0) {\n return new DirectStylePlayer(element, finalStyles);\n }\n const animationName = `${KEYFRAMES_NAME_PREFIX}${this._count++}`;\n const kfElm = this.buildKeyframeElement(element, animationName, keyframes);\n const nodeToAppendKfElm = findNodeToAppendKeyframeElement(element);\n nodeToAppendKfElm.appendChild(kfElm);\n const specialStyles = packageNonAnimatableStyles(element, keyframes);\n const player = new CssKeyframesPlayer(element, keyframes, animationName, duration, delay, easing, finalStyles, specialStyles);\n player.onDestroy(() => removeElement(kfElm));\n return player;\n }\n}\nfunction findNodeToAppendKeyframeElement(element) {\n var _a;\n const rootNode = (_a = element.getRootNode) === null || _a === void 0 ? void 0 : _a.call(element);\n if (typeof ShadowRoot !== 'undefined' && rootNode instanceof ShadowRoot) {\n return rootNode;\n }\n return document.head;\n}\nfunction flattenKeyframesIntoStyles(keyframes) {\n let flatKeyframes = {};\n if (keyframes) {\n const kfs = Array.isArray(keyframes) ? keyframes : [keyframes];\n kfs.forEach(kf => {\n Object.keys(kf).forEach(prop => {\n if (prop == 'offset' || prop == 'easing')\n return;\n flatKeyframes[prop] = kf[prop];\n });\n });\n }\n return flatKeyframes;\n}\nfunction removeElement(node) {\n node.parentNode.removeChild(node);\n}\nlet warningIssued = false;\nfunction notifyFaultyScrubber() {\n if (warningIssued)\n return;\n console.warn('@angular/animations: please load the web-animations.js polyfill to allow programmatic access...\\n', ' visit https://bit.ly/IWukam to learn more about using the web-animation-js polyfill.');\n warningIssued = true;\n}\n\nclass WebAnimationsPlayer {\n constructor(element, keyframes, options, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.options = options;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._initialized = false;\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this.time = 0;\n this.parentPlayer = null;\n this.currentSnapshot = {};\n this._duration = options['duration'];\n this._delay = options['delay'] || 0;\n this.time = this._duration + this._delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this._buildPlayer();\n this._preparePlayerBeforeStart();\n }\n _buildPlayer() {\n if (this._initialized)\n return;\n this._initialized = true;\n const keyframes = this.keyframes;\n this.domPlayer =\n this._triggerWebAnimation(this.element, keyframes, this.options);\n this._finalKeyframe = keyframes.length ? keyframes[keyframes.length - 1] : {};\n this.domPlayer.addEventListener('finish', () => this._onFinish());\n }\n _preparePlayerBeforeStart() {\n // this is required so that the player doesn't start to animate right away\n if (this._delay) {\n this._resetDomPlayerState();\n }\n else {\n this.domPlayer.pause();\n }\n }\n /** @internal */\n _triggerWebAnimation(element, keyframes, options) {\n // jscompiler doesn't seem to know animate is a native property because it's not fully\n // supported yet across common browsers (we polyfill it for Edge/Safari) [CL #143630929]\n return element['animate'](keyframes, options);\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n play() {\n this._buildPlayer();\n if (!this.hasStarted()) {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n this._started = true;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this.domPlayer.play();\n }\n pause() {\n this.init();\n this.domPlayer.pause();\n }\n finish() {\n this.init();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._onFinish();\n this.domPlayer.finish();\n }\n reset() {\n this._resetDomPlayerState();\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n _resetDomPlayerState() {\n if (this.domPlayer) {\n this.domPlayer.cancel();\n }\n }\n restart() {\n this.reset();\n this.play();\n }\n hasStarted() {\n return this._started;\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._resetDomPlayerState();\n this._onFinish();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n setPosition(p) {\n if (this.domPlayer === undefined) {\n this.init();\n }\n this.domPlayer.currentTime = p * this.time;\n }\n getPosition() {\n return this.domPlayer.currentTime / this.time;\n }\n get totalTime() {\n return this._delay + this._duration;\n }\n beforeDestroy() {\n const styles = {};\n if (this.hasStarted()) {\n // note: this code is invoked only when the `play` function was called prior to this\n // (thus `hasStarted` returns true), this implies that the code that initializes\n // `_finalKeyframe` has also been executed and the non-null assertion can be safely used here\n const finalKeyframe = this._finalKeyframe;\n Object.keys(finalKeyframe).forEach(prop => {\n if (prop != 'offset') {\n styles[prop] = this._finished ? finalKeyframe[prop] : computeStyle(this.element, prop);\n }\n });\n }\n this.currentSnapshot = styles;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nclass WebAnimationsDriver {\n constructor() {\n this._isNativeImpl = /\\{\\s*\\[native\\s+code\\]\\s*\\}/.test(getElementAnimateFn().toString());\n this._cssKeyframesDriver = new CssKeyframesDriver();\n }\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(_element, _selector) {\n // This method is deprecated and no longer in use so we return false.\n return false;\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n overrideWebAnimationsSupport(supported) {\n this._isNativeImpl = supported;\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n const useKeyframes = !scrubberAccessRequested && !this._isNativeImpl;\n if (useKeyframes) {\n return this._cssKeyframesDriver.animate(element, keyframes, duration, delay, easing, previousPlayers);\n }\n const fill = delay == 0 ? 'both' : 'forwards';\n const playerOptions = { duration, delay, fill };\n // we check for this to avoid having a null|undefined value be present\n // for the easing (which results in an error for certain browsers #9752)\n if (easing) {\n playerOptions['easing'] = easing;\n }\n const previousStyles = {};\n const previousWebAnimationPlayers = previousPlayers.filter(player => player instanceof WebAnimationsPlayer);\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousWebAnimationPlayers.forEach(player => {\n let styles = player.currentSnapshot;\n Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);\n });\n }\n keyframes = keyframes.map(styles => copyStyles(styles, false));\n keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);\n const specialStyles = packageNonAnimatableStyles(element, keyframes);\n return new WebAnimationsPlayer(element, keyframes, playerOptions, specialStyles);\n }\n}\nfunction supportsWebAnimations() {\n return typeof getElementAnimateFn() === 'function';\n}\nfunction getElementAnimateFn() {\n return (isBrowser() && Element.prototype['animate']) || {};\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AnimationDriver, Animation as ɵAnimation, AnimationEngine as ɵAnimationEngine, AnimationStyleNormalizer as ɵAnimationStyleNormalizer, CssKeyframesDriver as ɵCssKeyframesDriver, CssKeyframesPlayer as ɵCssKeyframesPlayer, NoopAnimationDriver as ɵNoopAnimationDriver, NoopAnimationStyleNormalizer as ɵNoopAnimationStyleNormalizer, WebAnimationsDriver as ɵWebAnimationsDriver, WebAnimationsPlayer as ɵWebAnimationsPlayer, WebAnimationsStyleNormalizer as ɵWebAnimationsStyleNormalizer, allowPreviousPlayerStylesMerge as ɵallowPreviousPlayerStylesMerge, containsElement as ɵcontainsElement, invokeQuery as ɵinvokeQuery, supportsWebAnimations as ɵsupportsWebAnimations, validateStyleProperty as ɵvalidateStyleProperty };\n","import { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, QueryList, Directive, Input, InjectionToken, Optional, EventEmitter, Output, NgModule } from '@angular/core';\nimport { Subject, Subscription, BehaviorSubject, of } from 'rxjs';\nimport { hasModifierKey, A, Z, ZERO, NINE, END, HOME, LEFT_ARROW, RIGHT_ARROW, UP_ARROW, DOWN_ARROW, TAB, ALT, CONTROL, MAC_META, META, SHIFT } from '@angular/cdk/keycodes';\nimport { tap, debounceTime, filter, map, take, skip, distinctUntilChanged, takeUntil } from 'rxjs/operators';\nimport { coerceBooleanProperty, coerceElement } from '@angular/cdk/coercion';\nimport * as i1 from '@angular/cdk/platform';\nimport { _getFocusedElementPierceShadowDom, normalizePassiveListenerOptions, _getEventTarget, _getShadowRoot, PlatformModule } from '@angular/cdk/platform';\nimport * as i1$1 from '@angular/cdk/observers';\nimport { ObserversModule } from '@angular/cdk/observers';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** IDs are delimited by an empty space, as per the spec. */\nconst ID_DELIMITER = ' ';\n/**\n * Adds the given ID to the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction addAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n if (ids.some(existingId => existingId.trim() == id.trim())) {\n return;\n }\n ids.push(id.trim());\n el.setAttribute(attr, ids.join(ID_DELIMITER));\n}\n/**\n * Removes the given ID from the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction removeAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n const filteredIds = ids.filter(val => val != id.trim());\n if (filteredIds.length) {\n el.setAttribute(attr, filteredIds.join(ID_DELIMITER));\n }\n else {\n el.removeAttribute(attr);\n }\n}\n/**\n * Gets the list of IDs referenced by the given ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction getAriaReferenceIds(el, attr) {\n // Get string array of all individual ids (whitespace delimited) in the attribute value\n return (el.getAttribute(attr) || '').match(/\\S+/g) || [];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** ID used for the body container where all messages are appended. */\nconst MESSAGES_CONTAINER_ID = 'cdk-describedby-message-container';\n/** ID prefix used for each created message element. */\nconst CDK_DESCRIBEDBY_ID_PREFIX = 'cdk-describedby-message';\n/** Attribute given to each host element that is described by a message element. */\nconst CDK_DESCRIBEDBY_HOST_ATTRIBUTE = 'cdk-describedby-host';\n/** Global incremental identifier for each registered message element. */\nlet nextId = 0;\n/** Global map of all registered message elements that have been placed into the document. */\nconst messageRegistry = new Map();\n/** Container for all registered messages. */\nlet messagesContainer = null;\n/**\n * Utility that creates visually hidden elements with a message content. Useful for elements that\n * want to use aria-describedby to further describe themselves without adding additional visual\n * content.\n */\nclass AriaDescriber {\n constructor(_document) {\n this._document = _document;\n }\n describe(hostElement, message, role) {\n if (!this._canBeDescribed(hostElement, message)) {\n return;\n }\n const key = getKey(message, role);\n if (typeof message !== 'string') {\n // We need to ensure that the element has an ID.\n setMessageId(message);\n messageRegistry.set(key, { messageElement: message, referenceCount: 0 });\n }\n else if (!messageRegistry.has(key)) {\n this._createMessageElement(message, role);\n }\n if (!this._isElementDescribedByMessage(hostElement, key)) {\n this._addMessageReference(hostElement, key);\n }\n }\n removeDescription(hostElement, message, role) {\n if (!message || !this._isElementNode(hostElement)) {\n return;\n }\n const key = getKey(message, role);\n if (this._isElementDescribedByMessage(hostElement, key)) {\n this._removeMessageReference(hostElement, key);\n }\n // If the message is a string, it means that it's one that we created for the\n // consumer so we can remove it safely, otherwise we should leave it in place.\n if (typeof message === 'string') {\n const registeredMessage = messageRegistry.get(key);\n if (registeredMessage && registeredMessage.referenceCount === 0) {\n this._deleteMessageElement(key);\n }\n }\n if (messagesContainer && messagesContainer.childNodes.length === 0) {\n this._deleteMessagesContainer();\n }\n }\n /** Unregisters all created message elements and removes the message container. */\n ngOnDestroy() {\n const describedElements = this._document.querySelectorAll(`[${CDK_DESCRIBEDBY_HOST_ATTRIBUTE}]`);\n for (let i = 0; i < describedElements.length; i++) {\n this._removeCdkDescribedByReferenceIds(describedElements[i]);\n describedElements[i].removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n if (messagesContainer) {\n this._deleteMessagesContainer();\n }\n messageRegistry.clear();\n }\n /**\n * Creates a new element in the visually hidden message container element with the message\n * as its content and adds it to the message registry.\n */\n _createMessageElement(message, role) {\n const messageElement = this._document.createElement('div');\n setMessageId(messageElement);\n messageElement.textContent = message;\n if (role) {\n messageElement.setAttribute('role', role);\n }\n this._createMessagesContainer();\n messagesContainer.appendChild(messageElement);\n messageRegistry.set(getKey(message, role), { messageElement, referenceCount: 0 });\n }\n /** Deletes the message element from the global messages container. */\n _deleteMessageElement(key) {\n var _a;\n const registeredMessage = messageRegistry.get(key);\n (_a = registeredMessage === null || registeredMessage === void 0 ? void 0 : registeredMessage.messageElement) === null || _a === void 0 ? void 0 : _a.remove();\n messageRegistry.delete(key);\n }\n /** Creates the global container for all aria-describedby messages. */\n _createMessagesContainer() {\n if (!messagesContainer) {\n const preExistingContainer = this._document.getElementById(MESSAGES_CONTAINER_ID);\n // When going from the server to the client, we may end up in a situation where there's\n // already a container on the page, but we don't have a reference to it. Clear the\n // old container so we don't get duplicates. Doing this, instead of emptying the previous\n // container, should be slightly faster.\n preExistingContainer === null || preExistingContainer === void 0 ? void 0 : preExistingContainer.remove();\n messagesContainer = this._document.createElement('div');\n messagesContainer.id = MESSAGES_CONTAINER_ID;\n // We add `visibility: hidden` in order to prevent text in this container from\n // being searchable by the browser's Ctrl + F functionality.\n // Screen-readers will still read the description for elements with aria-describedby even\n // when the description element is not visible.\n messagesContainer.style.visibility = 'hidden';\n // Even though we use `visibility: hidden`, we still apply `cdk-visually-hidden` so that\n // the description element doesn't impact page layout.\n messagesContainer.classList.add('cdk-visually-hidden');\n this._document.body.appendChild(messagesContainer);\n }\n }\n /** Deletes the global messages container. */\n _deleteMessagesContainer() {\n if (messagesContainer) {\n messagesContainer.remove();\n messagesContainer = null;\n }\n }\n /** Removes all cdk-describedby messages that are hosted through the element. */\n _removeCdkDescribedByReferenceIds(element) {\n // Remove all aria-describedby reference IDs that are prefixed by CDK_DESCRIBEDBY_ID_PREFIX\n const originalReferenceIds = getAriaReferenceIds(element, 'aria-describedby').filter(id => id.indexOf(CDK_DESCRIBEDBY_ID_PREFIX) != 0);\n element.setAttribute('aria-describedby', originalReferenceIds.join(' '));\n }\n /**\n * Adds a message reference to the element using aria-describedby and increments the registered\n * message's reference count.\n */\n _addMessageReference(element, key) {\n const registeredMessage = messageRegistry.get(key);\n // Add the aria-describedby reference and set the\n // describedby_host attribute to mark the element.\n addAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.setAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE, '');\n registeredMessage.referenceCount++;\n }\n /**\n * Removes a message reference from the element using aria-describedby\n * and decrements the registered message's reference count.\n */\n _removeMessageReference(element, key) {\n const registeredMessage = messageRegistry.get(key);\n registeredMessage.referenceCount--;\n removeAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n /** Returns true if the element has been described by the provided message ID. */\n _isElementDescribedByMessage(element, key) {\n const referenceIds = getAriaReferenceIds(element, 'aria-describedby');\n const registeredMessage = messageRegistry.get(key);\n const messageId = registeredMessage && registeredMessage.messageElement.id;\n return !!messageId && referenceIds.indexOf(messageId) != -1;\n }\n /** Determines whether a message can be described on a particular element. */\n _canBeDescribed(element, message) {\n if (!this._isElementNode(element)) {\n return false;\n }\n if (message && typeof message === 'object') {\n // We'd have to make some assumptions about the description element's text, if the consumer\n // passed in an element. Assume that if an element is passed in, the consumer has verified\n // that it can be used as a description.\n return true;\n }\n const trimmedMessage = message == null ? '' : `${message}`.trim();\n const ariaLabel = element.getAttribute('aria-label');\n // We shouldn't set descriptions if they're exactly the same as the `aria-label` of the\n // element, because screen readers will end up reading out the same text twice in a row.\n return trimmedMessage ? !ariaLabel || ariaLabel.trim() !== trimmedMessage : false;\n }\n /** Checks whether a node is an Element node. */\n _isElementNode(element) {\n return element.nodeType === this._document.ELEMENT_NODE;\n }\n}\nAriaDescriber.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: AriaDescriber, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nAriaDescriber.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: AriaDescriber, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: AriaDescriber, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n/** Gets a key that can be used to look messages up in the registry. */\nfunction getKey(message, role) {\n return typeof message === 'string' ? `${role || ''}/${message}` : message;\n}\n/** Assigns a unique ID to an element, if it doesn't have one already. */\nfunction setMessageId(element) {\n if (!element.id) {\n element.id = `${CDK_DESCRIBEDBY_ID_PREFIX}-${nextId++}`;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class manages keyboard events for selectable lists. If you pass it a query list\n * of items, it will set the active item correctly when arrow events occur.\n */\nclass ListKeyManager {\n constructor(_items) {\n this._items = _items;\n this._activeItemIndex = -1;\n this._activeItem = null;\n this._wrap = false;\n this._letterKeyStream = new Subject();\n this._typeaheadSubscription = Subscription.EMPTY;\n this._vertical = true;\n this._allowedModifierKeys = [];\n this._homeAndEnd = false;\n /**\n * Predicate function that can be used to check whether an item should be skipped\n * by the key manager. By default, disabled items are skipped.\n */\n this._skipPredicateFn = (item) => item.disabled;\n // Buffer for the letters that the user has pressed when the typeahead option is turned on.\n this._pressedLetters = [];\n /**\n * Stream that emits any time the TAB key is pressed, so components can react\n * when focus is shifted off of the list.\n */\n this.tabOut = new Subject();\n /** Stream that emits whenever the active item of the list manager changes. */\n this.change = new Subject();\n // We allow for the items to be an array because, in some cases, the consumer may\n // not have access to a QueryList of the items they want to manage (e.g. when the\n // items aren't being collected via `ViewChildren` or `ContentChildren`).\n if (_items instanceof QueryList) {\n _items.changes.subscribe((newItems) => {\n if (this._activeItem) {\n const itemArray = newItems.toArray();\n const newIndex = itemArray.indexOf(this._activeItem);\n if (newIndex > -1 && newIndex !== this._activeItemIndex) {\n this._activeItemIndex = newIndex;\n }\n }\n });\n }\n }\n /**\n * Sets the predicate function that determines which items should be skipped by the\n * list key manager.\n * @param predicate Function that determines whether the given item should be skipped.\n */\n skipPredicate(predicate) {\n this._skipPredicateFn = predicate;\n return this;\n }\n /**\n * Configures wrapping mode, which determines whether the active item will wrap to\n * the other end of list when there are no more items in the given direction.\n * @param shouldWrap Whether the list should wrap when reaching the end.\n */\n withWrap(shouldWrap = true) {\n this._wrap = shouldWrap;\n return this;\n }\n /**\n * Configures whether the key manager should be able to move the selection vertically.\n * @param enabled Whether vertical selection should be enabled.\n */\n withVerticalOrientation(enabled = true) {\n this._vertical = enabled;\n return this;\n }\n /**\n * Configures the key manager to move the selection horizontally.\n * Passing in `null` will disable horizontal movement.\n * @param direction Direction in which the selection can be moved.\n */\n withHorizontalOrientation(direction) {\n this._horizontal = direction;\n return this;\n }\n /**\n * Modifier keys which are allowed to be held down and whose default actions will be prevented\n * as the user is pressing the arrow keys. Defaults to not allowing any modifier keys.\n */\n withAllowedModifierKeys(keys) {\n this._allowedModifierKeys = keys;\n return this;\n }\n /**\n * Turns on typeahead mode which allows users to set the active item by typing.\n * @param debounceInterval Time to wait after the last keystroke before setting the active item.\n */\n withTypeAhead(debounceInterval = 200) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n this._items.length &&\n this._items.some(item => typeof item.getLabel !== 'function')) {\n throw Error('ListKeyManager items in typeahead mode must implement the `getLabel` method.');\n }\n this._typeaheadSubscription.unsubscribe();\n // Debounce the presses of non-navigational keys, collect the ones that correspond to letters\n // and convert those letters back into a string. Afterwards find the first item that starts\n // with that string and select it.\n this._typeaheadSubscription = this._letterKeyStream\n .pipe(tap(letter => this._pressedLetters.push(letter)), debounceTime(debounceInterval), filter(() => this._pressedLetters.length > 0), map(() => this._pressedLetters.join('')))\n .subscribe(inputString => {\n const items = this._getItemsArray();\n // Start at 1 because we want to start searching at the item immediately\n // following the current active item.\n for (let i = 1; i < items.length + 1; i++) {\n const index = (this._activeItemIndex + i) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item) &&\n item.getLabel().toUpperCase().trim().indexOf(inputString) === 0) {\n this.setActiveItem(index);\n break;\n }\n }\n this._pressedLetters = [];\n });\n return this;\n }\n /**\n * Configures the key manager to activate the first and last items\n * respectively when the Home or End key is pressed.\n * @param enabled Whether pressing the Home or End key activates the first/last item.\n */\n withHomeAndEnd(enabled = true) {\n this._homeAndEnd = enabled;\n return this;\n }\n setActiveItem(item) {\n const previousActiveItem = this._activeItem;\n this.updateActiveItem(item);\n if (this._activeItem !== previousActiveItem) {\n this.change.next(this._activeItemIndex);\n }\n }\n /**\n * Sets the active item depending on the key event passed in.\n * @param event Keyboard event to be used for determining which element should be active.\n */\n onKeydown(event) {\n const keyCode = event.keyCode;\n const modifiers = ['altKey', 'ctrlKey', 'metaKey', 'shiftKey'];\n const isModifierAllowed = modifiers.every(modifier => {\n return !event[modifier] || this._allowedModifierKeys.indexOf(modifier) > -1;\n });\n switch (keyCode) {\n case TAB:\n this.tabOut.next();\n return;\n case DOWN_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case UP_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case RIGHT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setPreviousItemActive() : this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case LEFT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setNextItemActive() : this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case HOME:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setFirstItemActive();\n break;\n }\n else {\n return;\n }\n case END:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setLastItemActive();\n break;\n }\n else {\n return;\n }\n default:\n if (isModifierAllowed || hasModifierKey(event, 'shiftKey')) {\n // Attempt to use the `event.key` which also maps it to the user's keyboard language,\n // otherwise fall back to resolving alphanumeric characters via the keyCode.\n if (event.key && event.key.length === 1) {\n this._letterKeyStream.next(event.key.toLocaleUpperCase());\n }\n else if ((keyCode >= A && keyCode <= Z) || (keyCode >= ZERO && keyCode <= NINE)) {\n this._letterKeyStream.next(String.fromCharCode(keyCode));\n }\n }\n // Note that we return here, in order to avoid preventing\n // the default action of non-navigational keys.\n return;\n }\n this._pressedLetters = [];\n event.preventDefault();\n }\n /** Index of the currently active item. */\n get activeItemIndex() {\n return this._activeItemIndex;\n }\n /** The active item. */\n get activeItem() {\n return this._activeItem;\n }\n /** Gets whether the user is currently typing into the manager using the typeahead feature. */\n isTyping() {\n return this._pressedLetters.length > 0;\n }\n /** Sets the active item to the first enabled item in the list. */\n setFirstItemActive() {\n this._setActiveItemByIndex(0, 1);\n }\n /** Sets the active item to the last enabled item in the list. */\n setLastItemActive() {\n this._setActiveItemByIndex(this._items.length - 1, -1);\n }\n /** Sets the active item to the next enabled item in the list. */\n setNextItemActive() {\n this._activeItemIndex < 0 ? this.setFirstItemActive() : this._setActiveItemByDelta(1);\n }\n /** Sets the active item to a previous enabled item in the list. */\n setPreviousItemActive() {\n this._activeItemIndex < 0 && this._wrap\n ? this.setLastItemActive()\n : this._setActiveItemByDelta(-1);\n }\n updateActiveItem(item) {\n const itemArray = this._getItemsArray();\n const index = typeof item === 'number' ? item : itemArray.indexOf(item);\n const activeItem = itemArray[index];\n // Explicitly check for `null` and `undefined` because other falsy values are valid.\n this._activeItem = activeItem == null ? null : activeItem;\n this._activeItemIndex = index;\n }\n /**\n * This method sets the active item, given a list of items and the delta between the\n * currently active item and the new active item. It will calculate differently\n * depending on whether wrap mode is turned on.\n */\n _setActiveItemByDelta(delta) {\n this._wrap ? this._setActiveInWrapMode(delta) : this._setActiveInDefaultMode(delta);\n }\n /**\n * Sets the active item properly given \"wrap\" mode. In other words, it will continue to move\n * down the list until it finds an item that is not disabled, and it will wrap if it\n * encounters either end of the list.\n */\n _setActiveInWrapMode(delta) {\n const items = this._getItemsArray();\n for (let i = 1; i <= items.length; i++) {\n const index = (this._activeItemIndex + delta * i + items.length) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item)) {\n this.setActiveItem(index);\n return;\n }\n }\n }\n /**\n * Sets the active item properly given the default mode. In other words, it will\n * continue to move down the list until it finds an item that is not disabled. If\n * it encounters either end of the list, it will stop and not wrap.\n */\n _setActiveInDefaultMode(delta) {\n this._setActiveItemByIndex(this._activeItemIndex + delta, delta);\n }\n /**\n * Sets the active item to the first enabled item starting at the index specified. If the\n * item is disabled, it will move in the fallbackDelta direction until it either\n * finds an enabled item or encounters the end of the list.\n */\n _setActiveItemByIndex(index, fallbackDelta) {\n const items = this._getItemsArray();\n if (!items[index]) {\n return;\n }\n while (this._skipPredicateFn(items[index])) {\n index += fallbackDelta;\n if (!items[index]) {\n return;\n }\n }\n this.setActiveItem(index);\n }\n /** Returns the items as an array. */\n _getItemsArray() {\n return this._items instanceof QueryList ? this._items.toArray() : this._items;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ActiveDescendantKeyManager extends ListKeyManager {\n setActiveItem(index) {\n if (this.activeItem) {\n this.activeItem.setInactiveStyles();\n }\n super.setActiveItem(index);\n if (this.activeItem) {\n this.activeItem.setActiveStyles();\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass FocusKeyManager extends ListKeyManager {\n constructor() {\n super(...arguments);\n this._origin = 'program';\n }\n /**\n * Sets the focus origin that will be passed in to the items for any subsequent `focus` calls.\n * @param origin Focus origin to be used when focusing items.\n */\n setFocusOrigin(origin) {\n this._origin = origin;\n return this;\n }\n setActiveItem(item) {\n super.setActiveItem(item);\n if (this.activeItem) {\n this.activeItem.focus(this._origin);\n }\n }\n}\n\n/**\n * Configuration for the isFocusable method.\n */\nclass IsFocusableConfig {\n constructor() {\n /**\n * Whether to count an element as focusable even if it is not currently visible.\n */\n this.ignoreVisibility = false;\n }\n}\n// The InteractivityChecker leans heavily on the ally.js accessibility utilities.\n// Methods like `isTabbable` are only covering specific edge-cases for the browsers which are\n// supported.\n/**\n * Utility for checking the interactivity of an element, such as whether is is focusable or\n * tabbable.\n */\nclass InteractivityChecker {\n constructor(_platform) {\n this._platform = _platform;\n }\n /**\n * Gets whether an element is disabled.\n *\n * @param element Element to be checked.\n * @returns Whether the element is disabled.\n */\n isDisabled(element) {\n // This does not capture some cases, such as a non-form control with a disabled attribute or\n // a form control inside of a disabled form, but should capture the most common cases.\n return element.hasAttribute('disabled');\n }\n /**\n * Gets whether an element is visible for the purposes of interactivity.\n *\n * This will capture states like `display: none` and `visibility: hidden`, but not things like\n * being clipped by an `overflow: hidden` parent or being outside the viewport.\n *\n * @returns Whether the element is visible.\n */\n isVisible(element) {\n return hasGeometry(element) && getComputedStyle(element).visibility === 'visible';\n }\n /**\n * Gets whether an element can be reached via Tab key.\n * Assumes that the element has already been checked with isFocusable.\n *\n * @param element Element to be checked.\n * @returns Whether the element is tabbable.\n */\n isTabbable(element) {\n // Nothing is tabbable on the server 😎\n if (!this._platform.isBrowser) {\n return false;\n }\n const frameElement = getFrameElement(getWindow(element));\n if (frameElement) {\n // Frame elements inherit their tabindex onto all child elements.\n if (getTabIndexValue(frameElement) === -1) {\n return false;\n }\n // Browsers disable tabbing to an element inside of an invisible frame.\n if (!this.isVisible(frameElement)) {\n return false;\n }\n }\n let nodeName = element.nodeName.toLowerCase();\n let tabIndexValue = getTabIndexValue(element);\n if (element.hasAttribute('contenteditable')) {\n return tabIndexValue !== -1;\n }\n if (nodeName === 'iframe' || nodeName === 'object') {\n // The frame or object's content may be tabbable depending on the content, but it's\n // not possibly to reliably detect the content of the frames. We always consider such\n // elements as non-tabbable.\n return false;\n }\n // In iOS, the browser only considers some specific elements as tabbable.\n if (this._platform.WEBKIT && this._platform.IOS && !isPotentiallyTabbableIOS(element)) {\n return false;\n }\n if (nodeName === 'audio') {\n // Audio elements without controls enabled are never tabbable, regardless\n // of the tabindex attribute explicitly being set.\n if (!element.hasAttribute('controls')) {\n return false;\n }\n // Audio elements with controls are by default tabbable unless the\n // tabindex attribute is set to `-1` explicitly.\n return tabIndexValue !== -1;\n }\n if (nodeName === 'video') {\n // For all video elements, if the tabindex attribute is set to `-1`, the video\n // is not tabbable. Note: We cannot rely on the default `HTMLElement.tabIndex`\n // property as that one is set to `-1` in Chrome, Edge and Safari v13.1. The\n // tabindex attribute is the source of truth here.\n if (tabIndexValue === -1) {\n return false;\n }\n // If the tabindex is explicitly set, and not `-1` (as per check before), the\n // video element is always tabbable (regardless of whether it has controls or not).\n if (tabIndexValue !== null) {\n return true;\n }\n // Otherwise (when no explicit tabindex is set), a video is only tabbable if it\n // has controls enabled. Firefox is special as videos are always tabbable regardless\n // of whether there are controls or not.\n return this._platform.FIREFOX || element.hasAttribute('controls');\n }\n return element.tabIndex >= 0;\n }\n /**\n * Gets whether an element can be focused by the user.\n *\n * @param element Element to be checked.\n * @param config The config object with options to customize this method's behavior\n * @returns Whether the element is focusable.\n */\n isFocusable(element, config) {\n // Perform checks in order of left to most expensive.\n // Again, naive approach that does not capture many edge cases and browser quirks.\n return (isPotentiallyFocusable(element) &&\n !this.isDisabled(element) &&\n ((config === null || config === void 0 ? void 0 : config.ignoreVisibility) || this.isVisible(element)));\n }\n}\nInteractivityChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: InteractivityChecker, deps: [{ token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nInteractivityChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: InteractivityChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: InteractivityChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }]; } });\n/**\n * Returns the frame element from a window object. Since browsers like MS Edge throw errors if\n * the frameElement property is being accessed from a different host address, this property\n * should be accessed carefully.\n */\nfunction getFrameElement(window) {\n try {\n return window.frameElement;\n }\n catch (_a) {\n return null;\n }\n}\n/** Checks whether the specified element has any geometry / rectangles. */\nfunction hasGeometry(element) {\n // Use logic from jQuery to check for an invisible element.\n // See https://github.com/jquery/jquery/blob/master/src/css/hiddenVisibleSelectors.js#L12\n return !!(element.offsetWidth ||\n element.offsetHeight ||\n (typeof element.getClientRects === 'function' && element.getClientRects().length));\n}\n/** Gets whether an element's */\nfunction isNativeFormElement(element) {\n let nodeName = element.nodeName.toLowerCase();\n return (nodeName === 'input' ||\n nodeName === 'select' ||\n nodeName === 'button' ||\n nodeName === 'textarea');\n}\n/** Gets whether an element is an ``. */\nfunction isHiddenInput(element) {\n return isInputElement(element) && element.type == 'hidden';\n}\n/** Gets whether an element is an anchor that has an href attribute. */\nfunction isAnchorWithHref(element) {\n return isAnchorElement(element) && element.hasAttribute('href');\n}\n/** Gets whether an element is an input element. */\nfunction isInputElement(element) {\n return element.nodeName.toLowerCase() == 'input';\n}\n/** Gets whether an element is an anchor element. */\nfunction isAnchorElement(element) {\n return element.nodeName.toLowerCase() == 'a';\n}\n/** Gets whether an element has a valid tabindex. */\nfunction hasValidTabIndex(element) {\n if (!element.hasAttribute('tabindex') || element.tabIndex === undefined) {\n return false;\n }\n let tabIndex = element.getAttribute('tabindex');\n return !!(tabIndex && !isNaN(parseInt(tabIndex, 10)));\n}\n/**\n * Returns the parsed tabindex from the element attributes instead of returning the\n * evaluated tabindex from the browsers defaults.\n */\nfunction getTabIndexValue(element) {\n if (!hasValidTabIndex(element)) {\n return null;\n }\n // See browser issue in Gecko https://bugzilla.mozilla.org/show_bug.cgi?id=1128054\n const tabIndex = parseInt(element.getAttribute('tabindex') || '', 10);\n return isNaN(tabIndex) ? -1 : tabIndex;\n}\n/** Checks whether the specified element is potentially tabbable on iOS */\nfunction isPotentiallyTabbableIOS(element) {\n let nodeName = element.nodeName.toLowerCase();\n let inputType = nodeName === 'input' && element.type;\n return (inputType === 'text' ||\n inputType === 'password' ||\n nodeName === 'select' ||\n nodeName === 'textarea');\n}\n/**\n * Gets whether an element is potentially focusable without taking current visible/disabled state\n * into account.\n */\nfunction isPotentiallyFocusable(element) {\n // Inputs are potentially focusable *unless* they're type=\"hidden\".\n if (isHiddenInput(element)) {\n return false;\n }\n return (isNativeFormElement(element) ||\n isAnchorWithHref(element) ||\n element.hasAttribute('contenteditable') ||\n hasValidTabIndex(element));\n}\n/** Gets the parent window of a DOM node with regards of being inside of an iframe. */\nfunction getWindow(node) {\n // ownerDocument is null if `node` itself *is* a document.\n return (node.ownerDocument && node.ownerDocument.defaultView) || window;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class currently uses a relatively simple approach to focus trapping.\n * It assumes that the tab order is the same as DOM order, which is not necessarily true.\n * Things like `tabIndex > 0`, flex `order`, and shadow roots can cause the two to be misaligned.\n *\n * @deprecated Use `ConfigurableFocusTrap` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrap {\n constructor(_element, _checker, _ngZone, _document, deferAnchors = false) {\n this._element = _element;\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n this._hasAttached = false;\n // Event listeners for the anchors. Need to be regular functions so that we can unbind them later.\n this.startAnchorListener = () => this.focusLastTabbableElement();\n this.endAnchorListener = () => this.focusFirstTabbableElement();\n this._enabled = true;\n if (!deferAnchors) {\n this.attachAnchors();\n }\n }\n /** Whether the focus trap is active. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(value, this._startAnchor);\n this._toggleAnchorTabIndex(value, this._endAnchor);\n }\n }\n /** Destroys the focus trap by cleaning up the anchors. */\n destroy() {\n const startAnchor = this._startAnchor;\n const endAnchor = this._endAnchor;\n if (startAnchor) {\n startAnchor.removeEventListener('focus', this.startAnchorListener);\n startAnchor.remove();\n }\n if (endAnchor) {\n endAnchor.removeEventListener('focus', this.endAnchorListener);\n endAnchor.remove();\n }\n this._startAnchor = this._endAnchor = null;\n this._hasAttached = false;\n }\n /**\n * Inserts the anchors into the DOM. This is usually done automatically\n * in the constructor, but can be deferred for cases like directives with `*ngIf`.\n * @returns Whether the focus trap managed to attach successfully. This may not be the case\n * if the target element isn't currently in the DOM.\n */\n attachAnchors() {\n // If we're not on the browser, there can be no focus to trap.\n if (this._hasAttached) {\n return true;\n }\n this._ngZone.runOutsideAngular(() => {\n if (!this._startAnchor) {\n this._startAnchor = this._createAnchor();\n this._startAnchor.addEventListener('focus', this.startAnchorListener);\n }\n if (!this._endAnchor) {\n this._endAnchor = this._createAnchor();\n this._endAnchor.addEventListener('focus', this.endAnchorListener);\n }\n });\n if (this._element.parentNode) {\n this._element.parentNode.insertBefore(this._startAnchor, this._element);\n this._element.parentNode.insertBefore(this._endAnchor, this._element.nextSibling);\n this._hasAttached = true;\n }\n return this._hasAttached;\n }\n /**\n * Waits for the zone to stabilize, then focuses the first tabbable element.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusInitialElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusInitialElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the first tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusFirstTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusFirstTabbableElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the last tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusLastTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusLastTabbableElement(options)));\n });\n }\n /**\n * Get the specified boundary element of the trapped region.\n * @param bound The boundary to get (start or end of trapped region).\n * @returns The boundary element.\n */\n _getRegionBoundary(bound) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const markers = this._element.querySelectorAll(`[cdk-focus-region-${bound}], ` + `[cdkFocusRegion${bound}], ` + `[cdk-focus-${bound}]`);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n for (let i = 0; i < markers.length; i++) {\n // @breaking-change 8.0.0\n if (markers[i].hasAttribute(`cdk-focus-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated ` +\n `attribute will be removed in 8.0.0.`, markers[i]);\n }\n else if (markers[i].hasAttribute(`cdk-focus-region-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-region-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated attribute ` +\n `will be removed in 8.0.0.`, markers[i]);\n }\n }\n }\n if (bound == 'start') {\n return markers.length ? markers[0] : this._getFirstTabbableElement(this._element);\n }\n return markers.length\n ? markers[markers.length - 1]\n : this._getLastTabbableElement(this._element);\n }\n /**\n * Focuses the element that should be focused when the focus trap is initialized.\n * @returns Whether focus was moved successfully.\n */\n focusInitialElement(options) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const redirectToElement = this._element.querySelector(`[cdk-focus-initial], ` + `[cdkFocusInitial]`);\n if (redirectToElement) {\n // @breaking-change 8.0.0\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n redirectToElement.hasAttribute(`cdk-focus-initial`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-initial', ` +\n `use 'cdkFocusInitial' instead. The deprecated attribute ` +\n `will be removed in 8.0.0`, redirectToElement);\n }\n // Warn the consumer if the element they've pointed to\n // isn't focusable, when not in production mode.\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n !this._checker.isFocusable(redirectToElement)) {\n console.warn(`Element matching '[cdkFocusInitial]' is not focusable.`, redirectToElement);\n }\n if (!this._checker.isFocusable(redirectToElement)) {\n const focusableChild = this._getFirstTabbableElement(redirectToElement);\n focusableChild === null || focusableChild === void 0 ? void 0 : focusableChild.focus(options);\n return !!focusableChild;\n }\n redirectToElement.focus(options);\n return true;\n }\n return this.focusFirstTabbableElement(options);\n }\n /**\n * Focuses the first tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusFirstTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('start');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Focuses the last tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusLastTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('end');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Checks whether the focus trap has successfully been attached.\n */\n hasAttached() {\n return this._hasAttached;\n }\n /** Get the first tabbable element from a DOM subtree (inclusive). */\n _getFirstTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n const children = root.children;\n for (let i = 0; i < children.length; i++) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getFirstTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Get the last tabbable element from a DOM subtree (inclusive). */\n _getLastTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n // Iterate in reverse DOM order.\n const children = root.children;\n for (let i = children.length - 1; i >= 0; i--) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getLastTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Creates an anchor element. */\n _createAnchor() {\n const anchor = this._document.createElement('div');\n this._toggleAnchorTabIndex(this._enabled, anchor);\n anchor.classList.add('cdk-visually-hidden');\n anchor.classList.add('cdk-focus-trap-anchor');\n anchor.setAttribute('aria-hidden', 'true');\n return anchor;\n }\n /**\n * Toggles the `tabindex` of an anchor, based on the enabled state of the focus trap.\n * @param isEnabled Whether the focus trap is enabled.\n * @param anchor Anchor on which to toggle the tabindex.\n */\n _toggleAnchorTabIndex(isEnabled, anchor) {\n // Remove the tabindex completely, rather than setting it to -1, because if the\n // element has a tabindex, the user might still hit it when navigating with the arrow keys.\n isEnabled ? anchor.setAttribute('tabindex', '0') : anchor.removeAttribute('tabindex');\n }\n /**\n * Toggles the`tabindex` of both anchors to either trap Tab focus or allow it to escape.\n * @param enabled: Whether the anchors should trap Tab.\n */\n toggleAnchors(enabled) {\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(enabled, this._startAnchor);\n this._toggleAnchorTabIndex(enabled, this._endAnchor);\n }\n }\n /** Executes a function when the zone is stable. */\n _executeOnStable(fn) {\n if (this._ngZone.isStable) {\n fn();\n }\n else {\n this._ngZone.onStable.pipe(take(1)).subscribe(fn);\n }\n }\n}\n/**\n * Factory that allows easy instantiation of focus traps.\n * @deprecated Use `ConfigurableFocusTrapFactory` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrapFactory {\n constructor(_checker, _ngZone, _document) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n }\n /**\n * Creates a focus-trapped region around the given element.\n * @param element The element around which focus will be trapped.\n * @param deferCaptureElements Defers the creation of focus-capturing elements to be done\n * manually by the user.\n * @returns The created focus trap instance.\n */\n create(element, deferCaptureElements = false) {\n return new FocusTrap(element, this._checker, this._ngZone, this._document, deferCaptureElements);\n }\n}\nFocusTrapFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nFocusTrapFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusTrapFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n/** Directive for trapping focus within a region. */\nclass CdkTrapFocus {\n constructor(_elementRef, _focusTrapFactory, \n /**\n * @deprecated No longer being used. To be removed.\n * @breaking-change 13.0.0\n */\n _document) {\n this._elementRef = _elementRef;\n this._focusTrapFactory = _focusTrapFactory;\n /** Previously focused element to restore focus to upon destroy when using autoCapture. */\n this._previouslyFocusedElement = null;\n this.focusTrap = this._focusTrapFactory.create(this._elementRef.nativeElement, true);\n }\n /** Whether the focus trap is active. */\n get enabled() {\n return this.focusTrap.enabled;\n }\n set enabled(value) {\n this.focusTrap.enabled = coerceBooleanProperty(value);\n }\n /**\n * Whether the directive should automatically move focus into the trapped region upon\n * initialization and return focus to the previous activeElement upon destruction.\n */\n get autoCapture() {\n return this._autoCapture;\n }\n set autoCapture(value) {\n this._autoCapture = coerceBooleanProperty(value);\n }\n ngOnDestroy() {\n this.focusTrap.destroy();\n // If we stored a previously focused element when using autoCapture, return focus to that\n // element now that the trapped region is being destroyed.\n if (this._previouslyFocusedElement) {\n this._previouslyFocusedElement.focus();\n this._previouslyFocusedElement = null;\n }\n }\n ngAfterContentInit() {\n this.focusTrap.attachAnchors();\n if (this.autoCapture) {\n this._captureFocus();\n }\n }\n ngDoCheck() {\n if (!this.focusTrap.hasAttached()) {\n this.focusTrap.attachAnchors();\n }\n }\n ngOnChanges(changes) {\n const autoCaptureChange = changes['autoCapture'];\n if (autoCaptureChange &&\n !autoCaptureChange.firstChange &&\n this.autoCapture &&\n this.focusTrap.hasAttached()) {\n this._captureFocus();\n }\n }\n _captureFocus() {\n this._previouslyFocusedElement = _getFocusedElementPierceShadowDom();\n this.focusTrap.focusInitialElementWhenReady();\n }\n}\nCdkTrapFocus.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkTrapFocus, deps: [{ token: i0.ElementRef }, { token: FocusTrapFactory }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive });\nCdkTrapFocus.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkTrapFocus, selector: \"[cdkTrapFocus]\", inputs: { enabled: [\"cdkTrapFocus\", \"enabled\"], autoCapture: [\"cdkTrapFocusAutoCapture\", \"autoCapture\"] }, exportAs: [\"cdkTrapFocus\"], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkTrapFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTrapFocus]',\n exportAs: 'cdkTrapFocus',\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ElementRef }, { type: FocusTrapFactory }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n }, propDecorators: { enabled: [{\n type: Input,\n args: ['cdkTrapFocus']\n }], autoCapture: [{\n type: Input,\n args: ['cdkTrapFocusAutoCapture']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class uses a strategy pattern that determines how it traps focus.\n * See FocusTrapInertStrategy.\n */\nclass ConfigurableFocusTrap extends FocusTrap {\n constructor(_element, _checker, _ngZone, _document, _focusTrapManager, _inertStrategy, config) {\n super(_element, _checker, _ngZone, _document, config.defer);\n this._focusTrapManager = _focusTrapManager;\n this._inertStrategy = _inertStrategy;\n this._focusTrapManager.register(this);\n }\n /** Whether the FocusTrap is enabled. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._enabled) {\n this._focusTrapManager.register(this);\n }\n else {\n this._focusTrapManager.deregister(this);\n }\n }\n /** Notifies the FocusTrapManager that this FocusTrap will be destroyed. */\n destroy() {\n this._focusTrapManager.deregister(this);\n super.destroy();\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _enable() {\n this._inertStrategy.preventFocus(this);\n this.toggleAnchors(true);\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _disable() {\n this._inertStrategy.allowFocus(this);\n this.toggleAnchors(false);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the inert strategy. */\nconst FOCUS_TRAP_INERT_STRATEGY = new InjectionToken('FOCUS_TRAP_INERT_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Lightweight FocusTrapInertStrategy that adds a document focus event\n * listener to redirect focus back inside the FocusTrap.\n */\nclass EventListenerFocusTrapInertStrategy {\n constructor() {\n /** Focus event handler. */\n this._listener = null;\n }\n /** Adds a document event listener that keeps focus inside the FocusTrap. */\n preventFocus(focusTrap) {\n // Ensure there's only one listener per document\n if (this._listener) {\n focusTrap._document.removeEventListener('focus', this._listener, true);\n }\n this._listener = (e) => this._trapFocus(focusTrap, e);\n focusTrap._ngZone.runOutsideAngular(() => {\n focusTrap._document.addEventListener('focus', this._listener, true);\n });\n }\n /** Removes the event listener added in preventFocus. */\n allowFocus(focusTrap) {\n if (!this._listener) {\n return;\n }\n focusTrap._document.removeEventListener('focus', this._listener, true);\n this._listener = null;\n }\n /**\n * Refocuses the first element in the FocusTrap if the focus event target was outside\n * the FocusTrap.\n *\n * This is an event listener callback. The event listener is added in runOutsideAngular,\n * so all this code runs outside Angular as well.\n */\n _trapFocus(focusTrap, event) {\n var _a;\n const target = event.target;\n const focusTrapRoot = focusTrap._element;\n // Don't refocus if target was in an overlay, because the overlay might be associated\n // with an element inside the FocusTrap, ex. mat-select.\n if (target && !focusTrapRoot.contains(target) && !((_a = target.closest) === null || _a === void 0 ? void 0 : _a.call(target, 'div.cdk-overlay-pane'))) {\n // Some legacy FocusTrap usages have logic that focuses some element on the page\n // just before FocusTrap is destroyed. For backwards compatibility, wait\n // to be sure FocusTrap is still enabled before refocusing.\n setTimeout(() => {\n // Check whether focus wasn't put back into the focus trap while the timeout was pending.\n if (focusTrap.enabled && !focusTrapRoot.contains(focusTrap._document.activeElement)) {\n focusTrap.focusFirstTabbableElement();\n }\n });\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Injectable that ensures only the most recently enabled FocusTrap is active. */\nclass FocusTrapManager {\n constructor() {\n // A stack of the FocusTraps on the page. Only the FocusTrap at the\n // top of the stack is active.\n this._focusTrapStack = [];\n }\n /**\n * Disables the FocusTrap at the top of the stack, and then pushes\n * the new FocusTrap onto the stack.\n */\n register(focusTrap) {\n // Dedupe focusTraps that register multiple times.\n this._focusTrapStack = this._focusTrapStack.filter(ft => ft !== focusTrap);\n let stack = this._focusTrapStack;\n if (stack.length) {\n stack[stack.length - 1]._disable();\n }\n stack.push(focusTrap);\n focusTrap._enable();\n }\n /**\n * Removes the FocusTrap from the stack, and activates the\n * FocusTrap that is the new top of the stack.\n */\n deregister(focusTrap) {\n focusTrap._disable();\n const stack = this._focusTrapStack;\n const i = stack.indexOf(focusTrap);\n if (i !== -1) {\n stack.splice(i, 1);\n if (stack.length) {\n stack[stack.length - 1]._enable();\n }\n }\n }\n}\nFocusTrapManager.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusTrapManager, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nFocusTrapManager.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusTrapManager, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusTrapManager, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Factory that allows easy instantiation of configurable focus traps. */\nclass ConfigurableFocusTrapFactory {\n constructor(_checker, _ngZone, _focusTrapManager, _document, _inertStrategy) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._focusTrapManager = _focusTrapManager;\n this._document = _document;\n // TODO split up the strategies into different modules, similar to DateAdapter.\n this._inertStrategy = _inertStrategy || new EventListenerFocusTrapInertStrategy();\n }\n create(element, config = { defer: false }) {\n let configObject;\n if (typeof config === 'boolean') {\n configObject = { defer: config };\n }\n else {\n configObject = config;\n }\n return new ConfigurableFocusTrap(element, this._checker, this._ngZone, this._document, this._focusTrapManager, this._inertStrategy, configObject);\n }\n}\nConfigurableFocusTrapFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: FocusTrapManager }, { token: DOCUMENT }, { token: FOCUS_TRAP_INERT_STRATEGY, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nConfigurableFocusTrapFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: FocusTrapManager }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_TRAP_INERT_STRATEGY]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether an event could be a faked `mousedown` event dispatched by a screen reader. */\nfunction isFakeMousedownFromScreenReader(event) {\n // Some screen readers will dispatch a fake `mousedown` event when pressing enter or space on\n // a clickable element. We can distinguish these events when both `offsetX` and `offsetY` are\n // zero or `event.buttons` is zero, depending on the browser:\n // - `event.buttons` works on Firefox, but fails on Chrome.\n // - `offsetX` and `offsetY` work on Chrome, but fail on Firefox.\n // Note that there's an edge case where the user could click the 0x0 spot of the\n // screen themselves, but that is unlikely to contain interactive elements.\n return event.buttons === 0 || (event.offsetX === 0 && event.offsetY === 0);\n}\n/** Gets whether an event could be a faked `touchstart` event dispatched by a screen reader. */\nfunction isFakeTouchstartFromScreenReader(event) {\n const touch = (event.touches && event.touches[0]) || (event.changedTouches && event.changedTouches[0]);\n // A fake `touchstart` can be distinguished from a real one by looking at the `identifier`\n // which is typically >= 0 on a real device versus -1 from a screen reader. Just to be safe,\n // we can also look at `radiusX` and `radiusY`. This behavior was observed against a Windows 10\n // device with a touch screen running NVDA v2020.4 and Firefox 85 or Chrome 88.\n return (!!touch &&\n touch.identifier === -1 &&\n (touch.radiusX == null || touch.radiusX === 1) &&\n (touch.radiusY == null || touch.radiusY === 1));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injectable options for the InputModalityDetector. These are shallowly merged with the default\n * options.\n */\nconst INPUT_MODALITY_DETECTOR_OPTIONS = new InjectionToken('cdk-input-modality-detector-options');\n/**\n * Default options for the InputModalityDetector.\n *\n * Modifier keys are ignored by default (i.e. when pressed won't cause the service to detect\n * keyboard input modality) for two reasons:\n *\n * 1. Modifier keys are commonly used with mouse to perform actions such as 'right click' or 'open\n * in new tab', and are thus less representative of actual keyboard interaction.\n * 2. VoiceOver triggers some keyboard events when linearly navigating with Control + Option (but\n * confusingly not with Caps Lock). Thus, to have parity with other screen readers, we ignore\n * these keys so as to not update the input modality.\n *\n * Note that we do not by default ignore the right Meta key on Safari because it has the same key\n * code as the ContextMenu key on other browsers. When we switch to using event.key, we can\n * distinguish between the two.\n */\nconst INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS = {\n ignoreKeys: [ALT, CONTROL, MAC_META, META, SHIFT],\n};\n/**\n * The amount of time needed to pass after a touchstart event in order for a subsequent mousedown\n * event to be attributed as mouse and not touch.\n *\n * This is the value used by AngularJS Material. Through trial and error (on iPhone 6S) they found\n * that a value of around 650ms seems appropriate.\n */\nconst TOUCH_BUFFER_MS = 650;\n/**\n * Event listener options that enable capturing and also mark the listener as passive if the browser\n * supports it.\n */\nconst modalityEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/**\n * Service that detects the user's input modality.\n *\n * This service does not update the input modality when a user navigates with a screen reader\n * (e.g. linear navigation with VoiceOver, object navigation / browse mode with NVDA, virtual PC\n * cursor mode with JAWS). This is in part due to technical limitations (i.e. keyboard events do not\n * fire as expected in these modes) but is also arguably the correct behavior. Navigating with a\n * screen reader is akin to visually scanning a page, and should not be interpreted as actual user\n * input interaction.\n *\n * When a user is not navigating but *interacting* with a screen reader, this service attempts to\n * update the input modality to keyboard, but in general this service's behavior is largely\n * undefined.\n */\nclass InputModalityDetector {\n constructor(_platform, ngZone, document, options) {\n this._platform = _platform;\n /**\n * The most recently detected input modality event target. Is null if no input modality has been\n * detected or if the associated event target is null for some unknown reason.\n */\n this._mostRecentTarget = null;\n /** The underlying BehaviorSubject that emits whenever an input modality is detected. */\n this._modality = new BehaviorSubject(null);\n /**\n * The timestamp of the last touch input modality. Used to determine whether mousedown events\n * should be attributed to mouse or touch.\n */\n this._lastTouchMs = 0;\n /**\n * Handles keydown events. Must be an arrow function in order to preserve the context when it gets\n * bound.\n */\n this._onKeydown = (event) => {\n var _a, _b;\n // If this is one of the keys we should ignore, then ignore it and don't update the input\n // modality to keyboard.\n if ((_b = (_a = this._options) === null || _a === void 0 ? void 0 : _a.ignoreKeys) === null || _b === void 0 ? void 0 : _b.some(keyCode => keyCode === event.keyCode)) {\n return;\n }\n this._modality.next('keyboard');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles mousedown events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onMousedown = (event) => {\n // Touches trigger both touch and mouse events, so we need to distinguish between mouse events\n // that were triggered via mouse vs touch. To do so, check if the mouse event occurs closely\n // after the previous touch event.\n if (Date.now() - this._lastTouchMs < TOUCH_BUFFER_MS) {\n return;\n }\n // Fake mousedown events are fired by some screen readers when controls are activated by the\n // screen reader. Attribute them to keyboard input modality.\n this._modality.next(isFakeMousedownFromScreenReader(event) ? 'keyboard' : 'mouse');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles touchstart events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onTouchstart = (event) => {\n // Same scenario as mentioned in _onMousedown, but on touch screen devices, fake touchstart\n // events are fired. Again, attribute to keyboard input modality.\n if (isFakeTouchstartFromScreenReader(event)) {\n this._modality.next('keyboard');\n return;\n }\n // Store the timestamp of this touch event, as it's used to distinguish between mouse events\n // triggered via mouse vs touch.\n this._lastTouchMs = Date.now();\n this._modality.next('touch');\n this._mostRecentTarget = _getEventTarget(event);\n };\n this._options = Object.assign(Object.assign({}, INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS), options);\n // Skip the first emission as it's null.\n this.modalityDetected = this._modality.pipe(skip(1));\n this.modalityChanged = this.modalityDetected.pipe(distinctUntilChanged());\n // If we're not in a browser, this service should do nothing, as there's no relevant input\n // modality to detect.\n if (_platform.isBrowser) {\n ngZone.runOutsideAngular(() => {\n document.addEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.addEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.addEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n });\n }\n }\n /** The most recently detected input modality. */\n get mostRecentModality() {\n return this._modality.value;\n }\n ngOnDestroy() {\n this._modality.complete();\n if (this._platform.isBrowser) {\n document.removeEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.removeEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.removeEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n }\n }\n}\nInputModalityDetector.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: InputModalityDetector, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT }, { token: INPUT_MODALITY_DETECTOR_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nInputModalityDetector.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: InputModalityDetector, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: InputModalityDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: i1.Platform }, { type: i0.NgZone }, { type: Document, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [INPUT_MODALITY_DETECTOR_OPTIONS]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst LIVE_ANNOUNCER_ELEMENT_TOKEN = new InjectionToken('liveAnnouncerElement', {\n providedIn: 'root',\n factory: LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY,\n});\n/** @docs-private */\nfunction LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY() {\n return null;\n}\n/** Injection token that can be used to configure the default options for the LiveAnnouncer. */\nconst LIVE_ANNOUNCER_DEFAULT_OPTIONS = new InjectionToken('LIVE_ANNOUNCER_DEFAULT_OPTIONS');\n\nclass LiveAnnouncer {\n constructor(elementToken, _ngZone, _document, _defaultOptions) {\n this._ngZone = _ngZone;\n this._defaultOptions = _defaultOptions;\n // We inject the live element and document as `any` because the constructor signature cannot\n // reference browser globals (HTMLElement, Document) on non-browser environments, since having\n // a class decorator causes TypeScript to preserve the constructor signature types.\n this._document = _document;\n this._liveElement = elementToken || this._createLiveElement();\n }\n announce(message, ...args) {\n const defaultOptions = this._defaultOptions;\n let politeness;\n let duration;\n if (args.length === 1 && typeof args[0] === 'number') {\n duration = args[0];\n }\n else {\n [politeness, duration] = args;\n }\n this.clear();\n clearTimeout(this._previousTimeout);\n if (!politeness) {\n politeness =\n defaultOptions && defaultOptions.politeness ? defaultOptions.politeness : 'polite';\n }\n if (duration == null && defaultOptions) {\n duration = defaultOptions.duration;\n }\n // TODO: ensure changing the politeness works on all environments we support.\n this._liveElement.setAttribute('aria-live', politeness);\n // This 100ms timeout is necessary for some browser + screen-reader combinations:\n // - Both JAWS and NVDA over IE11 will not announce anything without a non-zero timeout.\n // - With Chrome and IE11 with NVDA or JAWS, a repeated (identical) message won't be read a\n // second time without clearing and then using a non-zero delay.\n // (using JAWS 17 at time of this writing).\n return this._ngZone.runOutsideAngular(() => {\n return new Promise(resolve => {\n clearTimeout(this._previousTimeout);\n this._previousTimeout = setTimeout(() => {\n this._liveElement.textContent = message;\n resolve();\n if (typeof duration === 'number') {\n this._previousTimeout = setTimeout(() => this.clear(), duration);\n }\n }, 100);\n });\n });\n }\n /**\n * Clears the current text from the announcer element. Can be used to prevent\n * screen readers from reading the text out again while the user is going\n * through the page landmarks.\n */\n clear() {\n if (this._liveElement) {\n this._liveElement.textContent = '';\n }\n }\n ngOnDestroy() {\n var _a;\n clearTimeout(this._previousTimeout);\n (_a = this._liveElement) === null || _a === void 0 ? void 0 : _a.remove();\n this._liveElement = null;\n }\n _createLiveElement() {\n const elementClass = 'cdk-live-announcer-element';\n const previousElements = this._document.getElementsByClassName(elementClass);\n const liveEl = this._document.createElement('div');\n // Remove any old containers. This can happen when coming in from a server-side-rendered page.\n for (let i = 0; i < previousElements.length; i++) {\n previousElements[i].remove();\n }\n liveEl.classList.add(elementClass);\n liveEl.classList.add('cdk-visually-hidden');\n liveEl.setAttribute('aria-atomic', 'true');\n liveEl.setAttribute('aria-live', 'polite');\n this._document.body.appendChild(liveEl);\n return liveEl;\n }\n}\nLiveAnnouncer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: LiveAnnouncer, deps: [{ token: LIVE_ANNOUNCER_ELEMENT_TOKEN, optional: true }, { token: i0.NgZone }, { token: DOCUMENT }, { token: LIVE_ANNOUNCER_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nLiveAnnouncer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: LiveAnnouncer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: LiveAnnouncer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_ELEMENT_TOKEN]\n }] }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS]\n }] }];\n } });\n/**\n * A directive that works similarly to aria-live, but uses the LiveAnnouncer to ensure compatibility\n * with a wider range of browsers and screen readers.\n */\nclass CdkAriaLive {\n constructor(_elementRef, _liveAnnouncer, _contentObserver, _ngZone) {\n this._elementRef = _elementRef;\n this._liveAnnouncer = _liveAnnouncer;\n this._contentObserver = _contentObserver;\n this._ngZone = _ngZone;\n this._politeness = 'polite';\n }\n /** The aria-live politeness level to use when announcing messages. */\n get politeness() {\n return this._politeness;\n }\n set politeness(value) {\n this._politeness = value === 'off' || value === 'assertive' ? value : 'polite';\n if (this._politeness === 'off') {\n if (this._subscription) {\n this._subscription.unsubscribe();\n this._subscription = null;\n }\n }\n else if (!this._subscription) {\n this._subscription = this._ngZone.runOutsideAngular(() => {\n return this._contentObserver.observe(this._elementRef).subscribe(() => {\n // Note that we use textContent here, rather than innerText, in order to avoid a reflow.\n const elementText = this._elementRef.nativeElement.textContent;\n // The `MutationObserver` fires also for attribute\n // changes which we don't want to announce.\n if (elementText !== this._previousAnnouncedText) {\n this._liveAnnouncer.announce(elementText, this._politeness);\n this._previousAnnouncedText = elementText;\n }\n });\n });\n }\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._subscription.unsubscribe();\n }\n }\n}\nCdkAriaLive.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkAriaLive, deps: [{ token: i0.ElementRef }, { token: LiveAnnouncer }, { token: i1$1.ContentObserver }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkAriaLive.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkAriaLive, selector: \"[cdkAriaLive]\", inputs: { politeness: [\"cdkAriaLive\", \"politeness\"] }, exportAs: [\"cdkAriaLive\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkAriaLive, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkAriaLive]',\n exportAs: 'cdkAriaLive',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: LiveAnnouncer }, { type: i1$1.ContentObserver }, { type: i0.NgZone }]; }, propDecorators: { politeness: [{\n type: Input,\n args: ['cdkAriaLive']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** InjectionToken for FocusMonitorOptions. */\nconst FOCUS_MONITOR_DEFAULT_OPTIONS = new InjectionToken('cdk-focus-monitor-default-options');\n/**\n * Event listener options that enable capturing and also\n * mark the listener as passive if the browser supports it.\n */\nconst captureEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/** Monitors mouse and keyboard events to determine the cause of focus events. */\nclass FocusMonitor {\n constructor(_ngZone, _platform, _inputModalityDetector, \n /** @breaking-change 11.0.0 make document required */\n document, options) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n this._inputModalityDetector = _inputModalityDetector;\n /** The focus origin that the next focus event is a result of. */\n this._origin = null;\n /** Whether the window has just been focused. */\n this._windowFocused = false;\n /**\n * Whether the origin was determined via a touch interaction. Necessary as properly attributing\n * focus events to touch interactions requires special logic.\n */\n this._originFromTouchInteraction = false;\n /** Map of elements being monitored to their info. */\n this._elementInfo = new Map();\n /** The number of elements currently being monitored. */\n this._monitoredElementCount = 0;\n /**\n * Keeps track of the root nodes to which we've currently bound a focus/blur handler,\n * as well as the number of monitored elements that they contain. We have to treat focus/blur\n * handlers differently from the rest of the events, because the browser won't emit events\n * to the document when focus moves inside of a shadow root.\n */\n this._rootNodeFocusListenerCount = new Map();\n /**\n * Event listener for `focus` events on the window.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._windowFocusListener = () => {\n // Make a note of when the window regains focus, so we can\n // restore the origin info for the focused element.\n this._windowFocused = true;\n this._windowFocusTimeoutId = window.setTimeout(() => (this._windowFocused = false));\n };\n /** Subject for stopping our InputModalityDetector subscription. */\n this._stopInputModalityDetector = new Subject();\n /**\n * Event listener for `focus` and 'blur' events on the document.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._rootNodeFocusAndBlurListener = (event) => {\n const target = _getEventTarget(event);\n const handler = event.type === 'focus' ? this._onFocus : this._onBlur;\n // We need to walk up the ancestor chain in order to support `checkChildren`.\n for (let element = target; element; element = element.parentElement) {\n handler.call(this, event, element);\n }\n };\n this._document = document;\n this._detectionMode = (options === null || options === void 0 ? void 0 : options.detectionMode) || 0 /* IMMEDIATE */;\n }\n monitor(element, checkChildren = false) {\n const nativeElement = coerceElement(element);\n // Do nothing if we're not on the browser platform or the passed in node isn't an element.\n if (!this._platform.isBrowser || nativeElement.nodeType !== 1) {\n return of(null);\n }\n // If the element is inside the shadow DOM, we need to bind our focus/blur listeners to\n // the shadow root, rather than the `document`, because the browser won't emit focus events\n // to the `document`, if focus is moving within the same shadow root.\n const rootNode = _getShadowRoot(nativeElement) || this._getDocument();\n const cachedInfo = this._elementInfo.get(nativeElement);\n // Check if we're already monitoring this element.\n if (cachedInfo) {\n if (checkChildren) {\n // TODO(COMP-318): this can be problematic, because it'll turn all non-checkChildren\n // observers into ones that behave as if `checkChildren` was turned on. We need a more\n // robust solution.\n cachedInfo.checkChildren = true;\n }\n return cachedInfo.subject;\n }\n // Create monitored element info.\n const info = {\n checkChildren: checkChildren,\n subject: new Subject(),\n rootNode,\n };\n this._elementInfo.set(nativeElement, info);\n this._registerGlobalListeners(info);\n return info.subject;\n }\n stopMonitoring(element) {\n const nativeElement = coerceElement(element);\n const elementInfo = this._elementInfo.get(nativeElement);\n if (elementInfo) {\n elementInfo.subject.complete();\n this._setClasses(nativeElement);\n this._elementInfo.delete(nativeElement);\n this._removeGlobalListeners(elementInfo);\n }\n }\n focusVia(element, origin, options) {\n const nativeElement = coerceElement(element);\n const focusedElement = this._getDocument().activeElement;\n // If the element is focused already, calling `focus` again won't trigger the event listener\n // which means that the focus classes won't be updated. If that's the case, update the classes\n // directly without waiting for an event.\n if (nativeElement === focusedElement) {\n this._getClosestElementsInfo(nativeElement).forEach(([currentElement, info]) => this._originChanged(currentElement, origin, info));\n }\n else {\n this._setOrigin(origin);\n // `focus` isn't available on the server\n if (typeof nativeElement.focus === 'function') {\n nativeElement.focus(options);\n }\n }\n }\n ngOnDestroy() {\n this._elementInfo.forEach((_info, element) => this.stopMonitoring(element));\n }\n /** Access injected document if available or fallback to global document reference */\n _getDocument() {\n return this._document || document;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n const doc = this._getDocument();\n return doc.defaultView || window;\n }\n _getFocusOrigin(focusEventTarget) {\n if (this._origin) {\n // If the origin was realized via a touch interaction, we need to perform additional checks\n // to determine whether the focus origin should be attributed to touch or program.\n if (this._originFromTouchInteraction) {\n return this._shouldBeAttributedToTouch(focusEventTarget) ? 'touch' : 'program';\n }\n else {\n return this._origin;\n }\n }\n // If the window has just regained focus, we can restore the most recent origin from before the\n // window blurred. Otherwise, we've reached the point where we can't identify the source of the\n // focus. This typically means one of two things happened:\n //\n // 1) The element was programmatically focused, or\n // 2) The element was focused via screen reader navigation (which generally doesn't fire\n // events).\n //\n // Because we can't distinguish between these two cases, we default to setting `program`.\n return this._windowFocused && this._lastFocusOrigin ? this._lastFocusOrigin : 'program';\n }\n /**\n * Returns whether the focus event should be attributed to touch. Recall that in IMMEDIATE mode, a\n * touch origin isn't immediately reset at the next tick (see _setOrigin). This means that when we\n * handle a focus event following a touch interaction, we need to determine whether (1) the focus\n * event was directly caused by the touch interaction or (2) the focus event was caused by a\n * subsequent programmatic focus call triggered by the touch interaction.\n * @param focusEventTarget The target of the focus event under examination.\n */\n _shouldBeAttributedToTouch(focusEventTarget) {\n // Please note that this check is not perfect. Consider the following edge case:\n //\n //
\n // \n //
\n //\n // Suppose there is a FocusMonitor in IMMEDIATE mode attached to #parent. When the user touches\n // #child, #parent is programmatically focused. This code will attribute the focus to touch\n // instead of program. This is a relatively minor edge-case that can be worked around by using\n // focusVia(parent, 'program') to focus #parent.\n return (this._detectionMode === 1 /* EVENTUAL */ ||\n !!(focusEventTarget === null || focusEventTarget === void 0 ? void 0 : focusEventTarget.contains(this._inputModalityDetector._mostRecentTarget)));\n }\n /**\n * Sets the focus classes on the element based on the given focus origin.\n * @param element The element to update the classes on.\n * @param origin The focus origin.\n */\n _setClasses(element, origin) {\n element.classList.toggle('cdk-focused', !!origin);\n element.classList.toggle('cdk-touch-focused', origin === 'touch');\n element.classList.toggle('cdk-keyboard-focused', origin === 'keyboard');\n element.classList.toggle('cdk-mouse-focused', origin === 'mouse');\n element.classList.toggle('cdk-program-focused', origin === 'program');\n }\n /**\n * Updates the focus origin. If we're using immediate detection mode, we schedule an async\n * function to clear the origin at the end of a timeout. The duration of the timeout depends on\n * the origin being set.\n * @param origin The origin to set.\n * @param isFromInteraction Whether we are setting the origin from an interaction event.\n */\n _setOrigin(origin, isFromInteraction = false) {\n this._ngZone.runOutsideAngular(() => {\n this._origin = origin;\n this._originFromTouchInteraction = origin === 'touch' && isFromInteraction;\n // If we're in IMMEDIATE mode, reset the origin at the next tick (or in `TOUCH_BUFFER_MS` ms\n // for a touch event). We reset the origin at the next tick because Firefox focuses one tick\n // after the interaction event. We wait `TOUCH_BUFFER_MS` ms before resetting the origin for\n // a touch event because when a touch event is fired, the associated focus event isn't yet in\n // the event queue. Before doing so, clear any pending timeouts.\n if (this._detectionMode === 0 /* IMMEDIATE */) {\n clearTimeout(this._originTimeoutId);\n const ms = this._originFromTouchInteraction ? TOUCH_BUFFER_MS : 1;\n this._originTimeoutId = setTimeout(() => (this._origin = null), ms);\n }\n });\n }\n /**\n * Handles focus events on a registered element.\n * @param event The focus event.\n * @param element The monitored element.\n */\n _onFocus(event, element) {\n // NOTE(mmalerba): We currently set the classes based on the focus origin of the most recent\n // focus event affecting the monitored element. If we want to use the origin of the first event\n // instead we should check for the cdk-focused class here and return if the element already has\n // it. (This only matters for elements that have includesChildren = true).\n // If we are not counting child-element-focus as focused, make sure that the event target is the\n // monitored element itself.\n const elementInfo = this._elementInfo.get(element);\n const focusEventTarget = _getEventTarget(event);\n if (!elementInfo || (!elementInfo.checkChildren && element !== focusEventTarget)) {\n return;\n }\n this._originChanged(element, this._getFocusOrigin(focusEventTarget), elementInfo);\n }\n /**\n * Handles blur events on a registered element.\n * @param event The blur event.\n * @param element The monitored element.\n */\n _onBlur(event, element) {\n // If we are counting child-element-focus as focused, make sure that we aren't just blurring in\n // order to focus another child of the monitored element.\n const elementInfo = this._elementInfo.get(element);\n if (!elementInfo ||\n (elementInfo.checkChildren &&\n event.relatedTarget instanceof Node &&\n element.contains(event.relatedTarget))) {\n return;\n }\n this._setClasses(element);\n this._emitOrigin(elementInfo.subject, null);\n }\n _emitOrigin(subject, origin) {\n this._ngZone.run(() => subject.next(origin));\n }\n _registerGlobalListeners(elementInfo) {\n if (!this._platform.isBrowser) {\n return;\n }\n const rootNode = elementInfo.rootNode;\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode) || 0;\n if (!rootNodeFocusListeners) {\n this._ngZone.runOutsideAngular(() => {\n rootNode.addEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.addEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n });\n }\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners + 1);\n // Register global listeners when first element is monitored.\n if (++this._monitoredElementCount === 1) {\n // Note: we listen to events in the capture phase so we\n // can detect them even if the user stops propagation.\n this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n window.addEventListener('focus', this._windowFocusListener);\n });\n // The InputModalityDetector is also just a collection of global listeners.\n this._inputModalityDetector.modalityDetected\n .pipe(takeUntil(this._stopInputModalityDetector))\n .subscribe(modality => {\n this._setOrigin(modality, true /* isFromInteraction */);\n });\n }\n }\n _removeGlobalListeners(elementInfo) {\n const rootNode = elementInfo.rootNode;\n if (this._rootNodeFocusListenerCount.has(rootNode)) {\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode);\n if (rootNodeFocusListeners > 1) {\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners - 1);\n }\n else {\n rootNode.removeEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.removeEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n this._rootNodeFocusListenerCount.delete(rootNode);\n }\n }\n // Unregister global listeners when last element is unmonitored.\n if (!--this._monitoredElementCount) {\n const window = this._getWindow();\n window.removeEventListener('focus', this._windowFocusListener);\n // Equivalently, stop our InputModalityDetector subscription.\n this._stopInputModalityDetector.next();\n // Clear timeouts for all potentially pending timeouts to prevent the leaks.\n clearTimeout(this._windowFocusTimeoutId);\n clearTimeout(this._originTimeoutId);\n }\n }\n /** Updates all the state on an element once its focus origin has changed. */\n _originChanged(element, origin, elementInfo) {\n this._setClasses(element, origin);\n this._emitOrigin(elementInfo.subject, origin);\n this._lastFocusOrigin = origin;\n }\n /**\n * Collects the `MonitoredElementInfo` of a particular element and\n * all of its ancestors that have enabled `checkChildren`.\n * @param element Element from which to start the search.\n */\n _getClosestElementsInfo(element) {\n const results = [];\n this._elementInfo.forEach((info, currentElement) => {\n if (currentElement === element || (info.checkChildren && currentElement.contains(element))) {\n results.push([currentElement, info]);\n }\n });\n return results;\n }\n}\nFocusMonitor.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusMonitor, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: InputModalityDetector }, { token: DOCUMENT, optional: true }, { token: FOCUS_MONITOR_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nFocusMonitor.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusMonitor, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FocusMonitor, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: i0.NgZone }, { type: i1.Platform }, { type: InputModalityDetector }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_MONITOR_DEFAULT_OPTIONS]\n }] }];\n } });\n/**\n * Directive that determines how a particular element was focused (via keyboard, mouse, touch, or\n * programmatically) and adds corresponding classes to the element.\n *\n * There are two variants of this directive:\n * 1) cdkMonitorElementFocus: does not consider an element to be focused if one of its children is\n * focused.\n * 2) cdkMonitorSubtreeFocus: considers an element focused if it or any of its children are focused.\n */\nclass CdkMonitorFocus {\n constructor(_elementRef, _focusMonitor) {\n this._elementRef = _elementRef;\n this._focusMonitor = _focusMonitor;\n this.cdkFocusChange = new EventEmitter();\n }\n ngAfterViewInit() {\n const element = this._elementRef.nativeElement;\n this._monitorSubscription = this._focusMonitor\n .monitor(element, element.nodeType === 1 && element.hasAttribute('cdkMonitorSubtreeFocus'))\n .subscribe(origin => this.cdkFocusChange.emit(origin));\n }\n ngOnDestroy() {\n this._focusMonitor.stopMonitoring(this._elementRef);\n if (this._monitorSubscription) {\n this._monitorSubscription.unsubscribe();\n }\n }\n}\nCdkMonitorFocus.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkMonitorFocus, deps: [{ token: i0.ElementRef }, { token: FocusMonitor }], target: i0.ɵɵFactoryTarget.Directive });\nCdkMonitorFocus.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkMonitorFocus, selector: \"[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]\", outputs: { cdkFocusChange: \"cdkFocusChange\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkMonitorFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: FocusMonitor }]; }, propDecorators: { cdkFocusChange: [{\n type: Output\n }] } });\n\n/** CSS class applied to the document body when in black-on-white high-contrast mode. */\nconst BLACK_ON_WHITE_CSS_CLASS = 'cdk-high-contrast-black-on-white';\n/** CSS class applied to the document body when in white-on-black high-contrast mode. */\nconst WHITE_ON_BLACK_CSS_CLASS = 'cdk-high-contrast-white-on-black';\n/** CSS class applied to the document body when in high-contrast mode. */\nconst HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS = 'cdk-high-contrast-active';\n/**\n * Service to determine whether the browser is currently in a high-contrast-mode environment.\n *\n * Microsoft Windows supports an accessibility feature called \"High Contrast Mode\". This mode\n * changes the appearance of all applications, including web applications, to dramatically increase\n * contrast.\n *\n * IE, Edge, and Firefox currently support this mode. Chrome does not support Windows High Contrast\n * Mode. This service does not detect high-contrast mode as added by the Chrome \"High Contrast\"\n * browser extension.\n */\nclass HighContrastModeDetector {\n constructor(_platform, document) {\n this._platform = _platform;\n this._document = document;\n }\n /** Gets the current high-contrast-mode for the page. */\n getHighContrastMode() {\n if (!this._platform.isBrowser) {\n return 0 /* NONE */;\n }\n // Create a test element with an arbitrary background-color that is neither black nor\n // white; high-contrast mode will coerce the color to either black or white. Also ensure that\n // appending the test element to the DOM does not affect layout by absolutely positioning it\n const testElement = this._document.createElement('div');\n testElement.style.backgroundColor = 'rgb(1,2,3)';\n testElement.style.position = 'absolute';\n this._document.body.appendChild(testElement);\n // Get the computed style for the background color, collapsing spaces to normalize between\n // browsers. Once we get this color, we no longer need the test element. Access the `window`\n // via the document so we can fake it in tests. Note that we have extra null checks, because\n // this logic will likely run during app bootstrap and throwing can break the entire app.\n const documentWindow = this._document.defaultView || window;\n const computedStyle = documentWindow && documentWindow.getComputedStyle\n ? documentWindow.getComputedStyle(testElement)\n : null;\n const computedColor = ((computedStyle && computedStyle.backgroundColor) || '').replace(/ /g, '');\n testElement.remove();\n switch (computedColor) {\n case 'rgb(0,0,0)':\n return 2 /* WHITE_ON_BLACK */;\n case 'rgb(255,255,255)':\n return 1 /* BLACK_ON_WHITE */;\n }\n return 0 /* NONE */;\n }\n /** Applies CSS classes indicating high-contrast mode to document body (browser-only). */\n _applyBodyHighContrastModeCssClasses() {\n if (!this._hasCheckedHighContrastMode && this._platform.isBrowser && this._document.body) {\n const bodyClasses = this._document.body.classList;\n // IE11 doesn't support `classList` operations with multiple arguments\n bodyClasses.remove(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.remove(BLACK_ON_WHITE_CSS_CLASS);\n bodyClasses.remove(WHITE_ON_BLACK_CSS_CLASS);\n this._hasCheckedHighContrastMode = true;\n const mode = this.getHighContrastMode();\n if (mode === 1 /* BLACK_ON_WHITE */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.add(BLACK_ON_WHITE_CSS_CLASS);\n }\n else if (mode === 2 /* WHITE_ON_BLACK */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.add(WHITE_ON_BLACK_CSS_CLASS);\n }\n }\n }\n}\nHighContrastModeDetector.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: HighContrastModeDetector, deps: [{ token: i1.Platform }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nHighContrastModeDetector.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: HighContrastModeDetector, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: HighContrastModeDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: i1.Platform }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass A11yModule {\n constructor(highContrastModeDetector) {\n highContrastModeDetector._applyBodyHighContrastModeCssClasses();\n }\n}\nA11yModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: A11yModule, deps: [{ token: HighContrastModeDetector }], target: i0.ɵɵFactoryTarget.NgModule });\nA11yModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: A11yModule, declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus], imports: [PlatformModule, ObserversModule], exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus] });\nA11yModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: A11yModule, imports: [[PlatformModule, ObserversModule]] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: A11yModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [PlatformModule, ObserversModule],\n declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n }]\n }], ctorParameters: function () { return [{ type: HighContrastModeDetector }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A11yModule, ActiveDescendantKeyManager, AriaDescriber, CDK_DESCRIBEDBY_HOST_ATTRIBUTE, CDK_DESCRIBEDBY_ID_PREFIX, CdkAriaLive, CdkMonitorFocus, CdkTrapFocus, ConfigurableFocusTrap, ConfigurableFocusTrapFactory, EventListenerFocusTrapInertStrategy, FOCUS_MONITOR_DEFAULT_OPTIONS, FOCUS_TRAP_INERT_STRATEGY, FocusKeyManager, FocusMonitor, FocusTrap, FocusTrapFactory, HighContrastModeDetector, INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS, INPUT_MODALITY_DETECTOR_OPTIONS, InputModalityDetector, InteractivityChecker, IsFocusableConfig, LIVE_ANNOUNCER_DEFAULT_OPTIONS, LIVE_ANNOUNCER_ELEMENT_TOKEN, LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY, ListKeyManager, LiveAnnouncer, MESSAGES_CONTAINER_ID, isFakeMousedownFromScreenReader, isFakeTouchstartFromScreenReader };\n","import * as i0 from '@angular/core';\nimport { InjectionToken, inject, EventEmitter, Injectable, Optional, Inject, Directive, Output, Input, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token used to inject the document into Directionality.\n * This is used so that the value can be faked in tests.\n *\n * We can't use the real document in tests because changing the real `dir` causes geometry-based\n * tests in Safari to fail.\n *\n * We also can't re-provide the DOCUMENT token from platform-brower because the unit tests\n * themselves use things like `querySelector` in test code.\n *\n * This token is defined in a separate file from Directionality as a workaround for\n * https://github.com/angular/angular/issues/22559\n *\n * @docs-private\n */\nconst DIR_DOCUMENT = new InjectionToken('cdk-dir-doc', {\n providedIn: 'root',\n factory: DIR_DOCUMENT_FACTORY,\n});\n/** @docs-private */\nfunction DIR_DOCUMENT_FACTORY() {\n return inject(DOCUMENT);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Regex that matches locales with an RTL script. Taken from `goog.i18n.bidi.isRtlLanguage`. */\nconst RTL_LOCALE_PATTERN = /^(ar|ckb|dv|he|iw|fa|nqo|ps|sd|ug|ur|yi|.*[-_](Adlm|Arab|Hebr|Nkoo|Rohg|Thaa))(?!.*[-_](Latn|Cyrl)($|-|_))($|-|_)/i;\n/** Resolves a string value to a specific direction. */\nfunction _resolveDirectionality(rawValue) {\n const value = (rawValue === null || rawValue === void 0 ? void 0 : rawValue.toLowerCase()) || '';\n if (value === 'auto' && typeof navigator !== 'undefined' && (navigator === null || navigator === void 0 ? void 0 : navigator.language)) {\n return RTL_LOCALE_PATTERN.test(navigator.language) ? 'rtl' : 'ltr';\n }\n return value === 'rtl' ? 'rtl' : 'ltr';\n}\n/**\n * The directionality (LTR / RTL) context for the application (or a subtree of it).\n * Exposes the current direction and a stream of direction changes.\n */\nclass Directionality {\n constructor(_document) {\n /** The current 'ltr' or 'rtl' value. */\n this.value = 'ltr';\n /** Stream that emits whenever the 'ltr' / 'rtl' state changes. */\n this.change = new EventEmitter();\n if (_document) {\n const bodyDir = _document.body ? _document.body.dir : null;\n const htmlDir = _document.documentElement ? _document.documentElement.dir : null;\n this.value = _resolveDirectionality(bodyDir || htmlDir || 'ltr');\n }\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDirectionality.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Directionality, deps: [{ token: DIR_DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nDirectionality.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Directionality, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Directionality, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DIR_DOCUMENT]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive to listen for changes of direction of part of the DOM.\n *\n * Provides itself as Directionality such that descendant directives only need to ever inject\n * Directionality to get the closest direction.\n */\nclass Dir {\n constructor() {\n /** Normalized direction that accounts for invalid/unsupported values. */\n this._dir = 'ltr';\n /** Whether the `value` has been set to its initial value. */\n this._isInitialized = false;\n /** Event emitted when the direction changes. */\n this.change = new EventEmitter();\n }\n /** @docs-private */\n get dir() {\n return this._dir;\n }\n set dir(value) {\n const previousValue = this._dir;\n // Note: `_resolveDirectionality` resolves the language based on the browser's language,\n // whereas the browser does it based on the content of the element. Since doing so based\n // on the content can be expensive, for now we're doing the simpler matching.\n this._dir = _resolveDirectionality(value);\n this._rawDir = value;\n if (previousValue !== this._dir && this._isInitialized) {\n this.change.emit(this._dir);\n }\n }\n /** Current layout direction of the element. */\n get value() {\n return this.dir;\n }\n /** Initialize once default value has been set. */\n ngAfterContentInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDir.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Dir, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nDir.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: Dir, selector: \"[dir]\", inputs: { dir: \"dir\" }, outputs: { change: \"dirChange\" }, host: { properties: { \"attr.dir\": \"_rawDir\" } }, providers: [{ provide: Directionality, useExisting: Dir }], exportAs: [\"dir\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Dir, decorators: [{\n type: Directive,\n args: [{\n selector: '[dir]',\n providers: [{ provide: Directionality, useExisting: Dir }],\n host: { '[attr.dir]': '_rawDir' },\n exportAs: 'dir',\n }]\n }], propDecorators: { change: [{\n type: Output,\n args: ['dirChange']\n }], dir: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass BidiModule {\n}\nBidiModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BidiModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nBidiModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BidiModule, declarations: [Dir], exports: [Dir] });\nBidiModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BidiModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BidiModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [Dir],\n declarations: [Dir],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BidiModule, DIR_DOCUMENT, Dir, Directionality };\n","import { Version } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Current version of the Angular Component Development Kit. */\nconst VERSION = new Version('13.1.3');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\nexport { VERSION };\n","import { ElementRef } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a data-bound value (typically a string) to a boolean. */\nfunction coerceBooleanProperty(value) {\n return value != null && `${value}` !== 'false';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceNumberProperty(value, fallbackValue = 0) {\n return _isNumberValue(value) ? Number(value) : fallbackValue;\n}\n/**\n * Whether the provided value is considered a number.\n * @docs-private\n */\nfunction _isNumberValue(value) {\n // parseFloat(value) handles most of the cases we're interested in (it treats null, empty string,\n // and other non-number values as NaN, where Number just uses 0) but it considers the string\n // '123hello' to be a valid number. Therefore we also check if Number(value) is NaN.\n return !isNaN(parseFloat(value)) && !isNaN(Number(value));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceArray(value) {\n return Array.isArray(value) ? value : [value];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a value to a CSS pixel value. */\nfunction coerceCssPixelValue(value) {\n if (value == null) {\n return '';\n }\n return typeof value === 'string' ? value : `${value}px`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces an ElementRef or an Element into an element.\n * Useful for APIs that can accept either a ref or the native element itself.\n */\nfunction coerceElement(elementOrRef) {\n return elementOrRef instanceof ElementRef ? elementOrRef.nativeElement : elementOrRef;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces a value to an array of trimmed non-empty strings.\n * Any input that is not an array, `null` or `undefined` will be turned into a string\n * via `toString()` and subsequently split with the given separator.\n * `null` and `undefined` will result in an empty array.\n * This results in the following outcomes:\n * - `null` -> `[]`\n * - `[null]` -> `[\"null\"]`\n * - `[\"a\", \"b \", \" \"]` -> `[\"a\", \"b\"]`\n * - `[1, [2, 3]]` -> `[\"1\", \"2,3\"]`\n * - `[{ a: 0 }]` -> `[\"[object Object]\"]`\n * - `{ a: 0 }` -> `[\"[object\", \"Object]\"]`\n *\n * Useful for defining CSS classes or table columns.\n * @param value the value to coerce into an array of strings\n * @param separator split-separator if value isn't an array\n */\nfunction coerceStringArray(value, separator = /\\s+/) {\n const result = [];\n if (value != null) {\n const sourceValues = Array.isArray(value) ? value : `${value}`.split(separator);\n for (const sourceValue of sourceValues) {\n const trimmedString = `${sourceValue}`.trim();\n if (trimmedString) {\n result.push(trimmedString);\n }\n }\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\nexport { _isNumberValue, coerceArray, coerceBooleanProperty, coerceCssPixelValue, coerceElement, coerceNumberProperty, coerceStringArray };\n","import { isObservable, of, Subject } from 'rxjs';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass DataSource {\n}\n/** Checks whether an object is a data source. */\nfunction isDataSource(value) {\n // Check if the value is a DataSource by observing if it has a connect function. Cannot\n // be checked as an `instanceof DataSource` since people could create their own sources\n // that match the interface, but don't extend DataSource.\n return value && typeof value.connect === 'function';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** DataSource wrapper for a native array. */\nclass ArrayDataSource extends DataSource {\n constructor(_data) {\n super();\n this._data = _data;\n }\n connect() {\n return isObservable(this._data) ? this._data : of(this._data);\n }\n disconnect() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that destroys views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will always construct a new embedded view for each item.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _DisposeViewRepeaterStrategy {\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) {\n const insertContext = itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = viewContainerRef.createEmbeddedView(insertContext.templateRef, insertContext.context, insertContext.index);\n operation = 1 /* INSERTED */;\n }\n else if (currentIndex == null) {\n viewContainerRef.remove(adjustedPreviousIndex);\n operation = 3 /* REMOVED */;\n }\n else {\n view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n operation = 2 /* MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view === null || view === void 0 ? void 0 : view.context,\n operation,\n record,\n });\n }\n });\n }\n detach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that caches views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will reuse one of the cached views instead of creating a new\n * embedded view. Recycling cached views reduces the quantity of expensive DOM\n * inserts.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _RecycleViewRepeaterStrategy {\n constructor() {\n /**\n * The size of the cache used to store unused views.\n * Setting the cache size to `0` will disable caching. Defaults to 20 views.\n */\n this.viewCacheSize = 20;\n /**\n * View cache that stores embedded view instances that have been previously stamped out,\n * but don't are not currently rendered. The view repeater will reuse these views rather than\n * creating brand new ones.\n *\n * TODO(michaeljamesparsons) Investigate whether using a linked list would improve performance.\n */\n this._viewCache = [];\n }\n /** Apply changes to the DOM. */\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n // Rearrange the views to put them in the right location.\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) {\n // Item added.\n const viewArgsFactory = () => itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = this._insertView(viewArgsFactory, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = view ? 1 /* INSERTED */ : 0 /* REPLACED */;\n }\n else if (currentIndex == null) {\n // Item removed.\n this._detachAndCacheView(adjustedPreviousIndex, viewContainerRef);\n operation = 3 /* REMOVED */;\n }\n else {\n // Item moved.\n view = this._moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = 2 /* MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view === null || view === void 0 ? void 0 : view.context,\n operation,\n record,\n });\n }\n });\n }\n detach() {\n for (const view of this._viewCache) {\n view.destroy();\n }\n this._viewCache = [];\n }\n /**\n * Inserts a view for a new item, either from the cache or by creating a new\n * one. Returns `undefined` if the item was inserted into a cached view.\n */\n _insertView(viewArgsFactory, currentIndex, viewContainerRef, value) {\n const cachedView = this._insertViewFromCache(currentIndex, viewContainerRef);\n if (cachedView) {\n cachedView.context.$implicit = value;\n return undefined;\n }\n const viewArgs = viewArgsFactory();\n return viewContainerRef.createEmbeddedView(viewArgs.templateRef, viewArgs.context, viewArgs.index);\n }\n /** Detaches the view at the given index and inserts into the view cache. */\n _detachAndCacheView(index, viewContainerRef) {\n const detachedView = viewContainerRef.detach(index);\n this._maybeCacheView(detachedView, viewContainerRef);\n }\n /** Moves view at the previous index to the current index. */\n _moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, value) {\n const view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n view.context.$implicit = value;\n return view;\n }\n /**\n * Cache the given detached view. If the cache is full, the view will be\n * destroyed.\n */\n _maybeCacheView(view, viewContainerRef) {\n if (this._viewCache.length < this.viewCacheSize) {\n this._viewCache.push(view);\n }\n else {\n const index = viewContainerRef.indexOf(view);\n // The host component could remove views from the container outside of\n // the view repeater. It's unlikely this will occur, but just in case,\n // destroy the view on its own, otherwise destroy it through the\n // container to ensure that all the references are removed.\n if (index === -1) {\n view.destroy();\n }\n else {\n viewContainerRef.remove(index);\n }\n }\n }\n /** Inserts a recycled view from the cache at the given index. */\n _insertViewFromCache(index, viewContainerRef) {\n const cachedView = this._viewCache.pop();\n if (cachedView) {\n viewContainerRef.insert(cachedView, index);\n }\n return cachedView || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to be used to power selecting one or more options from a list.\n */\nclass SelectionModel {\n constructor(_multiple = false, initiallySelectedValues, _emitChanges = true) {\n this._multiple = _multiple;\n this._emitChanges = _emitChanges;\n /** Currently-selected values. */\n this._selection = new Set();\n /** Keeps track of the deselected options that haven't been emitted by the change event. */\n this._deselectedToEmit = [];\n /** Keeps track of the selected options that haven't been emitted by the change event. */\n this._selectedToEmit = [];\n /** Event emitted when the value has changed. */\n this.changed = new Subject();\n if (initiallySelectedValues && initiallySelectedValues.length) {\n if (_multiple) {\n initiallySelectedValues.forEach(value => this._markSelected(value));\n }\n else {\n this._markSelected(initiallySelectedValues[0]);\n }\n // Clear the array in order to avoid firing the change event for preselected values.\n this._selectedToEmit.length = 0;\n }\n }\n /** Selected values. */\n get selected() {\n if (!this._selected) {\n this._selected = Array.from(this._selection.values());\n }\n return this._selected;\n }\n /**\n * Selects a value or an array of values.\n */\n select(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._markSelected(value));\n this._emitChangeEvent();\n }\n /**\n * Deselects a value or an array of values.\n */\n deselect(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._unmarkSelected(value));\n this._emitChangeEvent();\n }\n /**\n * Toggles a value between selected and deselected.\n */\n toggle(value) {\n this.isSelected(value) ? this.deselect(value) : this.select(value);\n }\n /**\n * Clears all of the selected values.\n */\n clear() {\n this._unmarkAll();\n this._emitChangeEvent();\n }\n /**\n * Determines whether a value is selected.\n */\n isSelected(value) {\n return this._selection.has(value);\n }\n /**\n * Determines whether the model does not have a value.\n */\n isEmpty() {\n return this._selection.size === 0;\n }\n /**\n * Determines whether the model has a value.\n */\n hasValue() {\n return !this.isEmpty();\n }\n /**\n * Sorts the selected values based on a predicate function.\n */\n sort(predicate) {\n if (this._multiple && this.selected) {\n this._selected.sort(predicate);\n }\n }\n /**\n * Gets whether multiple values can be selected.\n */\n isMultipleSelection() {\n return this._multiple;\n }\n /** Emits a change event and clears the records of selected and deselected values. */\n _emitChangeEvent() {\n // Clear the selected values so they can be re-cached.\n this._selected = null;\n if (this._selectedToEmit.length || this._deselectedToEmit.length) {\n this.changed.next({\n source: this,\n added: this._selectedToEmit,\n removed: this._deselectedToEmit,\n });\n this._deselectedToEmit = [];\n this._selectedToEmit = [];\n }\n }\n /** Selects a value. */\n _markSelected(value) {\n if (!this.isSelected(value)) {\n if (!this._multiple) {\n this._unmarkAll();\n }\n this._selection.add(value);\n if (this._emitChanges) {\n this._selectedToEmit.push(value);\n }\n }\n }\n /** Deselects a value. */\n _unmarkSelected(value) {\n if (this.isSelected(value)) {\n this._selection.delete(value);\n if (this._emitChanges) {\n this._deselectedToEmit.push(value);\n }\n }\n }\n /** Clears out the selected values. */\n _unmarkAll() {\n if (!this.isEmpty()) {\n this._selection.forEach(value => this._unmarkSelected(value));\n }\n }\n /**\n * Verifies the value assignment and throws an error if the specified value array is\n * including multiple values while the selection model is not supporting multiple values.\n */\n _verifyValueAssignment(values) {\n if (values.length > 1 && !this._multiple && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMultipleValuesInSingleSelectionError();\n }\n }\n}\n/**\n * Returns an error that reports that multiple values are passed into a selection model\n * with a single value.\n * @docs-private\n */\nfunction getMultipleValuesInSingleSelectionError() {\n return Error('Cannot pass multiple values into SelectionModel with single-value mode.');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to coordinate unique selection based on name.\n * Intended to be consumed as an Angular service.\n * This service is needed because native radio change events are only fired on the item currently\n * being selected, and we still need to uncheck the previous selection.\n *\n * This service does not *store* any IDs and names because they may change at any time, so it is\n * less error-prone if they are simply passed through when the events occur.\n */\nclass UniqueSelectionDispatcher {\n constructor() {\n this._listeners = [];\n }\n /**\n * Notify other items that selection for the given name has been set.\n * @param id ID of the item.\n * @param name Name of the item.\n */\n notify(id, name) {\n for (let listener of this._listeners) {\n listener(id, name);\n }\n }\n /**\n * Listen for future changes to item selection.\n * @return Function used to deregister listener\n */\n listen(listener) {\n this._listeners.push(listener);\n return () => {\n this._listeners = this._listeners.filter((registered) => {\n return listener !== registered;\n });\n };\n }\n ngOnDestroy() {\n this._listeners = [];\n }\n}\nUniqueSelectionDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: UniqueSelectionDispatcher, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nUniqueSelectionDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: UniqueSelectionDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: UniqueSelectionDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token for {@link _ViewRepeater}. This token is for use by Angular Material only.\n * @docs-private\n */\nconst _VIEW_REPEATER_STRATEGY = new InjectionToken('_ViewRepeater');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ArrayDataSource, DataSource, SelectionModel, UniqueSelectionDispatcher, _DisposeViewRepeaterStrategy, _RecycleViewRepeaterStrategy, _VIEW_REPEATER_STRATEGY, getMultipleValuesInSingleSelectionError, isDataSource };\n","/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst MAC_ENTER = 3;\nconst BACKSPACE = 8;\nconst TAB = 9;\nconst NUM_CENTER = 12;\nconst ENTER = 13;\nconst SHIFT = 16;\nconst CONTROL = 17;\nconst ALT = 18;\nconst PAUSE = 19;\nconst CAPS_LOCK = 20;\nconst ESCAPE = 27;\nconst SPACE = 32;\nconst PAGE_UP = 33;\nconst PAGE_DOWN = 34;\nconst END = 35;\nconst HOME = 36;\nconst LEFT_ARROW = 37;\nconst UP_ARROW = 38;\nconst RIGHT_ARROW = 39;\nconst DOWN_ARROW = 40;\nconst PLUS_SIGN = 43;\nconst PRINT_SCREEN = 44;\nconst INSERT = 45;\nconst DELETE = 46;\nconst ZERO = 48;\nconst ONE = 49;\nconst TWO = 50;\nconst THREE = 51;\nconst FOUR = 52;\nconst FIVE = 53;\nconst SIX = 54;\nconst SEVEN = 55;\nconst EIGHT = 56;\nconst NINE = 57;\nconst FF_SEMICOLON = 59; // Firefox (Gecko) fires this for semicolon instead of 186\nconst FF_EQUALS = 61; // Firefox (Gecko) fires this for equals instead of 187\nconst QUESTION_MARK = 63;\nconst AT_SIGN = 64;\nconst A = 65;\nconst B = 66;\nconst C = 67;\nconst D = 68;\nconst E = 69;\nconst F = 70;\nconst G = 71;\nconst H = 72;\nconst I = 73;\nconst J = 74;\nconst K = 75;\nconst L = 76;\nconst M = 77;\nconst N = 78;\nconst O = 79;\nconst P = 80;\nconst Q = 81;\nconst R = 82;\nconst S = 83;\nconst T = 84;\nconst U = 85;\nconst V = 86;\nconst W = 87;\nconst X = 88;\nconst Y = 89;\nconst Z = 90;\nconst META = 91; // WIN_KEY_LEFT\nconst MAC_WK_CMD_LEFT = 91;\nconst MAC_WK_CMD_RIGHT = 93;\nconst CONTEXT_MENU = 93;\nconst NUMPAD_ZERO = 96;\nconst NUMPAD_ONE = 97;\nconst NUMPAD_TWO = 98;\nconst NUMPAD_THREE = 99;\nconst NUMPAD_FOUR = 100;\nconst NUMPAD_FIVE = 101;\nconst NUMPAD_SIX = 102;\nconst NUMPAD_SEVEN = 103;\nconst NUMPAD_EIGHT = 104;\nconst NUMPAD_NINE = 105;\nconst NUMPAD_MULTIPLY = 106;\nconst NUMPAD_PLUS = 107;\nconst NUMPAD_MINUS = 109;\nconst NUMPAD_PERIOD = 110;\nconst NUMPAD_DIVIDE = 111;\nconst F1 = 112;\nconst F2 = 113;\nconst F3 = 114;\nconst F4 = 115;\nconst F5 = 116;\nconst F6 = 117;\nconst F7 = 118;\nconst F8 = 119;\nconst F9 = 120;\nconst F10 = 121;\nconst F11 = 122;\nconst F12 = 123;\nconst NUM_LOCK = 144;\nconst SCROLL_LOCK = 145;\nconst FIRST_MEDIA = 166;\nconst FF_MINUS = 173;\nconst MUTE = 173; // Firefox (Gecko) fires 181 for MUTE\nconst VOLUME_DOWN = 174; // Firefox (Gecko) fires 182 for VOLUME_DOWN\nconst VOLUME_UP = 175; // Firefox (Gecko) fires 183 for VOLUME_UP\nconst FF_MUTE = 181;\nconst FF_VOLUME_DOWN = 182;\nconst LAST_MEDIA = 183;\nconst FF_VOLUME_UP = 183;\nconst SEMICOLON = 186; // Firefox (Gecko) fires 59 for SEMICOLON\nconst EQUALS = 187; // Firefox (Gecko) fires 61 for EQUALS\nconst COMMA = 188;\nconst DASH = 189; // Firefox (Gecko) fires 173 for DASH/MINUS\nconst PERIOD = 190;\nconst SLASH = 191;\nconst APOSTROPHE = 192;\nconst TILDE = 192;\nconst OPEN_SQUARE_BRACKET = 219;\nconst BACKSLASH = 220;\nconst CLOSE_SQUARE_BRACKET = 221;\nconst SINGLE_QUOTE = 222;\nconst MAC_META = 224;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Checks whether a modifier key is pressed.\n * @param event Event to be checked.\n */\nfunction hasModifierKey(event, ...modifiers) {\n if (modifiers.length) {\n return modifiers.some(modifier => event[modifier]);\n }\n return event.altKey || event.shiftKey || event.ctrlKey || event.metaKey;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A, ALT, APOSTROPHE, AT_SIGN, B, BACKSLASH, BACKSPACE, C, CAPS_LOCK, CLOSE_SQUARE_BRACKET, COMMA, CONTEXT_MENU, CONTROL, D, DASH, DELETE, DOWN_ARROW, E, EIGHT, END, ENTER, EQUALS, ESCAPE, F, F1, F10, F11, F12, F2, F3, F4, F5, F6, F7, F8, F9, FF_EQUALS, FF_MINUS, FF_MUTE, FF_SEMICOLON, FF_VOLUME_DOWN, FF_VOLUME_UP, FIRST_MEDIA, FIVE, FOUR, G, H, HOME, I, INSERT, J, K, L, LAST_MEDIA, LEFT_ARROW, M, MAC_ENTER, MAC_META, MAC_WK_CMD_LEFT, MAC_WK_CMD_RIGHT, META, MUTE, N, NINE, NUMPAD_DIVIDE, NUMPAD_EIGHT, NUMPAD_FIVE, NUMPAD_FOUR, NUMPAD_MINUS, NUMPAD_MULTIPLY, NUMPAD_NINE, NUMPAD_ONE, NUMPAD_PERIOD, NUMPAD_PLUS, NUMPAD_SEVEN, NUMPAD_SIX, NUMPAD_THREE, NUMPAD_TWO, NUMPAD_ZERO, NUM_CENTER, NUM_LOCK, O, ONE, OPEN_SQUARE_BRACKET, P, PAGE_DOWN, PAGE_UP, PAUSE, PERIOD, PLUS_SIGN, PRINT_SCREEN, Q, QUESTION_MARK, R, RIGHT_ARROW, S, SCROLL_LOCK, SEMICOLON, SEVEN, SHIFT, SINGLE_QUOTE, SIX, SLASH, SPACE, T, TAB, THREE, TILDE, TWO, U, UP_ARROW, V, VOLUME_DOWN, VOLUME_UP, W, X, Y, Z, ZERO, hasModifierKey };\n","import * as i0 from '@angular/core';\nimport { NgModule, Injectable } from '@angular/core';\nimport { coerceArray } from '@angular/cdk/coercion';\nimport { Subject, combineLatest, concat, Observable } from 'rxjs';\nimport { take, skip, debounceTime, map, startWith, takeUntil } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass LayoutModule {\n}\nLayoutModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: LayoutModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nLayoutModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: LayoutModule });\nLayoutModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: LayoutModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: LayoutModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Global registry for all dynamically-created, injected media queries. */\nconst mediaQueriesForWebkitCompatibility = new Set();\n/** Style tag that holds all of the dynamically-created media queries. */\nlet mediaQueryStyleNode;\n/** A utility for calling matchMedia queries. */\nclass MediaMatcher {\n constructor(_platform) {\n this._platform = _platform;\n this._matchMedia =\n this._platform.isBrowser && window.matchMedia\n ? // matchMedia is bound to the window scope intentionally as it is an illegal invocation to\n // call it from a different scope.\n window.matchMedia.bind(window)\n : noopMatchMedia;\n }\n /**\n * Evaluates the given media query and returns the native MediaQueryList from which results\n * can be retrieved.\n * Confirms the layout engine will trigger for the selector query provided and returns the\n * MediaQueryList for the query provided.\n */\n matchMedia(query) {\n if (this._platform.WEBKIT || this._platform.BLINK) {\n createEmptyStyleRule(query);\n }\n return this._matchMedia(query);\n }\n}\nMediaMatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: MediaMatcher, deps: [{ token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nMediaMatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: MediaMatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: MediaMatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }]; } });\n/**\n * Creates an empty stylesheet that is used to work around browser inconsistencies related to\n * `matchMedia`. At the time of writing, it handles the following cases:\n * 1. On WebKit browsers, a media query has to have at least one rule in order for `matchMedia`\n * to fire. We work around it by declaring a dummy stylesheet with a `@media` declaration.\n * 2. In some cases Blink browsers will stop firing the `matchMedia` listener if none of the rules\n * inside the `@media` match existing elements on the page. We work around it by having one rule\n * targeting the `body`. See https://github.com/angular/components/issues/23546.\n */\nfunction createEmptyStyleRule(query) {\n if (mediaQueriesForWebkitCompatibility.has(query)) {\n return;\n }\n try {\n if (!mediaQueryStyleNode) {\n mediaQueryStyleNode = document.createElement('style');\n mediaQueryStyleNode.setAttribute('type', 'text/css');\n document.head.appendChild(mediaQueryStyleNode);\n }\n if (mediaQueryStyleNode.sheet) {\n mediaQueryStyleNode.sheet.insertRule(`@media ${query} {body{ }}`, 0);\n mediaQueriesForWebkitCompatibility.add(query);\n }\n }\n catch (e) {\n console.error(e);\n }\n}\n/** No-op matchMedia replacement for non-browser platforms. */\nfunction noopMatchMedia(query) {\n // Use `as any` here to avoid adding additional necessary properties for\n // the noop matcher.\n return {\n matches: query === 'all' || query === '',\n media: query,\n addListener: () => { },\n removeListener: () => { },\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Utility for checking the matching state of @media queries. */\nclass BreakpointObserver {\n constructor(_mediaMatcher, _zone) {\n this._mediaMatcher = _mediaMatcher;\n this._zone = _zone;\n /** A map of all media queries currently being listened for. */\n this._queries = new Map();\n /** A subject for all other observables to takeUntil based on. */\n this._destroySubject = new Subject();\n }\n /** Completes the active subject, signalling to all other observables to complete. */\n ngOnDestroy() {\n this._destroySubject.next();\n this._destroySubject.complete();\n }\n /**\n * Whether one or more media queries match the current viewport size.\n * @param value One or more media queries to check.\n * @returns Whether any of the media queries match.\n */\n isMatched(value) {\n const queries = splitQueries(coerceArray(value));\n return queries.some(mediaQuery => this._registerQuery(mediaQuery).mql.matches);\n }\n /**\n * Gets an observable of results for the given queries that will emit new results for any changes\n * in matching of the given queries.\n * @param value One or more media queries to check.\n * @returns A stream of matches for the given queries.\n */\n observe(value) {\n const queries = splitQueries(coerceArray(value));\n const observables = queries.map(query => this._registerQuery(query).observable);\n let stateObservable = combineLatest(observables);\n // Emit the first state immediately, and then debounce the subsequent emissions.\n stateObservable = concat(stateObservable.pipe(take(1)), stateObservable.pipe(skip(1), debounceTime(0)));\n return stateObservable.pipe(map(breakpointStates => {\n const response = {\n matches: false,\n breakpoints: {},\n };\n breakpointStates.forEach(({ matches, query }) => {\n response.matches = response.matches || matches;\n response.breakpoints[query] = matches;\n });\n return response;\n }));\n }\n /** Registers a specific query to be listened for. */\n _registerQuery(query) {\n // Only set up a new MediaQueryList if it is not already being listened for.\n if (this._queries.has(query)) {\n return this._queries.get(query);\n }\n const mql = this._mediaMatcher.matchMedia(query);\n // Create callback for match changes and add it is as a listener.\n const queryObservable = new Observable((observer) => {\n // Listener callback methods are wrapped to be placed back in ngZone. Callbacks must be placed\n // back into the zone because matchMedia is only included in Zone.js by loading the\n // webapis-media-query.js file alongside the zone.js file. Additionally, some browsers do not\n // have MediaQueryList inherit from EventTarget, which causes inconsistencies in how Zone.js\n // patches it.\n const handler = (e) => this._zone.run(() => observer.next(e));\n mql.addListener(handler);\n return () => {\n mql.removeListener(handler);\n };\n }).pipe(startWith(mql), map(({ matches }) => ({ query, matches })), takeUntil(this._destroySubject));\n // Add the MediaQueryList to the set of queries.\n const output = { observable: queryObservable, mql };\n this._queries.set(query, output);\n return output;\n }\n}\nBreakpointObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BreakpointObserver, deps: [{ token: MediaMatcher }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable });\nBreakpointObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BreakpointObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BreakpointObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: MediaMatcher }, { type: i0.NgZone }]; } });\n/**\n * Split each query string into separate query strings if two queries are provided as comma\n * separated.\n */\nfunction splitQueries(queries) {\n return queries\n .map(query => query.split(','))\n .reduce((a1, a2) => a1.concat(a2))\n .map(query => query.trim());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// PascalCase is being used as Breakpoints is used like an enum.\n// tslint:disable-next-line:variable-name\nconst Breakpoints = {\n XSmall: '(max-width: 599.98px)',\n Small: '(min-width: 600px) and (max-width: 959.98px)',\n Medium: '(min-width: 960px) and (max-width: 1279.98px)',\n Large: '(min-width: 1280px) and (max-width: 1919.98px)',\n XLarge: '(min-width: 1920px)',\n Handset: '(max-width: 599.98px) and (orientation: portrait), ' +\n '(max-width: 959.98px) and (orientation: landscape)',\n Tablet: '(min-width: 600px) and (max-width: 839.98px) and (orientation: portrait), ' +\n '(min-width: 960px) and (max-width: 1279.98px) and (orientation: landscape)',\n Web: '(min-width: 840px) and (orientation: portrait), ' +\n '(min-width: 1280px) and (orientation: landscape)',\n HandsetPortrait: '(max-width: 599.98px) and (orientation: portrait)',\n TabletPortrait: '(min-width: 600px) and (max-width: 839.98px) and (orientation: portrait)',\n WebPortrait: '(min-width: 840px) and (orientation: portrait)',\n HandsetLandscape: '(max-width: 959.98px) and (orientation: landscape)',\n TabletLandscape: '(min-width: 960px) and (max-width: 1279.98px) and (orientation: landscape)',\n WebLandscape: '(min-width: 1280px) and (orientation: landscape)',\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BreakpointObserver, Breakpoints, LayoutModule, MediaMatcher };\n","import { coerceElement, coerceBooleanProperty, coerceNumberProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { Injectable, EventEmitter, Directive, Output, Input, NgModule } from '@angular/core';\nimport { Observable, Subject } from 'rxjs';\nimport { debounceTime } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Factory that creates a new MutationObserver and allows us to stub it out in unit tests.\n * @docs-private\n */\nclass MutationObserverFactory {\n create(callback) {\n return typeof MutationObserver === 'undefined' ? null : new MutationObserver(callback);\n }\n}\nMutationObserverFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: MutationObserverFactory, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nMutationObserverFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: MutationObserverFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: MutationObserverFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/** An injectable service that allows watching elements for changes to their content. */\nclass ContentObserver {\n constructor(_mutationObserverFactory) {\n this._mutationObserverFactory = _mutationObserverFactory;\n /** Keeps track of the existing MutationObservers so they can be reused. */\n this._observedElements = new Map();\n }\n ngOnDestroy() {\n this._observedElements.forEach((_, element) => this._cleanupObserver(element));\n }\n observe(elementOrRef) {\n const element = coerceElement(elementOrRef);\n return new Observable((observer) => {\n const stream = this._observeElement(element);\n const subscription = stream.subscribe(observer);\n return () => {\n subscription.unsubscribe();\n this._unobserveElement(element);\n };\n });\n }\n /**\n * Observes the given element by using the existing MutationObserver if available, or creating a\n * new one if not.\n */\n _observeElement(element) {\n if (!this._observedElements.has(element)) {\n const stream = new Subject();\n const observer = this._mutationObserverFactory.create(mutations => stream.next(mutations));\n if (observer) {\n observer.observe(element, {\n characterData: true,\n childList: true,\n subtree: true,\n });\n }\n this._observedElements.set(element, { observer, stream, count: 1 });\n }\n else {\n this._observedElements.get(element).count++;\n }\n return this._observedElements.get(element).stream;\n }\n /**\n * Un-observes the given element and cleans up the underlying MutationObserver if nobody else is\n * observing this element.\n */\n _unobserveElement(element) {\n if (this._observedElements.has(element)) {\n this._observedElements.get(element).count--;\n if (!this._observedElements.get(element).count) {\n this._cleanupObserver(element);\n }\n }\n }\n /** Clean up the underlying MutationObserver for the specified element. */\n _cleanupObserver(element) {\n if (this._observedElements.has(element)) {\n const { observer, stream } = this._observedElements.get(element);\n if (observer) {\n observer.disconnect();\n }\n stream.complete();\n this._observedElements.delete(element);\n }\n }\n}\nContentObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ContentObserver, deps: [{ token: MutationObserverFactory }], target: i0.ɵɵFactoryTarget.Injectable });\nContentObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ContentObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ContentObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: MutationObserverFactory }]; } });\n/**\n * Directive that triggers a callback whenever the content of\n * its associated element has changed.\n */\nclass CdkObserveContent {\n constructor(_contentObserver, _elementRef, _ngZone) {\n this._contentObserver = _contentObserver;\n this._elementRef = _elementRef;\n this._ngZone = _ngZone;\n /** Event emitted for each change in the element's content. */\n this.event = new EventEmitter();\n this._disabled = false;\n this._currentSubscription = null;\n }\n /**\n * Whether observing content is disabled. This option can be used\n * to disconnect the underlying MutationObserver until it is needed.\n */\n get disabled() {\n return this._disabled;\n }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n this._disabled ? this._unsubscribe() : this._subscribe();\n }\n /** Debounce interval for emitting the changes. */\n get debounce() {\n return this._debounce;\n }\n set debounce(value) {\n this._debounce = coerceNumberProperty(value);\n this._subscribe();\n }\n ngAfterContentInit() {\n if (!this._currentSubscription && !this.disabled) {\n this._subscribe();\n }\n }\n ngOnDestroy() {\n this._unsubscribe();\n }\n _subscribe() {\n this._unsubscribe();\n const stream = this._contentObserver.observe(this._elementRef);\n // TODO(mmalerba): We shouldn't be emitting on this @Output() outside the zone.\n // Consider brining it back inside the zone next time we're making breaking changes.\n // Bringing it back inside can cause things like infinite change detection loops and changed\n // after checked errors if people's code isn't handling it properly.\n this._ngZone.runOutsideAngular(() => {\n this._currentSubscription = (this.debounce ? stream.pipe(debounceTime(this.debounce)) : stream).subscribe(this.event);\n });\n }\n _unsubscribe() {\n var _a;\n (_a = this._currentSubscription) === null || _a === void 0 ? void 0 : _a.unsubscribe();\n }\n}\nCdkObserveContent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkObserveContent, deps: [{ token: ContentObserver }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkObserveContent.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkObserveContent, selector: \"[cdkObserveContent]\", inputs: { disabled: [\"cdkObserveContentDisabled\", \"disabled\"], debounce: \"debounce\" }, outputs: { event: \"cdkObserveContent\" }, exportAs: [\"cdkObserveContent\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkObserveContent, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkObserveContent]',\n exportAs: 'cdkObserveContent',\n }]\n }], ctorParameters: function () { return [{ type: ContentObserver }, { type: i0.ElementRef }, { type: i0.NgZone }]; }, propDecorators: { event: [{\n type: Output,\n args: ['cdkObserveContent']\n }], disabled: [{\n type: Input,\n args: ['cdkObserveContentDisabled']\n }], debounce: [{\n type: Input\n }] } });\nclass ObserversModule {\n}\nObserversModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ObserversModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nObserversModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ObserversModule, declarations: [CdkObserveContent], exports: [CdkObserveContent] });\nObserversModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ObserversModule, providers: [MutationObserverFactory] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ObserversModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkObserveContent],\n declarations: [CdkObserveContent],\n providers: [MutationObserverFactory],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkObserveContent, ContentObserver, MutationObserverFactory, ObserversModule };\n","import * as i1 from '@angular/cdk/scrolling';\nimport { ScrollingModule } from '@angular/cdk/scrolling';\nexport { CdkScrollable, ScrollDispatcher, ViewportRuler } from '@angular/cdk/scrolling';\nimport * as i6 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, ElementRef, ApplicationRef, InjectionToken, Directive, EventEmitter, Optional, Input, Output, NgModule } from '@angular/core';\nimport { coerceCssPixelValue, coerceArray, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i1$1 from '@angular/cdk/platform';\nimport { supportsScrollBehavior, _isTestEnvironment, _getEventTarget } from '@angular/cdk/platform';\nimport * as i5 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport { DomPortalOutlet, TemplatePortal, PortalModule } from '@angular/cdk/portal';\nimport { Subject, Subscription, merge } from 'rxjs';\nimport { take, takeUntil, takeWhile } from 'rxjs/operators';\nimport { ESCAPE, hasModifierKey } from '@angular/cdk/keycodes';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst scrollBehaviorSupported = supportsScrollBehavior();\n/**\n * Strategy that will prevent the user from scrolling while the overlay is visible.\n */\nclass BlockScrollStrategy {\n constructor(_viewportRuler, document) {\n this._viewportRuler = _viewportRuler;\n this._previousHTMLStyles = { top: '', left: '' };\n this._isEnabled = false;\n this._document = document;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach() { }\n /** Blocks page-level scroll while the attached overlay is open. */\n enable() {\n if (this._canBeEnabled()) {\n const root = this._document.documentElement;\n this._previousScrollPosition = this._viewportRuler.getViewportScrollPosition();\n // Cache the previous inline styles in case the user had set them.\n this._previousHTMLStyles.left = root.style.left || '';\n this._previousHTMLStyles.top = root.style.top || '';\n // Note: we're using the `html` node, instead of the `body`, because the `body` may\n // have the user agent margin, whereas the `html` is guaranteed not to have one.\n root.style.left = coerceCssPixelValue(-this._previousScrollPosition.left);\n root.style.top = coerceCssPixelValue(-this._previousScrollPosition.top);\n root.classList.add('cdk-global-scrollblock');\n this._isEnabled = true;\n }\n }\n /** Unblocks page-level scroll while the attached overlay is open. */\n disable() {\n if (this._isEnabled) {\n const html = this._document.documentElement;\n const body = this._document.body;\n const htmlStyle = html.style;\n const bodyStyle = body.style;\n const previousHtmlScrollBehavior = htmlStyle.scrollBehavior || '';\n const previousBodyScrollBehavior = bodyStyle.scrollBehavior || '';\n this._isEnabled = false;\n htmlStyle.left = this._previousHTMLStyles.left;\n htmlStyle.top = this._previousHTMLStyles.top;\n html.classList.remove('cdk-global-scrollblock');\n // Disable user-defined smooth scrolling temporarily while we restore the scroll position.\n // See https://developer.mozilla.org/en-US/docs/Web/CSS/scroll-behavior\n // Note that we don't mutate the property if the browser doesn't support `scroll-behavior`,\n // because it can throw off feature detections in `supportsScrollBehavior` which\n // checks for `'scrollBehavior' in documentElement.style`.\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = bodyStyle.scrollBehavior = 'auto';\n }\n window.scroll(this._previousScrollPosition.left, this._previousScrollPosition.top);\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = previousHtmlScrollBehavior;\n bodyStyle.scrollBehavior = previousBodyScrollBehavior;\n }\n }\n }\n _canBeEnabled() {\n // Since the scroll strategies can't be singletons, we have to use a global CSS class\n // (`cdk-global-scrollblock`) to make sure that we don't try to disable global\n // scrolling multiple times.\n const html = this._document.documentElement;\n if (html.classList.contains('cdk-global-scrollblock') || this._isEnabled) {\n return false;\n }\n const body = this._document.body;\n const viewport = this._viewportRuler.getViewportSize();\n return body.scrollHeight > viewport.height || body.scrollWidth > viewport.width;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an error to be thrown when attempting to attach an already-attached scroll strategy.\n */\nfunction getMatScrollStrategyAlreadyAttachedError() {\n return Error(`Scroll strategy has already been attached.`);\n}\n\n/**\n * Strategy that will close the overlay as soon as the user starts scrolling.\n */\nclass CloseScrollStrategy {\n constructor(_scrollDispatcher, _ngZone, _viewportRuler, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._config = _config;\n this._scrollSubscription = null;\n /** Detaches the overlay ref and disables the scroll strategy. */\n this._detach = () => {\n this.disable();\n if (this._overlayRef.hasAttached()) {\n this._ngZone.run(() => this._overlayRef.detach());\n }\n };\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables the closing of the attached overlay on scroll. */\n enable() {\n if (this._scrollSubscription) {\n return;\n }\n const stream = this._scrollDispatcher.scrolled(0);\n if (this._config && this._config.threshold && this._config.threshold > 1) {\n this._initialScrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n this._scrollSubscription = stream.subscribe(() => {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n if (Math.abs(scrollPosition - this._initialScrollPosition) > this._config.threshold) {\n this._detach();\n }\n else {\n this._overlayRef.updatePosition();\n }\n });\n }\n else {\n this._scrollSubscription = stream.subscribe(this._detach);\n }\n }\n /** Disables the closing the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Scroll strategy that doesn't do anything. */\nclass NoopScrollStrategy {\n /** Does nothing, as this scroll strategy is a no-op. */\n enable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n disable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n attach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Gets whether an element is scrolled outside of view by any of its parent scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is scrolled out of view\n * @docs-private\n */\nfunction isElementScrolledOutsideView(element, scrollContainers) {\n return scrollContainers.some(containerBounds => {\n const outsideAbove = element.bottom < containerBounds.top;\n const outsideBelow = element.top > containerBounds.bottom;\n const outsideLeft = element.right < containerBounds.left;\n const outsideRight = element.left > containerBounds.right;\n return outsideAbove || outsideBelow || outsideLeft || outsideRight;\n });\n}\n/**\n * Gets whether an element is clipped by any of its scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is clipped\n * @docs-private\n */\nfunction isElementClippedByScrolling(element, scrollContainers) {\n return scrollContainers.some(scrollContainerRect => {\n const clippedAbove = element.top < scrollContainerRect.top;\n const clippedBelow = element.bottom > scrollContainerRect.bottom;\n const clippedLeft = element.left < scrollContainerRect.left;\n const clippedRight = element.right > scrollContainerRect.right;\n return clippedAbove || clippedBelow || clippedLeft || clippedRight;\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Strategy that will update the element position as the user is scrolling.\n */\nclass RepositionScrollStrategy {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n this._config = _config;\n this._scrollSubscription = null;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables repositioning of the attached overlay on scroll. */\n enable() {\n if (!this._scrollSubscription) {\n const throttle = this._config ? this._config.scrollThrottle : 0;\n this._scrollSubscription = this._scrollDispatcher.scrolled(throttle).subscribe(() => {\n this._overlayRef.updatePosition();\n // TODO(crisbeto): make `close` on by default once all components can handle it.\n if (this._config && this._config.autoClose) {\n const overlayRect = this._overlayRef.overlayElement.getBoundingClientRect();\n const { width, height } = this._viewportRuler.getViewportSize();\n // TODO(crisbeto): include all ancestor scroll containers here once\n // we have a way of exposing the trigger element to the scroll strategy.\n const parentRects = [{ width, height, bottom: height, right: width, top: 0, left: 0 }];\n if (isElementScrolledOutsideView(overlayRect, parentRects)) {\n this.disable();\n this._ngZone.run(() => this._overlayRef.detach());\n }\n }\n });\n }\n }\n /** Disables repositioning of the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * Options for how an overlay will handle scrolling.\n *\n * Users can provide a custom value for `ScrollStrategyOptions` to replace the default\n * behaviors. This class primarily acts as a factory for ScrollStrategy instances.\n */\nclass ScrollStrategyOptions {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, document) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n /** Do nothing on scroll. */\n this.noop = () => new NoopScrollStrategy();\n /**\n * Close the overlay as soon as the user scrolls.\n * @param config Configuration to be used inside the scroll strategy.\n */\n this.close = (config) => new CloseScrollStrategy(this._scrollDispatcher, this._ngZone, this._viewportRuler, config);\n /** Block scrolling. */\n this.block = () => new BlockScrollStrategy(this._viewportRuler, this._document);\n /**\n * Update the overlay's position on scroll.\n * @param config Configuration to be used inside the scroll strategy.\n * Allows debouncing the reposition calls.\n */\n this.reposition = (config) => new RepositionScrollStrategy(this._scrollDispatcher, this._viewportRuler, this._ngZone, config);\n this._document = document;\n }\n}\nScrollStrategyOptions.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollStrategyOptions, deps: [{ token: i1.ScrollDispatcher }, { token: i1.ViewportRuler }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollStrategyOptions.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollStrategyOptions, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollStrategyOptions, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: i1.ScrollDispatcher }, { type: i1.ViewportRuler }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Initial configuration used when creating an overlay. */\nclass OverlayConfig {\n constructor(config) {\n /** Strategy to be used when handling scroll events while the overlay is open. */\n this.scrollStrategy = new NoopScrollStrategy();\n /** Custom class to add to the overlay pane. */\n this.panelClass = '';\n /** Whether the overlay has a backdrop. */\n this.hasBackdrop = false;\n /** Custom class to add to the backdrop */\n this.backdropClass = 'cdk-overlay-dark-backdrop';\n /**\n * Whether the overlay should be disposed of when the user goes backwards/forwards in history.\n * Note that this usually doesn't include clicking on links (unless the user is using\n * the `HashLocationStrategy`).\n */\n this.disposeOnNavigation = false;\n if (config) {\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n const configKeys = Object.keys(config);\n for (const key of configKeys) {\n if (config[key] !== undefined) {\n // TypeScript, as of version 3.5, sees the left-hand-side of this expression\n // as \"I don't know *which* key this is, so the only valid value is the intersection\n // of all the posible values.\" In this case, that happens to be `undefined`. TypeScript\n // is not smart enough to see that the right-hand-side is actually an access of the same\n // exact type with the same exact key, meaning that the value type must be identical.\n // So we use `any` to work around this.\n this[key] = config[key];\n }\n }\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The points of the origin element and the overlay element to connect. */\nclass ConnectionPositionPair {\n constructor(origin, overlay, \n /** Offset along the X axis. */\n offsetX, \n /** Offset along the Y axis. */\n offsetY, \n /** Class(es) to be applied to the panel while this position is active. */\n panelClass) {\n this.offsetX = offsetX;\n this.offsetY = offsetY;\n this.panelClass = panelClass;\n this.originX = origin.originX;\n this.originY = origin.originY;\n this.overlayX = overlay.overlayX;\n this.overlayY = overlay.overlayY;\n }\n}\n/**\n * Set of properties regarding the position of the origin and overlay relative to the viewport\n * with respect to the containing Scrollable elements.\n *\n * The overlay and origin are clipped if any part of their bounding client rectangle exceeds the\n * bounds of any one of the strategy's Scrollable's bounding client rectangle.\n *\n * The overlay and origin are outside view if there is no overlap between their bounding client\n * rectangle and any one of the strategy's Scrollable's bounding client rectangle.\n *\n * ----------- -----------\n * | outside | | clipped |\n * | view | --------------------------\n * | | | | | |\n * ---------- | ----------- |\n * -------------------------- | |\n * | | | Scrollable |\n * | | | |\n * | | --------------------------\n * | Scrollable |\n * | |\n * --------------------------\n *\n * @docs-private\n */\nclass ScrollingVisibility {\n}\n/** The change event emitted by the strategy when a fallback position is used. */\nclass ConnectedOverlayPositionChange {\n constructor(\n /** The position used as a result of this change. */\n connectionPair, \n /** @docs-private */\n scrollableViewProperties) {\n this.connectionPair = connectionPair;\n this.scrollableViewProperties = scrollableViewProperties;\n }\n}\n/**\n * Validates whether a vertical position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateVerticalPosition(property, value) {\n if (value !== 'top' && value !== 'bottom' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"top\", \"bottom\" or \"center\".`);\n }\n}\n/**\n * Validates whether a horizontal position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateHorizontalPosition(property, value) {\n if (value !== 'start' && value !== 'end' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"start\", \"end\" or \"center\".`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Reference to an overlay that has been created with the Overlay service.\n * Used to manipulate or dispose of said overlay.\n */\nclass OverlayRef {\n constructor(_portalOutlet, _host, _pane, _config, _ngZone, _keyboardDispatcher, _document, _location, _outsideClickDispatcher) {\n this._portalOutlet = _portalOutlet;\n this._host = _host;\n this._pane = _pane;\n this._config = _config;\n this._ngZone = _ngZone;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._document = _document;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._backdropElement = null;\n this._backdropClick = new Subject();\n this._attachments = new Subject();\n this._detachments = new Subject();\n this._locationChanges = Subscription.EMPTY;\n this._backdropClickHandler = (event) => this._backdropClick.next(event);\n /** Stream of keydown events dispatched to this overlay. */\n this._keydownEvents = new Subject();\n /** Stream of mouse outside events dispatched to this overlay. */\n this._outsidePointerEvents = new Subject();\n if (_config.scrollStrategy) {\n this._scrollStrategy = _config.scrollStrategy;\n this._scrollStrategy.attach(this);\n }\n this._positionStrategy = _config.positionStrategy;\n }\n /** The overlay's HTML element */\n get overlayElement() {\n return this._pane;\n }\n /** The overlay's backdrop HTML element. */\n get backdropElement() {\n return this._backdropElement;\n }\n /**\n * Wrapper around the panel element. Can be used for advanced\n * positioning where a wrapper with specific styling is\n * required around the overlay pane.\n */\n get hostElement() {\n return this._host;\n }\n /**\n * Attaches content, given via a Portal, to the overlay.\n * If the overlay is configured to have a backdrop, it will be created.\n *\n * @param portal Portal instance to which to attach the overlay.\n * @returns The portal attachment result.\n */\n attach(portal) {\n let attachResult = this._portalOutlet.attach(portal);\n // Update the pane element with the given configuration.\n if (!this._host.parentElement && this._previousHostParent) {\n this._previousHostParent.appendChild(this._host);\n }\n if (this._positionStrategy) {\n this._positionStrategy.attach(this);\n }\n this._updateStackingOrder();\n this._updateElementSize();\n this._updateElementDirection();\n if (this._scrollStrategy) {\n this._scrollStrategy.enable();\n }\n // Update the position once the zone is stable so that the overlay will be fully rendered\n // before attempting to position it, as the position may depend on the size of the rendered\n // content.\n this._ngZone.onStable.pipe(take(1)).subscribe(() => {\n // The overlay could've been detached before the zone has stabilized.\n if (this.hasAttached()) {\n this.updatePosition();\n }\n });\n // Enable pointer events for the overlay pane element.\n this._togglePointerEvents(true);\n if (this._config.hasBackdrop) {\n this._attachBackdrop();\n }\n if (this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, true);\n }\n // Only emit the `attachments` event once all other setup is done.\n this._attachments.next();\n // Track this overlay by the keyboard dispatcher\n this._keyboardDispatcher.add(this);\n if (this._config.disposeOnNavigation) {\n this._locationChanges = this._location.subscribe(() => this.dispose());\n }\n this._outsideClickDispatcher.add(this);\n return attachResult;\n }\n /**\n * Detaches an overlay from a portal.\n * @returns The portal detachment result.\n */\n detach() {\n if (!this.hasAttached()) {\n return;\n }\n this.detachBackdrop();\n // When the overlay is detached, the pane element should disable pointer events.\n // This is necessary because otherwise the pane element will cover the page and disable\n // pointer events therefore. Depends on the position strategy and the applied pane boundaries.\n this._togglePointerEvents(false);\n if (this._positionStrategy && this._positionStrategy.detach) {\n this._positionStrategy.detach();\n }\n if (this._scrollStrategy) {\n this._scrollStrategy.disable();\n }\n const detachmentResult = this._portalOutlet.detach();\n // Only emit after everything is detached.\n this._detachments.next();\n // Remove this overlay from keyboard dispatcher tracking.\n this._keyboardDispatcher.remove(this);\n // Keeping the host element in the DOM can cause scroll jank, because it still gets\n // rendered, even though it's transparent and unclickable which is why we remove it.\n this._detachContentWhenStable();\n this._locationChanges.unsubscribe();\n this._outsideClickDispatcher.remove(this);\n return detachmentResult;\n }\n /** Cleans up the overlay from the DOM. */\n dispose() {\n var _a;\n const isAttached = this.hasAttached();\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._disposeScrollStrategy();\n this._disposeBackdrop(this._backdropElement);\n this._locationChanges.unsubscribe();\n this._keyboardDispatcher.remove(this);\n this._portalOutlet.dispose();\n this._attachments.complete();\n this._backdropClick.complete();\n this._keydownEvents.complete();\n this._outsidePointerEvents.complete();\n this._outsideClickDispatcher.remove(this);\n (_a = this._host) === null || _a === void 0 ? void 0 : _a.remove();\n this._previousHostParent = this._pane = this._host = null;\n if (isAttached) {\n this._detachments.next();\n }\n this._detachments.complete();\n }\n /** Whether the overlay has attached content. */\n hasAttached() {\n return this._portalOutlet.hasAttached();\n }\n /** Gets an observable that emits when the backdrop has been clicked. */\n backdropClick() {\n return this._backdropClick;\n }\n /** Gets an observable that emits when the overlay has been attached. */\n attachments() {\n return this._attachments;\n }\n /** Gets an observable that emits when the overlay has been detached. */\n detachments() {\n return this._detachments;\n }\n /** Gets an observable of keydown events targeted to this overlay. */\n keydownEvents() {\n return this._keydownEvents;\n }\n /** Gets an observable of pointer events targeted outside this overlay. */\n outsidePointerEvents() {\n return this._outsidePointerEvents;\n }\n /** Gets the current overlay configuration, which is immutable. */\n getConfig() {\n return this._config;\n }\n /** Updates the position of the overlay based on the position strategy. */\n updatePosition() {\n if (this._positionStrategy) {\n this._positionStrategy.apply();\n }\n }\n /** Switches to a new position strategy and updates the overlay position. */\n updatePositionStrategy(strategy) {\n if (strategy === this._positionStrategy) {\n return;\n }\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._positionStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n this.updatePosition();\n }\n }\n /** Update the size properties of the overlay. */\n updateSize(sizeConfig) {\n this._config = Object.assign(Object.assign({}, this._config), sizeConfig);\n this._updateElementSize();\n }\n /** Sets the LTR/RTL direction for the overlay. */\n setDirection(dir) {\n this._config = Object.assign(Object.assign({}, this._config), { direction: dir });\n this._updateElementDirection();\n }\n /** Add a CSS class or an array of classes to the overlay pane. */\n addPanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, true);\n }\n }\n /** Remove a CSS class or an array of classes from the overlay pane. */\n removePanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, false);\n }\n }\n /**\n * Returns the layout direction of the overlay panel.\n */\n getDirection() {\n const direction = this._config.direction;\n if (!direction) {\n return 'ltr';\n }\n return typeof direction === 'string' ? direction : direction.value;\n }\n /** Switches to a new scroll strategy. */\n updateScrollStrategy(strategy) {\n if (strategy === this._scrollStrategy) {\n return;\n }\n this._disposeScrollStrategy();\n this._scrollStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n strategy.enable();\n }\n }\n /** Updates the text direction of the overlay panel. */\n _updateElementDirection() {\n this._host.setAttribute('dir', this.getDirection());\n }\n /** Updates the size of the overlay element based on the overlay config. */\n _updateElementSize() {\n if (!this._pane) {\n return;\n }\n const style = this._pane.style;\n style.width = coerceCssPixelValue(this._config.width);\n style.height = coerceCssPixelValue(this._config.height);\n style.minWidth = coerceCssPixelValue(this._config.minWidth);\n style.minHeight = coerceCssPixelValue(this._config.minHeight);\n style.maxWidth = coerceCssPixelValue(this._config.maxWidth);\n style.maxHeight = coerceCssPixelValue(this._config.maxHeight);\n }\n /** Toggles the pointer events for the overlay pane element. */\n _togglePointerEvents(enablePointer) {\n this._pane.style.pointerEvents = enablePointer ? '' : 'none';\n }\n /** Attaches a backdrop for this overlay. */\n _attachBackdrop() {\n const showingClass = 'cdk-overlay-backdrop-showing';\n this._backdropElement = this._document.createElement('div');\n this._backdropElement.classList.add('cdk-overlay-backdrop');\n if (this._config.backdropClass) {\n this._toggleClasses(this._backdropElement, this._config.backdropClass, true);\n }\n // Insert the backdrop before the pane in the DOM order,\n // in order to handle stacked overlays properly.\n this._host.parentElement.insertBefore(this._backdropElement, this._host);\n // Forward backdrop clicks such that the consumer of the overlay can perform whatever\n // action desired when such a click occurs (usually closing the overlay).\n this._backdropElement.addEventListener('click', this._backdropClickHandler);\n // Add class to fade-in the backdrop after one frame.\n if (typeof requestAnimationFrame !== 'undefined') {\n this._ngZone.runOutsideAngular(() => {\n requestAnimationFrame(() => {\n if (this._backdropElement) {\n this._backdropElement.classList.add(showingClass);\n }\n });\n });\n }\n else {\n this._backdropElement.classList.add(showingClass);\n }\n }\n /**\n * Updates the stacking order of the element, moving it to the top if necessary.\n * This is required in cases where one overlay was detached, while another one,\n * that should be behind it, was destroyed. The next time both of them are opened,\n * the stacking will be wrong, because the detached element's pane will still be\n * in its original DOM position.\n */\n _updateStackingOrder() {\n if (this._host.nextSibling) {\n this._host.parentNode.appendChild(this._host);\n }\n }\n /** Detaches the backdrop (if any) associated with the overlay. */\n detachBackdrop() {\n const backdropToDetach = this._backdropElement;\n if (!backdropToDetach) {\n return;\n }\n let timeoutId;\n const finishDetach = () => {\n // It may not be attached to anything in certain cases (e.g. unit tests).\n if (backdropToDetach) {\n backdropToDetach.removeEventListener('click', this._backdropClickHandler);\n backdropToDetach.removeEventListener('transitionend', finishDetach);\n this._disposeBackdrop(backdropToDetach);\n }\n if (this._config.backdropClass) {\n this._toggleClasses(backdropToDetach, this._config.backdropClass, false);\n }\n clearTimeout(timeoutId);\n };\n backdropToDetach.classList.remove('cdk-overlay-backdrop-showing');\n this._ngZone.runOutsideAngular(() => {\n backdropToDetach.addEventListener('transitionend', finishDetach);\n });\n // If the backdrop doesn't have a transition, the `transitionend` event won't fire.\n // In this case we make it unclickable and we try to remove it after a delay.\n backdropToDetach.style.pointerEvents = 'none';\n // Run this outside the Angular zone because there's nothing that Angular cares about.\n // If it were to run inside the Angular zone, every test that used Overlay would have to be\n // either async or fakeAsync.\n timeoutId = this._ngZone.runOutsideAngular(() => setTimeout(finishDetach, 500));\n }\n /** Toggles a single CSS class or an array of classes on an element. */\n _toggleClasses(element, cssClasses, isAdd) {\n const classes = coerceArray(cssClasses || []).filter(c => !!c);\n if (classes.length) {\n isAdd ? element.classList.add(...classes) : element.classList.remove(...classes);\n }\n }\n /** Detaches the overlay content next time the zone stabilizes. */\n _detachContentWhenStable() {\n // Normally we wouldn't have to explicitly run this outside the `NgZone`, however\n // if the consumer is using `zone-patch-rxjs`, the `Subscription.unsubscribe` call will\n // be patched to run inside the zone, which will throw us into an infinite loop.\n this._ngZone.runOutsideAngular(() => {\n // We can't remove the host here immediately, because the overlay pane's content\n // might still be animating. This stream helps us avoid interrupting the animation\n // by waiting for the pane to become empty.\n const subscription = this._ngZone.onStable\n .pipe(takeUntil(merge(this._attachments, this._detachments)))\n .subscribe(() => {\n // Needs a couple of checks for the pane and host, because\n // they may have been removed by the time the zone stabilizes.\n if (!this._pane || !this._host || this._pane.children.length === 0) {\n if (this._pane && this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, false);\n }\n if (this._host && this._host.parentElement) {\n this._previousHostParent = this._host.parentElement;\n this._host.remove();\n }\n subscription.unsubscribe();\n }\n });\n });\n }\n /** Disposes of a scroll strategy. */\n _disposeScrollStrategy() {\n const scrollStrategy = this._scrollStrategy;\n if (scrollStrategy) {\n scrollStrategy.disable();\n if (scrollStrategy.detach) {\n scrollStrategy.detach();\n }\n }\n }\n /** Removes a backdrop element from the DOM. */\n _disposeBackdrop(backdrop) {\n if (backdrop) {\n backdrop.remove();\n // It is possible that a new portal has been attached to this overlay since we started\n // removing the backdrop. If that is the case, only clear the backdrop reference if it\n // is still the same instance that we started to remove.\n if (this._backdropElement === backdrop) {\n this._backdropElement = null;\n }\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Container inside which all overlays will render. */\nclass OverlayContainer {\n constructor(document, _platform) {\n this._platform = _platform;\n this._document = document;\n }\n ngOnDestroy() {\n var _a;\n (_a = this._containerElement) === null || _a === void 0 ? void 0 : _a.remove();\n }\n /**\n * This method returns the overlay container element. It will lazily\n * create the element the first time it is called to facilitate using\n * the container in non-browser environments.\n * @returns the container element\n */\n getContainerElement() {\n if (!this._containerElement) {\n this._createContainer();\n }\n return this._containerElement;\n }\n /**\n * Create the overlay container element, which is simply a div\n * with the 'cdk-overlay-container' class on the document body.\n */\n _createContainer() {\n const containerClass = 'cdk-overlay-container';\n // TODO(crisbeto): remove the testing check once we have an overlay testing\n // module or Angular starts tearing down the testing `NgModule`. See:\n // https://github.com/angular/angular/issues/18831\n if (this._platform.isBrowser || _isTestEnvironment()) {\n const oppositePlatformContainers = this._document.querySelectorAll(`.${containerClass}[platform=\"server\"], ` + `.${containerClass}[platform=\"test\"]`);\n // Remove any old containers from the opposite platform.\n // This can happen when transitioning from the server to the client.\n for (let i = 0; i < oppositePlatformContainers.length; i++) {\n oppositePlatformContainers[i].remove();\n }\n }\n const container = this._document.createElement('div');\n container.classList.add(containerClass);\n // A long time ago we kept adding new overlay containers whenever a new app was instantiated,\n // but at some point we added logic which clears the duplicate ones in order to avoid leaks.\n // The new logic was a little too aggressive since it was breaking some legitimate use cases.\n // To mitigate the problem we made it so that only containers from a different platform are\n // cleared, but the side-effect was that people started depending on the overly-aggressive\n // logic to clean up their tests for them. Until we can introduce an overlay-specific testing\n // module which does the cleanup, we try to detect that we're in a test environment and we\n // always clear the container. See #17006.\n // TODO(crisbeto): remove the test environment check once we have an overlay testing module.\n if (_isTestEnvironment()) {\n container.setAttribute('platform', 'test');\n }\n else if (!this._platform.isBrowser) {\n container.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(container);\n this._containerElement = container;\n }\n}\nOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO: refactor clipping detection into a separate thing (part of scrolling module)\n// TODO: doesn't handle both flexible width and height when it has to scroll along both axis.\n/** Class to be added to the overlay bounding box. */\nconst boundingBoxClass = 'cdk-overlay-connected-position-bounding-box';\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * implicit position relative some origin element. The relative position is defined in terms of\n * a point on the origin element that is connected to a point on the overlay element. For example,\n * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner\n * of the overlay.\n */\nclass FlexibleConnectedPositionStrategy {\n constructor(connectedTo, _viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n /** Last size used for the bounding box. Used to avoid resizing the overlay after open. */\n this._lastBoundingBoxSize = { width: 0, height: 0 };\n /** Whether the overlay was pushed in a previous positioning. */\n this._isPushed = false;\n /** Whether the overlay can be pushed on-screen on the initial open. */\n this._canPush = true;\n /** Whether the overlay can grow via flexible width/height after the initial open. */\n this._growAfterOpen = false;\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n this._hasFlexibleDimensions = true;\n /** Whether the overlay position is locked. */\n this._positionLocked = false;\n /** Amount of space that must be maintained between the overlay and the edge of the viewport. */\n this._viewportMargin = 0;\n /** The Scrollable containers used to check scrollable view properties on position change. */\n this._scrollables = [];\n /** Ordered list of preferred positions, from most to least desirable. */\n this._preferredPositions = [];\n /** Subject that emits whenever the position changes. */\n this._positionChanges = new Subject();\n /** Subscription to viewport size changes. */\n this._resizeSubscription = Subscription.EMPTY;\n /** Default offset for the overlay along the x axis. */\n this._offsetX = 0;\n /** Default offset for the overlay along the y axis. */\n this._offsetY = 0;\n /** Keeps track of the CSS classes that the position strategy has applied on the overlay panel. */\n this._appliedPanelClasses = [];\n /** Observable sequence of position changes. */\n this.positionChanges = this._positionChanges;\n this.setOrigin(connectedTo);\n }\n /** Ordered list of preferred positions, from most to least desirable. */\n get positions() {\n return this._preferredPositions;\n }\n /** Attaches this position strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef &&\n overlayRef !== this._overlayRef &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('This position strategy is already attached to an overlay');\n }\n this._validatePositions();\n overlayRef.hostElement.classList.add(boundingBoxClass);\n this._overlayRef = overlayRef;\n this._boundingBox = overlayRef.hostElement;\n this._pane = overlayRef.overlayElement;\n this._isDisposed = false;\n this._isInitialRender = true;\n this._lastPosition = null;\n this._resizeSubscription.unsubscribe();\n this._resizeSubscription = this._viewportRuler.change().subscribe(() => {\n // When the window is resized, we want to trigger the next reposition as if it\n // was an initial render, in order for the strategy to pick a new optimal position,\n // otherwise position locking will cause it to stay at the old one.\n this._isInitialRender = true;\n this.apply();\n });\n }\n /**\n * Updates the position of the overlay element, using whichever preferred position relative\n * to the origin best fits on-screen.\n *\n * The selection of a position goes as follows:\n * - If any positions fit completely within the viewport as-is,\n * choose the first position that does so.\n * - If flexible dimensions are enabled and at least one satifies the given minimum width/height,\n * choose the position with the greatest available size modified by the positions' weight.\n * - If pushing is enabled, take the position that went off-screen the least and push it\n * on-screen.\n * - If none of the previous criteria were met, use the position that goes off-screen the least.\n * @docs-private\n */\n apply() {\n // We shouldn't do anything if the strategy was disposed or we're on the server.\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n // If the position has been applied already (e.g. when the overlay was opened) and the\n // consumer opted into locking in the position, re-use the old position, in order to\n // prevent the overlay from jumping around.\n if (!this._isInitialRender && this._positionLocked && this._lastPosition) {\n this.reapplyLastPosition();\n return;\n }\n this._clearPanelClasses();\n this._resetOverlayElementStyles();\n this._resetBoundingBoxStyles();\n // We need the bounding rects for the origin, the overlay and the container to determine how to position\n // the overlay relative to the origin.\n // We use the viewport rect to determine whether a position would go off-screen.\n this._viewportRect = this._getNarrowedViewportRect();\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originRect = this._originRect;\n const overlayRect = this._overlayRect;\n const viewportRect = this._viewportRect;\n const containerRect = this._containerRect;\n // Positions where the overlay will fit with flexible dimensions.\n const flexibleFits = [];\n // Fallback if none of the preferred positions fit within the viewport.\n let fallback;\n // Go through each of the preferred positions looking for a good fit.\n // If a good fit is found, it will be applied immediately.\n for (let pos of this._preferredPositions) {\n // Get the exact (x, y) coordinate for the point-of-origin on the origin element.\n let originPoint = this._getOriginPoint(originRect, containerRect, pos);\n // From that point-of-origin, get the exact (x, y) coordinate for the top-left corner of the\n // overlay in this position. We use the top-left corner for calculations and later translate\n // this into an appropriate (top, left, bottom, right) style.\n let overlayPoint = this._getOverlayPoint(originPoint, overlayRect, pos);\n // Calculate how well the overlay would fit into the viewport with this point.\n let overlayFit = this._getOverlayFit(overlayPoint, overlayRect, viewportRect, pos);\n // If the overlay, without any further work, fits into the viewport, use this position.\n if (overlayFit.isCompletelyWithinViewport) {\n this._isPushed = false;\n this._applyPosition(pos, originPoint);\n return;\n }\n // If the overlay has flexible dimensions, we can use this position\n // so long as there's enough space for the minimum dimensions.\n if (this._canFitWithFlexibleDimensions(overlayFit, overlayPoint, viewportRect)) {\n // Save positions where the overlay will fit with flexible dimensions. We will use these\n // if none of the positions fit *without* flexible dimensions.\n flexibleFits.push({\n position: pos,\n origin: originPoint,\n overlayRect,\n boundingBoxRect: this._calculateBoundingBoxRect(originPoint, pos),\n });\n continue;\n }\n // If the current preferred position does not fit on the screen, remember the position\n // if it has more visible area on-screen than we've seen and move onto the next preferred\n // position.\n if (!fallback || fallback.overlayFit.visibleArea < overlayFit.visibleArea) {\n fallback = { overlayFit, overlayPoint, originPoint, position: pos, overlayRect };\n }\n }\n // If there are any positions where the overlay would fit with flexible dimensions, choose the\n // one that has the greatest area available modified by the position's weight\n if (flexibleFits.length) {\n let bestFit = null;\n let bestScore = -1;\n for (const fit of flexibleFits) {\n const score = fit.boundingBoxRect.width * fit.boundingBoxRect.height * (fit.position.weight || 1);\n if (score > bestScore) {\n bestScore = score;\n bestFit = fit;\n }\n }\n this._isPushed = false;\n this._applyPosition(bestFit.position, bestFit.origin);\n return;\n }\n // When none of the preferred positions fit within the viewport, take the position\n // that went off-screen the least and attempt to push it on-screen.\n if (this._canPush) {\n // TODO(jelbourn): after pushing, the opening \"direction\" of the overlay might not make sense.\n this._isPushed = true;\n this._applyPosition(fallback.position, fallback.originPoint);\n return;\n }\n // All options for getting the overlay within the viewport have been exhausted, so go with the\n // position that went off-screen the least.\n this._applyPosition(fallback.position, fallback.originPoint);\n }\n detach() {\n this._clearPanelClasses();\n this._lastPosition = null;\n this._previousPushAmount = null;\n this._resizeSubscription.unsubscribe();\n }\n /** Cleanup after the element gets destroyed. */\n dispose() {\n if (this._isDisposed) {\n return;\n }\n // We can't use `_resetBoundingBoxStyles` here, because it resets\n // some properties to zero, rather than removing them.\n if (this._boundingBox) {\n extendStyles(this._boundingBox.style, {\n top: '',\n left: '',\n right: '',\n bottom: '',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n if (this._pane) {\n this._resetOverlayElementStyles();\n }\n if (this._overlayRef) {\n this._overlayRef.hostElement.classList.remove(boundingBoxClass);\n }\n this.detach();\n this._positionChanges.complete();\n this._overlayRef = this._boundingBox = null;\n this._isDisposed = true;\n }\n /**\n * This re-aligns the overlay element with the trigger in its last calculated position,\n * even if a position higher in the \"preferred positions\" list would now fit. This\n * allows one to re-align the panel without changing the orientation of the panel.\n */\n reapplyLastPosition() {\n if (!this._isDisposed && (!this._platform || this._platform.isBrowser)) {\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._viewportRect = this._getNarrowedViewportRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const lastPosition = this._lastPosition || this._preferredPositions[0];\n const originPoint = this._getOriginPoint(this._originRect, this._containerRect, lastPosition);\n this._applyPosition(lastPosition, originPoint);\n }\n }\n /**\n * Sets the list of Scrollable containers that host the origin element so that\n * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every\n * Scrollable must be an ancestor element of the strategy's origin element.\n */\n withScrollableContainers(scrollables) {\n this._scrollables = scrollables;\n return this;\n }\n /**\n * Adds new preferred positions.\n * @param positions List of positions options for this overlay.\n */\n withPositions(positions) {\n this._preferredPositions = positions;\n // If the last calculated position object isn't part of the positions anymore, clear\n // it in order to avoid it being picked up if the consumer tries to re-apply.\n if (positions.indexOf(this._lastPosition) === -1) {\n this._lastPosition = null;\n }\n this._validatePositions();\n return this;\n }\n /**\n * Sets a minimum distance the overlay may be positioned to the edge of the viewport.\n * @param margin Required margin between the overlay and the viewport edge in pixels.\n */\n withViewportMargin(margin) {\n this._viewportMargin = margin;\n return this;\n }\n /** Sets whether the overlay's width and height can be constrained to fit within the viewport. */\n withFlexibleDimensions(flexibleDimensions = true) {\n this._hasFlexibleDimensions = flexibleDimensions;\n return this;\n }\n /** Sets whether the overlay can grow after the initial open via flexible width/height. */\n withGrowAfterOpen(growAfterOpen = true) {\n this._growAfterOpen = growAfterOpen;\n return this;\n }\n /** Sets whether the overlay can be pushed on-screen if none of the provided positions fit. */\n withPush(canPush = true) {\n this._canPush = canPush;\n return this;\n }\n /**\n * Sets whether the overlay's position should be locked in after it is positioned\n * initially. When an overlay is locked in, it won't attempt to reposition itself\n * when the position is re-applied (e.g. when the user scrolls away).\n * @param isLocked Whether the overlay should locked in.\n */\n withLockedPosition(isLocked = true) {\n this._positionLocked = isLocked;\n return this;\n }\n /**\n * Sets the origin, relative to which to position the overlay.\n * Using an element origin is useful for building components that need to be positioned\n * relatively to a trigger (e.g. dropdown menus or tooltips), whereas using a point can be\n * used for cases like contextual menus which open relative to the user's pointer.\n * @param origin Reference to the new origin.\n */\n setOrigin(origin) {\n this._origin = origin;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the x-axis.\n * @param offset New offset in the X axis.\n */\n withDefaultOffsetX(offset) {\n this._offsetX = offset;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the y-axis.\n * @param offset New offset in the Y axis.\n */\n withDefaultOffsetY(offset) {\n this._offsetY = offset;\n return this;\n }\n /**\n * Configures that the position strategy should set a `transform-origin` on some elements\n * inside the overlay, depending on the current position that is being applied. This is\n * useful for the cases where the origin of an animation can change depending on the\n * alignment of the overlay.\n * @param selector CSS selector that will be used to find the target\n * elements onto which to set the transform origin.\n */\n withTransformOriginOn(selector) {\n this._transformOriginSelector = selector;\n return this;\n }\n /**\n * Gets the (x, y) coordinate of a connection point on the origin based on a relative position.\n */\n _getOriginPoint(originRect, containerRect, pos) {\n let x;\n if (pos.originX == 'center') {\n // Note: when centering we should always use the `left`\n // offset, otherwise the position will be wrong in RTL.\n x = originRect.left + originRect.width / 2;\n }\n else {\n const startX = this._isRtl() ? originRect.right : originRect.left;\n const endX = this._isRtl() ? originRect.left : originRect.right;\n x = pos.originX == 'start' ? startX : endX;\n }\n // When zooming in Safari the container rectangle contains negative values for the position\n // and we need to re-add them to the calculated coordinates.\n if (containerRect.left < 0) {\n x -= containerRect.left;\n }\n let y;\n if (pos.originY == 'center') {\n y = originRect.top + originRect.height / 2;\n }\n else {\n y = pos.originY == 'top' ? originRect.top : originRect.bottom;\n }\n // Normally the containerRect's top value would be zero, however when the overlay is attached to an input\n // (e.g. in an autocomplete), mobile browsers will shift everything in order to put the input in the middle\n // of the screen and to make space for the virtual keyboard. We need to account for this offset,\n // otherwise our positioning will be thrown off.\n // Additionally, when zooming in Safari this fixes the vertical position.\n if (containerRect.top < 0) {\n y -= containerRect.top;\n }\n return { x, y };\n }\n /**\n * Gets the (x, y) coordinate of the top-left corner of the overlay given a given position and\n * origin point to which the overlay should be connected.\n */\n _getOverlayPoint(originPoint, overlayRect, pos) {\n // Calculate the (overlayStartX, overlayStartY), the start of the\n // potential overlay position relative to the origin point.\n let overlayStartX;\n if (pos.overlayX == 'center') {\n overlayStartX = -overlayRect.width / 2;\n }\n else if (pos.overlayX === 'start') {\n overlayStartX = this._isRtl() ? -overlayRect.width : 0;\n }\n else {\n overlayStartX = this._isRtl() ? 0 : -overlayRect.width;\n }\n let overlayStartY;\n if (pos.overlayY == 'center') {\n overlayStartY = -overlayRect.height / 2;\n }\n else {\n overlayStartY = pos.overlayY == 'top' ? 0 : -overlayRect.height;\n }\n // The (x, y) coordinates of the overlay.\n return {\n x: originPoint.x + overlayStartX,\n y: originPoint.y + overlayStartY,\n };\n }\n /** Gets how well an overlay at the given point will fit within the viewport. */\n _getOverlayFit(point, rawOverlayRect, viewport, position) {\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n let { x, y } = point;\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n // Account for the offsets since they could push the overlay out of the viewport.\n if (offsetX) {\n x += offsetX;\n }\n if (offsetY) {\n y += offsetY;\n }\n // How much the overlay would overflow at this position, on each side.\n let leftOverflow = 0 - x;\n let rightOverflow = x + overlay.width - viewport.width;\n let topOverflow = 0 - y;\n let bottomOverflow = y + overlay.height - viewport.height;\n // Visible parts of the element on each axis.\n let visibleWidth = this._subtractOverflows(overlay.width, leftOverflow, rightOverflow);\n let visibleHeight = this._subtractOverflows(overlay.height, topOverflow, bottomOverflow);\n let visibleArea = visibleWidth * visibleHeight;\n return {\n visibleArea,\n isCompletelyWithinViewport: overlay.width * overlay.height === visibleArea,\n fitsInViewportVertically: visibleHeight === overlay.height,\n fitsInViewportHorizontally: visibleWidth == overlay.width,\n };\n }\n /**\n * Whether the overlay can fit within the viewport when it may resize either its width or height.\n * @param fit How well the overlay fits in the viewport at some position.\n * @param point The (x, y) coordinates of the overlay at some position.\n * @param viewport The geometry of the viewport.\n */\n _canFitWithFlexibleDimensions(fit, point, viewport) {\n if (this._hasFlexibleDimensions) {\n const availableHeight = viewport.bottom - point.y;\n const availableWidth = viewport.right - point.x;\n const minHeight = getPixelValue(this._overlayRef.getConfig().minHeight);\n const minWidth = getPixelValue(this._overlayRef.getConfig().minWidth);\n const verticalFit = fit.fitsInViewportVertically || (minHeight != null && minHeight <= availableHeight);\n const horizontalFit = fit.fitsInViewportHorizontally || (minWidth != null && minWidth <= availableWidth);\n return verticalFit && horizontalFit;\n }\n return false;\n }\n /**\n * Gets the point at which the overlay can be \"pushed\" on-screen. If the overlay is larger than\n * the viewport, the top-left corner will be pushed on-screen (with overflow occuring on the\n * right and bottom).\n *\n * @param start Starting point from which the overlay is pushed.\n * @param rawOverlayRect Dimensions of the overlay.\n * @param scrollPosition Current viewport scroll position.\n * @returns The point at which to position the overlay after pushing. This is effectively a new\n * originPoint.\n */\n _pushOverlayOnScreen(start, rawOverlayRect, scrollPosition) {\n // If the position is locked and we've pushed the overlay already, reuse the previous push\n // amount, rather than pushing it again. If we were to continue pushing, the element would\n // remain in the viewport, which goes against the expectations when position locking is enabled.\n if (this._previousPushAmount && this._positionLocked) {\n return {\n x: start.x + this._previousPushAmount.x,\n y: start.y + this._previousPushAmount.y,\n };\n }\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n const viewport = this._viewportRect;\n // Determine how much the overlay goes outside the viewport on each\n // side, which we'll use to decide which direction to push it.\n const overflowRight = Math.max(start.x + overlay.width - viewport.width, 0);\n const overflowBottom = Math.max(start.y + overlay.height - viewport.height, 0);\n const overflowTop = Math.max(viewport.top - scrollPosition.top - start.y, 0);\n const overflowLeft = Math.max(viewport.left - scrollPosition.left - start.x, 0);\n // Amount by which to push the overlay in each axis such that it remains on-screen.\n let pushX = 0;\n let pushY = 0;\n // If the overlay fits completely within the bounds of the viewport, push it from whichever\n // direction is goes off-screen. Otherwise, push the top-left corner such that its in the\n // viewport and allow for the trailing end of the overlay to go out of bounds.\n if (overlay.width <= viewport.width) {\n pushX = overflowLeft || -overflowRight;\n }\n else {\n pushX = start.x < this._viewportMargin ? viewport.left - scrollPosition.left - start.x : 0;\n }\n if (overlay.height <= viewport.height) {\n pushY = overflowTop || -overflowBottom;\n }\n else {\n pushY = start.y < this._viewportMargin ? viewport.top - scrollPosition.top - start.y : 0;\n }\n this._previousPushAmount = { x: pushX, y: pushY };\n return {\n x: start.x + pushX,\n y: start.y + pushY,\n };\n }\n /**\n * Applies a computed position to the overlay and emits a position change.\n * @param position The position preference\n * @param originPoint The point on the origin element where the overlay is connected.\n */\n _applyPosition(position, originPoint) {\n this._setTransformOrigin(position);\n this._setOverlayElementStyles(originPoint, position);\n this._setBoundingBoxStyles(originPoint, position);\n if (position.panelClass) {\n this._addPanelClasses(position.panelClass);\n }\n // Save the last connected position in case the position needs to be re-calculated.\n this._lastPosition = position;\n // Notify that the position has been changed along with its change properties.\n // We only emit if we've got any subscriptions, because the scroll visibility\n // calculcations can be somewhat expensive.\n if (this._positionChanges.observers.length) {\n const scrollableViewProperties = this._getScrollVisibility();\n const changeEvent = new ConnectedOverlayPositionChange(position, scrollableViewProperties);\n this._positionChanges.next(changeEvent);\n }\n this._isInitialRender = false;\n }\n /** Sets the transform origin based on the configured selector and the passed-in position. */\n _setTransformOrigin(position) {\n if (!this._transformOriginSelector) {\n return;\n }\n const elements = this._boundingBox.querySelectorAll(this._transformOriginSelector);\n let xOrigin;\n let yOrigin = position.overlayY;\n if (position.overlayX === 'center') {\n xOrigin = 'center';\n }\n else if (this._isRtl()) {\n xOrigin = position.overlayX === 'start' ? 'right' : 'left';\n }\n else {\n xOrigin = position.overlayX === 'start' ? 'left' : 'right';\n }\n for (let i = 0; i < elements.length; i++) {\n elements[i].style.transformOrigin = `${xOrigin} ${yOrigin}`;\n }\n }\n /**\n * Gets the position and size of the overlay's sizing container.\n *\n * This method does no measuring and applies no styles so that we can cheaply compute the\n * bounds for all positions and choose the best fit based on these results.\n */\n _calculateBoundingBoxRect(origin, position) {\n const viewport = this._viewportRect;\n const isRtl = this._isRtl();\n let height, top, bottom;\n if (position.overlayY === 'top') {\n // Overlay is opening \"downward\" and thus is bound by the bottom viewport edge.\n top = origin.y;\n height = viewport.height - top + this._viewportMargin;\n }\n else if (position.overlayY === 'bottom') {\n // Overlay is opening \"upward\" and thus is bound by the top viewport edge. We need to add\n // the viewport margin back in, because the viewport rect is narrowed down to remove the\n // margin, whereas the `origin` position is calculated based on its `ClientRect`.\n bottom = viewport.height - origin.y + this._viewportMargin * 2;\n height = viewport.height - bottom + this._viewportMargin;\n }\n else {\n // If neither top nor bottom, it means that the overlay is vertically centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.bottom - origin.y` and\n // `origin.y - viewport.top`.\n const smallestDistanceToViewportEdge = Math.min(viewport.bottom - origin.y + viewport.top, origin.y);\n const previousHeight = this._lastBoundingBoxSize.height;\n height = smallestDistanceToViewportEdge * 2;\n top = origin.y - smallestDistanceToViewportEdge;\n if (height > previousHeight && !this._isInitialRender && !this._growAfterOpen) {\n top = origin.y - previousHeight / 2;\n }\n }\n // The overlay is opening 'right-ward' (the content flows to the right).\n const isBoundedByRightViewportEdge = (position.overlayX === 'start' && !isRtl) || (position.overlayX === 'end' && isRtl);\n // The overlay is opening 'left-ward' (the content flows to the left).\n const isBoundedByLeftViewportEdge = (position.overlayX === 'end' && !isRtl) || (position.overlayX === 'start' && isRtl);\n let width, left, right;\n if (isBoundedByLeftViewportEdge) {\n right = viewport.width - origin.x + this._viewportMargin;\n width = origin.x - this._viewportMargin;\n }\n else if (isBoundedByRightViewportEdge) {\n left = origin.x;\n width = viewport.right - origin.x;\n }\n else {\n // If neither start nor end, it means that the overlay is horizontally centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.right - origin.x` and\n // `origin.x - viewport.left`.\n const smallestDistanceToViewportEdge = Math.min(viewport.right - origin.x + viewport.left, origin.x);\n const previousWidth = this._lastBoundingBoxSize.width;\n width = smallestDistanceToViewportEdge * 2;\n left = origin.x - smallestDistanceToViewportEdge;\n if (width > previousWidth && !this._isInitialRender && !this._growAfterOpen) {\n left = origin.x - previousWidth / 2;\n }\n }\n return { top: top, left: left, bottom: bottom, right: right, width, height };\n }\n /**\n * Sets the position and size of the overlay's sizing wrapper. The wrapper is positioned on the\n * origin's connection point and stetches to the bounds of the viewport.\n *\n * @param origin The point on the origin element where the overlay is connected.\n * @param position The position preference\n */\n _setBoundingBoxStyles(origin, position) {\n const boundingBoxRect = this._calculateBoundingBoxRect(origin, position);\n // It's weird if the overlay *grows* while scrolling, so we take the last size into account\n // when applying a new size.\n if (!this._isInitialRender && !this._growAfterOpen) {\n boundingBoxRect.height = Math.min(boundingBoxRect.height, this._lastBoundingBoxSize.height);\n boundingBoxRect.width = Math.min(boundingBoxRect.width, this._lastBoundingBoxSize.width);\n }\n const styles = {};\n if (this._hasExactPosition()) {\n styles.top = styles.left = '0';\n styles.bottom = styles.right = styles.maxHeight = styles.maxWidth = '';\n styles.width = styles.height = '100%';\n }\n else {\n const maxHeight = this._overlayRef.getConfig().maxHeight;\n const maxWidth = this._overlayRef.getConfig().maxWidth;\n styles.height = coerceCssPixelValue(boundingBoxRect.height);\n styles.top = coerceCssPixelValue(boundingBoxRect.top);\n styles.bottom = coerceCssPixelValue(boundingBoxRect.bottom);\n styles.width = coerceCssPixelValue(boundingBoxRect.width);\n styles.left = coerceCssPixelValue(boundingBoxRect.left);\n styles.right = coerceCssPixelValue(boundingBoxRect.right);\n // Push the pane content towards the proper direction.\n if (position.overlayX === 'center') {\n styles.alignItems = 'center';\n }\n else {\n styles.alignItems = position.overlayX === 'end' ? 'flex-end' : 'flex-start';\n }\n if (position.overlayY === 'center') {\n styles.justifyContent = 'center';\n }\n else {\n styles.justifyContent = position.overlayY === 'bottom' ? 'flex-end' : 'flex-start';\n }\n if (maxHeight) {\n styles.maxHeight = coerceCssPixelValue(maxHeight);\n }\n if (maxWidth) {\n styles.maxWidth = coerceCssPixelValue(maxWidth);\n }\n }\n this._lastBoundingBoxSize = boundingBoxRect;\n extendStyles(this._boundingBox.style, styles);\n }\n /** Resets the styles for the bounding box so that a new positioning can be computed. */\n _resetBoundingBoxStyles() {\n extendStyles(this._boundingBox.style, {\n top: '0',\n left: '0',\n right: '0',\n bottom: '0',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n /** Resets the styles for the overlay pane so that a new positioning can be computed. */\n _resetOverlayElementStyles() {\n extendStyles(this._pane.style, {\n top: '',\n left: '',\n bottom: '',\n right: '',\n position: '',\n transform: '',\n });\n }\n /** Sets positioning styles to the overlay element. */\n _setOverlayElementStyles(originPoint, position) {\n const styles = {};\n const hasExactPosition = this._hasExactPosition();\n const hasFlexibleDimensions = this._hasFlexibleDimensions;\n const config = this._overlayRef.getConfig();\n if (hasExactPosition) {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n extendStyles(styles, this._getExactOverlayY(position, originPoint, scrollPosition));\n extendStyles(styles, this._getExactOverlayX(position, originPoint, scrollPosition));\n }\n else {\n styles.position = 'static';\n }\n // Use a transform to apply the offsets. We do this because the `center` positions rely on\n // being in the normal flex flow and setting a `top` / `left` at all will completely throw\n // off the position. We also can't use margins, because they won't have an effect in some\n // cases where the element doesn't have anything to \"push off of\". Finally, this works\n // better both with flexible and non-flexible positioning.\n let transformString = '';\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n if (offsetX) {\n transformString += `translateX(${offsetX}px) `;\n }\n if (offsetY) {\n transformString += `translateY(${offsetY}px)`;\n }\n styles.transform = transformString.trim();\n // If a maxWidth or maxHeight is specified on the overlay, we remove them. We do this because\n // we need these values to both be set to \"100%\" for the automatic flexible sizing to work.\n // The maxHeight and maxWidth are set on the boundingBox in order to enforce the constraint.\n // Note that this doesn't apply when we have an exact position, in which case we do want to\n // apply them because they'll be cleared from the bounding box.\n if (config.maxHeight) {\n if (hasExactPosition) {\n styles.maxHeight = coerceCssPixelValue(config.maxHeight);\n }\n else if (hasFlexibleDimensions) {\n styles.maxHeight = '';\n }\n }\n if (config.maxWidth) {\n if (hasExactPosition) {\n styles.maxWidth = coerceCssPixelValue(config.maxWidth);\n }\n else if (hasFlexibleDimensions) {\n styles.maxWidth = '';\n }\n }\n extendStyles(this._pane.style, styles);\n }\n /** Gets the exact top/bottom for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayY(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the\n // preferred position has changed since the last `apply`.\n let styles = { top: '', bottom: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `top` or `bottom` based on whether the overlay wants to appear\n // above or below the origin and the direction in which the element will expand.\n if (position.overlayY === 'bottom') {\n // When using `bottom`, we adjust the y position such that it is the distance\n // from the bottom of the viewport rather than the top.\n const documentHeight = this._document.documentElement.clientHeight;\n styles.bottom = `${documentHeight - (overlayPoint.y + this._overlayRect.height)}px`;\n }\n else {\n styles.top = coerceCssPixelValue(overlayPoint.y);\n }\n return styles;\n }\n /** Gets the exact left/right for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayX(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the preferred position has\n // changed since the last `apply`.\n let styles = { left: '', right: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `left` or `right` based on whether the overlay wants to appear \"before\"\n // or \"after\" the origin, which determines the direction in which the element will expand.\n // For the horizontal axis, the meaning of \"before\" and \"after\" change based on whether the\n // page is in RTL or LTR.\n let horizontalStyleProperty;\n if (this._isRtl()) {\n horizontalStyleProperty = position.overlayX === 'end' ? 'left' : 'right';\n }\n else {\n horizontalStyleProperty = position.overlayX === 'end' ? 'right' : 'left';\n }\n // When we're setting `right`, we adjust the x position such that it is the distance\n // from the right edge of the viewport rather than the left edge.\n if (horizontalStyleProperty === 'right') {\n const documentWidth = this._document.documentElement.clientWidth;\n styles.right = `${documentWidth - (overlayPoint.x + this._overlayRect.width)}px`;\n }\n else {\n styles.left = coerceCssPixelValue(overlayPoint.x);\n }\n return styles;\n }\n /**\n * Gets the view properties of the trigger and overlay, including whether they are clipped\n * or completely outside the view of any of the strategy's scrollables.\n */\n _getScrollVisibility() {\n // Note: needs fresh rects since the position could've changed.\n const originBounds = this._getOriginRect();\n const overlayBounds = this._pane.getBoundingClientRect();\n // TODO(jelbourn): instead of needing all of the client rects for these scrolling containers\n // every time, we should be able to use the scrollTop of the containers if the size of those\n // containers hasn't changed.\n const scrollContainerBounds = this._scrollables.map(scrollable => {\n return scrollable.getElementRef().nativeElement.getBoundingClientRect();\n });\n return {\n isOriginClipped: isElementClippedByScrolling(originBounds, scrollContainerBounds),\n isOriginOutsideView: isElementScrolledOutsideView(originBounds, scrollContainerBounds),\n isOverlayClipped: isElementClippedByScrolling(overlayBounds, scrollContainerBounds),\n isOverlayOutsideView: isElementScrolledOutsideView(overlayBounds, scrollContainerBounds),\n };\n }\n /** Subtracts the amount that an element is overflowing on an axis from its length. */\n _subtractOverflows(length, ...overflows) {\n return overflows.reduce((currentValue, currentOverflow) => {\n return currentValue - Math.max(currentOverflow, 0);\n }, length);\n }\n /** Narrows the given viewport rect by the current _viewportMargin. */\n _getNarrowedViewportRect() {\n // We recalculate the viewport rect here ourselves, rather than using the ViewportRuler,\n // because we want to use the `clientWidth` and `clientHeight` as the base. The difference\n // being that the client properties don't include the scrollbar, as opposed to `innerWidth`\n // and `innerHeight` that do. This is necessary, because the overlay container uses\n // 100% `width` and `height` which don't include the scrollbar either.\n const width = this._document.documentElement.clientWidth;\n const height = this._document.documentElement.clientHeight;\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n return {\n top: scrollPosition.top + this._viewportMargin,\n left: scrollPosition.left + this._viewportMargin,\n right: scrollPosition.left + width - this._viewportMargin,\n bottom: scrollPosition.top + height - this._viewportMargin,\n width: width - 2 * this._viewportMargin,\n height: height - 2 * this._viewportMargin,\n };\n }\n /** Whether the we're dealing with an RTL context */\n _isRtl() {\n return this._overlayRef.getDirection() === 'rtl';\n }\n /** Determines whether the overlay uses exact or flexible positioning. */\n _hasExactPosition() {\n return !this._hasFlexibleDimensions || this._isPushed;\n }\n /** Retrieves the offset of a position along the x or y axis. */\n _getOffset(position, axis) {\n if (axis === 'x') {\n // We don't do something like `position['offset' + axis]` in\n // order to avoid breking minifiers that rename properties.\n return position.offsetX == null ? this._offsetX : position.offsetX;\n }\n return position.offsetY == null ? this._offsetY : position.offsetY;\n }\n /** Validates that the current position match the expected values. */\n _validatePositions() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._preferredPositions.length) {\n throw Error('FlexibleConnectedPositionStrategy: At least one position is required.');\n }\n // TODO(crisbeto): remove these once Angular's template type\n // checking is advanced enough to catch these cases.\n this._preferredPositions.forEach(pair => {\n validateHorizontalPosition('originX', pair.originX);\n validateVerticalPosition('originY', pair.originY);\n validateHorizontalPosition('overlayX', pair.overlayX);\n validateVerticalPosition('overlayY', pair.overlayY);\n });\n }\n }\n /** Adds a single CSS class or an array of classes on the overlay panel. */\n _addPanelClasses(cssClasses) {\n if (this._pane) {\n coerceArray(cssClasses).forEach(cssClass => {\n if (cssClass !== '' && this._appliedPanelClasses.indexOf(cssClass) === -1) {\n this._appliedPanelClasses.push(cssClass);\n this._pane.classList.add(cssClass);\n }\n });\n }\n }\n /** Clears the classes that the position strategy has applied from the overlay panel. */\n _clearPanelClasses() {\n if (this._pane) {\n this._appliedPanelClasses.forEach(cssClass => {\n this._pane.classList.remove(cssClass);\n });\n this._appliedPanelClasses = [];\n }\n }\n /** Returns the ClientRect of the current origin. */\n _getOriginRect() {\n const origin = this._origin;\n if (origin instanceof ElementRef) {\n return origin.nativeElement.getBoundingClientRect();\n }\n // Check for Element so SVG elements are also supported.\n if (origin instanceof Element) {\n return origin.getBoundingClientRect();\n }\n const width = origin.width || 0;\n const height = origin.height || 0;\n // If the origin is a point, return a client rect as if it was a 0x0 element at the point.\n return {\n top: origin.y,\n bottom: origin.y + height,\n left: origin.x,\n right: origin.x + width,\n height,\n width,\n };\n }\n}\n/** Shallow-extends a stylesheet object with another stylesheet object. */\nfunction extendStyles(destination, source) {\n for (let key in source) {\n if (source.hasOwnProperty(key)) {\n destination[key] = source[key];\n }\n }\n return destination;\n}\n/**\n * Extracts the pixel value as a number from a value, if it's a number\n * or a CSS pixel string (e.g. `1337px`). Otherwise returns null.\n */\nfunction getPixelValue(input) {\n if (typeof input !== 'number' && input != null) {\n const [value, units] = input.split(cssUnitPattern);\n return !units || units === 'px' ? parseFloat(value) : null;\n }\n return input || null;\n}\n/**\n * Gets a version of an element's bounding `ClientRect` where all the values are rounded down to\n * the nearest pixel. This allows us to account for the cases where there may be sub-pixel\n * deviations in the `ClientRect` returned by the browser (e.g. when zoomed in with a percentage\n * size, see #21350).\n */\nfunction getRoundedBoundingClientRect(clientRect) {\n return {\n top: Math.floor(clientRect.top),\n right: Math.floor(clientRect.right),\n bottom: Math.floor(clientRect.bottom),\n left: Math.floor(clientRect.left),\n width: Math.floor(clientRect.width),\n height: Math.floor(clientRect.height),\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Class to be added to the overlay pane wrapper. */\nconst wrapperClass = 'cdk-global-overlay-wrapper';\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * explicit position relative to the browser's viewport. We use flexbox, instead of\n * transforms, in order to avoid issues with subpixel rendering which can cause the\n * element to become blurry.\n */\nclass GlobalPositionStrategy {\n constructor() {\n this._cssPosition = 'static';\n this._topOffset = '';\n this._bottomOffset = '';\n this._leftOffset = '';\n this._rightOffset = '';\n this._alignItems = '';\n this._justifyContent = '';\n this._width = '';\n this._height = '';\n }\n attach(overlayRef) {\n const config = overlayRef.getConfig();\n this._overlayRef = overlayRef;\n if (this._width && !config.width) {\n overlayRef.updateSize({ width: this._width });\n }\n if (this._height && !config.height) {\n overlayRef.updateSize({ height: this._height });\n }\n overlayRef.hostElement.classList.add(wrapperClass);\n this._isDisposed = false;\n }\n /**\n * Sets the top position of the overlay. Clears any previously set vertical position.\n * @param value New top offset.\n */\n top(value = '') {\n this._bottomOffset = '';\n this._topOffset = value;\n this._alignItems = 'flex-start';\n return this;\n }\n /**\n * Sets the left position of the overlay. Clears any previously set horizontal position.\n * @param value New left offset.\n */\n left(value = '') {\n this._rightOffset = '';\n this._leftOffset = value;\n this._justifyContent = 'flex-start';\n return this;\n }\n /**\n * Sets the bottom position of the overlay. Clears any previously set vertical position.\n * @param value New bottom offset.\n */\n bottom(value = '') {\n this._topOffset = '';\n this._bottomOffset = value;\n this._alignItems = 'flex-end';\n return this;\n }\n /**\n * Sets the right position of the overlay. Clears any previously set horizontal position.\n * @param value New right offset.\n */\n right(value = '') {\n this._leftOffset = '';\n this._rightOffset = value;\n this._justifyContent = 'flex-end';\n return this;\n }\n /**\n * Sets the overlay width and clears any previously set width.\n * @param value New width for the overlay\n * @deprecated Pass the `width` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n width(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ width: value });\n }\n else {\n this._width = value;\n }\n return this;\n }\n /**\n * Sets the overlay height and clears any previously set height.\n * @param value New height for the overlay\n * @deprecated Pass the `height` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n height(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ height: value });\n }\n else {\n this._height = value;\n }\n return this;\n }\n /**\n * Centers the overlay horizontally with an optional offset.\n * Clears any previously set horizontal position.\n *\n * @param offset Overlay offset from the horizontal center.\n */\n centerHorizontally(offset = '') {\n this.left(offset);\n this._justifyContent = 'center';\n return this;\n }\n /**\n * Centers the overlay vertically with an optional offset.\n * Clears any previously set vertical position.\n *\n * @param offset Overlay offset from the vertical center.\n */\n centerVertically(offset = '') {\n this.top(offset);\n this._alignItems = 'center';\n return this;\n }\n /**\n * Apply the position to the element.\n * @docs-private\n */\n apply() {\n // Since the overlay ref applies the strategy asynchronously, it could\n // have been disposed before it ends up being applied. If that is the\n // case, we shouldn't do anything.\n if (!this._overlayRef || !this._overlayRef.hasAttached()) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parentStyles = this._overlayRef.hostElement.style;\n const config = this._overlayRef.getConfig();\n const { width, height, maxWidth, maxHeight } = config;\n const shouldBeFlushHorizontally = (width === '100%' || width === '100vw') &&\n (!maxWidth || maxWidth === '100%' || maxWidth === '100vw');\n const shouldBeFlushVertically = (height === '100%' || height === '100vh') &&\n (!maxHeight || maxHeight === '100%' || maxHeight === '100vh');\n styles.position = this._cssPosition;\n styles.marginLeft = shouldBeFlushHorizontally ? '0' : this._leftOffset;\n styles.marginTop = shouldBeFlushVertically ? '0' : this._topOffset;\n styles.marginBottom = this._bottomOffset;\n styles.marginRight = this._rightOffset;\n if (shouldBeFlushHorizontally) {\n parentStyles.justifyContent = 'flex-start';\n }\n else if (this._justifyContent === 'center') {\n parentStyles.justifyContent = 'center';\n }\n else if (this._overlayRef.getConfig().direction === 'rtl') {\n // In RTL the browser will invert `flex-start` and `flex-end` automatically, but we\n // don't want that because our positioning is explicitly `left` and `right`, hence\n // why we do another inversion to ensure that the overlay stays in the same position.\n // TODO: reconsider this if we add `start` and `end` methods.\n if (this._justifyContent === 'flex-start') {\n parentStyles.justifyContent = 'flex-end';\n }\n else if (this._justifyContent === 'flex-end') {\n parentStyles.justifyContent = 'flex-start';\n }\n }\n else {\n parentStyles.justifyContent = this._justifyContent;\n }\n parentStyles.alignItems = shouldBeFlushVertically ? 'flex-start' : this._alignItems;\n }\n /**\n * Cleans up the DOM changes from the position strategy.\n * @docs-private\n */\n dispose() {\n if (this._isDisposed || !this._overlayRef) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parent = this._overlayRef.hostElement;\n const parentStyles = parent.style;\n parent.classList.remove(wrapperClass);\n parentStyles.justifyContent =\n parentStyles.alignItems =\n styles.marginTop =\n styles.marginBottom =\n styles.marginLeft =\n styles.marginRight =\n styles.position =\n '';\n this._overlayRef = null;\n this._isDisposed = true;\n }\n}\n\n/** Builder for overlay position strategy. */\nclass OverlayPositionBuilder {\n constructor(_viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n }\n /**\n * Creates a global position strategy.\n */\n global() {\n return new GlobalPositionStrategy();\n }\n /**\n * Creates a flexible position strategy.\n * @param origin Origin relative to which to position the overlay.\n */\n flexibleConnectedTo(origin) {\n return new FlexibleConnectedPositionStrategy(origin, this._viewportRuler, this._document, this._platform, this._overlayContainer);\n }\n}\nOverlayPositionBuilder.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayPositionBuilder, deps: [{ token: i1.ViewportRuler }, { token: DOCUMENT }, { token: i1$1.Platform }, { token: OverlayContainer }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayPositionBuilder.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayPositionBuilder, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayPositionBuilder, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: i1.ViewportRuler }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: OverlayContainer }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass BaseOverlayDispatcher {\n constructor(document) {\n /** Currently attached overlays in the order they were attached. */\n this._attachedOverlays = [];\n this._document = document;\n }\n ngOnDestroy() {\n this.detach();\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n // Ensure that we don't get the same overlay multiple times.\n this.remove(overlayRef);\n this._attachedOverlays.push(overlayRef);\n }\n /** Remove an overlay from the list of attached overlay refs. */\n remove(overlayRef) {\n const index = this._attachedOverlays.indexOf(overlayRef);\n if (index > -1) {\n this._attachedOverlays.splice(index, 1);\n }\n // Remove the global listener once there are no more overlays.\n if (this._attachedOverlays.length === 0) {\n this.detach();\n }\n }\n}\nBaseOverlayDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BaseOverlayDispatcher, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBaseOverlayDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BaseOverlayDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: BaseOverlayDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching keyboard events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayKeyboardDispatcher extends BaseOverlayDispatcher {\n constructor(document) {\n super(document);\n /** Keyboard event listener that will be attached to the body. */\n this._keydownListener = (event) => {\n const overlays = this._attachedOverlays;\n for (let i = overlays.length - 1; i > -1; i--) {\n // Dispatch the keydown event to the top overlay which has subscribers to its keydown events.\n // We want to target the most recent overlay, rather than trying to match where the event came\n // from, because some components might open an overlay, but keep focus on a trigger element\n // (e.g. for select and autocomplete). We skip overlays without keydown event subscriptions,\n // because we don't want overlays that don't handle keyboard events to block the ones below\n // them that do.\n if (overlays[i]._keydownEvents.observers.length > 0) {\n overlays[i]._keydownEvents.next(event);\n break;\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Lazily start dispatcher once first overlay is added\n if (!this._isAttached) {\n this._document.body.addEventListener('keydown', this._keydownListener);\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n this._document.body.removeEventListener('keydown', this._keydownListener);\n this._isAttached = false;\n }\n }\n}\nOverlayKeyboardDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayKeyboardDispatcher, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayKeyboardDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayKeyboardDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayKeyboardDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching mouse click events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayOutsideClickDispatcher extends BaseOverlayDispatcher {\n constructor(document, _platform) {\n super(document);\n this._platform = _platform;\n this._cursorStyleIsSet = false;\n /** Store pointerdown event target to track origin of click. */\n this._pointerDownListener = (event) => {\n this._pointerDownEventTarget = _getEventTarget(event);\n };\n /** Click event listener that will be attached to the body propagate phase. */\n this._clickListener = (event) => {\n const target = _getEventTarget(event);\n // In case of a click event, we want to check the origin of the click\n // (e.g. in case where a user starts a click inside the overlay and\n // releases the click outside of it).\n // This is done by using the event target of the preceding pointerdown event.\n // Every click event caused by a pointer device has a preceding pointerdown\n // event, unless the click was programmatically triggered (e.g. in a unit test).\n const origin = event.type === 'click' && this._pointerDownEventTarget\n ? this._pointerDownEventTarget\n : target;\n // Reset the stored pointerdown event target, to avoid having it interfere\n // in subsequent events.\n this._pointerDownEventTarget = null;\n // We copy the array because the original may be modified asynchronously if the\n // outsidePointerEvents listener decides to detach overlays resulting in index errors inside\n // the for loop.\n const overlays = this._attachedOverlays.slice();\n // Dispatch the mouse event to the top overlay which has subscribers to its mouse events.\n // We want to target all overlays for which the click could be considered as outside click.\n // As soon as we reach an overlay for which the click is not outside click we break off\n // the loop.\n for (let i = overlays.length - 1; i > -1; i--) {\n const overlayRef = overlays[i];\n if (overlayRef._outsidePointerEvents.observers.length < 1 || !overlayRef.hasAttached()) {\n continue;\n }\n // If it's a click inside the overlay, just break - we should do nothing\n // If it's an outside click (both origin and target of the click) dispatch the mouse event,\n // and proceed with the next overlay\n if (overlayRef.overlayElement.contains(target) ||\n overlayRef.overlayElement.contains(origin)) {\n break;\n }\n overlayRef._outsidePointerEvents.next(event);\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Safari on iOS does not generate click events for non-interactive\n // elements. However, we want to receive a click for any element outside\n // the overlay. We can force a \"clickable\" state by setting\n // `cursor: pointer` on the document body. See:\n // https://developer.mozilla.org/en-US/docs/Web/API/Element/click_event#Safari_Mobile\n // https://developer.apple.com/library/archive/documentation/AppleApplications/Reference/SafariWebContent/HandlingEvents/HandlingEvents.html\n if (!this._isAttached) {\n const body = this._document.body;\n body.addEventListener('pointerdown', this._pointerDownListener, true);\n body.addEventListener('click', this._clickListener, true);\n body.addEventListener('auxclick', this._clickListener, true);\n body.addEventListener('contextmenu', this._clickListener, true);\n // click event is not fired on iOS. To make element \"clickable\" we are\n // setting the cursor to pointer\n if (this._platform.IOS && !this._cursorStyleIsSet) {\n this._cursorOriginalValue = body.style.cursor;\n body.style.cursor = 'pointer';\n this._cursorStyleIsSet = true;\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n const body = this._document.body;\n body.removeEventListener('pointerdown', this._pointerDownListener, true);\n body.removeEventListener('click', this._clickListener, true);\n body.removeEventListener('auxclick', this._clickListener, true);\n body.removeEventListener('contextmenu', this._clickListener, true);\n if (this._platform.IOS && this._cursorStyleIsSet) {\n body.style.cursor = this._cursorOriginalValue;\n this._cursorStyleIsSet = false;\n }\n this._isAttached = false;\n }\n }\n}\nOverlayOutsideClickDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayOutsideClickDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }];\n } });\n\n/** Next overlay unique ID. */\nlet nextUniqueId = 0;\n// Note that Overlay is *not* scoped to the app root because of the ComponentFactoryResolver\n// which needs to be different depending on where OverlayModule is imported.\n/**\n * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be\n * used as a low-level building block for other components. Dialogs, tooltips, menus,\n * selects, etc. can all be built using overlays. The service should primarily be used by authors\n * of re-usable components rather than developers building end-user applications.\n *\n * An overlay *is* a PortalOutlet, so any kind of Portal can be loaded into one.\n */\nclass Overlay {\n constructor(\n /** Scrolling strategies that can be used when creating an overlay. */\n scrollStrategies, _overlayContainer, _componentFactoryResolver, _positionBuilder, _keyboardDispatcher, _injector, _ngZone, _document, _directionality, _location, _outsideClickDispatcher) {\n this.scrollStrategies = scrollStrategies;\n this._overlayContainer = _overlayContainer;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._positionBuilder = _positionBuilder;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._injector = _injector;\n this._ngZone = _ngZone;\n this._document = _document;\n this._directionality = _directionality;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n }\n /**\n * Creates an overlay.\n * @param config Configuration applied to the overlay.\n * @returns Reference to the created overlay.\n */\n create(config) {\n const host = this._createHostElement();\n const pane = this._createPaneElement(host);\n const portalOutlet = this._createPortalOutlet(pane);\n const overlayConfig = new OverlayConfig(config);\n overlayConfig.direction = overlayConfig.direction || this._directionality.value;\n return new OverlayRef(portalOutlet, host, pane, overlayConfig, this._ngZone, this._keyboardDispatcher, this._document, this._location, this._outsideClickDispatcher);\n }\n /**\n * Gets a position builder that can be used, via fluent API,\n * to construct and configure a position strategy.\n * @returns An overlay position builder.\n */\n position() {\n return this._positionBuilder;\n }\n /**\n * Creates the DOM element for an overlay and appends it to the overlay container.\n * @returns Newly-created pane element\n */\n _createPaneElement(host) {\n const pane = this._document.createElement('div');\n pane.id = `cdk-overlay-${nextUniqueId++}`;\n pane.classList.add('cdk-overlay-pane');\n host.appendChild(pane);\n return pane;\n }\n /**\n * Creates the host element that wraps around an overlay\n * and can be used for advanced positioning.\n * @returns Newly-create host element.\n */\n _createHostElement() {\n const host = this._document.createElement('div');\n this._overlayContainer.getContainerElement().appendChild(host);\n return host;\n }\n /**\n * Create a DomPortalOutlet into which the overlay content can be loaded.\n * @param pane The DOM element to turn into a portal outlet.\n * @returns A portal outlet for the given DOM element.\n */\n _createPortalOutlet(pane) {\n // We have to resolve the ApplicationRef later in order to allow people\n // to use overlay-based providers during app initialization.\n if (!this._appRef) {\n this._appRef = this._injector.get(ApplicationRef);\n }\n return new DomPortalOutlet(pane, this._componentFactoryResolver, this._appRef, this._injector, this._document);\n }\n}\nOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Overlay, deps: [{ token: ScrollStrategyOptions }, { token: OverlayContainer }, { token: i0.ComponentFactoryResolver }, { token: OverlayPositionBuilder }, { token: OverlayKeyboardDispatcher }, { token: i0.Injector }, { token: i0.NgZone }, { token: DOCUMENT }, { token: i5.Directionality }, { token: i6.Location }, { token: OverlayOutsideClickDispatcher }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlay.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Overlay });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Overlay, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: i0.ComponentFactoryResolver }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: i0.Injector }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i5.Directionality }, { type: i6.Location }, { type: OverlayOutsideClickDispatcher }];\n } });\n\n/** Default set of positions for the overlay. Follows the behavior of a dropdown. */\nconst defaultPositionList = [\n {\n originX: 'start',\n originY: 'bottom',\n overlayX: 'start',\n overlayY: 'top',\n },\n {\n originX: 'start',\n originY: 'top',\n overlayX: 'start',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'top',\n overlayX: 'end',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'bottom',\n overlayX: 'end',\n overlayY: 'top',\n },\n];\n/** Injection token that determines the scroll handling while the connected overlay is open. */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY = new InjectionToken('cdk-connected-overlay-scroll-strategy');\n/**\n * Directive applied to an element to make it usable as an origin for an Overlay using a\n * ConnectedPositionStrategy.\n */\nclass CdkOverlayOrigin {\n constructor(\n /** Reference to the element on which the directive is applied. */\n elementRef) {\n this.elementRef = elementRef;\n }\n}\nCdkOverlayOrigin.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkOverlayOrigin, deps: [{ token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkOverlayOrigin.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkOverlayOrigin, selector: \"[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]\", exportAs: [\"cdkOverlayOrigin\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkOverlayOrigin, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]',\n exportAs: 'cdkOverlayOrigin',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }]; } });\n/**\n * Directive to facilitate declarative creation of an\n * Overlay using a FlexibleConnectedPositionStrategy.\n */\nclass CdkConnectedOverlay {\n // TODO(jelbourn): inputs for size, scroll behavior, animation, etc.\n constructor(_overlay, templateRef, viewContainerRef, scrollStrategyFactory, _dir) {\n this._overlay = _overlay;\n this._dir = _dir;\n this._hasBackdrop = false;\n this._lockPosition = false;\n this._growAfterOpen = false;\n this._flexibleDimensions = false;\n this._push = false;\n this._backdropSubscription = Subscription.EMPTY;\n this._attachSubscription = Subscription.EMPTY;\n this._detachSubscription = Subscription.EMPTY;\n this._positionSubscription = Subscription.EMPTY;\n /** Margin between the overlay and the viewport edges. */\n this.viewportMargin = 0;\n /** Whether the overlay is open. */\n this.open = false;\n /** Whether the overlay can be closed by user interaction. */\n this.disableClose = false;\n /** Event emitted when the backdrop is clicked. */\n this.backdropClick = new EventEmitter();\n /** Event emitted when the position has changed. */\n this.positionChange = new EventEmitter();\n /** Event emitted when the overlay has been attached. */\n this.attach = new EventEmitter();\n /** Event emitted when the overlay has been detached. */\n this.detach = new EventEmitter();\n /** Emits when there are keyboard events that are targeted at the overlay. */\n this.overlayKeydown = new EventEmitter();\n /** Emits when there are mouse outside click events that are targeted at the overlay. */\n this.overlayOutsideClick = new EventEmitter();\n this._templatePortal = new TemplatePortal(templateRef, viewContainerRef);\n this._scrollStrategyFactory = scrollStrategyFactory;\n this.scrollStrategy = this._scrollStrategyFactory();\n }\n /** The offset in pixels for the overlay connection point on the x-axis */\n get offsetX() {\n return this._offsetX;\n }\n set offsetX(offsetX) {\n this._offsetX = offsetX;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** The offset in pixels for the overlay connection point on the y-axis */\n get offsetY() {\n return this._offsetY;\n }\n set offsetY(offsetY) {\n this._offsetY = offsetY;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** Whether or not the overlay should attach a backdrop. */\n get hasBackdrop() {\n return this._hasBackdrop;\n }\n set hasBackdrop(value) {\n this._hasBackdrop = coerceBooleanProperty(value);\n }\n /** Whether or not the overlay should be locked when scrolling. */\n get lockPosition() {\n return this._lockPosition;\n }\n set lockPosition(value) {\n this._lockPosition = coerceBooleanProperty(value);\n }\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n get flexibleDimensions() {\n return this._flexibleDimensions;\n }\n set flexibleDimensions(value) {\n this._flexibleDimensions = coerceBooleanProperty(value);\n }\n /** Whether the overlay can grow after the initial open when flexible positioning is turned on. */\n get growAfterOpen() {\n return this._growAfterOpen;\n }\n set growAfterOpen(value) {\n this._growAfterOpen = coerceBooleanProperty(value);\n }\n /** Whether the overlay can be pushed on-screen if none of the provided positions fit. */\n get push() {\n return this._push;\n }\n set push(value) {\n this._push = coerceBooleanProperty(value);\n }\n /** The associated overlay reference. */\n get overlayRef() {\n return this._overlayRef;\n }\n /** The element's layout direction. */\n get dir() {\n return this._dir ? this._dir.value : 'ltr';\n }\n ngOnDestroy() {\n this._attachSubscription.unsubscribe();\n this._detachSubscription.unsubscribe();\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n if (this._overlayRef) {\n this._overlayRef.dispose();\n }\n }\n ngOnChanges(changes) {\n if (this._position) {\n this._updatePositionStrategy(this._position);\n this._overlayRef.updateSize({\n width: this.width,\n minWidth: this.minWidth,\n height: this.height,\n minHeight: this.minHeight,\n });\n if (changes['origin'] && this.open) {\n this._position.apply();\n }\n }\n if (changes['open']) {\n this.open ? this._attachOverlay() : this._detachOverlay();\n }\n }\n /** Creates an overlay */\n _createOverlay() {\n if (!this.positions || !this.positions.length) {\n this.positions = defaultPositionList;\n }\n const overlayRef = (this._overlayRef = this._overlay.create(this._buildConfig()));\n this._attachSubscription = overlayRef.attachments().subscribe(() => this.attach.emit());\n this._detachSubscription = overlayRef.detachments().subscribe(() => this.detach.emit());\n overlayRef.keydownEvents().subscribe((event) => {\n this.overlayKeydown.next(event);\n if (event.keyCode === ESCAPE && !this.disableClose && !hasModifierKey(event)) {\n event.preventDefault();\n this._detachOverlay();\n }\n });\n this._overlayRef.outsidePointerEvents().subscribe((event) => {\n this.overlayOutsideClick.next(event);\n });\n }\n /** Builds the overlay config based on the directive's inputs */\n _buildConfig() {\n const positionStrategy = (this._position =\n this.positionStrategy || this._createPositionStrategy());\n const overlayConfig = new OverlayConfig({\n direction: this._dir,\n positionStrategy,\n scrollStrategy: this.scrollStrategy,\n hasBackdrop: this.hasBackdrop,\n });\n if (this.width || this.width === 0) {\n overlayConfig.width = this.width;\n }\n if (this.height || this.height === 0) {\n overlayConfig.height = this.height;\n }\n if (this.minWidth || this.minWidth === 0) {\n overlayConfig.minWidth = this.minWidth;\n }\n if (this.minHeight || this.minHeight === 0) {\n overlayConfig.minHeight = this.minHeight;\n }\n if (this.backdropClass) {\n overlayConfig.backdropClass = this.backdropClass;\n }\n if (this.panelClass) {\n overlayConfig.panelClass = this.panelClass;\n }\n return overlayConfig;\n }\n /** Updates the state of a position strategy, based on the values of the directive inputs. */\n _updatePositionStrategy(positionStrategy) {\n const positions = this.positions.map(currentPosition => ({\n originX: currentPosition.originX,\n originY: currentPosition.originY,\n overlayX: currentPosition.overlayX,\n overlayY: currentPosition.overlayY,\n offsetX: currentPosition.offsetX || this.offsetX,\n offsetY: currentPosition.offsetY || this.offsetY,\n panelClass: currentPosition.panelClass || undefined,\n }));\n return positionStrategy\n .setOrigin(this._getFlexibleConnectedPositionStrategyOrigin())\n .withPositions(positions)\n .withFlexibleDimensions(this.flexibleDimensions)\n .withPush(this.push)\n .withGrowAfterOpen(this.growAfterOpen)\n .withViewportMargin(this.viewportMargin)\n .withLockedPosition(this.lockPosition)\n .withTransformOriginOn(this.transformOriginSelector);\n }\n /** Returns the position strategy of the overlay to be set on the overlay config */\n _createPositionStrategy() {\n const strategy = this._overlay\n .position()\n .flexibleConnectedTo(this._getFlexibleConnectedPositionStrategyOrigin());\n this._updatePositionStrategy(strategy);\n return strategy;\n }\n _getFlexibleConnectedPositionStrategyOrigin() {\n if (this.origin instanceof CdkOverlayOrigin) {\n return this.origin.elementRef;\n }\n else {\n return this.origin;\n }\n }\n /** Attaches the overlay and subscribes to backdrop clicks if backdrop exists */\n _attachOverlay() {\n if (!this._overlayRef) {\n this._createOverlay();\n }\n else {\n // Update the overlay size, in case the directive's inputs have changed\n this._overlayRef.getConfig().hasBackdrop = this.hasBackdrop;\n }\n if (!this._overlayRef.hasAttached()) {\n this._overlayRef.attach(this._templatePortal);\n }\n if (this.hasBackdrop) {\n this._backdropSubscription = this._overlayRef.backdropClick().subscribe(event => {\n this.backdropClick.emit(event);\n });\n }\n else {\n this._backdropSubscription.unsubscribe();\n }\n this._positionSubscription.unsubscribe();\n // Only subscribe to `positionChanges` if requested, because putting\n // together all the information for it can be expensive.\n if (this.positionChange.observers.length > 0) {\n this._positionSubscription = this._position.positionChanges\n .pipe(takeWhile(() => this.positionChange.observers.length > 0))\n .subscribe(position => {\n this.positionChange.emit(position);\n if (this.positionChange.observers.length === 0) {\n this._positionSubscription.unsubscribe();\n }\n });\n }\n }\n /** Detaches the overlay and unsubscribes to backdrop clicks if backdrop exists */\n _detachOverlay() {\n if (this._overlayRef) {\n this._overlayRef.detach();\n }\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n }\n}\nCdkConnectedOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkConnectedOverlay, deps: [{ token: Overlay }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY }, { token: i5.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkConnectedOverlay.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkConnectedOverlay, selector: \"[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]\", inputs: { origin: [\"cdkConnectedOverlayOrigin\", \"origin\"], positions: [\"cdkConnectedOverlayPositions\", \"positions\"], positionStrategy: [\"cdkConnectedOverlayPositionStrategy\", \"positionStrategy\"], offsetX: [\"cdkConnectedOverlayOffsetX\", \"offsetX\"], offsetY: [\"cdkConnectedOverlayOffsetY\", \"offsetY\"], width: [\"cdkConnectedOverlayWidth\", \"width\"], height: [\"cdkConnectedOverlayHeight\", \"height\"], minWidth: [\"cdkConnectedOverlayMinWidth\", \"minWidth\"], minHeight: [\"cdkConnectedOverlayMinHeight\", \"minHeight\"], backdropClass: [\"cdkConnectedOverlayBackdropClass\", \"backdropClass\"], panelClass: [\"cdkConnectedOverlayPanelClass\", \"panelClass\"], viewportMargin: [\"cdkConnectedOverlayViewportMargin\", \"viewportMargin\"], scrollStrategy: [\"cdkConnectedOverlayScrollStrategy\", \"scrollStrategy\"], open: [\"cdkConnectedOverlayOpen\", \"open\"], disableClose: [\"cdkConnectedOverlayDisableClose\", \"disableClose\"], transformOriginSelector: [\"cdkConnectedOverlayTransformOriginOn\", \"transformOriginSelector\"], hasBackdrop: [\"cdkConnectedOverlayHasBackdrop\", \"hasBackdrop\"], lockPosition: [\"cdkConnectedOverlayLockPosition\", \"lockPosition\"], flexibleDimensions: [\"cdkConnectedOverlayFlexibleDimensions\", \"flexibleDimensions\"], growAfterOpen: [\"cdkConnectedOverlayGrowAfterOpen\", \"growAfterOpen\"], push: [\"cdkConnectedOverlayPush\", \"push\"] }, outputs: { backdropClick: \"backdropClick\", positionChange: \"positionChange\", attach: \"attach\", detach: \"detach\", overlayKeydown: \"overlayKeydown\", overlayOutsideClick: \"overlayOutsideClick\" }, exportAs: [\"cdkConnectedOverlay\"], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkConnectedOverlay, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]',\n exportAs: 'cdkConnectedOverlay',\n }]\n }], ctorParameters: function () {\n return [{ type: Overlay }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY]\n }] }, { type: i5.Directionality, decorators: [{\n type: Optional\n }] }];\n }, propDecorators: { origin: [{\n type: Input,\n args: ['cdkConnectedOverlayOrigin']\n }], positions: [{\n type: Input,\n args: ['cdkConnectedOverlayPositions']\n }], positionStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayPositionStrategy']\n }], offsetX: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetX']\n }], offsetY: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetY']\n }], width: [{\n type: Input,\n args: ['cdkConnectedOverlayWidth']\n }], height: [{\n type: Input,\n args: ['cdkConnectedOverlayHeight']\n }], minWidth: [{\n type: Input,\n args: ['cdkConnectedOverlayMinWidth']\n }], minHeight: [{\n type: Input,\n args: ['cdkConnectedOverlayMinHeight']\n }], backdropClass: [{\n type: Input,\n args: ['cdkConnectedOverlayBackdropClass']\n }], panelClass: [{\n type: Input,\n args: ['cdkConnectedOverlayPanelClass']\n }], viewportMargin: [{\n type: Input,\n args: ['cdkConnectedOverlayViewportMargin']\n }], scrollStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayScrollStrategy']\n }], open: [{\n type: Input,\n args: ['cdkConnectedOverlayOpen']\n }], disableClose: [{\n type: Input,\n args: ['cdkConnectedOverlayDisableClose']\n }], transformOriginSelector: [{\n type: Input,\n args: ['cdkConnectedOverlayTransformOriginOn']\n }], hasBackdrop: [{\n type: Input,\n args: ['cdkConnectedOverlayHasBackdrop']\n }], lockPosition: [{\n type: Input,\n args: ['cdkConnectedOverlayLockPosition']\n }], flexibleDimensions: [{\n type: Input,\n args: ['cdkConnectedOverlayFlexibleDimensions']\n }], growAfterOpen: [{\n type: Input,\n args: ['cdkConnectedOverlayGrowAfterOpen']\n }], push: [{\n type: Input,\n args: ['cdkConnectedOverlayPush']\n }], backdropClick: [{\n type: Output\n }], positionChange: [{\n type: Output\n }], attach: [{\n type: Output\n }], detach: [{\n type: Output\n }], overlayKeydown: [{\n type: Output\n }], overlayOutsideClick: [{\n type: Output\n }] } });\n/** @docs-private */\nfunction CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY(overlay) {\n return () => overlay.scrollStrategies.reposition();\n}\n/** @docs-private */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER = {\n provide: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,\n deps: [Overlay],\n useFactory: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY,\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass OverlayModule {\n}\nOverlayModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nOverlayModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayModule, declarations: [CdkConnectedOverlay, CdkOverlayOrigin], imports: [BidiModule, PortalModule, ScrollingModule], exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule] });\nOverlayModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayModule, providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER], imports: [[BidiModule, PortalModule, ScrollingModule], ScrollingModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: OverlayModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule, PortalModule, ScrollingModule],\n exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule],\n declarations: [CdkConnectedOverlay, CdkOverlayOrigin],\n providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Alternative to OverlayContainer that supports correct displaying of overlay elements in\n * Fullscreen mode\n * https://developer.mozilla.org/en-US/docs/Web/API/Element/requestFullScreen\n *\n * Should be provided in the root component.\n */\nclass FullscreenOverlayContainer extends OverlayContainer {\n constructor(_document, platform) {\n super(_document, platform);\n }\n ngOnDestroy() {\n super.ngOnDestroy();\n if (this._fullScreenEventName && this._fullScreenListener) {\n this._document.removeEventListener(this._fullScreenEventName, this._fullScreenListener);\n }\n }\n _createContainer() {\n super._createContainer();\n this._adjustParentForFullscreenChange();\n this._addFullscreenChangeListener(() => this._adjustParentForFullscreenChange());\n }\n _adjustParentForFullscreenChange() {\n if (!this._containerElement) {\n return;\n }\n const fullscreenElement = this.getFullscreenElement();\n const parent = fullscreenElement || this._document.body;\n parent.appendChild(this._containerElement);\n }\n _addFullscreenChangeListener(fn) {\n const eventName = this._getEventName();\n if (eventName) {\n if (this._fullScreenListener) {\n this._document.removeEventListener(eventName, this._fullScreenListener);\n }\n this._document.addEventListener(eventName, fn);\n this._fullScreenListener = fn;\n }\n }\n _getEventName() {\n if (!this._fullScreenEventName) {\n const _document = this._document;\n if (_document.fullscreenEnabled) {\n this._fullScreenEventName = 'fullscreenchange';\n }\n else if (_document.webkitFullscreenEnabled) {\n this._fullScreenEventName = 'webkitfullscreenchange';\n }\n else if (_document.mozFullScreenEnabled) {\n this._fullScreenEventName = 'mozfullscreenchange';\n }\n else if (_document.msFullscreenEnabled) {\n this._fullScreenEventName = 'MSFullscreenChange';\n }\n }\n return this._fullScreenEventName;\n }\n /**\n * When the page is put into fullscreen mode, a specific element is specified.\n * Only that element and its children are visible when in fullscreen mode.\n */\n getFullscreenElement() {\n const _document = this._document;\n return (_document.fullscreenElement ||\n _document.webkitFullscreenElement ||\n _document.mozFullScreenElement ||\n _document.msFullscreenElement ||\n null);\n }\n}\nFullscreenOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FullscreenOverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nFullscreenOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FullscreenOverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: FullscreenOverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BlockScrollStrategy, CdkConnectedOverlay, CdkOverlayOrigin, CloseScrollStrategy, ConnectedOverlayPositionChange, ConnectionPositionPair, FlexibleConnectedPositionStrategy, FullscreenOverlayContainer, GlobalPositionStrategy, NoopScrollStrategy, Overlay, OverlayConfig, OverlayContainer, OverlayKeyboardDispatcher, OverlayModule, OverlayOutsideClickDispatcher, OverlayPositionBuilder, OverlayRef, RepositionScrollStrategy, ScrollStrategyOptions, ScrollingVisibility, validateHorizontalPosition, validateVerticalPosition };\n","import * as i0 from '@angular/core';\nimport { PLATFORM_ID, Injectable, Inject, NgModule } from '@angular/core';\nimport { isPlatformBrowser } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Whether the current platform supports the V8 Break Iterator. The V8 check\n// is necessary to detect all Blink based browsers.\nlet hasV8BreakIterator;\n// We need a try/catch around the reference to `Intl`, because accessing it in some cases can\n// cause IE to throw. These cases are tied to particular versions of Windows and can happen if\n// the consumer is providing a polyfilled `Map`. See:\n// https://github.com/Microsoft/ChakraCore/issues/3189\n// https://github.com/angular/components/issues/15687\ntry {\n hasV8BreakIterator = typeof Intl !== 'undefined' && Intl.v8BreakIterator;\n}\ncatch (_a) {\n hasV8BreakIterator = false;\n}\n/**\n * Service to detect the current platform by comparing the userAgent strings and\n * checking browser-specific global properties.\n */\nclass Platform {\n constructor(_platformId) {\n this._platformId = _platformId;\n // We want to use the Angular platform check because if the Document is shimmed\n // without the navigator, the following checks will fail. This is preferred because\n // sometimes the Document may be shimmed without the user's knowledge or intention\n /** Whether the Angular application is being rendered in the browser. */\n this.isBrowser = this._platformId\n ? isPlatformBrowser(this._platformId)\n : typeof document === 'object' && !!document;\n /** Whether the current browser is Microsoft Edge. */\n this.EDGE = this.isBrowser && /(edge)/i.test(navigator.userAgent);\n /** Whether the current rendering engine is Microsoft Trident. */\n this.TRIDENT = this.isBrowser && /(msie|trident)/i.test(navigator.userAgent);\n // EdgeHTML and Trident mock Blink specific things and need to be excluded from this check.\n /** Whether the current rendering engine is Blink. */\n this.BLINK = this.isBrowser &&\n !!(window.chrome || hasV8BreakIterator) &&\n typeof CSS !== 'undefined' &&\n !this.EDGE &&\n !this.TRIDENT;\n // Webkit is part of the userAgent in EdgeHTML, Blink and Trident. Therefore we need to\n // ensure that Webkit runs standalone and is not used as another engine's base.\n /** Whether the current rendering engine is WebKit. */\n this.WEBKIT = this.isBrowser &&\n /AppleWebKit/i.test(navigator.userAgent) &&\n !this.BLINK &&\n !this.EDGE &&\n !this.TRIDENT;\n /** Whether the current platform is Apple iOS. */\n this.IOS = this.isBrowser && /iPad|iPhone|iPod/.test(navigator.userAgent) && !('MSStream' in window);\n // It's difficult to detect the plain Gecko engine, because most of the browsers identify\n // them self as Gecko-like browsers and modify the userAgent's according to that.\n // Since we only cover one explicit Firefox case, we can simply check for Firefox\n // instead of having an unstable check for Gecko.\n /** Whether the current browser is Firefox. */\n this.FIREFOX = this.isBrowser && /(firefox|minefield)/i.test(navigator.userAgent);\n /** Whether the current platform is Android. */\n // Trident on mobile adds the android platform to the userAgent to trick detections.\n this.ANDROID = this.isBrowser && /android/i.test(navigator.userAgent) && !this.TRIDENT;\n // Safari browsers will include the Safari keyword in their userAgent. Some browsers may fake\n // this and just place the Safari keyword in the userAgent. To be more safe about Safari every\n // Safari browser should also use Webkit as its layout engine.\n /** Whether the current browser is Safari. */\n this.SAFARI = this.isBrowser && /safari/i.test(navigator.userAgent) && this.WEBKIT;\n }\n}\nPlatform.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Platform, deps: [{ token: PLATFORM_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nPlatform.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Platform, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: Platform, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass PlatformModule {\n}\nPlatformModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PlatformModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPlatformModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PlatformModule });\nPlatformModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PlatformModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PlatformModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result Set of input types support by the current browser. */\nlet supportedInputTypes;\n/** Types of `` that *might* be supported. */\nconst candidateInputTypes = [\n // `color` must come first. Chrome 56 shows a warning if we change the type to `color` after\n // first changing it to something else:\n // The specified value \"\" does not conform to the required format.\n // The format is \"#rrggbb\" where rr, gg, bb are two-digit hexadecimal numbers.\n 'color',\n 'button',\n 'checkbox',\n 'date',\n 'datetime-local',\n 'email',\n 'file',\n 'hidden',\n 'image',\n 'month',\n 'number',\n 'password',\n 'radio',\n 'range',\n 'reset',\n 'search',\n 'submit',\n 'tel',\n 'text',\n 'time',\n 'url',\n 'week',\n];\n/** @returns The input types supported by this browser. */\nfunction getSupportedInputTypes() {\n // Result is cached.\n if (supportedInputTypes) {\n return supportedInputTypes;\n }\n // We can't check if an input type is not supported until we're on the browser, so say that\n // everything is supported when not on the browser. We don't use `Platform` here since it's\n // just a helper function and can't inject it.\n if (typeof document !== 'object' || !document) {\n supportedInputTypes = new Set(candidateInputTypes);\n return supportedInputTypes;\n }\n let featureTestInput = document.createElement('input');\n supportedInputTypes = new Set(candidateInputTypes.filter(value => {\n featureTestInput.setAttribute('type', value);\n return featureTestInput.type === value;\n }));\n return supportedInputTypes;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of whether the user's browser supports passive event listeners. */\nlet supportsPassiveEvents;\n/**\n * Checks whether the user's browser supports passive event listeners.\n * See: https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md\n */\nfunction supportsPassiveEventListeners() {\n if (supportsPassiveEvents == null && typeof window !== 'undefined') {\n try {\n window.addEventListener('test', null, Object.defineProperty({}, 'passive', {\n get: () => (supportsPassiveEvents = true),\n }));\n }\n finally {\n supportsPassiveEvents = supportsPassiveEvents || false;\n }\n }\n return supportsPassiveEvents;\n}\n/**\n * Normalizes an `AddEventListener` object to something that can be passed\n * to `addEventListener` on any browser, no matter whether it supports the\n * `options` parameter.\n * @param options Object to be normalized.\n */\nfunction normalizePassiveListenerOptions(options) {\n return supportsPassiveEventListeners() ? options : !!options.capture;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of the way the browser handles the horizontal scroll axis in RTL mode. */\nlet rtlScrollAxisType;\n/** Cached result of the check that indicates whether the browser supports scroll behaviors. */\nlet scrollBehaviorSupported;\n/** Check whether the browser supports scroll behaviors. */\nfunction supportsScrollBehavior() {\n if (scrollBehaviorSupported == null) {\n // If we're not in the browser, it can't be supported. Also check for `Element`, because\n // some projects stub out the global `document` during SSR which can throw us off.\n if (typeof document !== 'object' || !document || typeof Element !== 'function' || !Element) {\n scrollBehaviorSupported = false;\n return scrollBehaviorSupported;\n }\n // If the element can have a `scrollBehavior` style, we can be sure that it's supported.\n if ('scrollBehavior' in document.documentElement.style) {\n scrollBehaviorSupported = true;\n }\n else {\n // At this point we have 3 possibilities: `scrollTo` isn't supported at all, it's\n // supported but it doesn't handle scroll behavior, or it has been polyfilled.\n const scrollToFunction = Element.prototype.scrollTo;\n if (scrollToFunction) {\n // We can detect if the function has been polyfilled by calling `toString` on it. Native\n // functions are obfuscated using `[native code]`, whereas if it was overwritten we'd get\n // the actual function source. Via https://davidwalsh.name/detect-native-function. Consider\n // polyfilled functions as supporting scroll behavior.\n scrollBehaviorSupported = !/\\{\\s*\\[native code\\]\\s*\\}/.test(scrollToFunction.toString());\n }\n else {\n scrollBehaviorSupported = false;\n }\n }\n }\n return scrollBehaviorSupported;\n}\n/**\n * Checks the type of RTL scroll axis used by this browser. As of time of writing, Chrome is NORMAL,\n * Firefox & Safari are NEGATED, and IE & Edge are INVERTED.\n */\nfunction getRtlScrollAxisType() {\n // We can't check unless we're on the browser. Just assume 'normal' if we're not.\n if (typeof document !== 'object' || !document) {\n return 0 /* NORMAL */;\n }\n if (rtlScrollAxisType == null) {\n // Create a 1px wide scrolling container and a 2px wide content element.\n const scrollContainer = document.createElement('div');\n const containerStyle = scrollContainer.style;\n scrollContainer.dir = 'rtl';\n containerStyle.width = '1px';\n containerStyle.overflow = 'auto';\n containerStyle.visibility = 'hidden';\n containerStyle.pointerEvents = 'none';\n containerStyle.position = 'absolute';\n const content = document.createElement('div');\n const contentStyle = content.style;\n contentStyle.width = '2px';\n contentStyle.height = '1px';\n scrollContainer.appendChild(content);\n document.body.appendChild(scrollContainer);\n rtlScrollAxisType = 0 /* NORMAL */;\n // The viewport starts scrolled all the way to the right in RTL mode. If we are in a NORMAL\n // browser this would mean that the scrollLeft should be 1. If it's zero instead we know we're\n // dealing with one of the other two types of browsers.\n if (scrollContainer.scrollLeft === 0) {\n // In a NEGATED browser the scrollLeft is always somewhere in [-maxScrollAmount, 0]. For an\n // INVERTED browser it is always somewhere in [0, maxScrollAmount]. We can determine which by\n // setting to the scrollLeft to 1. This is past the max for a NEGATED browser, so it will\n // return 0 when we read it again.\n scrollContainer.scrollLeft = 1;\n rtlScrollAxisType =\n scrollContainer.scrollLeft === 0 ? 1 /* NEGATED */ : 2 /* INVERTED */;\n }\n scrollContainer.remove();\n }\n return rtlScrollAxisType;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet shadowDomIsSupported;\n/** Checks whether the user's browser support Shadow DOM. */\nfunction _supportsShadowDom() {\n if (shadowDomIsSupported == null) {\n const head = typeof document !== 'undefined' ? document.head : null;\n shadowDomIsSupported = !!(head && (head.createShadowRoot || head.attachShadow));\n }\n return shadowDomIsSupported;\n}\n/** Gets the shadow root of an element, if supported and the element is inside the Shadow DOM. */\nfunction _getShadowRoot(element) {\n if (_supportsShadowDom()) {\n const rootNode = element.getRootNode ? element.getRootNode() : null;\n // Note that this should be caught by `_supportsShadowDom`, but some\n // teams have been able to hit this code path on unsupported browsers.\n if (typeof ShadowRoot !== 'undefined' && ShadowRoot && rootNode instanceof ShadowRoot) {\n return rootNode;\n }\n }\n return null;\n}\n/**\n * Gets the currently-focused element on the page while\n * also piercing through Shadow DOM boundaries.\n */\nfunction _getFocusedElementPierceShadowDom() {\n let activeElement = typeof document !== 'undefined' && document\n ? document.activeElement\n : null;\n while (activeElement && activeElement.shadowRoot) {\n const newActiveElement = activeElement.shadowRoot.activeElement;\n if (newActiveElement === activeElement) {\n break;\n }\n else {\n activeElement = newActiveElement;\n }\n }\n return activeElement;\n}\n/** Gets the target of an event while accounting for Shadow DOM. */\nfunction _getEventTarget(event) {\n // If an event is bound outside the Shadow DOM, the `event.target` will\n // point to the shadow root so we have to use `composedPath` instead.\n return (event.composedPath ? event.composedPath()[0] : event.target);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether the code is currently running in a test environment. */\nfunction _isTestEnvironment() {\n // We can't use `declare const` because it causes conflicts inside Google with the real typings\n // for these symbols and we can't read them off the global object, because they don't appear to\n // be attached there for some runners like Jest.\n // (see: https://github.com/angular/components/issues/23365#issuecomment-938146643)\n return (\n // @ts-ignore\n (typeof __karma__ !== 'undefined' && !!__karma__) ||\n // @ts-ignore\n (typeof jasmine !== 'undefined' && !!jasmine) ||\n // @ts-ignore\n (typeof jest !== 'undefined' && !!jest) ||\n // @ts-ignore\n (typeof Mocha !== 'undefined' && !!Mocha));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { Platform, PlatformModule, _getEventTarget, _getFocusedElementPierceShadowDom, _getShadowRoot, _isTestEnvironment, _supportsShadowDom, getRtlScrollAxisType, getSupportedInputTypes, normalizePassiveListenerOptions, supportsPassiveEventListeners, supportsScrollBehavior };\n","import * as i0 from '@angular/core';\nimport { ElementRef, Directive, EventEmitter, Inject, Output, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Throws an exception when attempting to attach a null portal to a host.\n * @docs-private\n */\nfunction throwNullPortalError() {\n throw Error('Must provide a portal to attach');\n}\n/**\n * Throws an exception when attempting to attach a portal to a host that is already attached.\n * @docs-private\n */\nfunction throwPortalAlreadyAttachedError() {\n throw Error('Host already has a portal attached');\n}\n/**\n * Throws an exception when attempting to attach a portal to an already-disposed host.\n * @docs-private\n */\nfunction throwPortalOutletAlreadyDisposedError() {\n throw Error('This PortalOutlet has already been disposed');\n}\n/**\n * Throws an exception when attempting to attach an unknown portal type.\n * @docs-private\n */\nfunction throwUnknownPortalTypeError() {\n throw Error('Attempting to attach an unknown Portal type. BasePortalOutlet accepts either ' +\n 'a ComponentPortal or a TemplatePortal.');\n}\n/**\n * Throws an exception when attempting to attach a portal to a null host.\n * @docs-private\n */\nfunction throwNullPortalOutletError() {\n throw Error('Attempting to attach a portal to a null PortalOutlet');\n}\n/**\n * Throws an exception when attempting to detach a portal that is not attached.\n * @docs-private\n */\nfunction throwNoPortalAttachedError() {\n throw Error('Attempting to detach a portal that is not attached to a host');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A `Portal` is something that you want to render somewhere else.\n * It can be attach to / detached from a `PortalOutlet`.\n */\nclass Portal {\n /** Attach this portal to a host. */\n attach(host) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (host == null) {\n throwNullPortalOutletError();\n }\n if (host.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n }\n this._attachedHost = host;\n return host.attach(this);\n }\n /** Detach this portal from its host */\n detach() {\n let host = this._attachedHost;\n if (host != null) {\n this._attachedHost = null;\n host.detach();\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwNoPortalAttachedError();\n }\n }\n /** Whether this portal is attached to a host. */\n get isAttached() {\n return this._attachedHost != null;\n }\n /**\n * Sets the PortalOutlet reference without performing `attach()`. This is used directly by\n * the PortalOutlet when it is performing an `attach()` or `detach()`.\n */\n setAttachedHost(host) {\n this._attachedHost = host;\n }\n}\n/**\n * A `ComponentPortal` is a portal that instantiates some Component upon attachment.\n */\nclass ComponentPortal extends Portal {\n constructor(component, viewContainerRef, injector, componentFactoryResolver) {\n super();\n this.component = component;\n this.viewContainerRef = viewContainerRef;\n this.injector = injector;\n this.componentFactoryResolver = componentFactoryResolver;\n }\n}\n/**\n * A `TemplatePortal` is a portal that represents some embedded template (TemplateRef).\n */\nclass TemplatePortal extends Portal {\n constructor(template, viewContainerRef, context) {\n super();\n this.templateRef = template;\n this.viewContainerRef = viewContainerRef;\n this.context = context;\n }\n get origin() {\n return this.templateRef.elementRef;\n }\n /**\n * Attach the portal to the provided `PortalOutlet`.\n * When a context is provided it will override the `context` property of the `TemplatePortal`\n * instance.\n */\n attach(host, context = this.context) {\n this.context = context;\n return super.attach(host);\n }\n detach() {\n this.context = undefined;\n return super.detach();\n }\n}\n/**\n * A `DomPortal` is a portal whose DOM element will be taken from its current position\n * in the DOM and moved into a portal outlet, when it is attached. On detach, the content\n * will be restored to its original position.\n */\nclass DomPortal extends Portal {\n constructor(element) {\n super();\n this.element = element instanceof ElementRef ? element.nativeElement : element;\n }\n}\n/**\n * Partial implementation of PortalOutlet that handles attaching\n * ComponentPortal and TemplatePortal.\n */\nclass BasePortalOutlet {\n constructor() {\n /** Whether this host has already been permanently disposed. */\n this._isDisposed = false;\n // @breaking-change 10.0.0 `attachDomPortal` to become a required abstract method.\n this.attachDomPortal = null;\n }\n /** Whether this host has an attached portal. */\n hasAttached() {\n return !!this._attachedPortal;\n }\n /** Attaches a portal. */\n attach(portal) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!portal) {\n throwNullPortalError();\n }\n if (this.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n if (this._isDisposed) {\n throwPortalOutletAlreadyDisposedError();\n }\n }\n if (portal instanceof ComponentPortal) {\n this._attachedPortal = portal;\n return this.attachComponentPortal(portal);\n }\n else if (portal instanceof TemplatePortal) {\n this._attachedPortal = portal;\n return this.attachTemplatePortal(portal);\n // @breaking-change 10.0.0 remove null check for `this.attachDomPortal`.\n }\n else if (this.attachDomPortal && portal instanceof DomPortal) {\n this._attachedPortal = portal;\n return this.attachDomPortal(portal);\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwUnknownPortalTypeError();\n }\n }\n /** Detaches a previously attached portal. */\n detach() {\n if (this._attachedPortal) {\n this._attachedPortal.setAttachedHost(null);\n this._attachedPortal = null;\n }\n this._invokeDisposeFn();\n }\n /** Permanently dispose of this portal host. */\n dispose() {\n if (this.hasAttached()) {\n this.detach();\n }\n this._invokeDisposeFn();\n this._isDisposed = true;\n }\n /** @docs-private */\n setDisposeFn(fn) {\n this._disposeFn = fn;\n }\n _invokeDisposeFn() {\n if (this._disposeFn) {\n this._disposeFn();\n this._disposeFn = null;\n }\n }\n}\n/**\n * @deprecated Use `BasePortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass BasePortalHost extends BasePortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A PortalOutlet for attaching portals to an arbitrary DOM element outside of the Angular\n * application context.\n */\nclass DomPortalOutlet extends BasePortalOutlet {\n constructor(\n /** Element into which the content is projected. */\n outletElement, _componentFactoryResolver, _appRef, _defaultInjector, \n /**\n * @deprecated `_document` Parameter to be made required.\n * @breaking-change 10.0.0\n */\n _document) {\n super();\n this.outletElement = outletElement;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n this._defaultInjector = _defaultInjector;\n /**\n * Attaches a DOM portal by transferring its content into the outlet.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 10.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n element.parentNode.insertBefore(anchorNode, element);\n this.outletElement.appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n // We can't use `replaceWith` here because IE doesn't support it.\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /**\n * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver.\n * @param portal Portal to be attached\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n let componentRef;\n // If the portal specifies a ViewContainerRef, we will use that as the attachment point\n // for the component (in terms of Angular's component tree, not rendering).\n // When the ViewContainerRef is missing, we use the factory to create the component directly\n // and then manually attach the view to the application.\n if (portal.viewContainerRef) {\n componentRef = portal.viewContainerRef.createComponent(componentFactory, portal.viewContainerRef.length, portal.injector || portal.viewContainerRef.injector);\n this.setDisposeFn(() => componentRef.destroy());\n }\n else {\n componentRef = componentFactory.create(portal.injector || this._defaultInjector);\n this._appRef.attachView(componentRef.hostView);\n this.setDisposeFn(() => {\n this._appRef.detachView(componentRef.hostView);\n componentRef.destroy();\n });\n }\n // At this point the component has been instantiated, so we move it to the location in the DOM\n // where we want it to be rendered.\n this.outletElement.appendChild(this._getComponentRootNode(componentRef));\n this._attachedPortal = portal;\n return componentRef;\n }\n /**\n * Attaches a template portal to the DOM as an embedded view.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n let viewContainer = portal.viewContainerRef;\n let viewRef = viewContainer.createEmbeddedView(portal.templateRef, portal.context);\n // The method `createEmbeddedView` will add the view as a child of the viewContainer.\n // But for the DomPortalOutlet the view can be added everywhere in the DOM\n // (e.g Overlay Container) To move the view to the specified host element. We just\n // re-append the existing root nodes.\n viewRef.rootNodes.forEach(rootNode => this.outletElement.appendChild(rootNode));\n // Note that we want to detect changes after the nodes have been moved so that\n // any directives inside the portal that are looking at the DOM inside a lifecycle\n // hook won't be invoked too early.\n viewRef.detectChanges();\n this.setDisposeFn(() => {\n let index = viewContainer.indexOf(viewRef);\n if (index !== -1) {\n viewContainer.remove(index);\n }\n });\n this._attachedPortal = portal;\n // TODO(jelbourn): Return locals from view.\n return viewRef;\n }\n /**\n * Clears out a portal from the DOM.\n */\n dispose() {\n super.dispose();\n this.outletElement.remove();\n }\n /** Gets the root HTMLElement for an instantiated component. */\n _getComponentRootNode(componentRef) {\n return componentRef.hostView.rootNodes[0];\n }\n}\n/**\n * @deprecated Use `DomPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass DomPortalHost extends DomPortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive version of a `TemplatePortal`. Because the directive *is* a TemplatePortal,\n * the directive instance itself can be attached to a host, enabling declarative use of portals.\n */\nclass CdkPortal extends TemplatePortal {\n constructor(templateRef, viewContainerRef) {\n super(templateRef, viewContainerRef);\n }\n}\nCdkPortal.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkPortal, deps: [{ token: i0.TemplateRef }, { token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortal.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkPortal, selector: \"[cdkPortal]\", exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkPortal, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortal]',\n exportAs: 'cdkPortal',\n }]\n }], ctorParameters: function () { return [{ type: i0.TemplateRef }, { type: i0.ViewContainerRef }]; } });\n/**\n * @deprecated Use `CdkPortal` instead.\n * @breaking-change 9.0.0\n */\nclass TemplatePortalDirective extends CdkPortal {\n}\nTemplatePortalDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: TemplatePortalDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nTemplatePortalDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: TemplatePortalDirective, selector: \"[cdk-portal], [portal]\", providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ], exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: TemplatePortalDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-portal], [portal]',\n exportAs: 'cdkPortal',\n providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ],\n }]\n }] });\n/**\n * Directive version of a PortalOutlet. Because the directive *is* a PortalOutlet, portals can be\n * directly attached to it, enabling declarative use.\n *\n * Usage:\n * ``\n */\nclass CdkPortalOutlet extends BasePortalOutlet {\n constructor(_componentFactoryResolver, _viewContainerRef, \n /**\n * @deprecated `_document` parameter to be made required.\n * @breaking-change 9.0.0\n */\n _document) {\n super();\n this._componentFactoryResolver = _componentFactoryResolver;\n this._viewContainerRef = _viewContainerRef;\n /** Whether the portal component is initialized. */\n this._isInitialized = false;\n /** Emits when a portal is attached to the outlet. */\n this.attached = new EventEmitter();\n /**\n * Attaches the given DomPortal to this PortalHost by moving all of the portal content into it.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 9.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n portal.setAttachedHost(this);\n element.parentNode.insertBefore(anchorNode, element);\n this._getRootNode().appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /** Portal associated with the Portal outlet. */\n get portal() {\n return this._attachedPortal;\n }\n set portal(portal) {\n // Ignore the cases where the `portal` is set to a falsy value before the lifecycle hooks have\n // run. This handles the cases where the user might do something like `
`\n // and attach a portal programmatically in the parent component. When Angular does the first CD\n // round, it will fire the setter with empty string, causing the user's content to be cleared.\n if (this.hasAttached() && !portal && !this._isInitialized) {\n return;\n }\n if (this.hasAttached()) {\n super.detach();\n }\n if (portal) {\n super.attach(portal);\n }\n this._attachedPortal = portal || null;\n }\n /** Component or view reference that is attached to the portal. */\n get attachedRef() {\n return this._attachedRef;\n }\n ngOnInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n super.dispose();\n this._attachedPortal = null;\n this._attachedRef = null;\n }\n /**\n * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.\n *\n * @param portal Portal to be attached to the portal outlet.\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n portal.setAttachedHost(this);\n // If the portal specifies an origin, use that as the logical location of the component\n // in the application tree. Otherwise use the location of this PortalOutlet.\n const viewContainerRef = portal.viewContainerRef != null ? portal.viewContainerRef : this._viewContainerRef;\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector);\n // If we're using a view container that's different from the injected one (e.g. when the portal\n // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered\n // inside of the alternate view container.\n if (viewContainerRef !== this._viewContainerRef) {\n this._getRootNode().appendChild(ref.hostView.rootNodes[0]);\n }\n super.setDisposeFn(() => ref.destroy());\n this._attachedPortal = portal;\n this._attachedRef = ref;\n this.attached.emit(ref);\n return ref;\n }\n /**\n * Attach the given TemplatePortal to this PortalHost as an embedded View.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n portal.setAttachedHost(this);\n const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context);\n super.setDisposeFn(() => this._viewContainerRef.clear());\n this._attachedPortal = portal;\n this._attachedRef = viewRef;\n this.attached.emit(viewRef);\n return viewRef;\n }\n /** Gets the root node of the portal outlet. */\n _getRootNode() {\n const nativeElement = this._viewContainerRef.element.nativeElement;\n // The directive could be set on a template which will result in a comment\n // node being the root. Use the comment's parent node if that is the case.\n return (nativeElement.nodeType === nativeElement.ELEMENT_NODE\n ? nativeElement\n : nativeElement.parentNode);\n }\n}\nCdkPortalOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkPortalOutlet, deps: [{ token: i0.ComponentFactoryResolver }, { token: i0.ViewContainerRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortalOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkPortalOutlet, selector: \"[cdkPortalOutlet]\", inputs: { portal: [\"cdkPortalOutlet\", \"portal\"] }, outputs: { attached: \"attached\" }, exportAs: [\"cdkPortalOutlet\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkPortalOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalOutlet]',\n exportAs: 'cdkPortalOutlet',\n inputs: ['portal: cdkPortalOutlet'],\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ComponentFactoryResolver }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n }, propDecorators: { attached: [{\n type: Output\n }] } });\n/**\n * @deprecated Use `CdkPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass PortalHostDirective extends CdkPortalOutlet {\n}\nPortalHostDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PortalHostDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nPortalHostDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: PortalHostDirective, selector: \"[cdkPortalHost], [portalHost]\", inputs: { portal: [\"cdkPortalHost\", \"portal\"] }, providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ], exportAs: [\"cdkPortalHost\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PortalHostDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalHost], [portalHost]',\n exportAs: 'cdkPortalHost',\n inputs: ['portal: cdkPortalHost'],\n providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ],\n }]\n }] });\nclass PortalModule {\n}\nPortalModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PortalModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPortalModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PortalModule, declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] });\nPortalModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PortalModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: PortalModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Custom injector to be used when providing custom\n * injection tokens to components inside a portal.\n * @docs-private\n * @deprecated Use `Injector.create` instead.\n * @breaking-change 11.0.0\n */\nclass PortalInjector {\n constructor(_parentInjector, _customTokens) {\n this._parentInjector = _parentInjector;\n this._customTokens = _customTokens;\n }\n get(token, notFoundValue) {\n const value = this._customTokens.get(token);\n if (typeof value !== 'undefined') {\n return value;\n }\n return this._parentInjector.get(token, notFoundValue);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective };\n","import { coerceNumberProperty, coerceElement, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, forwardRef, Directive, Input, Injectable, Optional, Inject, Component, ViewEncapsulation, ChangeDetectionStrategy, Output, ViewChild, SkipSelf, NgModule } from '@angular/core';\nimport { Subject, of, Observable, fromEvent, animationFrameScheduler, asapScheduler, Subscription, isObservable } from 'rxjs';\nimport { distinctUntilChanged, auditTime, filter, takeUntil, startWith, pairwise, switchMap, shareReplay } from 'rxjs/operators';\nimport { DOCUMENT } from '@angular/common';\nimport * as i1 from '@angular/cdk/platform';\nimport { getRtlScrollAxisType, supportsScrollBehavior, PlatformModule } from '@angular/cdk/platform';\nimport * as i2 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport * as i2$1 from '@angular/cdk/collections';\nimport { isDataSource, ArrayDataSource, _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy } from '@angular/cdk/collections';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the virtual scrolling strategy. */\nconst VIRTUAL_SCROLL_STRATEGY = new InjectionToken('VIRTUAL_SCROLL_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Virtual scrolling strategy for lists with items of known fixed size. */\nclass FixedSizeVirtualScrollStrategy {\n /**\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n constructor(itemSize, minBufferPx, maxBufferPx) {\n this._scrolledIndexChange = new Subject();\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n this.scrolledIndexChange = this._scrolledIndexChange.pipe(distinctUntilChanged());\n /** The attached viewport. */\n this._viewport = null;\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n }\n /**\n * Attaches this scroll strategy to a viewport.\n * @param viewport The viewport to attach this strategy to.\n */\n attach(viewport) {\n this._viewport = viewport;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** Detaches this scroll strategy from the currently attached viewport. */\n detach() {\n this._scrolledIndexChange.complete();\n this._viewport = null;\n }\n /**\n * Update the item size and buffer size.\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) {\n if (maxBufferPx < minBufferPx && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx');\n }\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentScrolled() {\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onDataLengthChanged() {\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentRendered() {\n /* no-op */\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onRenderedOffsetChanged() {\n /* no-op */\n }\n /**\n * Scroll to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling.\n */\n scrollToIndex(index, behavior) {\n if (this._viewport) {\n this._viewport.scrollToOffset(index * this._itemSize, behavior);\n }\n }\n /** Update the viewport's total content size. */\n _updateTotalContentSize() {\n if (!this._viewport) {\n return;\n }\n this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize);\n }\n /** Update the viewport's rendered range. */\n _updateRenderedRange() {\n if (!this._viewport) {\n return;\n }\n const renderedRange = this._viewport.getRenderedRange();\n const newRange = { start: renderedRange.start, end: renderedRange.end };\n const viewportSize = this._viewport.getViewportSize();\n const dataLength = this._viewport.getDataLength();\n let scrollOffset = this._viewport.measureScrollOffset();\n // Prevent NaN as result when dividing by zero.\n let firstVisibleIndex = this._itemSize > 0 ? scrollOffset / this._itemSize : 0;\n // If user scrolls to the bottom of the list and data changes to a smaller list\n if (newRange.end > dataLength) {\n // We have to recalculate the first visible index based on new data length and viewport size.\n const maxVisibleItems = Math.ceil(viewportSize / this._itemSize);\n const newVisibleIndex = Math.max(0, Math.min(firstVisibleIndex, dataLength - maxVisibleItems));\n // If first visible index changed we must update scroll offset to handle start/end buffers\n // Current range must also be adjusted to cover the new position (bottom of new list).\n if (firstVisibleIndex != newVisibleIndex) {\n firstVisibleIndex = newVisibleIndex;\n scrollOffset = newVisibleIndex * this._itemSize;\n newRange.start = Math.floor(firstVisibleIndex);\n }\n newRange.end = Math.max(0, Math.min(dataLength, newRange.start + maxVisibleItems));\n }\n const startBuffer = scrollOffset - newRange.start * this._itemSize;\n if (startBuffer < this._minBufferPx && newRange.start != 0) {\n const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize);\n newRange.start = Math.max(0, newRange.start - expandStart);\n newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize));\n }\n else {\n const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize);\n if (endBuffer < this._minBufferPx && newRange.end != dataLength) {\n const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize);\n if (expandEnd > 0) {\n newRange.end = Math.min(dataLength, newRange.end + expandEnd);\n newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize));\n }\n }\n }\n this._viewport.setRenderedRange(newRange);\n this._viewport.setRenderedContentOffset(this._itemSize * newRange.start);\n this._scrolledIndexChange.next(Math.floor(firstVisibleIndex));\n }\n}\n/**\n * Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created\n * `FixedSizeVirtualScrollStrategy` from the given directive.\n * @param fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the\n * `FixedSizeVirtualScrollStrategy` from.\n */\nfunction _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) {\n return fixedSizeDir._scrollStrategy;\n}\n/** A virtual scroll strategy that supports fixed-size items. */\nclass CdkFixedSizeVirtualScroll {\n constructor() {\n this._itemSize = 20;\n this._minBufferPx = 100;\n this._maxBufferPx = 200;\n /** The scroll strategy used by this directive. */\n this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n /** The size of the items in the list (in pixels). */\n get itemSize() {\n return this._itemSize;\n }\n set itemSize(value) {\n this._itemSize = coerceNumberProperty(value);\n }\n /**\n * The minimum amount of buffer rendered beyond the viewport (in pixels).\n * If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px.\n */\n get minBufferPx() {\n return this._minBufferPx;\n }\n set minBufferPx(value) {\n this._minBufferPx = coerceNumberProperty(value);\n }\n /**\n * The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px.\n */\n get maxBufferPx() {\n return this._maxBufferPx;\n }\n set maxBufferPx(value) {\n this._maxBufferPx = coerceNumberProperty(value);\n }\n ngOnChanges() {\n this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n}\nCdkFixedSizeVirtualScroll.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nCdkFixedSizeVirtualScroll.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkFixedSizeVirtualScroll, selector: \"cdk-virtual-scroll-viewport[itemSize]\", inputs: { itemSize: \"itemSize\", minBufferPx: \"minBufferPx\", maxBufferPx: \"maxBufferPx\" }, providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[itemSize]',\n providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ],\n }]\n }], propDecorators: { itemSize: [{\n type: Input\n }], minBufferPx: [{\n type: Input\n }], maxBufferPx: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the scrolling events by default. */\nconst DEFAULT_SCROLL_TIME = 20;\n/**\n * Service contained all registered Scrollable references and emits an event when any one of the\n * Scrollable references emit a scrolled event.\n */\nclass ScrollDispatcher {\n constructor(_ngZone, _platform, document) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n /** Subject for notifying that a registered scrollable reference element has been scrolled. */\n this._scrolled = new Subject();\n /** Keeps track of the global `scroll` and `resize` subscriptions. */\n this._globalSubscription = null;\n /** Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards. */\n this._scrolledCount = 0;\n /**\n * Map of all the scrollable references that are registered with the service and their\n * scroll event subscriptions.\n */\n this.scrollContainers = new Map();\n this._document = document;\n }\n /**\n * Registers a scrollable instance with the service and listens for its scrolled events. When the\n * scrollable is scrolled, the service emits the event to its scrolled observable.\n * @param scrollable Scrollable instance to be registered.\n */\n register(scrollable) {\n if (!this.scrollContainers.has(scrollable)) {\n this.scrollContainers.set(scrollable, scrollable.elementScrolled().subscribe(() => this._scrolled.next(scrollable)));\n }\n }\n /**\n * Deregisters a Scrollable reference and unsubscribes from its scroll event observable.\n * @param scrollable Scrollable instance to be deregistered.\n */\n deregister(scrollable) {\n const scrollableReference = this.scrollContainers.get(scrollable);\n if (scrollableReference) {\n scrollableReference.unsubscribe();\n this.scrollContainers.delete(scrollable);\n }\n }\n /**\n * Returns an observable that emits an event whenever any of the registered Scrollable\n * references (or window, document, or body) fire a scrolled event. Can provide a time in ms\n * to override the default \"throttle\" time.\n *\n * **Note:** in order to avoid hitting change detection for every scroll event,\n * all of the events emitted from this stream will be run outside the Angular zone.\n * If you need to update any data bindings as a result of a scroll event, you have\n * to run the callback using `NgZone.run`.\n */\n scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) {\n if (!this._platform.isBrowser) {\n return of();\n }\n return new Observable((observer) => {\n if (!this._globalSubscription) {\n this._addGlobalListener();\n }\n // In the case of a 0ms delay, use an observable without auditTime\n // since it does add a perceptible delay in processing overhead.\n const subscription = auditTimeInMs > 0\n ? this._scrolled.pipe(auditTime(auditTimeInMs)).subscribe(observer)\n : this._scrolled.subscribe(observer);\n this._scrolledCount++;\n return () => {\n subscription.unsubscribe();\n this._scrolledCount--;\n if (!this._scrolledCount) {\n this._removeGlobalListener();\n }\n };\n });\n }\n ngOnDestroy() {\n this._removeGlobalListener();\n this.scrollContainers.forEach((_, container) => this.deregister(container));\n this._scrolled.complete();\n }\n /**\n * Returns an observable that emits whenever any of the\n * scrollable ancestors of an element are scrolled.\n * @param elementOrElementRef Element whose ancestors to listen for.\n * @param auditTimeInMs Time to throttle the scroll events.\n */\n ancestorScrolled(elementOrElementRef, auditTimeInMs) {\n const ancestors = this.getAncestorScrollContainers(elementOrElementRef);\n return this.scrolled(auditTimeInMs).pipe(filter(target => {\n return !target || ancestors.indexOf(target) > -1;\n }));\n }\n /** Returns all registered Scrollables that contain the provided element. */\n getAncestorScrollContainers(elementOrElementRef) {\n const scrollingContainers = [];\n this.scrollContainers.forEach((_subscription, scrollable) => {\n if (this._scrollableContainsElement(scrollable, elementOrElementRef)) {\n scrollingContainers.push(scrollable);\n }\n });\n return scrollingContainers;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Returns true if the element is contained within the provided Scrollable. */\n _scrollableContainsElement(scrollable, elementOrElementRef) {\n let element = coerceElement(elementOrElementRef);\n let scrollableElement = scrollable.getElementRef().nativeElement;\n // Traverse through the element parents until we reach null, checking if any of the elements\n // are the scrollable's element.\n do {\n if (element == scrollableElement) {\n return true;\n }\n } while ((element = element.parentElement));\n return false;\n }\n /** Sets up the global scroll listeners. */\n _addGlobalListener() {\n this._globalSubscription = this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n return fromEvent(window.document, 'scroll').subscribe(() => this._scrolled.next());\n });\n }\n /** Cleans up the global scroll listener. */\n _removeGlobalListener() {\n if (this._globalSubscription) {\n this._globalSubscription.unsubscribe();\n this._globalSubscription = null;\n }\n }\n}\nScrollDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollDispatcher, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: i0.NgZone }, { type: i1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n\n/**\n * Sends an event when the directive's element is scrolled. Registers itself with the\n * ScrollDispatcher service to include itself as part of its collection of scrolling events that it\n * can be listened to through the service.\n */\nclass CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n this.elementRef = elementRef;\n this.scrollDispatcher = scrollDispatcher;\n this.ngZone = ngZone;\n this.dir = dir;\n this._destroyed = new Subject();\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(this.elementRef.nativeElement, 'scroll')\n .pipe(takeUntil(this._destroyed))\n .subscribe(observer)));\n }\n ngOnInit() {\n this.scrollDispatcher.register(this);\n }\n ngOnDestroy() {\n this.scrollDispatcher.deregister(this);\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Returns observable that emits when a scroll event is fired on the host element. */\n elementScrolled() {\n return this._elementScrolled;\n }\n /** Gets the ElementRef for the viewport. */\n getElementRef() {\n return this.elementRef;\n }\n /**\n * Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo\n * method, since browsers are not consistent about what scrollLeft means in RTL. For this method\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param options specified the offsets to scroll to.\n */\n scrollTo(options) {\n const el = this.elementRef.nativeElement;\n const isRtl = this.dir && this.dir.value == 'rtl';\n // Rewrite start & end offsets as right or left offsets.\n if (options.left == null) {\n options.left = isRtl ? options.end : options.start;\n }\n if (options.right == null) {\n options.right = isRtl ? options.start : options.end;\n }\n // Rewrite the bottom offset as a top offset.\n if (options.bottom != null) {\n options.top =\n el.scrollHeight - el.clientHeight - options.bottom;\n }\n // Rewrite the right offset as a left offset.\n if (isRtl && getRtlScrollAxisType() != 0 /* NORMAL */) {\n if (options.left != null) {\n options.right =\n el.scrollWidth - el.clientWidth - options.left;\n }\n if (getRtlScrollAxisType() == 2 /* INVERTED */) {\n options.left = options.right;\n }\n else if (getRtlScrollAxisType() == 1 /* NEGATED */) {\n options.left = options.right ? -options.right : options.right;\n }\n }\n else {\n if (options.right != null) {\n options.left =\n el.scrollWidth - el.clientWidth - options.right;\n }\n }\n this._applyScrollToOptions(options);\n }\n _applyScrollToOptions(options) {\n const el = this.elementRef.nativeElement;\n if (supportsScrollBehavior()) {\n el.scrollTo(options);\n }\n else {\n if (options.top != null) {\n el.scrollTop = options.top;\n }\n if (options.left != null) {\n el.scrollLeft = options.left;\n }\n }\n }\n /**\n * Measures the scroll offset relative to the specified edge of the viewport. This method can be\n * used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent\n * about what scrollLeft means in RTL. The values returned by this method are normalized such that\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param from The edge to measure from.\n */\n measureScrollOffset(from) {\n const LEFT = 'left';\n const RIGHT = 'right';\n const el = this.elementRef.nativeElement;\n if (from == 'top') {\n return el.scrollTop;\n }\n if (from == 'bottom') {\n return el.scrollHeight - el.clientHeight - el.scrollTop;\n }\n // Rewrite start & end as left or right offsets.\n const isRtl = this.dir && this.dir.value == 'rtl';\n if (from == 'start') {\n from = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n from = isRtl ? LEFT : RIGHT;\n }\n if (isRtl && getRtlScrollAxisType() == 2 /* INVERTED */) {\n // For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n else {\n return el.scrollLeft;\n }\n }\n else if (isRtl && getRtlScrollAxisType() == 1 /* NEGATED */) {\n // For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft + el.scrollWidth - el.clientWidth;\n }\n else {\n return -el.scrollLeft;\n }\n }\n else {\n // For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and\n // (scrollWidth - clientWidth) when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft;\n }\n else {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n }\n }\n}\nCdkScrollable.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkScrollable.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkScrollable, selector: \"[cdk-scrollable], [cdkScrollable]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkScrollable, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-scrollable], [cdkScrollable]',\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }];\n } });\n\n/** Time in ms to throttle the resize events by default. */\nconst DEFAULT_RESIZE_TIME = 20;\n/**\n * Simple utility for getting the bounds of the browser viewport.\n * @docs-private\n */\nclass ViewportRuler {\n constructor(_platform, ngZone, document) {\n this._platform = _platform;\n /** Stream of viewport change events. */\n this._change = new Subject();\n /** Event listener that will be used to handle the viewport change events. */\n this._changeListener = (event) => {\n this._change.next(event);\n };\n this._document = document;\n ngZone.runOutsideAngular(() => {\n if (_platform.isBrowser) {\n const window = this._getWindow();\n // Note that bind the events ourselves, rather than going through something like RxJS's\n // `fromEvent` so that we can ensure that they're bound outside of the NgZone.\n window.addEventListener('resize', this._changeListener);\n window.addEventListener('orientationchange', this._changeListener);\n }\n // Clear the cached position so that the viewport is re-measured next time it is required.\n // We don't need to keep track of the subscription, because it is completed on destroy.\n this.change().subscribe(() => (this._viewportSize = null));\n });\n }\n ngOnDestroy() {\n if (this._platform.isBrowser) {\n const window = this._getWindow();\n window.removeEventListener('resize', this._changeListener);\n window.removeEventListener('orientationchange', this._changeListener);\n }\n this._change.complete();\n }\n /** Returns the viewport's width and height. */\n getViewportSize() {\n if (!this._viewportSize) {\n this._updateViewportSize();\n }\n const output = { width: this._viewportSize.width, height: this._viewportSize.height };\n // If we're not on a browser, don't cache the size since it'll be mocked out anyway.\n if (!this._platform.isBrowser) {\n this._viewportSize = null;\n }\n return output;\n }\n /** Gets a ClientRect for the viewport's bounds. */\n getViewportRect() {\n // Use the document element's bounding rect rather than the window scroll properties\n // (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll\n // properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different\n // conceptual viewports. Under most circumstances these viewports are equivalent, but they\n // can disagree when the page is pinch-zoomed (on devices that support touch).\n // See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4\n // We use the documentElement instead of the body because, by default (without a css reset)\n // browsers typically give the document body an 8px margin, which is not included in\n // getBoundingClientRect().\n const scrollPosition = this.getViewportScrollPosition();\n const { width, height } = this.getViewportSize();\n return {\n top: scrollPosition.top,\n left: scrollPosition.left,\n bottom: scrollPosition.top + height,\n right: scrollPosition.left + width,\n height,\n width,\n };\n }\n /** Gets the (top, left) scroll position of the viewport. */\n getViewportScrollPosition() {\n // While we can get a reference to the fake document\n // during SSR, it doesn't have getBoundingClientRect.\n if (!this._platform.isBrowser) {\n return { top: 0, left: 0 };\n }\n // The top-left-corner of the viewport is determined by the scroll position of the document\n // body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about\n // whether `document.body` or `document.documentElement` is the scrolled element, so reading\n // `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of\n // `document.documentElement` works consistently, where the `top` and `left` values will\n // equal negative the scroll position.\n const document = this._document;\n const window = this._getWindow();\n const documentElement = document.documentElement;\n const documentRect = documentElement.getBoundingClientRect();\n const top = -documentRect.top ||\n document.body.scrollTop ||\n window.scrollY ||\n documentElement.scrollTop ||\n 0;\n const left = -documentRect.left ||\n document.body.scrollLeft ||\n window.scrollX ||\n documentElement.scrollLeft ||\n 0;\n return { top, left };\n }\n /**\n * Returns a stream that emits whenever the size of the viewport changes.\n * This stream emits outside of the Angular zone.\n * @param throttleTime Time in milliseconds to throttle the stream.\n */\n change(throttleTime = DEFAULT_RESIZE_TIME) {\n return throttleTime > 0 ? this._change.pipe(auditTime(throttleTime)) : this._change;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Updates the cached viewport size. */\n _updateViewportSize() {\n const window = this._getWindow();\n this._viewportSize = this._platform.isBrowser\n ? { width: window.innerWidth, height: window.innerHeight }\n : { width: 0, height: 0 };\n }\n}\nViewportRuler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ViewportRuler, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nViewportRuler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ViewportRuler, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ViewportRuler, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: i1.Platform }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\n\n/** Checks if the given ranges are equal. */\nfunction rangesEqual(r1, r2) {\n return r1.start == r2.start && r1.end == r2.end;\n}\n/**\n * Scheduler to be used for scroll events. Needs to fall back to\n * something that doesn't rely on requestAnimationFrame on environments\n * that don't support it (e.g. server-side rendering).\n */\nconst SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? animationFrameScheduler : asapScheduler;\n/** A viewport that virtualizes its scrolling with the help of `CdkVirtualForOf`. */\nclass CdkVirtualScrollViewport extends CdkScrollable {\n constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher, viewportRuler) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n this.elementRef = elementRef;\n this._changeDetectorRef = _changeDetectorRef;\n this._scrollStrategy = _scrollStrategy;\n /** Emits when the viewport is detached from a CdkVirtualForOf. */\n this._detachedSubject = new Subject();\n /** Emits when the rendered range changes. */\n this._renderedRangeSubject = new Subject();\n this._orientation = 'vertical';\n this._appendOnly = false;\n // Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll\n // strategy lazily (i.e. only if the user is actually listening to the events). We do this because\n // depending on how the strategy calculates the scrolled index, it may come at a cost to\n // performance.\n /** Emits when the index of the first element visible in the viewport changes. */\n this.scrolledIndexChange = new Observable((observer) => this._scrollStrategy.scrolledIndexChange.subscribe(index => Promise.resolve().then(() => this.ngZone.run(() => observer.next(index)))));\n /** A stream that emits whenever the rendered range changes. */\n this.renderedRangeStream = this._renderedRangeSubject;\n /**\n * The total size of all content (in pixels), including content that is not currently rendered.\n */\n this._totalContentSize = 0;\n /** A string representing the `style.width` property value to be used for the spacer element. */\n this._totalContentWidth = '';\n /** A string representing the `style.height` property value to be used for the spacer element. */\n this._totalContentHeight = '';\n /** The currently rendered range of indices. */\n this._renderedRange = { start: 0, end: 0 };\n /** The length of the data bound to this viewport (in number of items). */\n this._dataLength = 0;\n /** The size of the viewport (in pixels). */\n this._viewportSize = 0;\n /** The last rendered content offset that was set. */\n this._renderedContentOffset = 0;\n /**\n * Whether the last rendered content offset was to the end of the content (and therefore needs to\n * be rewritten as an offset to the start of the content).\n */\n this._renderedContentOffsetNeedsRewrite = false;\n /** Whether there is a pending change detection cycle. */\n this._isChangeDetectionPending = false;\n /** A list of functions to run after the next change detection cycle. */\n this._runAfterChangeDetection = [];\n /** Subscription to changes in the viewport size. */\n this._viewportChanges = Subscription.EMPTY;\n if (!_scrollStrategy && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Error: cdk-virtual-scroll-viewport requires the \"itemSize\" property to be set.');\n }\n this._viewportChanges = viewportRuler.change().subscribe(() => {\n this.checkViewportSize();\n });\n }\n /** The direction the viewport scrolls. */\n get orientation() {\n return this._orientation;\n }\n set orientation(orientation) {\n if (this._orientation !== orientation) {\n this._orientation = orientation;\n this._calculateSpacerSize();\n }\n }\n /**\n * Whether rendered items should persist in the DOM after scrolling out of view. By default, items\n * will be removed.\n */\n get appendOnly() {\n return this._appendOnly;\n }\n set appendOnly(value) {\n this._appendOnly = coerceBooleanProperty(value);\n }\n ngOnInit() {\n super.ngOnInit();\n // It's still too early to measure the viewport at this point. Deferring with a promise allows\n // the Viewport to be rendered with the correct size before we measure. We run this outside the\n // zone to avoid causing more change detection cycles. We handle the change detection loop\n // ourselves instead.\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._measureViewportSize();\n this._scrollStrategy.attach(this);\n this.elementScrolled()\n .pipe(\n // Start off with a fake scroll event so we properly detect our initial position.\n startWith(null), \n // Collect multiple events into one until the next animation frame. This way if\n // there are multiple scroll events in the same frame we only need to recheck\n // our layout once.\n auditTime(0, SCROLL_SCHEDULER))\n .subscribe(() => this._scrollStrategy.onContentScrolled());\n this._markChangeDetectionNeeded();\n }));\n }\n ngOnDestroy() {\n this.detach();\n this._scrollStrategy.detach();\n // Complete all subjects\n this._renderedRangeSubject.complete();\n this._detachedSubject.complete();\n this._viewportChanges.unsubscribe();\n super.ngOnDestroy();\n }\n /** Attaches a `CdkVirtualScrollRepeater` to this viewport. */\n attach(forOf) {\n if (this._forOf && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CdkVirtualScrollViewport is already attached.');\n }\n // Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length\n // changes. Run outside the zone to avoid triggering change detection, since we're managing the\n // change detection loop ourselves.\n this.ngZone.runOutsideAngular(() => {\n this._forOf = forOf;\n this._forOf.dataStream.pipe(takeUntil(this._detachedSubject)).subscribe(data => {\n const newLength = data.length;\n if (newLength !== this._dataLength) {\n this._dataLength = newLength;\n this._scrollStrategy.onDataLengthChanged();\n }\n this._doChangeDetection();\n });\n });\n }\n /** Detaches the current `CdkVirtualForOf`. */\n detach() {\n this._forOf = null;\n this._detachedSubject.next();\n }\n /** Gets the length of the data bound to this viewport (in number of items). */\n getDataLength() {\n return this._dataLength;\n }\n /** Gets the size of the viewport (in pixels). */\n getViewportSize() {\n return this._viewportSize;\n }\n // TODO(mmalerba): This is technically out of sync with what's really rendered until a render\n // cycle happens. I'm being careful to only call it after the render cycle is complete and before\n // setting it to something else, but its error prone and should probably be split into\n // `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM.\n /** Get the current rendered range of items. */\n getRenderedRange() {\n return this._renderedRange;\n }\n /**\n * Sets the total size of all content (in pixels), including content that is not currently\n * rendered.\n */\n setTotalContentSize(size) {\n if (this._totalContentSize !== size) {\n this._totalContentSize = size;\n this._calculateSpacerSize();\n this._markChangeDetectionNeeded();\n }\n }\n /** Sets the currently rendered range of indices. */\n setRenderedRange(range) {\n if (!rangesEqual(this._renderedRange, range)) {\n if (this.appendOnly) {\n range = { start: 0, end: Math.max(this._renderedRange.end, range.end) };\n }\n this._renderedRangeSubject.next((this._renderedRange = range));\n this._markChangeDetectionNeeded(() => this._scrollStrategy.onContentRendered());\n }\n }\n /**\n * Gets the offset from the start of the viewport to the start of the rendered data (in pixels).\n */\n getOffsetToRenderedContentStart() {\n return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset;\n }\n /**\n * Sets the offset from the start of the viewport to either the start or end of the rendered data\n * (in pixels).\n */\n setRenderedContentOffset(offset, to = 'to-start') {\n // For a horizontal viewport in a right-to-left language we need to translate along the x-axis\n // in the negative direction.\n const isRtl = this.dir && this.dir.value == 'rtl';\n const isHorizontal = this.orientation == 'horizontal';\n const axis = isHorizontal ? 'X' : 'Y';\n const axisDirection = isHorizontal && isRtl ? -1 : 1;\n let transform = `translate${axis}(${Number(axisDirection * offset)}px)`;\n this._renderedContentOffset = offset;\n if (to === 'to-end') {\n transform += ` translate${axis}(-100%)`;\n // The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise\n // elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would\n // expand upward).\n this._renderedContentOffsetNeedsRewrite = true;\n }\n if (this._renderedContentTransform != transform) {\n // We know this value is safe because we parse `offset` with `Number()` before passing it\n // into the string.\n this._renderedContentTransform = transform;\n this._markChangeDetectionNeeded(() => {\n if (this._renderedContentOffsetNeedsRewrite) {\n this._renderedContentOffset -= this.measureRenderedContentSize();\n this._renderedContentOffsetNeedsRewrite = false;\n this.setRenderedContentOffset(this._renderedContentOffset);\n }\n else {\n this._scrollStrategy.onRenderedOffsetChanged();\n }\n });\n }\n }\n /**\n * Scrolls to the given offset from the start of the viewport. Please note that this is not always\n * the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left\n * direction, this would be the equivalent of setting a fictional `scrollRight` property.\n * @param offset The offset to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToOffset(offset, behavior = 'auto') {\n const options = { behavior };\n if (this.orientation === 'horizontal') {\n options.start = offset;\n }\n else {\n options.top = offset;\n }\n this.scrollTo(options);\n }\n /**\n * Scrolls to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToIndex(index, behavior = 'auto') {\n this._scrollStrategy.scrollToIndex(index, behavior);\n }\n /**\n * Gets the current scroll offset from the start of the viewport (in pixels).\n * @param from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start'\n * in horizontal mode.\n */\n measureScrollOffset(from) {\n return from\n ? super.measureScrollOffset(from)\n : super.measureScrollOffset(this.orientation === 'horizontal' ? 'start' : 'top');\n }\n /** Measure the combined size of all of the rendered items. */\n measureRenderedContentSize() {\n const contentEl = this._contentWrapper.nativeElement;\n return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight;\n }\n /**\n * Measure the total combined size of the given range. Throws if the range includes items that are\n * not rendered.\n */\n measureRangeSize(range) {\n if (!this._forOf) {\n return 0;\n }\n return this._forOf.measureRangeSize(range, this.orientation);\n }\n /** Update the viewport dimensions and re-render. */\n checkViewportSize() {\n // TODO: Cleanup later when add logic for handling content resize\n this._measureViewportSize();\n this._scrollStrategy.onDataLengthChanged();\n }\n /** Measure the viewport size. */\n _measureViewportSize() {\n const viewportEl = this.elementRef.nativeElement;\n this._viewportSize =\n this.orientation === 'horizontal' ? viewportEl.clientWidth : viewportEl.clientHeight;\n }\n /** Queue up change detection to run. */\n _markChangeDetectionNeeded(runAfter) {\n if (runAfter) {\n this._runAfterChangeDetection.push(runAfter);\n }\n // Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of\n // properties sequentially we only have to run `_doChangeDetection` once at the end.\n if (!this._isChangeDetectionPending) {\n this._isChangeDetectionPending = true;\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._doChangeDetection();\n }));\n }\n }\n /** Run change detection. */\n _doChangeDetection() {\n this._isChangeDetectionPending = false;\n // Apply the content transform. The transform can't be set via an Angular binding because\n // bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of\n // string literals, a variable that can only be 'X' or 'Y', and user input that is run through\n // the `Number` function first to coerce it to a numeric value.\n this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform;\n // Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection\n // from the root, since the repeated items are content projected in. Calling `detectChanges`\n // instead does not properly check the projected content.\n this.ngZone.run(() => this._changeDetectorRef.markForCheck());\n const runAfterChangeDetection = this._runAfterChangeDetection;\n this._runAfterChangeDetection = [];\n for (const fn of runAfterChangeDetection) {\n fn();\n }\n }\n /** Calculates the `style.width` and `style.height` for the spacer element. */\n _calculateSpacerSize() {\n this._totalContentHeight =\n this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`;\n this._totalContentWidth =\n this.orientation === 'horizontal' ? `${this._totalContentSize}px` : '';\n }\n}\nCdkVirtualScrollViewport.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkVirtualScrollViewport, deps: [{ token: i0.ElementRef }, { token: i0.ChangeDetectorRef }, { token: i0.NgZone }, { token: VIRTUAL_SCROLL_STRATEGY, optional: true }, { token: i2.Directionality, optional: true }, { token: ScrollDispatcher }, { token: ViewportRuler }], target: i0.ɵɵFactoryTarget.Component });\nCdkVirtualScrollViewport.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkVirtualScrollViewport, selector: \"cdk-virtual-scroll-viewport\", inputs: { orientation: \"orientation\", appendOnly: \"appendOnly\" }, outputs: { scrolledIndexChange: \"scrolledIndexChange\" }, host: { properties: { \"class.cdk-virtual-scroll-orientation-horizontal\": \"orientation === \\\"horizontal\\\"\", \"class.cdk-virtual-scroll-orientation-vertical\": \"orientation !== \\\"horizontal\\\"\" }, classAttribute: \"cdk-virtual-scroll-viewport\" }, providers: [\n {\n provide: CdkScrollable,\n useExisting: CdkVirtualScrollViewport,\n },\n ], viewQueries: [{ propertyName: \"_contentWrapper\", first: true, predicate: [\"contentWrapper\"], descendants: true, static: true }], usesInheritance: true, ngImport: i0, template: \"\\n
\\n\\n\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;overflow:auto;contain:strict;transform:translateZ(0);will-change:scroll-position;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{position:absolute;top:0;left:0;height:1px;width:1px;transform-origin:0 0}[dir=rtl] .cdk-virtual-scroll-spacer{right:0;left:auto;transform-origin:100% 0}\\n\"] }]\n }], ctorParameters: function () {\n return [{ type: i0.ElementRef }, { type: i0.ChangeDetectorRef }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLL_STRATEGY]\n }] }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }, { type: ScrollDispatcher }, { type: ViewportRuler }];\n }, propDecorators: { orientation: [{\n type: Input\n }], appendOnly: [{\n type: Input\n }], scrolledIndexChange: [{\n type: Output\n }], _contentWrapper: [{\n type: ViewChild,\n args: ['contentWrapper', { static: true }]\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Helper to extract the offset of a DOM Node in a certain direction. */\nfunction getOffset(orientation, direction, node) {\n const el = node;\n if (!el.getBoundingClientRect) {\n return 0;\n }\n const rect = el.getBoundingClientRect();\n if (orientation === 'horizontal') {\n return direction === 'start' ? rect.left : rect.right;\n }\n return direction === 'start' ? rect.top : rect.bottom;\n}\n/**\n * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling\n * container.\n */\nclass CdkVirtualForOf {\n constructor(\n /** The view container to add items to. */\n _viewContainerRef, \n /** The template to use when stamping out new items. */\n _template, \n /** The set of available differs. */\n _differs, \n /** The strategy used to render items in the virtual scroll viewport. */\n _viewRepeater, \n /** The virtual scrolling viewport that these items are being rendered in. */\n _viewport, ngZone) {\n this._viewContainerRef = _viewContainerRef;\n this._template = _template;\n this._differs = _differs;\n this._viewRepeater = _viewRepeater;\n this._viewport = _viewport;\n /** Emits when the rendered view of the data changes. */\n this.viewChange = new Subject();\n /** Subject that emits when a new DataSource instance is given. */\n this._dataSourceChanges = new Subject();\n /** Emits whenever the data in the current DataSource changes. */\n this.dataStream = this._dataSourceChanges.pipe(\n // Start off with null `DataSource`.\n startWith(null), \n // Bundle up the previous and current data sources so we can work with both.\n pairwise(), \n // Use `_changeDataSource` to disconnect from the previous data source and connect to the\n // new one, passing back a stream of data changes which we run through `switchMap` to give\n // us a data stream that emits the latest data from whatever the current `DataSource` is.\n switchMap(([prev, cur]) => this._changeDataSource(prev, cur)), \n // Replay the last emitted data when someone subscribes.\n shareReplay(1));\n /** The differ used to calculate changes to the data. */\n this._differ = null;\n /** Whether the rendered data should be updated during the next ngDoCheck cycle. */\n this._needsUpdate = false;\n this._destroyed = new Subject();\n this.dataStream.subscribe(data => {\n this._data = data;\n this._onRenderedDataChange();\n });\n this._viewport.renderedRangeStream.pipe(takeUntil(this._destroyed)).subscribe(range => {\n this._renderedRange = range;\n ngZone.run(() => this.viewChange.next(this._renderedRange));\n this._onRenderedDataChange();\n });\n this._viewport.attach(this);\n }\n /** The DataSource to display. */\n get cdkVirtualForOf() {\n return this._cdkVirtualForOf;\n }\n set cdkVirtualForOf(value) {\n this._cdkVirtualForOf = value;\n if (isDataSource(value)) {\n this._dataSourceChanges.next(value);\n }\n else {\n // If value is an an NgIterable, convert it to an array.\n this._dataSourceChanges.next(new ArrayDataSource(isObservable(value) ? value : Array.from(value || [])));\n }\n }\n /**\n * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and\n * the item and produces a value to be used as the item's identity when tracking changes.\n */\n get cdkVirtualForTrackBy() {\n return this._cdkVirtualForTrackBy;\n }\n set cdkVirtualForTrackBy(fn) {\n this._needsUpdate = true;\n this._cdkVirtualForTrackBy = fn\n ? (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item)\n : undefined;\n }\n /** The template used to stamp out new elements. */\n set cdkVirtualForTemplate(value) {\n if (value) {\n this._needsUpdate = true;\n this._template = value;\n }\n }\n /**\n * The size of the cache used to store templates that are not being used for re-use later.\n * Setting the cache size to `0` will disable caching. Defaults to 20 templates.\n */\n get cdkVirtualForTemplateCacheSize() {\n return this._viewRepeater.viewCacheSize;\n }\n set cdkVirtualForTemplateCacheSize(size) {\n this._viewRepeater.viewCacheSize = coerceNumberProperty(size);\n }\n /**\n * Measures the combined size (width for horizontal orientation, height for vertical) of all items\n * in the specified range. Throws an error if the range includes items that are not currently\n * rendered.\n */\n measureRangeSize(range, orientation) {\n if (range.start >= range.end) {\n return 0;\n }\n if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Error: attempted to measure an item that isn't rendered.`);\n }\n // The index into the list of rendered views for the first item in the range.\n const renderedStartIndex = range.start - this._renderedRange.start;\n // The length of the range we're measuring.\n const rangeLen = range.end - range.start;\n // Loop over all the views, find the first and land node and compute the size by subtracting\n // the top of the first node from the bottom of the last one.\n let firstNode;\n let lastNode;\n // Find the first node by starting from the beginning and going forwards.\n for (let i = 0; i < rangeLen; i++) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n firstNode = lastNode = view.rootNodes[0];\n break;\n }\n }\n // Find the last node by starting from the end and going backwards.\n for (let i = rangeLen - 1; i > -1; i--) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n lastNode = view.rootNodes[view.rootNodes.length - 1];\n break;\n }\n }\n return firstNode && lastNode\n ? getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode)\n : 0;\n }\n ngDoCheck() {\n if (this._differ && this._needsUpdate) {\n // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of\n // this list being rendered (can use simpler algorithm) vs needs update due to data actually\n // changing (need to do this diff).\n const changes = this._differ.diff(this._renderedItems);\n if (!changes) {\n this._updateContext();\n }\n else {\n this._applyChanges(changes);\n }\n this._needsUpdate = false;\n }\n }\n ngOnDestroy() {\n this._viewport.detach();\n this._dataSourceChanges.next(undefined);\n this._dataSourceChanges.complete();\n this.viewChange.complete();\n this._destroyed.next();\n this._destroyed.complete();\n this._viewRepeater.detach();\n }\n /** React to scroll state changes in the viewport. */\n _onRenderedDataChange() {\n if (!this._renderedRange) {\n return;\n }\n this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);\n if (!this._differ) {\n // Use a wrapper function for the `trackBy` so any new values are\n // picked up automatically without having to recreate the differ.\n this._differ = this._differs.find(this._renderedItems).create((index, item) => {\n return this.cdkVirtualForTrackBy ? this.cdkVirtualForTrackBy(index, item) : item;\n });\n }\n this._needsUpdate = true;\n }\n /** Swap out one `DataSource` for another. */\n _changeDataSource(oldDs, newDs) {\n if (oldDs) {\n oldDs.disconnect(this);\n }\n this._needsUpdate = true;\n return newDs ? newDs.connect(this) : of();\n }\n /** Update the `CdkVirtualForOfContext` for all views. */\n _updateContext() {\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n view.detectChanges();\n }\n }\n /** Apply changes to the DOM. */\n _applyChanges(changes) {\n this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), record => record.item);\n // Update $implicit for any items that had an identity change.\n changes.forEachIdentityChange((record) => {\n const view = this._viewContainerRef.get(record.currentIndex);\n view.context.$implicit = record.item;\n });\n // Update the context variables on all items.\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n }\n }\n /** Update the computed properties on the `CdkVirtualForOfContext`. */\n _updateComputedContextProperties(context) {\n context.first = context.index === 0;\n context.last = context.index === context.count - 1;\n context.even = context.index % 2 === 0;\n context.odd = !context.even;\n }\n _getEmbeddedViewArgs(record, index) {\n // Note that it's important that we insert the item directly at the proper index,\n // rather than inserting it and the moving it in place, because if there's a directive\n // on the same node that injects the `ViewContainerRef`, Angular will insert another\n // comment node which can throw off the move when it's being repeated for all items.\n return {\n templateRef: this._template,\n context: {\n $implicit: record.item,\n // It's guaranteed that the iterable is not \"undefined\" or \"null\" because we only\n // generate views for elements if the \"cdkVirtualForOf\" iterable has elements.\n cdkVirtualForOf: this._cdkVirtualForOf,\n index: -1,\n count: -1,\n first: false,\n last: false,\n odd: false,\n even: false,\n },\n index,\n };\n }\n}\nCdkVirtualForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkVirtualForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: _VIEW_REPEATER_STRATEGY }, { token: CdkVirtualScrollViewport, skipSelf: true }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.0\", type: CdkVirtualForOf, selector: \"[cdkVirtualFor][cdkVirtualForOf]\", inputs: { cdkVirtualForOf: \"cdkVirtualForOf\", cdkVirtualForTrackBy: \"cdkVirtualForTrackBy\", cdkVirtualForTemplate: \"cdkVirtualForTemplate\", cdkVirtualForTemplateCacheSize: \"cdkVirtualForTemplateCacheSize\" }, providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkVirtualForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualFor][cdkVirtualForOf]',\n providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }],\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: i2$1._RecycleViewRepeaterStrategy, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: CdkVirtualScrollViewport, decorators: [{\n type: SkipSelf\n }] }, { type: i0.NgZone }];\n }, propDecorators: { cdkVirtualForOf: [{\n type: Input\n }], cdkVirtualForTrackBy: [{\n type: Input\n }], cdkVirtualForTemplate: [{\n type: Input\n }], cdkVirtualForTemplateCacheSize: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass CdkScrollableModule {\n}\nCdkScrollableModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkScrollableModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCdkScrollableModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkScrollableModule, declarations: [CdkScrollable], exports: [CdkScrollable] });\nCdkScrollableModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkScrollableModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: CdkScrollableModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkScrollable],\n declarations: [CdkScrollable],\n }]\n }] });\n/**\n * @docs-primary-export\n */\nclass ScrollingModule {\n}\nScrollingModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollingModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nScrollingModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollingModule, declarations: [CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport], imports: [BidiModule, PlatformModule, CdkScrollableModule], exports: [BidiModule, CdkScrollableModule, CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport] });\nScrollingModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollingModule, imports: [[BidiModule, PlatformModule, CdkScrollableModule], BidiModule, CdkScrollableModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.0\", ngImport: i0, type: ScrollingModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule, PlatformModule, CdkScrollableModule],\n exports: [\n BidiModule,\n CdkScrollableModule,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n ],\n declarations: [CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory };\n","/**\n * @license Angular v13.1.3\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Injectable, ɵɵinject, Inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵisListLikeIterable, ɵstringify, Directive, Input, NgModuleRef, ComponentFactoryResolver, Host, ɵRuntimeError, Attribute, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setDOM(adapter) {\n _DOM = adapter;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A DI Token representing the main rendering context. In a browser this is the DOM Document.\n *\n * Note: Document might not be available in the Application Context when Application and Rendering\n * Contexts are not the same (e.g. when running the application in a Web Worker).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: useBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }] });\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._init();\n }\n // This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it\n /** @internal */\n _init() {\n this.location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this.location.href;\n }\n get protocol() {\n return this.location.protocol;\n }\n get hostname() {\n return this.location.hostname;\n }\n get port() {\n return this.location.port;\n }\n get pathname() {\n return this.location.pathname;\n }\n get search() {\n return this.location.search;\n }\n get hash() {\n return this.location.hash;\n }\n set pathname(newPath) {\n this.location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: BrowserPlatformLocation, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: createBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: provideLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: provideLocationStrategy }]\n }] });\nfunction provideLocationStrategy(platformLocation) {\n // See #23917\n const location = ɵɵinject(DOCUMENT).location;\n return new PathLocationStrategy(ɵɵinject(PlatformLocation), location && location.origin || '');\n}\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you must provide a {@link APP_BASE_HREF}\n * or add a `` element to the document.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n if (href == null) {\n href = this._platformLocation.getBaseHrefFromDOM();\n }\n if (href == null) {\n throw new Error(`No base href set. Please provide a value for the APP_BASE_HREF token or add a base element to the document.`);\n }\n this._baseHref = href;\n }\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nPathLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PathLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nHashLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: HashLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(platformStrategy, platformLocation) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n this._platformStrategy = platformStrategy;\n const browserBaseHref = this._platformStrategy.getBaseHref();\n this._platformLocation = platformLocation;\n this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));\n this._platformStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._platformStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._platformLocation.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._platformStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._platformStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._platformStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._platformStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._platformStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformStrategy).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }, { token: PlatformLocation }], target: i0.ɵɵFactoryTarget.Injectable });\nLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }, { type: PlatformLocation }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy), ɵɵinject(PlatformLocation));\n}\nfunction _stripBaseHref(baseHref, url) {\n return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, \"р.\", 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RUR\": [undefined, \"р.\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formating string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formating string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ISO8601_DATE_REGEX = /^(\\d{4})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ?\n dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' : value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.substr(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substr(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is supressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substr(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substr(0, pos).replace(/'/g, '');\n p.negSuf = negative.substr(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocaleLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgLocaleLocalization });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._initialClasses = [];\n this._rawClass = null;\n }\n set klass(value) {\n this._removeClasses(this._initialClasses);\n this._initialClasses = typeof value === 'string' ? value.split(/\\s+/) : [];\n this._applyClasses(this._initialClasses);\n this._applyClasses(this._rawClass);\n }\n set ngClass(value) {\n this._removeClasses(this._rawClass);\n this._applyClasses(this._initialClasses);\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._rawClass = typeof value === 'string' ? value.split(/\\s+/) : value;\n if (this._rawClass) {\n if (ɵisListLikeIterable(this._rawClass)) {\n this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();\n }\n else {\n this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();\n }\n }\n }\n ngDoCheck() {\n if (this._iterableDiffer) {\n const iterableChanges = this._iterableDiffer.diff(this._rawClass);\n if (iterableChanges) {\n this._applyIterableChanges(iterableChanges);\n }\n }\n else if (this._keyValueDiffer) {\n const keyValueChanges = this._keyValueDiffer.diff(this._rawClass);\n if (keyValueChanges) {\n this._applyKeyValueChanges(keyValueChanges);\n }\n }\n }\n _applyKeyValueChanges(changes) {\n changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachRemovedItem((record) => {\n if (record.previousValue) {\n this._toggleClass(record.key, false);\n }\n });\n }\n _applyIterableChanges(changes) {\n changes.forEachAddedItem((record) => {\n if (typeof record.item === 'string') {\n this._toggleClass(record.item, true);\n }\n else {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(record.item)}`);\n }\n });\n changes.forEachRemovedItem((record) => this._toggleClass(record.item, false));\n }\n /**\n * Applies a collection of CSS classes to the DOM element.\n *\n * For argument of type Set and Array CSS class names contained in those collections are always\n * added.\n * For argument of type Map CSS class name in the map's key is toggled based on the value (added\n * for truthy and removed for falsy).\n */\n _applyClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, true));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass]));\n }\n }\n }\n /**\n * Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup\n * purposes.\n */\n _removeClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, false));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false));\n }\n }\n }\n _toggleClass(klass, enabled) {\n klass = klass.trim();\n if (klass) {\n klass.split(/\\s+/g).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgClass.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgClass, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{ selector: '[ngClass]' }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModuleFactory`: Optional module factory to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized ngModuleFactory\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._componentRef = null;\n this._moduleRef = null;\n }\n ngOnChanges(changes) {\n this._viewContainerRef.clear();\n this._componentRef = null;\n if (this.ngComponentOutlet) {\n const elInjector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (this.ngComponentOutletNgModuleFactory) {\n const parentModule = elInjector.get(NgModuleRef);\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(parentModule.injector);\n }\n else {\n this._moduleRef = null;\n }\n }\n const componentFactoryResolver = this._moduleRef ? this._moduleRef.componentFactoryResolver :\n elInjector.get(ComponentFactoryResolver);\n const componentFactory = componentFactoryResolver.resolveComponentFactory(this.ngComponentOutlet);\n this._componentRef = this._viewContainerRef.createComponent(componentFactory, this._viewContainerRef.length, elInjector, this.ngComponentOutletContent);\n }\n }\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgComponentOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgComponentOutlet, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{ selector: '[ngComponentOutlet]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
` element.\n *\n * ```\n *
...
\n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `
` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n *
...
\n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/built-in-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For futher discussion, see\n * [Structural Directives](guide/built-in-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n *
\n * {{i}}/{{users.length}}. {{user}} default\n *
\n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {\n // TODO(vicb): use a log service once there is a public one available\n if (console && console.warn) {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch (_a) {\n throw new Error(`Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables such as Arrays.`);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\nNgForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgForOf, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{ selector: '[ngFor][ngForOf]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n *
Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n *
Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n *
Content to render when condition is true.
\n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n * \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n *
{{value}}
\n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n *
\n * ...\n *
\n *\n * \n *
Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n *
\n * ...\n *
\n * \n *\n * \n *
Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](https://angular.io/guide/built-in-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgIf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgIf, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{ selector: '[ngIf]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n if (!this._defaultViews) {\n this._defaultViews = [];\n }\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (let i = 0; i < this._defaultViews.length; i++) {\n const defaultView = this._defaultViews[i];\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitch.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgSwitch, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{ selector: '[ngSwitch]' }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgSwitchCase, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{ selector: '[ngSwitchCase]' }]\n }], ctorParameters: function () {\n return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }];\n }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchDefault.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgSwitchDefault, selector: \"[ngSwitchDefault]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{ selector: '[ngSwitchDefault]' }]\n }], ctorParameters: function () {\n return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }];\n } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._switchValue = value;\n this._updateView();\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView() {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(this._switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\nNgPlural.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgPlural, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{ selector: '[ngPlural]' }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgPluralCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgPluralCase, selector: \"[ngPluralCase]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{ selector: '[ngPluralCase]' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n value = value != null && unit ? `${value}${unit}` : value;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, value);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgStyle.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgStyle, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{ selector: '[ngStyle]' }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n }\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n this._viewRef = this.ngTemplateOutlet ?\n viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) :\n null;\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgTemplateOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.1.3\", type: NgTemplateOutlet, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{ selector: '[ngTemplateOutlet]' }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction invalidPipeArgumentError(type, value) {\n const errorMessage = (typeof ngDevMode === 'undefined' || ngDevMode) ?\n `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'` :\n '';\n return new ɵRuntimeError(2100 /* INVALID_PIPE_ARGUMENT */, errorMessage);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n onDestroy(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n onDestroy(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(_ref) {\n this._ref = _ref;\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\nAsyncPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: AsyncPipe, name: \"async\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'async', pure: false }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nLowerCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: LowerCasePipe, name: \"lowercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'lowercase' }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nTitleCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: TitleCasePipe, name: \"titlecase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'titlecase' }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nUpperCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: UpperCasePipe, name: \"uppercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'uppercase' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_TIMEZONE`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `
\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
`\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale, defaultTimezone) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n }\n transform(value, format = 'mediumDate', timezone, locale) {\n var _a;\n if (value == null || value === '' || value !== value)\n return null;\n try {\n return formatDate(value, format, locale || this.locale, (_a = timezone !== null && timezone !== void 0 ? timezone : this.defaultTimezone) !== null && _a !== void 0 ? _a : undefined);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n}\nDatePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }], target: i0.ɵɵFactoryTarget.Pipe });\nDatePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: DatePipe, name: \"date\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'date', pure: true }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * http://userguide.icu-project.org/formatparse/messages.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n}\nI18nPluralPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe });\nI18nPluralPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: I18nPluralPipe, name: \"i18nPlural\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'i18nPlural', pure: true }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n}\nI18nSelectPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nI18nSelectPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: I18nSelectPipe, name: \"i18nSelect\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'i18nSelect', pure: true }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n}\nJsonPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nJsonPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: JsonPipe, name: \"json\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'json', pure: false }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n}\nKeyValuePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe });\nKeyValuePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: KeyValuePipe, name: \"keyvalue\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'keyvalue', pure: false }]\n }], ctorParameters: function () { return [{ type: i0.KeyValueDiffers }]; } });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see `formatNumber()`\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format: \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nDecimalPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: DecimalPipe, name: \"number\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'number' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nPercentPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PercentPipe, name: \"percent\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'percent' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n * {@a currency-code-deprecation}\n *
\n *\n * **Deprecation notice:**\n *\n * The default currency code is currently always `USD` but this is deprecated from v9.\n *\n * **In v11 the default currency code will be taken from the current locale identified by\n * the `LOCALE_ID` token. See the [i18n guide](guide/i18n-common-locale-id) for\n * more information.**\n *\n * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in\n * your application `NgModule`:\n *\n * ```ts\n * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}\n * ```\n *\n *
\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\nCurrencyPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: CurrencyPipe, name: \"currency\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{ name: 'currency' }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }];\n } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *
b
\n *
c
\n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nSlicePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: SlicePipe, name: \"slice\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{ name: 'slice', pure: false }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * * The `providers` options configure the NgModule's injector to provide\n * localization dependencies to members.\n * * The `exports` options make the declared directives and pipes available for import\n * by other NgModules.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: CommonModule, declarations: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\nCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: CommonModule, providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('13.1.3');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n this.attemptFocus(elSelected);\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * Calls `focus` on the `focusTarget` and returns `true` if the element was focused successfully.\n *\n * If `false`, further steps may be necessary to determine a valid substitute to be focused\n * instead.\n *\n * @see https://html.spec.whatwg.org/#get-the-focusable-area\n * @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n * @see https://html.spec.whatwg.org/#focusable-area\n */\n attemptFocus(focusTarget) {\n focusTarget.focus();\n return this.document.activeElement === focusTarget;\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch (_a) {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch (_a) {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, registerLocaleData, BrowserPlatformLocation as ɵBrowserPlatformLocation, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v13.1.3\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, ɵparseCookieValue, XhrFactory as XhrFactory$1 } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, Inject, PLATFORM_ID, NgModule } from '@angular/core';\nimport { of, Observable } from 'rxjs';\nimport { concatMap, filter, map } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else {\n this.lazyInit = () => {\n this.headers = new Map();\n Object.keys(headers).forEach(name => {\n let values = headers[name];\n const key = name.toLowerCase();\n if (typeof values === 'string') {\n values = [values];\n }\n if (values.length > 0) {\n this.headers.set(key, values);\n this.maybeSetNormalizedName(name, key);\n }\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or overide for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '2B': '+',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => { var _a; return (_a = STANDARD_ENCODING_REPLACEMENTS[t]) !== null && _a !== void 0 ? _a : s; });\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n this.map.set(key, Array.isArray(value) ? value : [value]);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n var _a;\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = (_a = update.context) !== null && _a !== void 0 ? _a : this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n}\nHttpClient.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpClient.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: HttpClient });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpHandler }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * `HttpHandler` which applies an `HttpInterceptor` to an `HttpRequest`.\n *\n *\n */\nclass HttpInterceptorHandler {\n constructor(next, interceptor) {\n this.next = next;\n this.interceptor = interceptor;\n }\n handle(req) {\n return this.interceptor.intercept(req, this.next);\n }\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken('HTTP_INTERCEPTORS');\nclass NoopInterceptor {\n intercept(req, next) {\n return next.handle(req);\n }\n}\nNoopInterceptor.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NoopInterceptor, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNoopInterceptor.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NoopInterceptor });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.1.3\", ngImport: i0, type: NoopInterceptor, decorators: [{\n type: Injectable\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n// Error text given when a JSONP script is injected, but doesn't invoke the callback\n// passed in its URL.\nconst JSONP_ERR_NO_CALLBACK = 'JSONP injected script did not invoke callback.';\n// Error text given when a request is passed to the JsonpClientBackend that doesn't\n// have a request method JSONP.\nconst JSONP_ERR_WRONG_METHOD = 'JSONP requests must use JSONP request method.';\nconst JSONP_ERR_WRONG_RESPONSE_TYPE = 'JSONP requests must use Json response type.';\n/**\n * DI token/abstract type representing a map of JSONP callbacks.\n *\n * In the browser, this should always be the `window` object.\n *\n *\n */\nclass JsonpCallbackContext {\n}\n/**\n * Processes an `HttpRequest` with the JSONP method,\n * by performing JSONP style requests.\n * @see `HttpHandler`\n * @see `HttpXhrBackend`\n *\n * @publicApi\n */\nclass JsonpClientBackend {\n constructor(callbackMap, document) {\n this.callbackMap = callbackMap;\n this.document = document;\n /**\n * A resolved promise that can be used to schedule microtasks in the event handlers.\n */\n this.resolvedPromise = Promise.resolve();\n }\n /**\n * Get the name of the next callback method, by incrementing the global `nextRequestId`.\n */\n nextCallback() {\n return `ng_jsonp_callback_${nextRequestId++}`;\n }\n /**\n * Processes a JSONP request and returns an event stream of the results.\n * @param req The request object.\n * @returns An observable of the response events.\n *\n */\n handle(req) {\n // Firstly, check both the method and response type. If either doesn't match\n // then the request was improperly routed here and cannot be handled.\n if (req.method !== 'JSONP') {\n throw new Error(JSONP_ERR_WRONG_METHOD);\n }\n else if (req.responseType !== 'json') {\n throw new Error(JSONP_ERR_WRONG_RESPONSE_TYPE);\n }\n // Everything else happens inside the Observable boundary.\n return new Observable((observer) => {\n // The first step to make a request is to generate the callback name, and replace the\n // callback placeholder in the URL with the name. Care has to be taken here to ensure\n // a trailing &, if matched, gets inserted back into the URL in the correct place.\n const callback = this.nextCallback();\n const url = req.urlWithParams.replace(/=JSONP_CALLBACK(&|$)/, `=${callback}$1`);\n // Construct the